mapcheck/
run/
sympcheck/
-compinfo
-DIL/
bin/unres/MD/unres_ifort_MPICH_GAB_czyt.exe
+bin/unres/MD-M/unres_Tc_procor_newparm_em64-D-symetr.exe
+DIL/
+compinfo
--- /dev/null
+1 3.800 41.7 0.000 43.0 14.33 2.5 ! peptide group
+1 1.396 243.1 0.000 59.0 19.67 5.0 ! Cys
+2 2.103 71.3 0.850 2.500 128.0 0.033 88.0 29.33 6.2 ! Met
+1 2.997 124.6 0.000 104.0 34.67 6.8 ! Phe
+2 1.645 260.7 0.857 1.908 312.6 .00010 70.0 23.33 6.2 ! Ile
+2 1.782 638.3 2.360 2.086 160.4 0.409 70.0 23.33 6.3 ! Leu
+1 1.488 294.4 0.000 56.0 18.67 5.8 ! Val
+2 3.368 123.1 0.000 3.686 129.1 .00049 143.0 47.67 7.2 ! Trp
+1 3.362 113.2 0.000 120.0 40.00 6.9 ! Tyr
+1 0.778 353.0 0.000 28.0 9.33 4.6 ! Ala
+0 14.0 0.00 3.8 ! Gly
+1 1.480 295.8 0.000 58.0 19.33 5.6 ! Thr
+1 1.311 269.6 0.000 44.0 14.67 4.8 ! Ser
+3 2.125 147.9 2.125 2.424 138.9 .0333 2.776 383.8 0.000 85.0 28.33 6.1 ! Gln
+1 2.008 161.4 0.000 71.0 23.67 5.7 ! Asn
+3 2.093 131.2 1.943 2.425 146.5 .0263 2.784 479.3 0.784 85.0 28.33 6.1 ! Glu
+1 2.030 160.2 0.000 71.0 23.67 5.6 ! Asp
+1 2.739 134.5 0.000 95.0 31.67 6.2 ! His
+3 2.644 48.8 1.707 3.433 34.8 .00123 4.080 899.9 1.175 114.0 38.00 6.8 ! Arg
+3 2.379 99.0 1.974 2.704 157.5 0.546 3.073 164.7 0.055 86.0 28.67 6.3 ! Lys
+1 1.422 605.2 0.000 71.0 23.67 5.6 ! Pro
+2 2.142 71.3 0.850 2.500 128.0 0.033 135.0 45.00 6.2 ! SeMet
+1 3.799 124.6 0.000 149.0 49.67 7.2 ! Dap(Bz)
+1 0.743 353.00 0.000 42.0 14.00 4.7 ! Aib
+1 1.210 353.00 0.000 42.0 14.00 5.6 ! Abu
+
--- /dev/null
+3.800 500.00 43.0 14.33 5.0 ! peptide group
+1.237 500.00 59.0 19.67 5.0 ! Cys
+2.142 500.00 88.0 29.33 6.2 ! Met
+2.299 500.00 104.0 34.67 6.8 ! Phe
+1.776 500.00 70.0 23.33 6.2 ! Ile
+1.939 500.00 70.0 23.33 6.3 ! Leu
+1.410 500.00 56.0 18.67 5.8 ! Val
+2.605 500.00 143.0 47.67 7.2 ! Trp
+2.484 500.00 120.0 40.00 6.9 ! Tyr
+0.743 500.00 28.0 9.33 4.6 ! Ala
+0.000 500.00 14.0 0.00 3.8 ! Gly
+1.393 500.00 58.0 19.33 5.6 ! Thr
+1.150 500.00 44.0 14.67 4.8 ! Ser
+2.240 500.00 85.0 28.33 6.1 ! Glu
+1.684 500.00 71.0 23.67 5.7 ! Asn
+2.254 500.00 85.0 28.33 6.1 ! Glu
+1.709 500.00 71.0 23.67 5.6 ! Asp
+2.113 500.00 95.0 31.67 6.2 ! His
+3.020 500.00 114.0 38.00 6.8 ! Arg
+2.541 500.00 86.0 28.67 6.3 ! Lys
+1.345 500.00 71.0 23.67 5.6 ! Pro
+2.142 500.00 135.0 45.00 6.2 ! SeMet
+3.799 500.00 149.0 49.67 7.2 ! Dap(Bz)
+0.743 500.00 42.0 14.00 4.7 ! Aib
+1.210 500.00 42.0 14.00 5.6 ! Abu
--- /dev/null
+ 0.35860954 0.16982996 3.29863666 3.2 cys cys
+ 0.56282835 -0.05299321 3.60729199 2.1 cys met
+ 0.33964241 0.05207525 4.17039421 2.4 cys phe
+ 0.37589252 -0.13754074 3.40782436 3.2 cys ile
+ 0.19324876 -0.12584486 3.97277369 2.4 cys leu
+ 0.40072817 0.10036272 4.49587991 1.6 cys val
+ 0.42263839 0.06477987 3.63916207 3.6 cys trp
+ 0.54237237 0.04744217 3.48308370 3.1 cys tyr
+ 0.51547365 -0.00799778 3.40011763 2.2 cys ala
+ 0.51607945 -0.12446741 3.70421858 1.6 cys gly
+ 0.43412348 0.15581630 4.56079263 1.3 cys thr
+ 0.38622584 -0.07788669 3.77359853 2.0 cys ser
+ 0.50860385 -0.01971684 3.49518888 3.0 cys gln
+ 0.39057873 -0.13582425 3.09416287 3.6 cys asn
+ 0.42554013 -0.10224673 3.99873956 2.0 cys glu
+ 0.51197275 -0.00799778 3.42940555 3.0 cys asp
+ 0.51368036 -0.01971684 3.45279388 2.8 cys his
+ 0.53687925 -0.05416896 3.53908504 2.8 cys arg
+ 0.52071055 -0.00432467 3.85035238 2.3 cys lys
+ 0.56790413 -0.10114534 3.62096650 1.9 cys pro
+ 0.56282835 -0.05299321 3.60729199 2.1 cys sem
+ 0.33964241 0.05207525 4.17039421 2.4 cys phe
+ 0.51547365 -0.00799778 3.40011763 2.2 cys aib
+ 0.51547365 -0.00799778 3.40011763 2.2 cys abu
+ 0.68048894 -0.06899195 3.60729199 2.1 met cys
+ 0.47168906 -0.01389221 3.62448254 3.4 met met
+ 0.38809483 0.05839704 3.69650927 3.8 met phe
+ 0.30403358 -0.17995008 4.29852296 2.5 met ile
+ 0.33973020 -0.34834021 4.94950826 1.2 met leu
+ 0.30071237 0.01285368 4.18347745 2.6 met val
+ 0.52333332 0.17569346 3.51061576 4.2 met trp
+ 0.61170525 0.20950877 4.06080648 3.0 met tyr
+ 0.41902197 -0.08043824 3.17380260 3.3 met ala
+ 0.52139540 0.00438353 3.43153041 2.6 met gly
+ 0.49784550 0.12355497 4.19683352 2.2 met thr
+ 0.63180941 -0.16149377 4.09465313 1.6 met ser
+ 0.44886809 -0.15991724 3.53814108 3.3 met gln
+ 0.41073744 0.00740397 4.06717512 2.5 met asn
+ 0.54442625 -0.07267571 3.41282057 3.5 met glu
+ 0.63996137 -0.06915184 3.94820588 2.2 met asp
+ 0.62501187 0.11051556 3.67829283 2.8 met his
+ 0.53066821 0.05034669 3.92004157 3.0 met arg
+ 0.33560623 -0.08136851 4.49980555 2.0 met lys
+ 0.49366704 -0.10767906 3.76955189 2.7 met pro
+ 0.47168906 -0.01389221 3.62448254 3.4 met sem
+ 0.38809483 0.05839704 3.69650927 3.8 met dbz
+ 0.41902197 -0.08043824 3.17380260 3.3 met aib
+ 0.41902197 -0.08043824 3.17380260 3.3 met abu
+ 0.36262117 -0.19622749 4.17039421 2.4 phe cys
+ 0.26128467 0.01513555 3.69650927 3.8 phe met
+ 0.20490480 -0.09214195 4.22979013 3.0 phe phe
+ 0.28320764 -0.11272094 4.28523432 2.8 phe ile
+ 0.49776022 0.15233796 3.52640364 3.7 phe leu
+ 0.38397299 0.13538890 4.83243966 2.0 phe val
+ 0.37298546 -0.07130682 3.38863637 4.4 phe trp
+ 0.50532840 -0.04912285 3.56784740 3.7 phe tyr
+ 0.47086276 -0.20131132 3.61044593 2.4 phe ala
+ 0.47136787 -0.02932642 3.89454305 2.0 phe gly
+ 0.43636452 0.05389401 4.20612459 2.6 phe thr
+ 0.39664510 0.04040127 3.97909758 2.6 phe ser
+ 0.37270815 -0.11268458 3.88510036 3.0 phe gln
+ 0.55039146 -0.03205935 4.10110530 2.6 phe asn
+ 0.33746013 -0.24962819 3.93827274 2.7 phe glu
+ 0.43948791 -0.14279533 4.16332864 2.3 phe asp
+ 0.57384992 -0.03571288 3.97249455 2.6 phe his
+ 0.49181945 0.18810757 3.92791573 3.4 phe arg
+ 0.34273176 -0.21712089 3.95551322 3.0 phe lys
+ 0.44953604 -0.00243978 3.77053096 2.9 phe pro
+ 0.26128467 0.01513555 3.69650927 3.8 phe sme
+ 0.20490480 -0.09214195 4.22979013 3.0 phe dbz
+ 0.47086276 -0.20131132 3.61044593 2.4 phe aib
+ 0.47086276 -0.20131132 3.61044593 2.4 phe abu
+ 0.40831404 -0.11390349 3.40782436 3.2 ile cys
+ 0.36166967 0.16294633 4.29852296 2.5 ile met
+ 0.17153929 0.01989158 4.28523432 2.8 ile phe
+ 0.47535754 0.30766747 3.94168510 3.2 ile ile
+ 0.29127023 -0.18034538 3.95620992 2.9 ile leu
+ 0.40891029 0.37221078 4.77230778 2.0 ile val
+ 0.40490198 0.25444624 3.55185603 4.3 ile trp
+ 0.40189859 0.12737180 3.99860644 3.1 ile tyr
+ 0.37442735 -0.07448267 3.66929044 2.7 ile ala
+ 0.38837277 0.21898895 3.87773858 2.1 ile gly
+ 0.48188659 0.47591913 4.59886714 2.2 ile thr
+ 0.26566057 -0.00988237 4.43023881 1.8 ile ser
+ 0.16126661 0.12105441 3.21763584 4.2 ile gln
+ 0.37751545 -0.07665185 3.55147963 3.1 ile asn
+ 0.26828456 -0.05165526 3.82344372 3.1 ile glu
+ 0.11152774 -0.21162156 4.20071886 2.1 ile asp
+ 0.27999892 -0.04581434 3.87438904 3.0 ile his
+ 0.28625871 0.18884379 4.27655600 2.9 ile arg
+ 0.51810565 0.20449041 4.52497861 1.8 ile lys
+ 0.27899493 0.14745809 4.93089469 1.5 ile pro
+ 0.36166967 0.16294633 4.29852296 2.5 ile sme
+ 0.17153929 0.01989158 4.28523432 2.8 ile dbz
+ 0.37442735 -0.07448267 3.66929044 2.7 ile aib
+ 0.37442735 -0.07448267 3.66929044 2.7 ile abu
+ 0.27669006 -0.08857650 3.97277369 2.4 leu cys
+ 0.46145819 0.11704558 4.94950826 1.2 leu met
+ 0.39499219 -0.06849736 3.52640364 3.7 leu phe
+ 0.37951422 0.12929207 3.95620992 2.9 leu ile
+ 0.37548431 0.25972538 4.68988538 2.2 leu leu
+ 0.31811044 -0.12698715 4.07045515 2.6 leu val
+ 0.56177403 0.27868668 3.78215175 3.7 leu trp
+ 0.38385722 0.09687124 3.56586168 3.7 leu tyr
+ 0.34823804 -0.09467021 4.02083643 1.8 leu ala
+ 0.47111001 0.19515789 3.78987702 2.1 leu gly
+ 0.48994191 0.30052632 4.61644076 2.0 leu thr
+ 0.33626266 -0.13893079 3.78032608 2.5 leu ser
+ 0.47005465 -0.09199330 3.89621932 2.5 leu gln
+ 0.41288855 0.02311019 3.71732693 2.8 leu asn
+ 0.32910008 -0.16223127 4.40927943 1.8 leu glu
+ 0.29408977 -0.05874025 4.12366306 2.3 leu asp
+ 0.43376746 0.01891589 3.48566489 3.5 leu his
+ 0.44700953 0.11595371 3.53775960 3.6 leu arg
+ 0.38429980 0.03881280 4.36103401 2.2 leu lys
+ 0.43262307 0.03816639 4.08852337 2.4 leu pro
+ 0.46145819 0.11704558 4.94950826 1.2 leu sme
+ 0.39499219 -0.06849736 3.52640364 3.7 leu dbz
+ 0.34823804 -0.09467021 4.02083643 1.8 leu aib
+ 0.34823804 -0.09467021 4.02083643 1.8 leu abu
+ 0.26123252 0.11055566 4.49587991 1.6 val cys
+ -0.11325692 -0.14606457 4.18347745 2.6 val met
+ 0.09409692 0.11177909 4.83243966 2.0 val phe
+ -0.00666800 -0.07497911 4.77230778 2.0 val ile
+ 0.28991366 0.17674772 4.07045515 2.6 val leu
+ -0.10515666 -0.11003497 4.12314563 2.8 val val
+ 0.30183179 0.14806296 3.74692371 3.7 val trp
+ 0.29338214 0.08282836 4.24592089 2.6 val tyr
+ 0.12064673 -0.00982537 4.10663351 1.7 val ala
+ 0.19385817 -0.03823541 3.80654563 2.0 val gly
+ -0.01013325 -0.07812848 3.79210798 3.1 val thr
+ 0.29858743 0.07767388 3.58093493 2.8 val ser
+ 0.35822386 -0.09616652 3.47357789 3.2 val gln
+ 0.34627205 -0.01311854 3.51658941 3.1 val asn
+ 0.06254100 -0.04565289 4.06702052 2.5 val glu
+ 0.18901220 -0.16654191 4.12654645 2.1 val asp
+ 0.24391223 0.13836662 4.17589586 2.4 val his
+ 0.06426380 0.09368312 4.00988606 3.0 val arg
+ -0.13595797 -0.17161034 4.64018900 2.0 val lys
+ 0.17932755 0.09383245 4.56454004 2.0 val pro
+ -0.11325692 -0.14606457 4.18347745 2.6 val sme
+ 0.09409692 0.11177909 4.83243966 2.0 val dbz
+ 0.12064673 -0.00982537 4.10663351 1.7 val aib
+ 0.12064673 -0.00982537 4.10663351 1.7 val abu
+ 0.31196785 0.02064366 3.63916207 3.6 trp cys
+ 0.46366596 -0.03700266 3.51061576 4.2 trp met
+ 0.58088610 -0.11066174 3.38863637 4.4 trp phe
+ 0.24583477 -0.33494927 3.55185603 4.3 trp ile
+ 0.32671974 -0.22702523 3.78215175 3.7 trp leu
+ 0.45612392 0.10634243 3.74692371 3.7 trp val
+ 0.36417512 -0.20528168 2.98506467 5.8 trp trp
+ 0.50155918 -0.12768864 3.15117399 5.1 trp tyr
+ 0.32812767 -0.00610991 3.47226781 3.7 trp ala
+ 0.40467084 -0.29644951 3.34936384 3.4 trp gly
+ 0.49007720 -0.23396191 4.06972159 2.9 trp thr
+ 0.46206287 -0.16415403 3.19708779 4.0 trp ser
+ 0.42889946 -0.18850961 3.34772285 4.3 trp gln
+ 0.51128091 -0.12547768 3.16744534 4.5 trp asn
+ 0.39266635 -0.37772802 3.09551785 4.5 trp glu
+ 0.48243867 0.01467772 3.56336594 3.9 trp asp
+ 0.42702047 -0.16605199 3.41608597 4.4 trp his
+ 0.52626838 -0.12547768 3.01681706 5.0 trp arg
+ 0.37799932 -0.12350334 3.76243382 3.8 trp lys
+ 0.49906417 -0.08578986 3.94460593 2.7 trp pro
+ 0.46366596 -0.03700266 3.51061576 4.2 trp sme
+ 0.58088610 -0.11066174 3.38863637 4.4 trp dbz
+ 0.32812767 -0.00610991 3.47226781 3.7 trp aib
+ 0.32812767 -0.00610991 3.47226781 3.7 trp abu
+ 0.61872403 -0.14590233 3.48308370 3.1 tyr cys
+ 0.51373838 0.10165708 4.06080648 3.0 tyr met
+ 0.48847918 -0.25213997 3.56784740 3.7 tyr phe
+ 0.61169095 0.09973185 3.99860644 3.1 tyr ile
+ 0.59378113 -0.01121051 3.56586168 3.7 tyr leu
+ 0.46928231 -0.00248010 4.24592089 2.6 tyr val
+ 0.43672853 -0.13447255 3.15117399 5.1 tyr trp
+ 0.48884849 -0.22303211 2.84305042 5.2 tyr tyr
+ 0.67005094 -0.07584168 3.22022624 3.4 tyr ala
+ 0.65174425 -0.24311887 3.86011481 2.0 tyr gly
+ 0.50879141 -0.25935026 4.15837027 2.5 tyr thr
+ 0.54564025 -0.22727470 3.66401120 2.7 tyr ser
+ 0.66853458 -0.14863634 3.50128149 3.5 tyr gln
+ 0.65954068 -0.14062835 3.33886112 3.6 tyr asn
+ 0.50689915 -0.32717288 3.42836329 3.5 tyr glu
+ 0.51002994 -0.14640234 3.25938544 4.0 tyr asp
+ 0.61200946 -0.24411836 4.02269765 2.4 tyr his
+ 0.46534272 -0.20073886 3.36685862 4.3 tyr arg
+ 0.42351858 -0.18191847 4.14326778 2.9 tyr lys
+ 0.47769600 -0.16559256 3.95285757 2.9 tyr pro
+ 0.51373838 0.10165708 4.06080648 3.0 tyr sme
+ 0.48847918 -0.25213997 3.56784740 3.7 tyr dbz
+ 0.67005094 -0.07584168 3.22022624 3.4 tyr aib
+ 0.67005094 -0.07584168 3.22022624 3.4 tyr abu
+ 0.31170564 0.13087300 3.40011763 2.2 ala cys
+ 0.35817150 -0.05118436 3.17380260 3.3 ala met
+ 0.35531356 -0.07100358 3.61044593 2.4 ala phe
+ 0.16898670 0.06047415 3.66929044 2.7 ala ile
+ 0.29707520 -0.00251129 4.02083643 1.8 ala leu
+ 0.16009076 -0.19966586 4.10663351 1.7 ala val
+ 0.33543361 0.02729744 3.47226781 3.7 ala trp
+ 0.40771637 0.04944451 3.22022624 3.4 ala tyr
+ 0.32491593 0.00199416 3.48648915 1.4 ala ala
+ 0.32250163 0.00199416 3.50576712 1.1 ala gly
+ 0.44809712 -0.03625897 3.28319535 2.9 ala thr
+ 0.32570984 0.00199416 3.48018928 2.2 ala ser
+ 0.25708601 -0.02518611 3.98829105 2.0 ala gln
+ 0.27223871 0.02170282 3.77047757 2.1 ala asn
+ 0.37126794 -0.02710099 3.50057256 2.6 ala glu
+ 0.15955468 -0.05289865 3.56513816 2.4 ala asp
+ 0.41120950 0.04944451 3.19268981 2.9 ala his
+ 0.27446733 0.00786488 4.09477647 1.9 ala arg
+ 0.22981425 -0.09322596 4.42291744 0.9 ala lys
+ 0.37507388 0.05588781 3.38612759 2.5 ala pro
+ 0.35817150 -0.05118436 3.17380260 3.3 ala sme
+ 0.35531356 -0.07100358 3.61044593 2.4 ala dbz
+ 0.32491593 0.00199416 3.48648915 1.4 ala aib
+ 0.32491593 0.00199416 3.48648915 1.4 ala abu
+ -0.00336656 0.02622444 3.70421858 1.6 gly cys
+ -0.09302725 0.26319430 3.43153041 2.6 gly met
+ -0.09760057 0.17790940 3.89454305 2.0 gly phe
+ -0.22751502 0.17812915 3.87773858 2.1 gly ile
+ -0.25069250 0.09450769 3.78987702 2.1 gly leu
+ -0.18213085 0.07188032 3.80654563 2.0 gly val
+ 0.02178246 0.08557004 3.34936384 3.4 gly trp
+ -0.11493048 0.22893358 3.86011481 2.0 gly tyr
+ -0.11323243 0.10823838 3.50576712 1.1 gly ala
+ -0.11186659 0.10823838 3.52493966 0.8 gly gly
+ -0.15040905 0.28755373 3.59967226 2.3 gly thr
+ -0.11368436 0.10823838 3.49950195 1.9 gly ser
+ -0.03597803 0.10164763 4.26660952 1.4 gly gln
+ -0.11204539 0.10823838 3.52240926 2.4 gly asn
+ -0.23143037 -0.03794759 3.90940249 1.9 gly glu
+ -0.14158106 -0.07444570 3.87388976 1.8 gly asp
+ -0.11031945 0.23711722 3.23796583 3.0 gly his
+ -0.17946054 0.00419438 3.25922115 3.2 gly arg
+ -0.29030826 0.10161339 4.01153241 1.5 gly lys
+ -0.01947913 0.15568872 3.41316198 2.1 gly pro
+ -0.09302725 0.26319430 3.43153041 2.6 gly sme
+ -0.09760057 0.17790940 3.89454305 2.0 gly dbz
+ -0.11323243 0.10823838 3.50576712 1.1 gly aib
+ -0.11323243 0.10823838 3.50576712 1.1 gly abu
+ 0.25327931 0.01671477 4.56079263 1.3 thr cys
+ 0.23416404 0.05555785 4.19683352 2.2 thr met
+ -0.05802816 -0.16538168 4.20612459 2.6 thr phe
+ -0.00442492 -0.07151185 4.59886714 2.2 thr ile
+ 0.07792594 0.14574366 4.61644076 2.0 thr leu
+ 0.17777770 0.04200606 3.79210798 3.1 thr val
+ 0.28036614 0.17671473 4.06972159 2.9 thr trp
+ 0.21670162 0.02128130 4.15837027 2.5 thr tyr
+ 0.28703884 0.05657710 3.28319535 2.9 thr ala
+ 0.20185014 -0.02758099 3.59967226 2.3 thr gly
+ -0.02168311 0.07585571 4.09544630 2.8 thr thr
+ 0.12417560 -0.13819171 3.43029089 3.1 thr ser
+ 0.19988109 -0.12547841 3.29954085 3.6 thr gln
+ 0.09516162 -0.02303978 3.87932811 2.9 thr asn
+ -0.00509545 -0.16916448 3.91402729 2.8 thr glu
+ -0.23145136 -0.34804909 3.89588321 2.3 thr asp
+ 0.01936770 -0.15186953 4.11716100 2.7 thr his
+ 0.16868560 0.15199778 4.12871646 2.8 thr arg
+ 0.37511648 0.23392103 5.19110983 0.8 thr lys
+ 0.14543985 0.10143310 3.81482913 2.9 thr pro
+ 0.23416404 0.05555785 4.19683352 2.2 thr sme
+ -0.05802816 -0.16538168 4.20612459 2.6 thr dbz
+ 0.28703884 0.05657710 3.28319535 2.9 thr aib
+ 0.28703884 0.05657710 3.28319535 2.9 thr abu
+ 0.21517295 -0.24554423 3.77359853 2.0 ser cys
+ 0.25883244 -0.12670009 4.09465313 1.6 ser met
+ 0.14102918 -0.01538099 3.97909758 2.6 ser phe
+ 0.25921833 0.08059688 4.43023881 1.8 ser ile
+ 0.20136778 -0.16976156 3.78032608 2.5 ser leu
+ 0.28531354 -0.09273778 3.58093493 2.8 ser val
+ 0.39448436 -0.03696454 3.19708779 4.0 ser trp
+ 0.43603784 0.09648460 3.66401120 2.7 ser tyr
+ 0.30692270 -0.04308303 3.48018928 2.2 ser ala
+ 0.30457335 -0.04308303 3.49950195 1.9 ser gly
+ 0.32020038 0.00223073 3.43029089 3.1 ser thr
+ 0.30769547 -0.04308303 3.47387798 2.4 ser ser
+ 0.11488573 -0.13472978 3.12392468 3.9 ser gln
+ 0.21105760 -0.12158253 3.72665420 2.4 ser asn
+ 0.04115496 0.04092516 4.61451625 1.5 ser glu
+ 0.10088016 -0.28980003 3.72754795 2.4 ser asp
+ 0.17721632 -0.10937848 3.18728475 3.7 ser his
+ 0.13355810 -0.32587585 3.87794402 2.5 ser arg
+ 0.22605173 -0.17882693 4.37211026 1.5 ser lys
+ 0.13546239 -0.16030706 4.22414116 2.0 ser pro
+ 0.25883244 -0.12670009 4.09465313 1.6 ser sme
+ 0.14102918 -0.01538099 3.97909758 2.6 ser dbz
+ 0.30692270 -0.04308303 3.48018928 2.2 ser aib
+ 0.30692270 -0.04308303 3.48018928 2.2 ser abu
+ 0.46907450 0.23814067 3.49518888 3.0 gln cys
+ 0.64462489 0.20629501 3.53814108 3.3 gln met
+ 0.62450221 0.26002714 3.88510036 3.0 gln phe
+ 0.64883105 0.31118595 3.21763584 4.2 gln ile
+ 0.52131440 0.03272724 3.89621932 2.5 gln leu
+ 0.65106047 0.16613237 3.47357789 3.2 gln val
+ 0.57768605 0.14932176 3.34772285 4.3 gln trp
+ 0.55788468 0.30256567 3.50128149 3.5 gln tyr
+ 0.47680255 0.04342046 3.98829105 2.0 gln ala
+ 0.47868436 -0.03204437 4.26660952 1.4 gln gly
+ 0.45754127 0.06306618 3.29954085 3.6 gln thr
+ 0.59818612 0.19256561 3.12392468 3.9 gln ser
+ 0.55149012 -0.02069686 3.92298950 2.4 gln gln
+ 0.55970840 0.15394656 3.33545255 3.7 gln asn
+ 0.52123754 0.23540666 3.53114474 3.5 gln glu
+ 0.56477134 0.12111678 4.15342990 2.3 gln asp
+ 0.60162954 0.19256561 3.09986815 4.1 gln his
+ 0.41096673 -0.00430890 3.59510761 3.4 gln arg
+ 0.54772483 0.12647211 4.40523407 1.8 gln lys
+ 0.65056464 0.45016870 4.27763332 2.2 gln pro
+ 0.64462489 0.20629501 3.53814108 3.3 gln sme
+ 0.62450221 0.26002714 3.88510036 3.0 gln dbz
+ 0.47680255 0.04342046 3.98829105 2.0 gln aib
+ 0.47680255 0.04342046 3.98829105 2.0 gln abu
+ 0.57572212 0.14373398 3.09416287 3.6 asn cys
+ 0.44333739 0.28309684 4.06717512 2.5 asn met
+ 0.44442019 0.21261136 4.10110530 2.6 asn phe
+ 0.49499497 0.11891284 3.55147963 3.1 asn ile
+ 0.53576677 0.15090652 3.71732693 2.8 asn leu
+ 0.52751327 0.11911315 3.51658941 3.1 asn val
+ 0.52684562 0.21607903 3.16744534 4.5 asn trp
+ 0.57007352 0.24209638 3.33886112 3.6 asn tyr
+ 0.53360274 0.10469691 3.77047757 2.1 asn ala
+ 0.53096441 0.17749158 3.52240926 2.4 asn gly
+ 0.40760213 0.22182945 3.87932811 2.9 asn thr
+ 0.47722200 0.11590346 3.72665420 2.4 asn ser
+ 0.43939620 0.14592084 3.33545255 3.7 asn gln
+ 0.46547953 0.08929379 3.07503648 4.2 asn asn
+ 0.45066424 0.03916198 3.88381092 2.6 asn glu
+ 0.56591130 0.16761648 3.73937544 2.6 asn asp
+ 0.53142890 0.30777945 3.38670300 3.4 asn his
+ 0.30442390 0.01364112 4.48141529 1.9 asn arg
+ 0.27593110 0.18004212 4.18933053 2.5 asn lys
+ 0.50353752 0.32164896 3.73467727 2.9 asn pro
+ 0.44333739 0.28309684 4.06717512 2.5 asn sme
+ 0.44442019 0.21261136 4.10110530 2.6 asn dbz
+ 0.53360274 0.10469691 3.77047757 2.1 asn aib
+ 0.53360274 0.10469691 3.77047757 2.1 asn abu
+ 0.45167162 0.28718023 3.99873956 2.0 glu cys
+ 0.58329544 0.31669128 3.41282057 3.5 glu met
+ 0.65649724 0.21234517 3.93827274 2.7 glu phe
+ 0.53672118 0.18971451 3.82344372 3.1 glu ile
+ 0.61529042 0.23787159 4.40927943 1.8 glu leu
+ 0.57711221 0.16371932 4.06702052 2.5 glu val
+ 0.57842612 0.14725703 3.09551785 4.5 glu trp
+ 0.68045805 0.20875844 3.42836329 3.5 glu tyr
+ 0.52828434 0.09169166 3.50057256 2.6 glu ala
+ 0.54349648 0.27262886 3.90940249 1.9 glu gly
+ 0.65080974 0.43402569 3.91402729 2.8 glu thr
+ 0.47242896 0.07323090 4.61451625 1.5 glu ser
+ 0.45962325 0.34422613 3.53114474 3.5 glu gln
+ 0.45784628 0.08542837 3.88381092 2.6 glu asn
+ 0.45136983 0.32035022 3.77778958 2.9 glu glu
+ 0.40995790 -0.03116378 4.26798075 2.0 glu asp
+ 0.52859120 0.16354546 3.78696151 3.1 glu his
+ 0.55740234 0.22045560 3.81136201 3.1 glu arg
+ 0.55181260 0.35744091 4.66520100 1.6 glu lys
+ 0.66236078 0.36052823 3.47970840 3.3 glu pro
+ 0.58329544 0.31669128 3.41282057 3.5 glu sme
+ 0.65649724 0.21234517 3.93827274 2.7 glu dbz
+ 0.52828434 0.09169166 3.50057256 2.6 glu aib
+ 0.52828434 0.09169166 3.50057256 2.6 glu abu
+ 0.32481843 0.30241943 3.42940555 3.0 asp cys
+ 0.48146154 0.12184204 3.94820588 2.2 asp met
+ 0.49531096 0.13459205 4.16332864 2.3 asp phe
+ 0.48629858 0.10892335 4.20071886 2.1 asp ile
+ 0.42458969 0.04067298 4.12366306 2.3 asp leu
+ 0.46012374 0.06388031 4.12654645 2.1 asp val
+ 0.44400377 0.21493328 3.56336594 3.9 asp trp
+ 0.49469528 0.08857244 3.25938544 4.0 asp tyr
+ 0.43791837 0.09152666 3.56513816 2.4 asp ala
+ 0.40782681 0.10505865 3.87388976 1.8 asp gly
+ 0.53260595 0.06977694 3.89588321 2.3 asp thr
+ 0.41899901 0.06697791 3.72754795 2.4 asp ser
+ 0.31470323 0.16090621 4.15342990 2.3 asp gln
+ 0.41087617 0.03408678 3.73937544 2.6 asp asn
+ 0.36889970 -0.15930847 4.26798075 2.0 asp glu
+ 0.49914534 0.28237257 3.82849221 2.6 asp asp
+ 0.35831041 0.17803592 3.53238450 3.3 asp his
+ 0.46844169 0.00518452 2.71889129 5.3 asp arg
+ 0.33974035 0.00746795 4.11707156 2.3 asp lys
+ 0.58065436 0.12893457 3.46466683 2.9 asp pro
+ 0.48146154 0.12184204 3.94820588 2.2 asp sme
+ 0.49531096 0.13459205 4.16332864 2.3 asp dbz
+ 0.43791837 0.09152666 3.56513816 2.4 asp aib
+ 0.43791837 0.09152666 3.56513816 2.4 asp abu
+ 0.66712991 -0.00059312 3.45279388 2.8 his cys
+ 0.62023666 0.07810136 3.67829283 2.8 his met
+ 0.54813450 0.02387399 3.97249455 2.6 his phe
+ 0.50448776 0.10129703 3.87438904 3.0 his ile
+ 0.43502367 -0.13271534 3.48566489 3.5 his leu
+ 0.50083039 0.09390639 4.17589586 2.4 his val
+ 0.34876524 0.17810403 3.41608597 4.4 his trp
+ 0.52214146 -0.08932064 4.02269765 2.4 his tyr
+ 0.62795477 -0.02594442 3.19268981 2.9 his ala
+ 0.55372190 0.05824969 3.23796583 3.0 his gly
+ 0.41891546 0.11138432 4.11716100 2.7 his thr
+ 0.54068082 -0.04376077 3.18728475 3.7 his ser
+ 0.52837481 -0.09497389 3.09986815 4.1 his gln
+ 0.59926199 -0.09807584 3.38670300 3.4 his asn
+ 0.30784556 -0.28464757 3.78696151 3.1 his glu
+ 0.57435087 0.02111146 3.53238450 3.3 his asp
+ 0.65809056 -0.09152492 2.98047276 4.0 his his
+ 0.54935375 -0.06444900 3.84130645 3.2 his arg
+ 0.55747594 0.18348617 4.00467347 2.6 his lys
+ 0.61284214 0.16197710 3.89481022 2.5 his pro
+ 0.62023666 0.07810136 3.67829283 2.8 his sme
+ 0.54813450 0.02387399 3.97249455 2.6 his dbz
+ 0.62795477 -0.02594442 3.19268981 2.9 his aib
+ 0.62795477 -0.02594442 3.19268981 2.9 his abu
+ 0.75225350 0.20735450 3.53908504 2.8 arg cys
+ 0.61621105 0.32748378 3.92004157 3.0 arg met
+ 0.66251194 0.14629924 3.92791573 3.4 arg phe
+ 0.57629387 0.00597023 4.27655600 2.9 arg ile
+ 0.74108830 0.24297317 3.53775960 3.6 arg leu
+ 0.62859689 0.04738249 4.00988606 3.0 arg val
+ 0.76107791 0.21620637 3.01681706 5.0 arg trp
+ 0.64334219 -0.01420347 3.36685862 4.3 arg tyr
+ 0.61765505 -0.23266856 4.09477647 1.9 arg ala
+ 0.63577289 0.03826170 3.25922115 3.2 arg gly
+ 0.52962288 0.04658043 4.12871646 2.8 arg thr
+ 0.57322475 -0.01630823 3.87794402 2.5 arg ser
+ 0.63768385 -0.04885203 3.59510761 3.4 arg gln
+ 0.60938603 0.03300984 4.48141529 1.9 arg asn
+ 0.63351724 -0.10980006 3.81136201 3.1 arg glu
+ 0.63619125 -0.04461328 2.71889129 5.3 arg asp
+ 0.61095825 0.10189057 3.84130645 3.2 arg his
+ 0.71730775 0.08728438 2.81437659 5.4 arg arg
+ 0.60658407 -0.03333816 4.23716346 2.5 arg lys
+ 0.68568576 0.07786298 3.77385723 3.0 arg pro
+ 0.61621105 0.32748378 3.92004157 3.0 arg sme
+ 0.66251194 0.14629924 3.92791573 3.4 arg dbz
+ 0.61765505 -0.23266856 4.09477647 1.9 arg aib
+ 0.61765505 -0.23266856 4.09477647 1.9 arg abu
+ 0.76470157 0.76084085 3.85035238 2.3 lys cys
+ 0.67255968 0.44875322 4.49980555 2.0 lys met
+ 0.76960024 0.60831176 3.95551322 3.0 lys phe
+ 0.61378093 0.26242515 4.52497861 1.8 lys ile
+ 0.71563444 0.68072580 4.36103401 2.2 lys leu
+ 0.67409525 0.58814366 4.64018900 2.0 lys val
+ 0.88671210 1.00380282 3.76243382 3.8 lys trp
+ 0.67158296 0.42635325 4.14326778 2.9 lys tyr
+ 0.67254432 0.35248523 4.42291744 0.9 lys ala
+ 0.69462202 0.31735268 4.01153241 1.5 lys gly
+ 0.58760205 0.22591520 5.19110983 0.8 lys thr
+ 0.62437605 0.35173136 4.37211026 1.5 lys ser
+ 0.70291910 0.54587675 4.40523407 1.8 lys gln
+ 0.71487329 0.62683782 4.18933053 2.5 lys asn
+ 0.63139916 0.33371478 4.66520100 1.6 lys glu
+ 0.72656677 0.46183912 4.11707156 2.3 lys asp
+ 0.83364969 0.89847717 4.00467347 2.6 lys his
+ 0.77862679 0.71215250 4.23716346 2.5 lys arg
+ 0.56582949 -0.04350298 4.78186650 1.3 lys lys
+ 0.80330046 0.84741487 4.53882609 2.0 lys pro
+ 0.67255968 0.44875322 4.49980555 2.0 lys sme
+ 0.76960024 0.60831176 3.95551322 3.0 lys dbz
+ 0.67254432 0.35248523 4.42291744 0.9 lys aib
+ 0.67254432 0.35248523 4.42291744 0.9 lys abu
+ 0.49304685 -0.20581200 3.62096650 1.9 pro cys
+ 0.12683702 -0.30939905 3.76955189 2.7 pro met
+ 0.11511445 -0.18829660 3.77053096 2.9 pro phe
+ 0.05125111 -0.18929142 4.93089469 1.5 pro ile
+ 0.11747631 -0.02693818 4.08852337 2.4 pro leu
+ 0.26952062 0.30671521 4.56454004 2.0 pro val
+ 0.38994700 -0.04061465 3.94460593 2.7 pro trp
+ 0.29377104 0.11826092 3.95285757 2.9 pro tyr
+ 0.25804259 -0.13915496 3.38612759 2.5 pro ala
+ 0.38094914 -0.14696919 3.41316198 2.1 pro gly
+ 0.30752420 0.17160109 3.81482913 2.9 pro thr
+ 0.07822398 0.05027273 4.22414116 2.0 pro ser
+ 0.14107113 -0.04129291 4.27763332 2.2 pro gln
+ 0.21471187 -0.00268809 3.73467727 2.9 pro asn
+ 0.22170637 -0.11224658 3.47970840 3.3 pro glu
+ 0.08872349 -0.40993001 3.46466683 2.9 pro asp
+ 0.31135187 0.03163507 3.89481022 2.5 pro his
+ 0.38918420 0.21697911 3.77385723 3.0 pro arg
+ -0.11536833 -0.12070488 4.53882609 2.0 pro lys
+ 0.24887782 -0.07176013 3.66640730 2.7 pro pro
+ 0.12683702 -0.30939905 3.76955189 2.7 pro sme
+ 0.11511445 -0.18829660 3.77053096 2.9 pro dbz
+ 0.25804259 -0.13915496 3.38612759 2.5 pro aib
+ 0.25804259 -0.13915496 3.38612759 2.5 pro abu
+ 0.68048894 -0.06899195 3.60729199 2.1 sme cys
+ 0.47168906 -0.01389221 3.62448254 3.4 sme met
+ 0.38809483 0.05839704 3.69650927 3.8 sme phe
+ 0.30403358 -0.17995008 4.29852296 2.5 sme ile
+ 0.33973020 -0.34834021 4.94950826 1.2 sme leu
+ 0.30071237 0.01285368 4.18347745 2.6 sme val
+ 0.52333332 0.17569346 3.51061576 4.2 sme trp
+ 0.61170525 0.20950877 4.06080648 3.0 sme tyr
+ 0.41902197 -0.08043824 3.17380260 3.3 sme ala
+ 0.52139540 0.00438353 3.43153041 2.6 sme gly
+ 0.49784550 0.12355497 4.19683352 2.2 sme thr
+ 0.63180941 -0.16149377 4.09465313 1.6 sme ser
+ 0.44886809 -0.15991724 3.53814108 3.3 sme gln
+ 0.41073744 0.00740397 4.06717512 2.5 sme asn
+ 0.54442625 -0.07267571 3.41282057 3.5 sme glu
+ 0.63996137 -0.06915184 3.94820588 2.2 sme asp
+ 0.62501187 0.11051556 3.67829283 2.8 sme his
+ 0.53066821 0.05034669 3.92004157 3.0 sme arg
+ 0.33560623 -0.08136851 4.49980555 2.0 sme lys
+ 0.49366704 -0.10767906 3.76955189 2.7 sme pro
+ 0.47168906 -0.01389221 3.62448254 3.4 sme sme
+ 0.38809483 0.05839704 3.69650927 3.8 sme dbz
+ 0.41902197 -0.08043824 3.17380260 3.3 sme aib
+ 0.41902197 -0.08043824 3.17380260 3.3 sme abu
+ 0.36262117 -0.19622749 4.17039421 2.4 dbz cys
+ 0.26128467 0.01513555 3.69650927 3.8 dbz met
+ 0.20490480 -0.09214195 4.22979013 3.0 dbz phe
+ 0.28320764 -0.11272094 4.28523432 2.8 dbz ile
+ 0.49776022 0.15233796 3.52640364 3.7 dbz leu
+ 0.38397299 0.13538890 4.83243966 2.0 dbz val
+ 0.37298546 -0.07130682 3.38863637 4.4 dbz trp
+ 0.50532840 -0.04912285 3.56784740 3.7 dbz tyr
+ 0.47086276 -0.20131132 3.61044593 2.4 dbz ala
+ 0.47136787 -0.02932642 3.89454305 2.0 dbz gly
+ 0.43636452 0.05389401 4.20612459 2.6 dbz thr
+ 0.39664510 0.04040127 3.97909758 2.6 dbz ser
+ 0.37270815 -0.11268458 3.88510036 3.0 dbz gln
+ 0.55039146 -0.03205935 4.10110530 2.6 dbz asn
+ 0.33746013 -0.24962819 3.93827274 2.7 dbz glu
+ 0.43948791 -0.14279533 4.16332864 2.3 dbz asp
+ 0.57384992 -0.03571288 3.97249455 2.6 dbz his
+ 0.49181945 0.18810757 3.92791573 3.4 dbz arg
+ 0.34273176 -0.21712089 3.95551322 3.0 dbz lys
+ 0.44953604 -0.00243978 3.77053096 2.9 dbz pro
+ 0.26128467 0.01513555 3.69650927 3.8 dbz sme
+ 0.20490480 -0.09214195 4.22979013 3.0 dbz dbz
+ 0.47086276 -0.20131132 3.61044593 2.4 dbz aib
+ 0.47086276 -0.20131132 3.61044593 2.4 dbz abu
+ 0.31170564 0.13087300 3.40011763 2.2 ala cys
+ 0.35817150 -0.05118436 3.17380260 3.3 ala met
+ 0.35531356 -0.07100358 3.61044593 2.4 ala phe
+ 0.16898670 0.06047415 3.66929044 2.7 ala ile
+ 0.29707520 -0.00251129 4.02083643 1.8 ala leu
+ 0.16009076 -0.19966586 4.10663351 1.7 ala val
+ 0.33543361 0.02729744 3.47226781 3.7 ala trp
+ 0.40771637 0.04944451 3.22022624 3.4 ala tyr
+ 0.32491593 0.00199416 3.48648915 1.4 ala ala
+ 0.32250163 0.00199416 3.50576712 1.1 ala gly
+ 0.44809712 -0.03625897 3.28319535 2.9 ala thr
+ 0.32570984 0.00199416 3.48018928 2.2 ala ser
+ 0.25708601 -0.02518611 3.98829105 2.0 ala gln
+ 0.27223871 0.02170282 3.77047757 2.1 ala asn
+ 0.37126794 -0.02710099 3.50057256 2.6 ala glu
+ 0.15955468 -0.05289865 3.56513816 2.4 ala asp
+ 0.41120950 0.04944451 3.19268981 2.9 ala his
+ 0.27446733 0.00786488 4.09477647 1.9 ala arg
+ 0.22981425 -0.09322596 4.42291744 0.9 ala lys
+ 0.37507388 0.05588781 3.38612759 2.5 ala pro
+ 0.35817150 -0.05118436 3.17380260 3.3 ala sme
+ 0.35531356 -0.07100358 3.61044593 2.4 ala dbz
+ 0.32491593 0.00199416 3.48648915 1.4 ala aib
+ 0.32491593 0.00199416 3.48648915 1.4 ala abu
+ 0.31170564 0.13087300 3.40011763 2.2 ala cys
+ 0.35817150 -0.05118436 3.17380260 3.3 ala met
+ 0.35531356 -0.07100358 3.61044593 2.4 ala phe
+ 0.16898670 0.06047415 3.66929044 2.7 ala ile
+ 0.29707520 -0.00251129 4.02083643 1.8 ala leu
+ 0.16009076 -0.19966586 4.10663351 1.7 ala val
+ 0.33543361 0.02729744 3.47226781 3.7 ala trp
+ 0.40771637 0.04944451 3.22022624 3.4 ala tyr
+ 0.32491593 0.00199416 3.48648915 1.4 ala ala
+ 0.32250163 0.00199416 3.50576712 1.1 ala gly
+ 0.44809712 -0.03625897 3.28319535 2.9 ala thr
+ 0.32570984 0.00199416 3.48018928 2.2 ala ser
+ 0.25708601 -0.02518611 3.98829105 2.0 ala gln
+ 0.27223871 0.02170282 3.77047757 2.1 ala asn
+ 0.37126794 -0.02710099 3.50057256 2.6 ala glu
+ 0.15955468 -0.05289865 3.56513816 2.4 ala asp
+ 0.41120950 0.04944451 3.19268981 2.9 ala his
+ 0.27446733 0.00786488 4.09477647 1.9 ala arg
+ 0.22981425 -0.09322596 4.42291744 0.9 ala lys
+ 0.37507388 0.05588781 3.38612759 2.5 ala pro
+ 0.35817150 -0.05118436 3.17380260 3.3 ala sme
+ 0.35531356 -0.07100358 3.61044593 2.4 ala dbz
+ 0.32491593 0.00199416 3.48648915 1.4 ala aib
+ 0.32491593 0.00199416 3.48648915 1.4 ala abu
--- /dev/null
+ 1.0850 0.5544 0.5544 0.9622 ! EPP
+ 5.2739 5.4561 5.4561 5.2261 ! RPP
+ -1.6027 -1.4879 -1.4879 -0.0779 ! ELPP6
+ -0.0444 0.0000 0.0000 0.0137 ! ELPP3
+
--- /dev/null
+ 3 # Number of local interaction types
+Gly
+ 0.000000000000000
+ 0.791965124028570
+ 0.206068961118571
+ 0.000000000000000
+ 0.000000000000000
+ 2.373462483972307
+ -0.927962753087420
+ 0.000000000000000
+ 0.000000000000000
+ 1.329421814829764
+ -0.370576187607876
+ 0.000000000000000
+ 0.000000000000000
+Ala
+ 0.000000000000000
+ 0.500261572719827
+ -0.233786079150650
+ -0.878020534542259
+ 1.501220349138902
+ -2.089734050079038
+ 2.302365702770721
+ -0.532502145482045
+ -1.596421505165690
+ 1.276301651241011
+ 0.399942874780603
+ -0.543778421330412
+ 0.400478498916355
+Pro
+ 0.000000000000000
+ -1.286480000000000
+ 0.031808800000000
+ -0.906628000000000
+ 1.015390000000000
+ -1.548870000000000
+ 1.914370000000000
+ 0.664143000000000
+ -0.454839000000000
+ -0.051291400000000
+ 0.103179000000000
+ 0.316367000000000
+ 0.045277200000000
--- /dev/null
+cys
+2.516050
+1.519290
+-0.549712
+-1.031160
+1.143970
+2.488560
+-1.092110
+2.234960
+-0.755595
+1.289450
+1.853910
+4.001970
+-0.082907
+0.826224
+1.632090
+0.593940
+-0.364204
+-1.171220
+1.667710
+-1.599100
+-2.976120
+-2.507130
+1.072030
+-0.956779
+-2.533370
+-1.691250
+1.266100
+-0.870809
+1.513010
+2.242270
+-1.570990
+0.964612
+0.482876
+0.654966
+1.063640
+0.999274
+-2.492650
+-1.951980
+-0.535164
+-0.771304
+-2.293140
+-2.335450
+-0.858895
+-0.116272
+-1.427930
+-1.834970
+0.975263
+-0.416979
+-1.447500
+0.127525
+-0.663205
+-1.101400
+0.162302
+-0.060514
+0.180357
+-1.109550
+-0.456202
+-0.571306
+0.314586
+-1.498430
+-0.195562
+-1.682240
+0.767131
+6.286060
+4.999080
+met
+0.242385
+-3.867820
+-2.519440
+-1.840060
+0.346345
+0.104127
+-0.232111
+-0.456953
+2.560720
+-1.205500
+2.222330
+3.339340
+4.420270
+0.229703
+-0.059912
+2.543360
+-0.293651
+-0.050722
+2.341280
+-0.042924
+0.373985
+0.807829
+0.707855
+-0.993956
+-1.432900
+2.581280
+-0.794355
+-2.675380
+4.672100
+2.112750
+0.401415
+-1.225100
+0.323175
+1.696930
+-0.723040
+-1.083670
+-0.604380
+1.495140
+0.235245
+-0.748861
+-0.536377
+1.078860
+-2.003290
+-0.713276
+0.498966
+-2.266150
+1.213190
+-1.843220
+-3.535470
+1.424330
+-0.126241
+-0.887041
+-0.274146
+-0.492489
+-0.686889
+0.543455
+0.237177
+0.666361
+-0.619648
+1.448780
+-0.001620
+-1.655960
+5.119950
+3.850810
+6.772310
+phe
+2.905280
+1.563400
+0.260704
+-1.436610
+1.035990
+1.024140
+0.840447
+0.324290
+1.078110
+1.582520
+0.766660
+2.290690
+-0.135215
+-1.649520
+0.534748
+0.163339
+0.063276
+-1.823560
+-0.359499
+-1.494990
+-0.983586
+0.284312
+-0.312291
+-1.074510
+-0.659699
+-0.828137
+0.500521
+-3.527010
+0.428427
+-0.142418
+-0.771393
+-0.097615
+0.289041
+0.230247
+-0.782115
+-0.229896
+-0.587347
+1.285140
+-0.443417
+-0.812455
+-0.805578
+0.384103
+-0.636362
+-0.321168
+0.534795
+-1.278490
+-0.064930
+-2.042540
+-0.800358
+-0.244451
+-0.002745
+-0.445024
+0.477842
+-0.470867
+-0.692151
+-0.102851
+-0.110080
+0.490363
+0.280005
+-0.390101
+-0.411756
+-1.548200
+2.443590
+3.917670
+3.425880
+ile
+2.547010
+-0.480555
+-0.215172
+0.837321
+0.729540
+0.043286
+1.774070
+0.045433
+0.389008
+-0.849535
+1.303160
+-0.116116
+0.036272
+-0.297137
+0.131116
+1.057620
+0.114229
+0.195998
+-0.425898
+0.189526
+-1.451270
+1.337360
+0.613895
+-1.300010
+-1.115540
+0.279502
+-0.615356
+0.182825
+0.051340
+0.108723
+0.496082
+0.576282
+-1.245120
+-0.159551
+0.461861
+0.754533
+-0.516837
+0.086829
+0.197196
+0.005101
+-1.071330
+1.017270
+-0.714900
+-0.956747
+-0.565657
+-0.093550
+-0.412198
+0.416137
+0.107666
+-0.577227
+0.150543
+-1.242490
+-0.698236
+0.585429
+0.395118
+0.364855
+-0.653697
+0.501917
+-0.057772
+0.445256
+-0.362675
+-1.518600
+2.525450
+0.374404
+0.682944
+leu
+1.680740
+2.206260
+-1.020490
+-4.442000
+1.740900
+1.505040
+-1.447370
+0.359811
+-0.556261
+1.452810
+2.989010
+4.116870
+0.112662
+-0.159364
+0.673536
+0.586452
+1.865760
+-3.334100
+0.060408
+-2.004410
+-4.576780
+-4.974520
+1.658540
+2.955230
+-3.053830
+-0.617349
+-0.816079
+4.289990
+1.903920
+1.499120
+-2.080390
+0.496676
+1.354440
+0.236928
+2.237880
+-0.772602
+-0.600654
+-2.207890
+0.925248
+-1.403310
+0.907402
+2.736260
+-0.042247
+-2.761980
+2.254060
+-2.655420
+1.394610
+-6.677840
+-0.368599
+0.291979
+0.697959
+-0.306545
+0.002515
+-0.214417
+-3.297980
+-0.685060
+0.585051
+2.654060
+0.476247
+-0.642854
+-0.224549
+-1.778700
+1.643520
+8.321350
+8.662130
+val
+2.853420
+2.372460
+0.347315
+-1.687860
+1.167160
+2.017490
+-0.321584
+1.574110
+1.450650
+0.966125
+2.343690
+1.163800
+-0.910076
+-0.266744
+-0.563304
+1.765470
+1.150000
+0.945044
+-2.124250
+-3.053060
+-3.243560
+-1.337950
+1.407690
+-0.439212
+-0.482510
+-2.719870
+-0.035101
+-3.712790
+1.500760
+0.800428
+-0.590109
+0.503066
+0.749586
+0.017932
+0.069581
+-0.752567
+-1.256130
+0.000240
+0.887223
+-0.746863
+-1.302360
+-0.133817
+-0.070895
+-1.012470
+-0.255720
+-1.585790
+0.545734
+-2.406620
+0.266017
+1.527210
+-0.059205
+0.078433
+-0.453017
+0.252419
+1.112470
+-0.299918
+-1.668670
+0.220561
+-0.401384
+-0.756521
+-0.411065
+-1.569620
+1.493110
+5.922200
+4.609540
+trp
+2.921620
+0.684920
+-0.599147
+-1.786150
+1.272310
+1.207640
+0.446673
+0.990996
+-1.442880
+0.174451
+0.745048
+3.226680
+0.573147
+-0.374842
+0.584342
+0.374784
+-0.207986
+-1.031510
+0.674108
+-0.390621
+-1.465510
+-0.603164
+-0.228428
+-0.701186
+-1.343350
+-0.431420
+0.312777
+-3.304840
+3.352130
+0.892130
+-0.807663
+-0.149322
+0.432795
+0.373168
+-0.568305
+-0.426774
+-0.559088
+0.633184
+-0.453757
+-0.873045
+-0.986508
+0.621304
+-1.482100
+-0.080794
+1.285140
+-1.991150
+-0.276781
+-2.516300
+-0.972887
+0.721706
+0.470161
+-0.420591
+0.454982
+-1.389310
+-1.260280
+0.335462
+0.729529
+-0.183500
+0.327032
+-0.218261
+-0.364944
+-1.523350
+2.591340
+3.992920
+3.500820
+tyr
+2.848390
+1.220450
+0.164588
+-1.416060
+0.864915
+0.959356
+1.020760
+0.346926
+1.091540
+1.440250
+0.515721
+1.825900
+0.328914
+-1.270620
+0.346300
+0.327131
+-0.161742
+-1.593460
+-0.222144
+-1.405750
+-0.955410
+0.352884
+-0.374064
+-0.939478
+-0.774774
+-0.536210
+0.352785
+-3.080560
+0.836825
+-0.506611
+-0.776758
+-0.211439
+0.184199
+0.377714
+-0.478433
+-0.171748
+-0.650885
+1.300680
+-0.539006
+-1.333370
+-0.964979
+0.290092
+-0.846196
+-0.297355
+0.400525
+-1.367340
+-0.000126
+-1.621890
+-0.615022
+-0.529794
+-0.066040
+-0.797892
+0.462295
+-0.386974
+-0.333067
+0.016663
+-0.429482
+0.339500
+0.338939
+-0.896894
+-0.390244
+-1.524800
+2.793770
+3.087750
+2.543540
+ala
+29.581800
+5.302400
+-8.747850
+6.252030
+53.434500
+11.092900
+26.127600
+15.726000
+0.066585
+68.839800
+12.858300
+8.451450
+-3.332160
+6.671050
+-15.863800
+1.456490
+-0.410963
+8.873910
+3.570870
+-17.554000
+-30.977100
+-4.646740
+8.804110
+-27.391600
+-15.911000
+-5.664230
+-12.905200
+-12.063900
+8.869960
+-1.839190
+-3.407650
+12.814000
+-9.468340
+-8.090890
+5.999440
+3.456650
+-23.923700
+-4.696260
+4.081510
+3.765870
+-3.646730
+-6.890210
+-3.788290
+-15.397100
+-7.145120
+7.975680
+-4.482870
+-4.678150
+-11.878400
+-9.343300
+-2.332450
+0.687960
+-4.130170
+-3.224060
+8.454630
+4.189470
+-19.724500
+-8.742350
+-1.249890
+-12.608200
+0.643325
+-1.817150
+-2.059430
+10.866800
+1.832750
+gly
+no side-chain
+thr
+2.552870
+0.908677
+0.013694
+-1.912020
+0.374026
+2.534850
+-0.358242
+1.314570
+-0.002403
+-0.339657
+1.182830
+0.571142
+-2.281230
+-0.362873
+-0.513174
+-0.309246
+2.008470
+0.834209
+-3.807740
+-1.651370
+-2.468030
+-0.628244
+1.982210
+0.353341
+-0.372571
+-1.191460
+-0.908825
+-2.598860
+4.084590
+0.794012
+-0.447691
+-0.558372
+0.686901
+0.706404
+0.570963
+-0.359765
+-0.908598
+0.181491
+1.827310
+-0.391557
+-1.079830
+-0.148791
+-0.238554
+0.168299
+0.449106
+-1.445600
+-0.078064
+-0.544035
+0.494414
+2.771950
+0.662545
+0.581236
+-0.716348
+-0.641217
+1.142900
+-0.502831
+-0.253750
+-0.309933
+-0.182098
+0.467125
+-0.435565
+-1.536860
+0.657918
+5.468580
+4.348550
+ser
+3.261260
+2.372320
+-0.441888
+-7.144530
+1.440980
+0.892894
+0.967241
+-0.883910
+-0.944144
+3.267120
+2.454180
+5.861420
+-1.770560
+0.282070
+1.153690
+0.324110
+1.000110
+-5.381160
+-1.037120
+-3.287730
+-4.500800
+-4.680830
+1.271610
+4.062690
+-2.100630
+-0.620598
+-1.751340
+5.047890
+2.318850
+0.772142
+-1.676040
+0.548819
+1.828580
+0.481638
+1.905550
+-1.055500
+0.347758
+-1.972810
+0.263296
+-0.884153
+-0.717223
+0.058630
+1.748850
+-0.549066
+0.233948
+-1.675870
+0.743669
+-2.786440
+2.582160
+-1.611050
+-0.418236
+0.214639
+0.299815
+0.653207
+-1.614910
+-1.122350
+0.779347
+1.581610
+0.907118
+-2.092000
+-0.319132
+-1.760880
+3.277280
+10.253200
+8.112910
+glu
+0.070526
+0.913876
+0.970204
+-1.418860
+1.519230
+2.363470
+1.081950
+-1.141770
+3.408860
+-1.998530
+2.035560
+2.802280
+1.986150
+-1.296320
+1.860060
+2.806320
+0.930869
+-0.049774
+0.030898
+-0.319751
+-5.890110
+-3.467340
+3.128240
+1.891450
+-0.751099
+-2.948590
+1.299560
+0.943981
+3.945590
+-0.885366
+-1.286460
+1.379920
+0.835779
+2.274900
+1.066560
+-4.810250
+2.487680
+-0.815236
+0.825560
+-0.133447
+-1.847050
+0.642237
+-1.740230
+-1.127830
+1.302210
+-2.245610
+2.246220
+-2.465710
+-1.162500
+0.821033
+-0.618164
+-1.400750
+0.045507
+0.398040
+-0.880369
+-2.039250
+1.389940
+0.044041
+-0.500567
+-1.652310
+-0.447018
+-1.224190
+9.871030
+1.155810
+5.541080
+asn
+2.887160
+1.505510
+-0.880658
+-1.802050
+1.318050
+0.853847
+0.728651
+-0.450756
+0.406586
+1.918440
+1.067310
+3.575890
+0.260153
+-0.523274
+1.166750
+0.115179
+-0.202976
+-0.886999
+-0.844886
+-1.510850
+-1.495980
+-1.305910
+-0.006770
+-1.018110
+-1.196710
+-0.152800
+-0.135317
+-2.751090
+1.718150
+0.784398
+-0.582188
+-0.092762
+0.689656
+0.320720
+-0.915587
+-0.715622
+-0.786048
+-0.013911
+-0.230284
+0.144000
+-0.095310
+0.066526
+0.327789
+-1.946870
+-0.961993
+-1.139090
+2.011190
+-3.389190
+1.069160
+-0.480208
+-0.900915
+0.021566
+-0.754257
+0.146208
+-0.930949
+-0.772920
+-0.259499
+1.736500
+0.162489
+-0.932451
+-0.431414
+-1.573430
+1.702680
+4.384230
+5.557500
+glu
+0.070526
+0.913876
+0.970204
+-1.418860
+1.519230
+2.363470
+1.081950
+-1.141770
+3.408860
+-1.998530
+2.035560
+2.802280
+1.986150
+-1.296320
+1.860060
+2.806320
+0.930869
+-0.049774
+0.030898
+-0.319751
+-5.890110
+-3.467340
+3.128240
+1.891450
+-0.751099
+-2.948590
+1.299560
+0.943981
+3.945590
+-0.885366
+-1.286460
+1.379920
+0.835779
+2.274900
+1.066560
+-4.810250
+2.487680
+-0.815236
+0.825560
+-0.133447
+-1.847050
+0.642237
+-1.740230
+-1.127830
+1.302210
+-2.245610
+2.246220
+-2.465710
+-1.162500
+0.821033
+-0.618164
+-1.400750
+0.045507
+0.398040
+-0.880369
+-2.039250
+1.389940
+0.044041
+-0.500567
+-1.652310
+-0.447018
+-1.224190
+9.871030
+1.155810
+5.541080
+asp
+3.393100
+1.530490
+-0.056195
+-1.829370
+0.141299
+0.771783
+2.517790
+-2.256840
+1.947970
+2.418020
+0.641765
+3.385780
+-1.085960
+-1.751340
+1.666850
+0.082569
+-1.067290
+-0.953673
+-1.956880
+-0.130965
+-2.165850
+-2.021030
+0.465149
+0.849165
+-1.408640
+-0.396844
+-0.332769
+0.203629
+0.950651
+-1.758780
+-1.002960
+0.174170
+0.586997
+0.665809
+-0.036146
+-0.823361
+0.314356
+-0.212134
+-0.371333
+0.187511
+0.279874
+1.091480
+0.597046
+-1.809290
+0.561474
+-1.582770
+1.327560
+-4.028240
+0.663853
+-1.131780
+-0.099988
+0.155690
+-0.329172
+0.299049
+-1.895480
+-0.927719
+0.431330
+2.101560
+0.144432
+0.026490
+-0.468977
+-1.619670
+0.674945
+5.389650
+6.091920
+his
+2.771840
+1.871420
+0.642667
+-1.621980
+1.040560
+0.858055
+0.864645
+0.156787
+1.255050
+2.113910
+0.967605
+2.535960
+-0.255966
+-1.687760
+0.740406
+0.097038
+0.120513
+-2.171050
+-0.576881
+-2.281680
+-0.949819
+0.202620
+-0.108227
+-1.119410
+-0.294544
+-1.029800
+0.367984
+-3.538760
+0.558602
+0.039279
+-0.569377
+-0.037731
+0.571981
+0.288592
+-1.038140
+-0.439625
+-0.660975
+1.212290
+-0.357194
+-0.827404
+-0.637842
+-0.027649
+-0.510968
+-0.721916
+-0.315069
+-1.222220
+0.893482
+-2.230320
+-0.429219
+0.038562
+-0.667068
+-0.322006
+-0.026325
+-0.384665
+-0.805183
+-0.584237
+0.104319
+1.225640
+0.196774
+-0.568376
+-0.404463
+-1.585910
+2.504960
+4.242010
+4.344010
+arg
+15.635000
+15.480100
+6.648870
+-18.867400
+8.112720
+1.091870
+6.428840
+-5.933360
+0.563115
+-1.135150
+-3.091790
+0.253889
+-13.733700
+7.578930
+0.670338
+-1.723080
+-1.999990
+-3.289380
+-5.317610
+6.425830
+-11.558600
+-9.164840
+0.615527
+6.209540
+-4.682290
+-5.909200
+-0.913172
+4.976140
+1.524290
+3.750960
+-2.577270
+1.538390
+1.621870
+0.113149
+0.840945
+-5.173650
+3.728470
+-1.250960
+-1.053350
+0.256049
+-4.819690
+-4.631460
+0.267787
+3.154990
+-2.481970
+-0.005787
+-2.416910
+3.124050
+-3.999920
+-1.868040
+0.112267
+1.347600
+1.780410
+-2.247470
+0.415467
+-3.660360
+0.892497
+-0.918464
+1.156950
+3.541130
+0.209257
+0.052619
+16.451300
+29.575700
+16.781700
+lys
+3.629200
+8.354760
+-5.316650
+-6.442250
+3.029120
+-0.253504
+1.095740
+-4.598450
+-1.232190
+-0.188861
+3.902230
+1.638270
+5.393420
+-0.498152
+1.255330
+3.180320
+-0.267965
+-2.358320
+-1.556550
+0.516286
+-4.359970
+-5.661280
+2.927070
+3.790640
+-4.595660
+2.104740
+-1.689900
+4.922930
+2.532640
+0.448579
+-2.297530
+0.332371
+1.576610
+1.927500
+1.400070
+-1.447210
+0.984547
+-1.969040
+0.618915
+-1.514840
+-3.391120
+-2.581270
+-2.370860
+2.161890
+-1.264640
+-1.934220
+-0.016963
+1.932110
+-2.249750
+2.818560
+-1.075660
+0.433778
+0.863336
+-2.522350
+-0.160333
+-0.729450
+1.572090
+-0.855726
+-0.301598
+3.318270
+-0.585549
+-1.112810
+6.153790
+15.332000
+10.158700
+pro
+4.181670
+0.818431
+1.557990
+-2.590020
+3.171380
+2.036200
+-0.972179
+2.330640
+-3.042700
+3.502460
+3.108800
+0.727264
+1.380870
+0.382058
+1.953450
+0.248880
+0.962273
+0.672548
+-2.864740
+-4.209440
+-2.663210
+0.061483
+0.338868
+-1.111720
+0.407801
+-2.285720
+-0.748390
+-1.232650
+4.219010
+0.595086
+3.794940
+-1.492820
+0.985205
+2.047750
+-2.326250
+-1.786200
+0.262373
+-1.959410
+-0.225483
+-0.414578
+-2.540780
+0.607528
+-2.705600
+-0.472333
+-0.260711
+-1.019870
+-1.220640
+-2.372380
+0.977973
+1.609700
+-0.776966
+0.530990
+1.137450
+-2.496770
+-1.364430
+3.473310
+-0.209746
+-2.099850
+-0.749455
+-0.820907
+-0.327475
+-1.714150
+2.053060
+6.348730
+5.232300
+sme
+0.242385
+-3.867820
+-2.519440
+-1.840060
+0.346345
+0.104127
+-0.232111
+-0.456953
+2.560720
+-1.205500
+2.222330
+3.339340
+4.420270
+0.229703
+-0.059912
+2.543360
+-0.293651
+-0.050722
+2.341280
+-0.042924
+0.373985
+0.807829
+0.707855
+-0.993956
+-1.432900
+2.581280
+-0.794355
+-2.675380
+4.672100
+2.112750
+0.401415
+-1.225100
+0.323175
+1.696930
+-0.723040
+-1.083670
+-0.604380
+1.495140
+0.235245
+-0.748861
+-0.536377
+1.078860
+-2.003290
+-0.713276
+0.498966
+-2.266150
+1.213190
+-1.843220
+-3.535470
+1.424330
+-0.126241
+-0.887041
+-0.274146
+-0.492489
+-0.686889
+0.543455
+0.237177
+0.666361
+-0.619648
+1.448780
+-0.001620
+-1.655960
+5.119950
+3.850810
+6.772310
+dbz
+2.905280
+1.563400
+0.260704
+-1.436610
+1.035990
+1.024140
+0.840447
+0.324290
+1.078110
+1.582520
+0.766660
+2.290690
+-0.135215
+-1.649520
+0.534748
+0.163339
+0.063276
+-1.823560
+-0.359499
+-1.494990
+-0.983586
+0.284312
+-0.312291
+-1.074510
+-0.659699
+-0.828137
+0.500521
+-3.527010
+0.428427
+-0.142418
+-0.771393
+-0.097615
+0.289041
+0.230247
+-0.782115
+-0.229896
+-0.587347
+1.285140
+-0.443417
+-0.812455
+-0.805578
+0.384103
+-0.636362
+-0.321168
+0.534795
+-1.278490
+-0.064930
+-2.042540
+-0.800358
+-0.244451
+-0.002745
+-0.445024
+0.477842
+-0.470867
+-0.692151
+-0.102851
+-0.110080
+0.490363
+0.280005
+-0.390101
+-0.411756
+-1.548200
+2.443590
+3.917670
+3.425880
+Aib
+29.581800
+5.302400
+-8.747850
+0.0000
+53.434500
+11.092900
+0.0000
+0.0000
+0.066585
+0.0000
+12.858300
+8.451450
+-3.332160
+0.0000
+-15.863800
+1.456490
+0.0000
+0.0000
+3.570870
+0.0000
+-30.977100
+-4.646740
+8.804110
+0.000
+-15.911000
+-5.664230
+0.0000
+0.0000
+8.869960
+0.0000
+-3.407650
+12.814000
+0.0000
+-8.090890
+0.0000
+3.456650
+0.000
+0.000
+0.000
+0.000
+-3.646730
+-6.890210
+-3.788290
+0.000
+-7.145120
+7.975680
+0.000
+0.000
+-11.878400
+0.000
+-2.332450
+0.687960
+0.000
+-3.224060
+0.000
+4.189470
+0.000
+0.000
+0.000
+0.000
+0.643325
+-1.817150
+-2.059430
+10.866800
+1.832750
+Abu
+29.581800
+5.302400
+-8.747850
+6.252030
+53.434500
+11.092900
+26.127600
+15.726000
+0.066585
+68.839800
+12.858300
+8.451450
+-3.332160
+6.671050
+-15.863800
+1.456490
+-0.410963
+8.873910
+3.570870
+-17.554000
+-30.977100
+-4.646740
+8.804110
+-27.391600
+-15.911000
+-5.664230
+-12.905200
+-12.063900
+8.869960
+-1.839190
+-3.407650
+12.814000
+-9.468340
+-8.090890
+5.999440
+3.456650
+-23.923700
+-4.696260
+4.081510
+3.765870
+-3.646730
+-6.890210
+-3.788290
+-15.397100
+-7.145120
+7.975680
+-4.482870
+-4.678150
+-11.878400
+-9.343300
+-2.332450
+0.687960
+-4.130170
+-3.224060
+8.454630
+4.189470
+-19.724500
+-8.742350
+-1.249890
+-12.608200
+0.643325
+-1.817150
+-2.059430
+10.866800
+1.832750
5.263842382200000 5.496195412400000 4.292812416200000 4.358225054000000
4.266775592100000 3.681384595800000 3.540542964700000 3.702698591200000
4.717759615600000 3.381199222700000 3.793608545800000 4.515749058500000
+
6.629674668000000 6.671726050800000 6.816887694500000 6.837896015200000
6.351203998600000 6.142519242300000 5.520020640600000 5.485893602400000
4.938257326200000 4.279512916600000 4.053485701800000 4.208642852500000
3.538808627900000 3.420973032700000 2.799574419300000 4.816426855300000
- 3.879075507100000 3.587826217700000 4.645743255500000 5.434261193691611
- 6.009504353949445 5.751833613689151 4.388369927131041 6.139482146000000
- 4.432779364180328 3.635448013213493 3.042556269070575 1.858255457238648
- 3.619846653665197 3.902273188000000 2.840826371233924 1.901219059651194
- 3.010635482615414 2.681361243261458 3.871192813400000 3.639660062795308
- 4.487266103000000 7.144249845164532 5.950132764851209 5.636408114630104
- 6.256568766200000 4.721753486138623 5.072743940945156 4.725634408062251
- 3.773513014441411 3.537762800513723 4.309235277900000 4.002278495651890
- 4.124103654261368 1.771213000543424 3.864752062532702 4.468184401000000
- 4.481956278333824 4.902394508200000 5.956274037802311 7.211686591187319
- 6.204787608200000 5.376059458542183 5.023511032618925 3.156887023825594
- 2.932344993803476 2.999897908513799 3.895407345300000 2.991138620007669
- 2.096199593475473 1.780803572610500 3.558049006448599 4.023841260600000
- 3.682633555857166 4.808718037700000 5.741243604492526 5.884448203300000
- 3.398137040446693 5.432746439707773 4.729707784043235 3.970010356404483
- 3.414577863946629 3.650628980600000 2.605234605568324 2.392978757746573
- 3.096075853472831 4.009206356643173 3.441595274000000 3.721594130855455
- 4.593424600900000 5.282881132500000 4.829846631500000 4.757532777700000
- 4.724977904200000 3.565638428500000 3.561336656700000 3.927304556400000
- 3.766477911800000 3.586169976100000 3.552319162700000 4.650867246300000
- 4.242430826000000 4.098772778300000 4.507966992900000 4.222264575400000
- 3.568880377430671 1.710507474941357 0.726915001472055 2.519422404183540
- 3.136598518800000 2.564808696931206 3.101026335222954 2.213396947938416
- 3.343125814753411 3.444306825200000 2.416478592751639 4.091530576300000
+ 3.879075507100000 3.587826217700000 4.645743255500000
+
+ 5.434261193691611 6.009504353949445 5.751833613689151 4.388369927131041
+ 6.139482146000000 4.432779364180328 3.635448013213493 3.042556269070575
+ 1.858255457238648 3.619846653665197 3.902273188000000 2.840826371233924
+ 1.901219059651194 3.010635482615414 2.681361243261458 3.871192813400000
+ 3.639660062795308 4.487266103000000
+
+ 7.144249845164532 5.950132764851209 5.636408114630104 6.256568766200000
+ 4.721753486138623 5.072743940945156 4.725634408062251 3.773513014441411
+ 3.537762800513723 4.309235277900000 4.002278495651890 4.124103654261368
+ 1.771213000543424 3.864752062532702 4.468184401000000 4.481956278333824
+ 4.902394508200000
+
+ 5.956274037802311 7.211686591187319 6.204787608200000 5.376059458542183
+ 5.023511032618925 3.156887023825594 2.932344993803476 2.999897908513799
+ 3.895407345300000 2.991138620007669 2.096199593475473 1.780803572610500
+ 3.558049006448599 4.023841260600000 3.682633555857166 4.808718037700000
+
+ 5.741243604492526 5.884448203300000 3.398137040446693 5.432746439707773
+ 4.729707784043235 3.970010356404483 3.414577863946629 3.650628980600000
+ 2.605234605568324 2.392978757746573 3.096075853472831 4.009206356643173
+ 3.441595274000000 3.721594130855455 4.593424600900000
+
+ 5.282881132500000 4.829846631500000 4.757532777700000 4.724977904200000
+ 3.565638428500000 3.561336656700000 3.927304556400000 3.766477911800000
+ 3.586169976100000 3.552319162700000 4.650867246300000 4.242430826000000
+ 4.098772778300000 4.507966992900000
+
+ 4.222264575400000 3.568880377430671 1.710507474941357 0.726915001472055
+ 2.519422404183540 3.136598518800000 2.564808696931206 3.101026335222954
+ 2.213396947938416 3.343125814753411 3.444306825200000 2.416478592751639
+ 4.091530576300000
+
4.157487725645439 3.262380685905436 2.953659747759453 1.237209789211462
2.500185737000000 1.984183152198450 1.368828812773212 2.060401072298498
2.863410468895249 2.015232903800000 1.541966676954322 3.639585254600000
+
2.501655793500000 2.394681323067151 2.071384505085577 1.074154474700000
0.985099710786774 0.001985439127056 0.921773098679111 5.126752085199419
- 1.500212764900000 -0.018286801754111 3.538112898500000 2.248058879145623
- 2.683627337507786 1.505360785600000 -0.706299059260768 1.284606704482992
- 1.109202790492530 2.070407759035996 1.983305353800000 -0.008577364700000
- 2.955755366600000 1.280003824300000 0.768980610000000 0.625889188870640
- 1.535343520692143 0.574105444778441 1.174671233709513 1.497548217400000
- -0.665902088339257 2.941502147900000 -0.679242885900000 0.453238323900000
- -0.759038766000000 -0.361703484600000 1.680327505800000 0.677520998800000
- -0.535483746800000 2.620859136300000 0.290068410287431 -0.092399325129687
- 1.982203632452388 0.078357579868221 0.389638827500000 -0.177470106993247
- 2.325532607700000 -3.392465857895507 -1.871634582322480 1.071505323254014
- 2.748917412400000 1.802089391960750 1.797571866700000 -1.397996047062832
- 0.263585152937208 2.820287379000000 1.642062410367716 1.862509124700000
+ 1.500212764900000 -0.018286801754111 3.538112898500000
+
+ 2.248058879145623 2.683627337507786 1.505360785600000 -0.706299059260768
+ 1.284606704482992 1.109202790492530 2.070407759035996 1.983305353800000
+ -0.008577364700000 2.955755366600000
+
+ 1.280003824300000 0.768980610000000 0.625889188870640 1.535343520692143
+ 0.574105444778441 1.174671233709513 1.497548217400000 -0.665902088339257
+ 2.941502147900000
+
+ -0.679242885900000 0.453238323900000 -0.759038766000000 -0.361703484600000
+ 1.680327505800000 0.677520998800000 -0.535483746800000 2.620859136300000
+
+ 0.290068410287431 -0.092399325129687 1.982203632452388 0.078357579868221
+ 0.389638827500000 -0.177470106993247 2.325532607700000
+
+ -3.392465857895507 -1.871634582322480 1.071505323254014 2.748917412400000
+ 1.802089391960750 1.797571866700000
+
+ -1.397996047062832 0.263585152937208 2.820287379000000 1.642062410367716
+ 1.862509124700000
+
3.729277869700000 2.294443648100000 -0.070327972331951 3.111577617700000
- -0.082736296100000 -1.604311318200000 2.443983743500000 -3.048709356063184
- 2.366463453300000 4.192796926000000 2.674806001700000 2.733881014500000
- 2.966464722900000 2.881963673700000 3.021073815000000 2.841428615200000
- 2.477343866000000 2.461194378800000 2.465320121300000 2.492508737100000
- 2.573476775100000 2.456402674400000 2.484782528100000 2.488928923300000
- 2.508951764500000 2.508333838300000 2.422062272300000 2.271460977000000
- 2.452070308900000 2.702612978800000 4.927215476100000 5.105428423000000
- 4.207351616500000 4.851397283700000 2.784887529300000 3.582986163400000
- 7.866021757600000 7.429920984700000 1.962593983200000 0.798776956900000
- 4.058089968100000 1.888902103200000 3.198719702600000 3.267327453800000
- 2.684813190400000 2.004302740400000 6.244634191000000 8.195945209500000
- 13.474829585800000 2.663237683700000 0.869902301100000 1.054066001400000
- 0.938590929800000 1.026327410100000 1.083527704500000 1.054318388600000
- 0.788868699600000 0.898930583300000 1.003996287500000 1.242751812800000
- 0.893280172400000 0.917392899000000 1.615769565700000 1.431586037300000
- 2.049831787900000 1.419961554600000 0.993367797100000 1.431962560000000
- 27.495176328800000 0.778802528600000 0.010369755600000 0.061138567400000
- 0.044830334600000 0.039283178200000 0.085416633800000 0.039889661900000
- 0.024949656900000 0.023241090800000 0.086137910000000 -0.075479418500000
- -0.026614602100000 -0.016342909900000 0.057216710300000 -0.046860882500000
- 0.015104845500000 0.008496367800000 0.027893039700000 0.007692291100000
- 0.103353673800000 -0.009825603600000
+
+ -0.082736296100000 -1.604311318200000 2.443983743500000
+
+ -3.048709356063184 2.366463453300000
+
+ 4.192796926000000
+
+ 2.674806001700000 2.733881014500000 2.966464722900000 2.881963673700000
+ 3.021073815000000 2.841428615200000 2.477343866000000 2.461194378800000
+ 2.465320121300000 2.492508737100000 2.573476775100000 2.456402674400000
+ 2.484782528100000 2.488928923300000 2.508951764500000 2.508333838300000
+ 2.422062272300000 2.271460977000000 2.452070308900000 2.702612978800000
+
+ 4.927215476100000 5.105428423000000 4.207351616500000 4.851397283700000
+ 2.784887529300000 3.582986163400000 7.866021757600000 7.429920984700000
+ 1.962593983200000 0.798776956900000 4.058089968100000 1.888902103200000
+ 3.198719702600000 3.267327453800000 2.684813190400000 2.004302740400000
+ 6.244634191000000 8.195945209500000 13.474829585800000 2.663237683700000
+
+ 0.869902301100000 1.054066001400000 0.938590929800000 1.026327410100000
+ 1.083527704500000 1.054318388600000 0.788868699600000 0.898930583300000
+ 1.003996287500000 1.242751812800000 0.893280172400000 0.917392899000000
+ 1.615769565700000 1.431586037300000 2.049831787900000 1.419961554600000
+ 0.993367797100000 1.431962560000000 27.495176328800000 0.778802528600000
+
+ 0.010369755600000 0.061138567400000 0.044830334600000 0.039283178200000
+ 0.085416633800000 0.039889661900000 0.024949656900000 0.023241090800000
+ 0.086137910000000 -0.075479418500000 -0.026614602100000 -0.016342909900000
+ 0.057216710300000 -0.046860882500000 0.015104845500000 0.008496367800000
+ 0.027893039700000 0.007692291100000 0.103353673800000 -0.009825603600000
--- /dev/null
+ 4 6
+ 5.605353726100000 6.220003215400000 6.215989849600000 6.438696896300000
+ 6.209810123100000 5.959637479800000 5.431022266200000 4.879008525700000
+ 5.263842382200000 5.496195412400000 4.292812416200000 4.358225054000000
+ 4.266775592100000 3.681384595800000 3.540542964700000 3.702698591200000
+ 4.717759615600000 3.381199222700000 3.793608545800000 4.515749058500000
+ 6.220003215400000 6.215989849600000 5.496195412400000 5.496195412400000
+
+ 6.629674668000000 6.671726050800000 6.816887694500000 6.837896015200000
+ 6.351203998600000 6.142519242300000 5.520020640600000 5.485893602400000
+ 4.938257326200000 4.279512916600000 4.053485701800000 4.208642852500000
+ 3.538808627900000 3.420973032700000 2.799574419300000 4.816426855300000
+ 3.879075507100000 3.587826217700000 4.645743255500000 6.629674668000000
+ 6.671726050800000 5.485893602400000 5.485893602400000
+
+ 5.434261193691611 6.009504353949445 5.751833613689151 4.388369927131041
+ 6.139482146000000 4.432779364180328 3.635448013213493 3.042556269070575
+ 1.858255457238648 3.619846653665197 3.902273188000000 2.840826371233924
+ 1.901219059651194 3.010635482615414 2.681361243261458 3.871192813400000
+ 3.639660062795308 4.487266103000000 6.671726050800000 5.434261193691611
+ 3.635448013213493 3.635448013213493
+
+ 7.144249845164532 5.950132764851209 5.636408114630104 6.256568766200000
+ 4.721753486138623 5.072743940945156 4.725634408062251 3.773513014441411
+ 3.537762800513723 4.309235277900000 4.002278495651890 4.124103654261368
+ 1.771213000543424 3.864752062532702 4.468184401000000 4.481956278333824
+ 4.902394508200000 6.816887694500000 6.009504353949445 5.072743940945156
+ 5.072743940945156
+
+ 5.956274037802311 7.211686591187319 6.204787608200000 5.376059458542183
+ 5.023511032618925 3.156887023825594 2.932344993803476 2.999897908513799
+ 3.895407345300000 2.991138620007669 2.096199593475473 1.780803572610500
+ 3.558049006448599 4.023841260600000 3.682633555857166 4.808718037700000
+ 6.837896015200000 5.751833613689151 5.023511032618925 5.023511032618925
+
+ 5.741243604492526 5.884448203300000 3.398137040446693 5.432746439707773
+ 4.729707784043235 3.970010356404483 3.414577863946629 3.650628980600000
+ 2.605234605568324 2.392978757746573 3.096075853472831 4.009206356643173
+ 3.441595274000000 3.721594130855455 4.593424600900000 6.351203998600000
+ 4.388369927131041 5.432746439707773 5.432746439707773
+
+ 5.282881132500000 4.829846631500000 4.757532777700000 4.724977904200000
+ 3.565638428500000 3.561336656700000 3.927304556400000 3.766477911800000
+ 3.586169976100000 3.552319162700000 4.650867246300000 4.242430826000000
+ 4.098772778300000 4.507966992900000 6.142519242300000 6.139482146000000
+ 4.757532777700000 4.757532777700000
+
+ 4.222264575400000 3.568880377430671 1.710507474941357 0.726915001472055
+ 2.519422404183540 3.136598518800000 2.564808696931206 3.101026335222954
+ 2.213396947938416 3.343125814753411 3.444306825200000 2.416478592751639
+ 4.091530576300000 5.520020640600000 4.432779364180328 1.710507474941357
+ 1.710507474941357
+
+ 4.157487725645439 3.262380685905436 2.953659747759453 1.237209789211462
+ 2.500185737000000 1.984183152198450 1.368828812773212 2.060401072298498
+ 2.863410468895249 2.015232903800000 1.541966676954322 3.639585254600000
+ 5.485893602400000 3.635448013213493 3.262380685905436 3.262380685905436
+
+ 2.501655793500000 2.394681323067151 2.071384505085577 1.074154474700000
+ 0.985099710786774 0.001985439127056 0.921773098679111 5.126752085199419
+ 1.500212764900000 -0.018286801754111 3.538112898500000 4.938257326200000
+ 3.042556269070575 2.501655793500000 2.501655793500000
+
+ 2.248058879145623 2.683627337507786 1.505360785600000 -0.706299059260768
+ 1.284606704482992 1.109202790492530 2.070407759035996 1.983305353800000
+ -0.008577364700000 2.955755366600000 4.279512916600000 1.858255457238648
+ 2.394681323067151 2.394681323067151
+
+ 1.280003824300000 0.768980610000000 0.625889188870640 1.535343520692143
+ 0.574105444778441 1.174671233709513 1.497548217400000 -0.665902088339257
+ 2.941502147900000 4.053485701800000 3.619846653665197 2.071384505085577
+ 2.071384505085577
+
+ -0.679242885900000 0.453238323900000 -0.759038766000000 -0.361703484600000
+ 1.680327505800000 0.677520998800000 -0.535483746800000 2.620859136300000
+ 4.208642852500000 3.902273188000000 1.074154474700000 1.074154474700000
+
+ 0.290068410287431 -0.092399325129687 1.982203632452388 0.078357579868221
+ 0.389638827500000 -0.177470106993247 2.325532607700000 3.538808627900000
+ 2.840826371233924 0.985099710786774 0.985099710786774
+
+ -3.392465857895507 -1.871634582322480 1.071505323254014 2.748917412400000
+ 1.802089391960750 1.797571866700000 3.420973032700000 1.90121905965119
+ 0.001985439127056 0.001985439127056
+
+ -1.397996047062832 0.263585152937208 2.820287379000000 1.642062410367716
+ 1.862509124700000 2.799574419300000 3.010635482615414 0.921773098679111
+ 0.921773098679111
+
+ 3.729277869700000 2.294443648100000 -0.070327972331951 3.111577617700000
+ 4.816426855300000 2.681361243261458 5.126752085199419 5.126752085199419
+
+ -0.082736296100000 -1.604311318200000 2.443983743500000 3.879075507100000
+ 3.871192813400000 1.500212764900000 1.500212764900000
+
+ -3.048709356063184 2.366463453300000 3.587826217700000 3.639660062795308
+ -0.018286801754111 -0.018286801754111
+
+ 4.192796926000000 4.645743255500000 4.487266103000000 3.538112898500000
+ 3.538112898500000
+
+ 6.629674668000000 6.671726050800000 5.485893602400000 5.485893602400000
+
+ 5.434261193691611 3.635448013213493 3.635448013213493
+
+ 2.501655793500000 2.501655793500000
+
+ 2.501655793500000
+
+ 2.674806001700000 2.733881014500000 2.966464722900000 2.881963673700000
+ 3.021073815000000 2.841428615200000 2.477343866000000 2.461194378800000
+ 2.465320121300000 2.492508737100000 2.573476775100000 2.456402674400000
+ 2.484782528100000 2.488928923300000 2.508951764500000 2.508333838300000
+ 2.422062272300000 2.271460977000000 2.452070308900000 2.702612978800000
+ 2.733881014500000 3.239567000000000 2.465320121300000 2.465320121300000
+
+ 4.927215476100000 5.105428423000000 4.207351616500000 4.851397283700000
+ 2.784887529300000 3.582986163400000 7.866021757600000 7.429920984700000
+ 1.962593983200000 0.798776956900000 4.058089968100000 1.888902103200000
+ 3.198719702600000 3.267327453800000 2.684813190400000 2.004302740400000
+ 6.244634191000000 8.195945209500000 13.474829585800000 2.663237683700000
+ 7.005428423000000 4.207351616500000 1.962593983200000 1.888902103200000
+
+ 0.869902301100000 1.054066001400000 0.938590929800000 1.026327410100000
+ 1.083527704500000 1.054318388600000 0.788868699600000 0.898930583300000
+ 1.003996287500000 1.242751812800000 0.893280172400000 0.917392899000000
+ 1.615769565700000 1.431586037300000 2.049831787900000 1.419961554600000
+ 0.993367797100000 1.431962560000000 27.495176328800000 0.778802528600000
+ 1.446666701400000 0.868195759800000 1.000000000000300 0.917392899000000
+
+ 0.010369755600000 0.061138567400000 0.044830334600000 0.039283178200000
+ 0.085416633800000 0.039889661900000 0.024949656900000 0.023241090800000
+ 0.086137910000000 -0.075479418500000 -0.026614602100000 -0.016342909900000
+ 0.057216710300000 -0.046860882500000 0.015104845500000 0.008496367800000
+ 0.027893039700000 0.007692291100000 0.103353673800000 -0.009825603600000
+ 0.061138567400000 0.044830334600000 0.086137910000000 -0.016342909900000
-20 *** Parameters derived by pdb statistical analysis by Shelly Rackovsky ***
-1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20
-6 0 *********** SCCC-cys-cys
- 1 5.45931E-02 -1.10282E-01
- 2 4.82158E-01 -2.25706E-01
- 3 -3.67560E-02 -2.97931E-01
- 4 -2.49045E-01 9.67159E-02
- 5 1.34632E-01 -1.09511E-01
- 6 -1.68916E-01 -2.57077E-01
-6 0 *********** SCCC-cys-met
- 1 6.40963E-03 -8.09148E-02
- 2 2.48432E-01 -1.35278E-01
- 3 -7.67158E-02 -2.09906E-01
- 4 -2.03279E-01 1.80072E-01
- 5 1.17018E-01 -7.28347E-02
- 6 -1.16434E-01 -2.55404E-01
-6 0 *********** SCCC-cys-phe
- 1 2.46957E-03 -6.90023E-02
- 2 2.82778E-01 -1.40088E-01
- 3 -5.93369E-02 -2.06898E-01
- 4 -2.07033E-01 1.72839E-01
- 5 1.29682E-01 -7.80802E-02
- 6 -1.24887E-01 -2.47229E-01
-6 0 *********** SCCC-cys-ile
- 1 5.17851E-02 -1.17234E-01
- 2 1.68169E-01 -1.89794E-01
- 3 -9.59141E-02 -2.27578E-01
- 4 -1.93878E-01 1.62680E-01
- 5 7.40516E-02 -6.99551E-02
- 6 -1.00504E-01 -2.37842E-01
-6 0 *********** SCCC-cys-leu
- 1 6.44195E-03 -7.49974E-02
- 2 1.99861E-01 -1.57652E-01
- 3 -7.86098E-02 -1.91358E-01
- 4 -2.05404E-01 2.00564E-01
- 5 1.23188E-01 -6.63393E-02
- 6 -1.08968E-01 -2.43074E-01
-6 0 *********** SCCC-cys-val
- 1 3.93569E-02 -9.96239E-02
- 2 1.45329E-01 -1.74471E-01
- 3 -8.40500E-02 -2.07350E-01
- 4 -1.82728E-01 1.67441E-01
- 5 7.94596E-02 -7.25319E-02
- 6 -1.01735E-01 -2.34355E-01
-6 0 *********** SCCC-cys-trp
- 1 1.11121E-02 -7.80568E-02
- 2 3.01485E-01 -1.43698E-01
- 3 -5.84868E-02 -2.18165E-01
- 4 -2.03775E-01 1.55923E-01
- 5 1.21116E-01 -8.21209E-02
- 6 -1.27457E-01 -2.46761E-01
-6 0 *********** SCCC-cys-tyr
- 1 1.92918E-03 -6.91731E-02
- 2 2.81784E-01 -1.38897E-01
- 3 -5.98217E-02 -2.06231E-01
- 4 -2.06598E-01 1.73506E-01
- 5 1.29844E-01 -7.77232E-02
- 6 -1.24495E-01 -2.47822E-01
-6 0 *********** SCCC-cys-ala
- 1 -3.55771E-02 -5.72553E-02
- 2 2.00780E-01 -5.32466E-02
- 3 -8.65932E-02 -1.79483E-01
- 4 -1.97823E-01 2.14875E-01
- 5 1.24288E-01 -6.63089E-02
- 6 -1.14348E-01 -2.83161E-01
-6 0 *********** SCCC-cys-gly
- 1 -8.99719E-01 -3.06730E-01
- 2 5.19510E-01 2.67231E-01
- 3 -1.24890E-01 4.30351E-02
- 4 3.79635E-02 9.73085E-02
- 5 -9.52232E-02 2.26545E-02
- 6 -3.94545E-02 -1.71337E-01
-6 0 *********** SCCC-cys-thr
- 1 2.31120E-02 -6.02100E-02
- 2 2.46281E-01 -1.62147E-01
- 3 -5.70137E-02 -2.11843E-01
- 4 -2.20818E-01 1.23064E-01
- 5 9.00645E-02 -6.72328E-02
- 6 -1.20063E-01 -2.02380E-01
-6 0 *********** SCCC-cys-ser
- 1 1.98782E-01 -1.89672E-01
- 2 4.88464E-01 -4.97095E-01
- 3 -4.16198E-02 -3.79945E-01
- 4 -3.24676E-01 2.52388E-02
- 5 8.39623E-02 -1.36651E-01
- 6 -2.00125E-01 -1.86076E-01
-6 0 *********** SCCC-cys-gln
- 1 1.64904E-02 -8.99450E-02
- 2 3.60622E-01 -1.39490E-01
- 3 -5.96330E-02 -2.47606E-01
- 4 -2.11874E-01 1.40631E-01
- 5 1.18551E-01 -9.01857E-02
- 6 -1.37465E-01 -2.63109E-01
-6 0 *********** SCCC-cys-asn
- 1 -1.43719E-02 -9.83107E-02
- 2 6.38476E-01 -3.38175E-02
- 3 -1.01279E-02 -3.39412E-01
- 4 -2.25531E-01 1.02705E-01
- 5 1.60814E-01 -1.35305E-01
- 6 -1.88797E-01 -3.61858E-01
-6 0 *********** SCCC-cys-glu
- 1 4.31092E-02 -9.64928E-02
- 2 3.60906E-01 -1.94302E-01
- 3 -5.09037E-02 -2.55149E-01
- 4 -2.18269E-01 1.27379E-01
- 5 1.15615E-01 -9.38484E-02
- 6 -1.39056E-01 -2.47579E-01
-6 0 *********** SCCC-cys-asp
- 1 -2.30799E-02 -7.27225E-02
- 2 4.92423E-01 -9.86162E-02
- 3 -3.52881E-02 -2.59979E-01
- 4 -2.35300E-01 1.57689E-01
- 5 1.83470E-01 -9.35041E-02
- 6 -1.58576E-01 -2.98743E-01
-6 0 *********** SCCC-cys-his
- 1 6.84440E-02 -1.23694E-01
- 2 5.52244E-01 -2.04733E-01
- 3 -2.98255E-02 -3.41767E-01
- 4 -2.53115E-01 7.43386E-02
- 5 1.24230E-01 -1.23824E-01
- 6 -1.78848E-01 -2.80315E-01
-6 0 *********** SCCC-cys-arg
- 1 -2.44467E-03 -7.29119E-02
- 2 2.13443E-01 -1.14090E-01
- 3 -7.85595E-02 -1.92981E-01
- 4 -1.92943E-01 1.95561E-01
- 5 1.20217E-01 -6.61456E-02
- 6 -1.06840E-01 -2.58793E-01
-6 0 *********** SCCC-cys-lys
- 1 -1.27507E-02 -6.55858E-02
- 2 2.10507E-01 -8.05734E-02
- 3 -7.88342E-02 -1.92996E-01
- 4 -1.90763E-01 1.92004E-01
- 5 1.12415E-01 -6.95885E-02
- 6 -1.11073E-01 -2.64765E-01
-6 0 *********** SCCC-cys-pro
- 1 -3.54862E+01 8.90582E+00
- 2 2.80923E+01 -1.54585E+01
- 3 -1.81830E+01 1.86800E+01
- 4 8.71081E+00 -1.55236E+01
- 5 -2.42838E+00 8.99693E+00
- 6 -5.91881E-02 3.38803E+01
-6 0 *********** SCCC-met-cys
- 1 -3.01780E-01 5.36752E-01
- 2 4.12826E-01 3.13283E-01
- 3 1.63130E-01 -6.23383E-01
- 4 -3.56692E-01 4.90048E-01
- 5 4.81576E-01 -3.05150E-01
- 6 -3.19432E-01 -9.00480E-01
-6 0 *********** SCCC-met-met
- 1 -2.05458E-01 5.08672E-01
- 2 1.77517E-01 3.38951E-01
- 3 1.81966E-03 -5.39532E-01
- 4 -3.35948E-01 4.16529E-01
- 5 3.30316E-01 -2.26759E-01
- 6 -2.90481E-01 -7.78197E-01
-6 0 *********** SCCC-met-phe
- 1 -2.95017E-01 5.24049E-01
- 2 2.13559E-01 3.43243E-01
- 3 2.95122E-02 -5.69379E-01
- 4 -3.72998E-01 4.63311E-01
- 5 3.78469E-01 -2.58749E-01
- 6 -3.12538E-01 -8.34500E-01
-6 0 *********** SCCC-met-ile
- 1 -2.97778E-02 4.82312E-01
- 2 1.24540E-01 3.16384E-01
- 3 -1.63750E-02 -5.33428E-01
- 4 -2.90218E-01 3.65926E-01
- 5 2.85073E-01 -2.01339E-01
- 6 -2.67080E-01 -7.12581E-01
-6 0 *********** SCCC-met-leu
- 1 -2.45210E-01 5.28864E-01
- 2 1.27561E-01 3.21685E-01
- 3 -8.73769E-03 -5.69825E-01
- 4 -3.61352E-01 4.42058E-01
- 5 3.37631E-01 -2.37909E-01
- 6 -3.03101E-01 -7.91291E-01
-6 0 *********** SCCC-met-val
- 1 -8.17187E-02 4.93353E-01
- 2 9.36645E-02 3.25929E-01
- 3 -3.03968E-02 -5.33621E-01
- 4 -3.07898E-01 3.87350E-01
- 5 2.97244E-01 -2.07227E-01
- 6 -2.73594E-01 -7.28796E-01
-6 0 *********** SCCC-met-trp
- 1 -2.38615E-01 5.01395E-01
- 2 2.43429E-01 3.47681E-01
- 3 3.49735E-02 -5.49332E-01
- 4 -3.47839E-01 4.39748E-01
- 5 3.72628E-01 -2.47904E-01
- 6 -3.00035E-01 -8.08803E-01
-6 0 *********** SCCC-met-tyr
- 1 -2.92155E-01 5.21545E-01
- 2 2.14184E-01 3.44644E-01
- 3 2.76088E-02 -5.67233E-01
- 4 -3.72167E-01 4.61644E-01
- 5 3.77353E-01 -2.57476E-01
- 6 -3.12068E-01 -8.28761E-01
-6 0 *********** SCCC-met-ala
- 1 -2.80922E-01 4.82109E-01
- 2 1.35929E-01 3.78662E-01
- 3 -5.17388E-02 -5.04868E-01
- 4 -3.55075E-01 4.16220E-01
- 5 3.16298E-01 -2.17961E-01
- 6 -2.90815E-01 -7.62101E-01
-6 0 *********** SCCC-met-gly
- 1 -2.76509E-01 -9.21319E-01
- 2 5.06576E-01 2.65583E-01
- 3 3.06408E-02 -2.33690E-01
- 4 -1.36523E-02 1.21184E-01
- 5 6.50258E-02 -6.27890E-02
- 6 -3.87783E-02 -4.94003E-01
-6 0 *********** SCCC-met-thr
- 1 -3.26799E-01 5.28057E-01
- 2 1.64509E-01 3.25958E-01
- 3 5.00554E-02 -6.05141E-01
- 4 -3.81937E-01 4.72134E-01
- 5 3.75722E-01 -2.85411E-01
- 6 -3.14617E-01 -8.86460E-01
-6 0 *********** SCCC-met-ser
- 1 -2.67091E-01 5.64875E-01
- 2 4.50976E-01 2.03132E-01
- 3 2.84953E-01 -8.24005E-01
- 4 -4.14014E-01 5.83641E-01
- 5 5.56754E-01 -4.19675E-01
- 6 -3.52117E-01 -1.12998E+00
-6 0 *********** SCCC-met-gln
- 1 -2.05798E-01 5.05993E-01
- 2 2.89515E-01 3.45515E-01
- 3 6.17780E-02 -5.37561E-01
- 4 -3.17029E-01 4.20197E-01
- 5 3.72094E-01 -2.39211E-01
- 6 -2.86645E-01 -7.89640E-01
-6 0 *********** SCCC-met-asn
- 1 -4.62900E-01 5.09093E-01
- 2 5.68065E-01 4.23279E-01
- 3 1.82972E-01 -5.40787E-01
- 4 -3.46702E-01 5.07400E-01
- 5 5.59241E-01 -2.91757E-01
- 6 -3.22591E-01 -9.07169E-01
-6 0 *********** SCCC-met-glu
- 1 -2.08419E-01 5.30320E-01
- 2 2.87787E-01 3.15021E-01
- 3 9.06310E-02 -5.74778E-01
- 4 -3.28203E-01 4.41985E-01
- 5 3.92925E-01 -2.58649E-01
- 6 -2.94719E-01 -8.24200E-01
-6 0 *********** SCCC-met-asp
- 1 -5.59083E-01 5.17660E-01
- 2 4.44708E-01 4.08082E-01
- 3 1.30859E-01 -6.69641E-01
- 4 -4.58187E-01 5.82180E-01
- 5 5.62139E-01 -3.50621E-01
- 6 -3.84406E-01 -1.07305E+00
-6 0 *********** SCCC-met-his
- 1 -2.64054E-01 5.70729E-01
- 2 4.48676E-01 2.99134E-01
- 3 2.10458E-01 -5.78350E-01
- 4 -3.05617E-01 4.65948E-01
- 5 4.70184E-01 -2.86594E-01
- 6 -2.85875E-01 -8.38436E-01
-6 0 *********** SCCC-met-arg
- 1 -2.14506E-01 5.08442E-01
- 2 1.44051E-01 3.49230E-01
- 3 -1.81400E-02 -5.28486E-01
- 4 -3.38072E-01 4.17722E-01
- 5 3.21811E-01 -2.19762E-01
- 6 -2.88684E-01 -7.61195E-01
-6 0 *********** SCCC-met-lys
- 1 -2.26564E-01 5.06338E-01
- 2 1.32927E-01 3.67585E-01
- 3 -2.97057E-02 -5.08657E-01
- 4 -3.36240E-01 4.11839E-01
- 5 3.09527E-01 -2.13695E-01
- 6 -2.84749E-01 -7.50768E-01
-6 0 *********** SCCC-met-pro
- 1 -3.06216E+01 6.99962E+00
- 2 2.52794E+01 -1.31802E+01
- 3 -1.58023E+01 1.61761E+01
- 4 7.90152E+00 -1.39296E+01
- 5 -1.72751E+00 8.17312E+00
- 6 -1.90027E-01 2.87699E+01
-6 0 *********** SCCC-phe-cys
- 1 5.62736E-01 1.04786E+00
- 2 1.20811E-01 3.63352E-01
- 3 -3.34295E-02 -2.50754E-01
- 4 -2.69925E-01 2.50906E-01
- 5 1.41579E-01 -1.46389E-01
- 6 -1.77888E-01 -3.57024E-01
-6 0 *********** SCCC-phe-met
- 1 4.26193E-01 8.81392E-01
- 2 -7.23208E-03 5.11026E-01
- 3 -2.08569E-01 -2.20018E-01
- 4 -3.38093E-01 2.68202E-01
- 5 1.43968E-01 -1.53454E-01
- 6 -1.92996E-01 -4.43327E-01
-6 0 *********** SCCC-phe-phe
- 1 3.88862E-01 9.60538E-01
- 2 -4.23310E-02 4.67080E-01
- 3 -1.75250E-01 -2.36248E-01
- 4 -3.30159E-01 2.76872E-01
- 5 1.37983E-01 -1.50849E-01
- 6 -1.93462E-01 -4.33610E-01
-6 0 *********** SCCC-phe-ile
- 1 5.72607E-01 7.68745E-01
- 2 4.88185E-02 5.80985E-01
- 3 -2.31055E-01 -2.24889E-01
- 4 -3.48304E-01 2.82660E-01
- 5 1.50752E-01 -1.62104E-01
- 6 -2.02885E-01 -5.00246E-01
-6 0 *********** SCCC-phe-leu
- 1 3.91578E-01 9.45717E-01
- 2 -1.15507E-01 5.22986E-01
- 3 -2.51639E-01 -2.61998E-01
- 4 -3.46071E-01 2.61080E-01
- 5 1.65105E-01 -1.69832E-01
- 6 -1.88196E-01 -4.73010E-01
-6 0 *********** SCCC-phe-val
- 1 5.03556E-01 7.96803E-01
- 2 -1.66325E-02 5.87650E-01
- 3 -2.49792E-01 -2.37551E-01
- 4 -3.53604E-01 2.82476E-01
- 5 1.63603E-01 -1.72472E-01
- 6 -2.01254E-01 -5.21849E-01
-6 0 *********** SCCC-phe-trp
- 1 4.28126E-01 8.77309E-01
- 2 4.87514E-02 4.53685E-01
- 3 -1.37288E-01 -2.13143E-01
- 4 -3.20095E-01 2.88101E-01
- 5 1.32245E-01 -1.40251E-01
- 6 -1.98661E-01 -4.22537E-01
-6 0 *********** SCCC-phe-tyr
- 1 3.88218E-01 9.51717E-01
- 2 -3.58923E-02 4.66211E-01
- 3 -1.72971E-01 -2.32225E-01
- 4 -3.30818E-01 2.79730E-01
- 5 1.36602E-01 -1.49473E-01
- 6 -1.94379E-01 -4.24751E-01
-6 0 *********** SCCC-phe-ala
- 1 2.55458E-01 8.15015E-01
- 2 -4.51587E-02 4.79954E-01
- 3 -2.08805E-01 -2.03016E-01
- 4 -3.33866E-01 2.81987E-01
- 5 1.40177E-01 -1.41592E-01
- 6 -1.93078E-01 -4.39787E-01
-6 0 *********** SCCC-phe-gly
- 1 -3.86494E-01 -1.48424E+00
- 2 3.24905E-01 -3.87422E-02
- 3 -1.29073E-01 -3.58128E-01
- 4 -1.08789E-01 1.40002E-01
- 5 8.16376E-02 -1.18575E-01
- 6 -1.10887E-01 -6.06428E-01
-6 0 *********** SCCC-phe-thr
- 1 3.19424E-01 9.80432E-01
- 2 -1.64358E-01 4.20044E-01
- 3 -1.90102E-01 -3.55953E-01
- 4 -2.84628E-01 2.16596E-01
- 5 1.59156E-01 -1.61977E-01
- 6 -1.76591E-01 -4.39485E-01
-6 0 *********** SCCC-phe-ser
- 1 8.90027E-01 1.22895E+00
- 2 9.14301E-02 3.29414E-01
- 3 5.02864E-02 -4.50696E-01
- 4 -1.65287E-01 2.31000E-01
- 5 2.17641E-01 -1.62464E-01
- 6 -1.74819E-01 -4.17520E-01
-6 0 *********** SCCC-phe-gln
- 1 4.96136E-01 8.94718E-01
- 2 1.14712E-01 4.62575E-01
- 3 -1.22486E-01 -1.97607E-01
- 4 -3.06351E-01 2.64405E-01
- 5 1.32663E-01 -1.38198E-01
- 6 -1.90748E-01 -3.96121E-01
-6 0 *********** SCCC-phe-asn
- 1 3.71138E-01 1.03914E+00
- 2 2.42518E-01 2.61000E-01
- 3 7.98518E-02 -1.58115E-01
- 4 -2.14977E-01 2.38309E-01
- 5 1.37618E-01 -1.15462E-01
- 6 -1.46034E-01 -2.43843E-01
-6 0 *********** SCCC-phe-glu
- 1 5.52266E-01 9.69128E-01
- 2 7.38434E-02 4.69791E-01
- 3 -1.26632E-01 -2.34747E-01
- 4 -3.04414E-01 2.59399E-01
- 5 1.44178E-01 -1.50510E-01
- 6 -1.89383E-01 -4.13418E-01
-6 0 *********** SCCC-phe-asp
- 1 3.22985E-01 1.15989E+00
- 2 -1.46185E-02 2.93775E-01
- 3 -4.01305E-02 -2.40166E-01
- 4 -2.90918E-01 2.58059E-01
- 5 1.11870E-01 -1.48253E-01
- 6 -1.63544E-01 -3.18868E-01
-6 0 *********** SCCC-phe-his
- 1 6.55475E-01 1.14317E+00
- 2 1.69105E-01 4.08599E-01
- 3 -9.38497E-03 -2.41840E-01
- 4 -2.15868E-01 2.20551E-01
- 5 1.66436E-01 -1.33832E-01
- 6 -1.56176E-01 -3.18403E-01
-6 0 *********** SCCC-phe-arg
- 1 3.90077E-01 8.75619E-01
- 2 -3.88447E-02 5.28799E-01
- 3 -2.24470E-01 -2.18291E-01
- 4 -3.38578E-01 2.73160E-01
- 5 1.50688E-01 -1.54281E-01
- 6 -1.91212E-01 -4.58614E-01
-6 0 *********** SCCC-phe-lys
- 1 3.59006E-01 8.73322E-01
- 2 -4.47749E-02 5.43684E-01
- 3 -2.34643E-01 -2.07829E-01
- 4 -3.41267E-01 2.66591E-01
- 5 1.43842E-01 -1.53896E-01
- 6 -1.90224E-01 -4.42073E-01
-6 0 *********** SCCC-phe-pro
- 1 -1.42086E+01 1.77362E+00
- 2 1.24527E+01 -6.76589E+00
- 3 -7.32196E+00 7.04425E+00
- 4 3.47537E+00 -6.70933E+00
- 5 -7.01907E-01 3.63147E+00
- 6 -2.79033E-01 1.33553E+01
-6 0 *********** SCCC-ile-cys
- 1 -9.06482E-02 3.06526E-01
- 2 4.73714E-01 -4.32743E-01
- 3 -3.89692E-01 -1.97297E-01
- 4 3.68788E-01 1.85061E-02
- 5 -5.30473E-01 -5.35170E-02
- 6 1.98534E-01 3.15889E-02
-6 0 *********** SCCC-ile-met
- 1 -4.70288E-02 2.77782E-01
- 2 2.56609E-01 -2.20614E-01
- 3 -3.71185E-01 -1.03354E-01
- 4 2.98581E-01 4.33961E-02
- 5 -3.85196E-01 -1.53739E-03
- 6 1.45764E-01 2.41653E-02
-6 0 *********** SCCC-ile-phe
- 1 -6.95791E-02 3.09726E-01
- 2 2.70410E-01 -2.49908E-01
- 3 -3.55388E-01 -1.11042E-01
- 4 3.06779E-01 5.00167E-02
- 5 -3.99266E-01 -9.78447E-03
- 6 1.53915E-01 2.60592E-02
-6 0 *********** SCCC-ile-ile
- 1 1.67046E-02 2.01920E-01
- 2 2.21628E-01 -2.00331E-01
- 3 -4.25387E-01 -1.19355E-01
- 4 2.95960E-01 2.49516E-02
- 5 -3.98268E-01 7.03663E-03
- 6 1.41153E-01 2.75675E-02
-6 0 *********** SCCC-ile-leu
- 1 -4.69683E-02 2.95297E-01
- 2 1.89376E-01 -2.05614E-01
- 3 -3.69213E-01 -1.00382E-01
- 4 2.96749E-01 5.43458E-02
- 5 -3.74389E-01 4.98680E-03
- 6 1.40244E-01 3.35776E-02
-6 0 *********** SCCC-ile-val
- 1 6.77440E-04 2.25469E-01
- 2 1.91904E-01 -1.74263E-01
- 3 -4.11560E-01 -1.05900E-01
- 4 2.95083E-01 2.91144E-02
- 5 -3.89410E-01 5.43783E-03
- 6 1.38324E-01 2.76631E-02
-6 0 *********** SCCC-ile-trp
- 1 -6.34676E-02 2.86027E-01
- 2 3.12959E-01 -2.62544E-01
- 3 -3.69513E-01 -1.18723E-01
- 4 3.16352E-01 3.78559E-02
- 5 -4.16528E-01 -1.43969E-02
- 6 1.59867E-01 3.23977E-02
-6 0 *********** SCCC-ile-tyr
- 1 -6.97422E-02 3.08402E-01
- 2 2.71268E-01 -2.48563E-01
- 3 -3.55867E-01 -1.10027E-01
- 4 3.07072E-01 4.98213E-02
- 5 -3.98853E-01 -9.64549E-03
- 6 1.54006E-01 1.82873E-02
-6 0 *********** SCCC-ile-ala
- 1 -7.30355E-02 2.97628E-01
- 2 2.03818E-01 -1.40547E-01
- 3 -3.33907E-01 -5.53480E-02
- 4 2.59665E-01 5.62984E-02
- 5 -3.32511E-01 3.85827E-03
- 6 1.22431E-01 3.24782E-02
-6 0 *********** SCCC-ile-gly
- 1 -7.77069E-01 -4.78662E-01
- 2 5.65410E-01 3.13515E-02
- 3 -6.66011E-02 -2.14325E-01
- 4 -5.93211E-03 5.93862E-02
- 5 4.84755E-02 -6.40522E-02
- 6 -5.03652E-02 -2.93044E-01
-6 0 *********** SCCC-ile-thr
- 1 -4.62156E-02 3.09758E-01
- 2 2.10482E-01 -2.30955E-01
- 3 -3.43062E-01 -1.25088E-01
- 4 2.57377E-01 5.71369E-02
- 5 -3.92084E-01 -5.07925E-03
- 6 1.32803E-01 2.78824E-02
-6 0 *********** SCCC-ile-ser
- 1 -9.35681E-02 2.47429E-01
- 2 5.61682E-01 -6.24156E-01
- 3 -5.73157E-01 -3.60078E-01
- 4 4.84501E-01 -3.23809E-02
- 5 -7.93399E-01 -8.93653E-02
- 6 2.45691E-01 1.19833E-02
-6 0 *********** SCCC-ile-gln
- 1 -6.15355E-02 2.77919E-01
- 2 3.77561E-01 -2.95386E-01
- 3 -3.74191E-01 -1.33565E-01
- 4 3.24465E-01 2.58384E-02
- 5 -4.33676E-01 -2.08755E-02
- 6 1.65280E-01 4.94663E-02
-6 0 *********** SCCC-ile-asn
- 1 -1.71793E-01 3.57789E-01
- 2 6.42507E-01 -4.15485E-01
- 3 -3.14277E-01 -1.44138E-01
- 4 3.65341E-01 7.27856E-03
- 5 -4.92921E-01 -7.13500E-02
- 6 2.00846E-01 5.69640E-02
-6 0 *********** SCCC-ile-glu
- 1 -5.53419E-02 2.80598E-01
- 2 3.71533E-01 -3.30905E-01
- 3 -3.92671E-01 -1.61189E-01
- 4 3.42084E-01 2.36931E-02
- 5 -4.66633E-01 -2.51863E-02
- 6 1.73998E-01 2.59762E-02
-6 0 *********** SCCC-ile-asp
- 1 -1.28191E-01 3.73836E-01
- 2 4.24434E-01 -3.79418E-01
- 3 -2.98778E-01 -1.32485E-01
- 4 3.11695E-01 5.45769E-02
- 5 -4.35127E-01 -4.66159E-02
- 6 1.77902E-01 4.77835E-02
-6 0 *********** SCCC-ile-his
- 1 -1.01933E-01 3.07532E-01
- 2 5.62819E-01 -4.55388E-01
- 3 -3.94388E-01 -2.13715E-01
- 4 3.87996E-01 -5.04240E-05
- 5 -5.58396E-01 -6.36935E-02
- 6 2.04482E-01 4.23809E-02
-6 0 *********** SCCC-ile-arg
- 1 -5.15008E-02 2.82264E-01
- 2 2.30327E-01 -1.84639E-01
- 3 -3.66201E-01 -8.80618E-02
- 4 2.94458E-01 4.57293E-02
- 5 -3.69877E-01 2.03339E-03
- 6 1.39599E-01 4.09605E-02
-6 0 *********** SCCC-ile-lys
- 1 -5.65761E-02 2.86599E-01
- 2 2.27566E-01 -1.58025E-01
- 3 -3.53513E-01 -7.51403E-02
- 4 2.77978E-01 4.72638E-02
- 5 -3.55384E-01 2.91141E-03
- 6 1.31825E-01 3.52149E-02
-6 0 *********** SCCC-ile-pro
- 1 -2.90830E+01 -5.25163E-01
- 2 1.73873E+01 6.84163E-02
- 3 2.13198E-01 1.12906E-01
- 4 -1.56796E+01 -1.79716E-01
- 5 2.77503E+01 1.06571E-01
- 6 -1.58066E+01 -5.23707E-02
-6 0 *********** SCCC-leu-cys
- 1 1.82689E-01 6.61723E-01
- 2 1.45335E-01 -3.83929E-01
- 3 -1.63053E-01 -2.08538E-01
- 4 8.34856E-02 2.60962E-02
- 5 -2.53232E-01 -5.58680E-02
- 6 5.45046E-02 6.94273E-02
-6 0 *********** SCCC-leu-met
- 1 1.49410E-01 5.75606E-01
- 2 6.91954E-02 -1.21745E-01
- 3 -3.04426E-01 -9.01305E-02
- 4 1.38974E-01 4.71152E-02
- 5 -2.34761E-01 -3.05869E-03
- 6 7.30624E-02 5.28832E-02
-6 0 *********** SCCC-leu-phe
- 1 1.16985E-01 6.31897E-01
- 2 5.30040E-02 -1.73279E-01
- 3 -2.57166E-01 -1.00380E-01
- 4 1.27192E-01 6.73332E-02
- 5 -2.41746E-01 -1.42924E-02
- 6 7.40644E-02 4.74807E-02
-6 0 *********** SCCC-leu-ile
- 1 2.51741E-01 4.87632E-01
- 2 5.93123E-02 -7.34831E-02
- 3 -3.75411E-01 -1.10380E-01
- 4 1.65097E-01 2.25079E-02
- 5 -2.57908E-01 6.03095E-03
- 6 8.19231E-02 3.48478E-02
-6 0 *********** SCCC-leu-leu
- 1 1.33496E-01 6.13415E-01
- 2 -6.58440E-03 -1.12905E-01
- 3 -3.13647E-01 -8.65109E-02
- 4 1.46109E-01 6.86339E-02
- 5 -2.42828E-01 2.19112E-03
- 6 7.61703E-02 5.58780E-02
-6 0 *********** SCCC-leu-val
- 1 2.17695E-01 5.17836E-01
- 2 2.72232E-02 -5.34491E-02
- 3 -3.66078E-01 -9.13391E-02
- 4 1.66183E-01 3.52496E-02
- 5 -2.64789E-01 2.97273E-03
- 6 8.32752E-02 3.05015E-02
-6 0 *********** SCCC-leu-trp
- 1 1.48129E-01 5.88059E-01
- 2 1.01082E-01 -1.78913E-01
- 3 -2.58325E-01 -1.05970E-01
- 4 1.25811E-01 4.84123E-02
- 5 -2.41842E-01 -1.91537E-02
- 6 7.31110E-02 4.73471E-02
-6 0 *********** SCCC-leu-tyr
- 1 1.17435E-01 6.28308E-01
- 2 5.56951E-02 -1.71437E-01
- 3 -2.58090E-01 -9.82451E-02
- 4 1.27061E-01 6.68122E-02
- 5 -2.41126E-01 -1.43671E-02
- 6 7.42543E-02 5.85918E-02
-6 0 *********** SCCC-leu-ala
- 1 6.25619E-02 5.72521E-01
- 2 6.39324E-02 -5.25259E-02
- 3 -3.12947E-01 -2.70696E-02
- 4 1.29353E-01 6.41332E-02
- 5 -2.29307E-01 -2.65277E-04
- 6 6.92854E-02 5.45214E-02
-6 0 *********** SCCC-leu-gly
- 1 -5.07454E-01 -7.12336E-01
- 2 6.21750E-01 -1.43399E-01
- 3 -5.20535E-02 -2.12833E-01
- 4 7.12664E-02 1.36647E-02
- 5 5.97499E-02 -6.67030E-02
- 6 -1.78196E-02 -2.40561E-01
-6 0 *********** SCCC-leu-thr
- 1 9.60331E-02 6.50755E-01
- 2 2.56458E-03 -1.64702E-01
- 3 -2.70905E-01 -1.49122E-01
- 4 1.32041E-01 9.33707E-02
- 5 -2.95369E-01 -1.48786E-02
- 6 8.31390E-02 7.03886E-03
-6 0 *********** SCCC-leu-ser
- 1 3.32853E-01 7.31043E-01
- 2 -1.29113E-02 -6.28811E-01
- 3 -1.11877E-01 -3.96711E-01
- 4 3.39903E-02 4.16725E-02
- 5 -3.85526E-01 -1.25008E-01
- 6 4.86841E-02 -3.76682E-03
-6 0 *********** SCCC-leu-gln
- 1 1.71457E-01 5.75117E-01
- 2 1.56209E-01 -2.06167E-01
- 3 -2.50126E-01 -1.29722E-01
- 4 1.21688E-01 2.16208E-02
- 5 -2.30293E-01 -2.07333E-02
- 6 6.35899E-02 6.98307E-02
-6 0 *********** SCCC-leu-asn
- 1 3.58694E-02 6.95532E-01
- 2 3.31508E-01 -4.07236E-01
- 3 -6.80974E-02 -1.57478E-01
- 4 5.93611E-02 4.16173E-03
- 5 -1.98546E-01 -7.19475E-02
- 6 3.75504E-02 1.10659E-01
-6 0 *********** SCCC-leu-glu
- 1 1.97783E-01 6.05729E-01
- 2 1.11591E-01 -2.46386E-01
- 3 -2.40107E-01 -1.64984E-01
- 4 1.24724E-01 2.80708E-02
- 5 -2.47436E-01 -2.46564E-02
- 6 6.46178E-02 5.35425E-02
-6 0 *********** SCCC-leu-asp
- 1 2.18484E-02 7.58889E-01
- 2 1.34036E-01 -3.72637E-01
- 3 -1.11032E-01 -1.35427E-01
- 4 6.24580E-02 8.13465E-02
- 5 -2.23117E-01 -6.05562E-02
- 6 6.38299E-02 7.99218E-02
-6 0 *********** SCCC-leu-his
- 1 1.94226E-01 6.65303E-01
- 2 2.07196E-01 -3.99651E-01
- 3 -1.48655E-01 -2.47027E-01
- 4 9.76349E-02 -6.06183E-03
- 5 -2.43279E-01 -4.99361E-02
- 6 3.71873E-02 8.17822E-02
-6 0 *********** SCCC-leu-arg
- 1 1.31589E-01 5.77691E-01
- 2 5.42293E-02 -8.45056E-02
- 3 -3.13232E-01 -7.04597E-02
- 4 1.47457E-01 5.25674E-02
- 5 -2.35376E-01 -2.01349E-03
- 6 7.53322E-02 5.25001E-02
-6 0 *********** SCCC-leu-lys
- 1 1.08323E-01 5.75368E-01
- 2 6.66998E-02 -5.76889E-02
- 3 -3.16971E-01 -5.89524E-02
- 4 1.45904E-01 5.32025E-02
- 5 -2.36424E-01 1.66523E-03
- 6 7.31761E-02 5.24056E-02
-6 0 *********** SCCC-leu-pro
- 1 -2.95936E+01 -8.13497E+00
- 2 2.54209E+01 1.34203E+01
- 3 -1.50359E+01 -1.49607E+01
- 4 7.74638E+00 1.35518E+01
- 5 -1.72657E+00 -7.45364E+00
- 6 -2.19544E-01 -2.85411E+01
-6 0 *********** SCCC-val-cys
- 1 8.00832E-01 1.11313E+00
- 2 2.17101E-01 3.95667E-01
- 3 -1.05806E-01 -1.53294E-01
- 4 -3.87639E-01 3.12485E-01
- 5 2.41862E-02 -9.52883E-02
- 6 -2.33532E-01 -3.11032E-01
-6 0 *********** SCCC-val-met
- 1 6.82733E-01 1.01959E+00
- 2 2.21384E-02 5.68410E-01
- 3 -2.91292E-01 -2.10435E-03
- 4 -3.93133E-01 3.31397E-01
- 5 -1.52095E-02 -4.32610E-02
- 6 -2.04752E-01 -2.75562E-01
-6 0 *********** SCCC-val-phe
- 1 6.35410E-01 1.09440E+00
- 2 -1.41673E-03 5.24116E-01
- 3 -2.49341E-01 -2.12621E-02
- 4 -3.98756E-01 3.46745E-01
- 5 -1.73237E-02 -4.91361E-02
- 6 -2.14567E-01 -2.73952E-01
-6 0 *********** SCCC-val-ile
- 1 8.88508E-01 9.30617E-01
- 2 6.05838E-02 6.18320E-01
- 3 -3.17116E-01 4.67575E-02
- 4 -3.83531E-01 3.31939E-01
- 5 -6.79469E-02 -1.93742E-02
- 6 -1.98734E-01 -2.68255E-01
-6 0 *********** SCCC-val-leu
- 1 6.69095E-01 1.11535E+00
- 2 -1.09749E-01 5.86002E-01
- 3 -3.49277E-01 -1.11956E-02
- 4 -4.02386E-01 3.18310E-01
- 5 -7.25214E-03 -5.34410E-02
- 6 -1.89001E-01 -2.69876E-01
-6 0 *********** SCCC-val-val
- 1 8.21720E-01 9.74747E-01
- 2 -1.34219E-02 6.27391E-01
- 3 -3.33221E-01 5.18120E-02
- 4 -3.83662E-01 3.18949E-01
- 5 -6.53774E-02 -3.16696E-02
- 6 -1.96307E-01 -2.63360E-01
-6 0 *********** SCCC-val-trp
- 1 6.51842E-01 9.79381E-01
- 2 9.07931E-02 4.74654E-01
- 3 -1.99423E-01 -3.29161E-02
- 4 -3.69585E-01 3.35195E-01
- 5 -5.54390E-03 -4.75149E-02
- 6 -2.12448E-01 -2.79979E-01
-6 0 *********** SCCC-val-tyr
- 1 6.33199E-01 1.08315E+00
- 2 5.78338E-03 5.21194E-01
- 3 -2.45650E-01 -1.75165E-02
- 4 -3.98129E-01 3.49843E-01
- 5 -1.81537E-02 -4.72674E-02
- 6 -2.15142E-01 -2.82477E-01
-6 0 *********** SCCC-val-ala
- 1 4.60554E-01 9.27295E-01
- 2 -2.12472E-02 5.12717E-01
- 3 -2.72683E-01 -9.24481E-03
- 4 -3.67425E-01 3.37906E-01
- 5 5.93982E-03 -3.92029E-02
- 6 -1.97185E-01 -2.83221E-01
-6 0 *********** SCCC-val-gly
- 1 -4.86806E-01 -1.53153E+00
- 2 3.94205E-01 -1.70152E-01
- 3 -2.27152E-01 -2.17713E-01
- 4 -7.88180E-03 1.17063E-01
- 5 2.11058E-02 -3.41489E-02
- 6 -4.65275E-02 -4.17365E-01
-6 0 *********** SCCC-val-thr
- 1 5.29657E-01 1.12563E+00
- 2 -2.05541E-01 4.11231E-01
- 3 -2.92544E-01 -2.14031E-01
- 4 -3.28553E-01 1.64674E-01
- 5 4.90184E-02 -1.02758E-01
- 6 -1.39771E-01 -2.51991E-01
-6 0 *********** SCCC-val-ser
- 1 1.33215E+00 1.30633E+00
- 2 2.34878E-01 2.72101E-01
- 3 -1.11535E-02 -3.56899E-01
- 4 -2.80237E-01 2.33424E-01
- 5 6.08041E-02 -1.27302E-01
- 6 -2.03272E-01 -3.21272E-01
-6 0 *********** SCCC-val-gln
- 1 7.31603E-01 9.92853E-01
- 2 1.80112E-01 5.13236E-01
- 3 -1.92179E-01 -4.35785E-02
- 4 -3.78467E-01 3.25224E-01
- 5 2.32679E-03 -5.66945E-02
- 6 -2.22093E-01 -2.99824E-01
-6 0 *********** SCCC-val-asn
- 1 4.93846E-01 1.01398E+00
- 2 3.98892E-01 2.91547E-01
- 3 5.82251E-02 -2.30716E-01
- 4 -3.64739E-01 2.98368E-01
- 5 1.10884E-01 -1.48590E-01
- 6 -2.46003E-01 -3.72811E-01
-6 0 *********** SCCC-val-glu
- 1 8.24553E-01 1.09173E+00
- 2 1.35240E-01 5.27544E-01
- 3 -2.06300E-01 -5.27107E-02
- 4 -3.87510E-01 3.21258E-01
- 5 -1.06841E-02 -6.15764E-02
- 6 -2.21645E-01 -2.89693E-01
-6 0 *********** SCCC-val-asp
- 1 5.09520E-01 1.24510E+00
- 2 1.02666E-01 4.07419E-01
- 3 -9.87052E-02 -1.12490E-01
- 4 -4.47943E-01 4.06738E-01
- 5 2.26632E-02 -9.71246E-02
- 6 -2.39450E-01 -3.45170E-01
-6 0 *********** SCCC-val-his
- 1 9.63831E-01 1.23306E+00
- 2 3.13947E-01 5.06482E-01
- 3 -8.28701E-02 -1.66336E-01
- 4 -3.70574E-01 3.04856E-01
- 5 3.83417E-02 -9.80156E-02
- 6 -2.40786E-01 -3.41551E-01
-6 0 *********** SCCC-val-arg
- 1 6.46155E-01 1.02135E+00
- 2 -1.80402E-02 5.83940E-01
- 3 -3.03968E-01 1.06208E-02
- 4 -3.81791E-01 3.33161E-01
- 5 -8.70441E-03 -3.89505E-02
- 6 -1.94363E-01 -2.73490E-01
-6 0 *********** SCCC-val-lys
- 1 6.17618E-01 1.02630E+00
- 2 -1.84483E-02 6.14428E-01
- 3 -3.14126E-01 2.08371E-02
- 4 -3.91659E-01 3.27774E-01
- 5 -2.39671E-02 -4.27168E-02
- 6 -2.00647E-01 -2.78894E-01
-6 0 *********** SCCC-val-pro
- 1 -4.76439E+01 -2.71010E+00
- 2 3.53401E+01 -7.48312E-01
- 3 -1.67057E+01 4.63748E-02
- 4 -4.31729E-01 -7.08512E-01
- 5 1.23807E+01 9.40533E-02
- 6 -8.50442E+00 2.38787E-01
-6 0 *********** SCCC-trp-cys
- 1 3.37649E-01 9.09889E-01
- 2 2.86174E-01 7.58962E-01
- 3 -2.02931E-02 -5.34232E-01
- 4 -4.46189E-01 5.70288E-01
- 5 4.19880E-01 -3.04817E-01
- 6 -3.56946E-01 -1.01318E+00
-6 0 *********** SCCC-trp-met
- 1 2.47398E-01 7.62366E-01
- 2 1.06479E-01 7.43559E-01
- 3 -1.91251E-01 -4.34464E-01
- 4 -4.56574E-01 4.57902E-01
- 5 3.33909E-01 -2.75793E-01
- 6 -3.09010E-01 -8.69081E-01
-6 0 *********** SCCC-trp-phe
- 1 1.78922E-01 8.24870E-01
- 2 8.47641E-02 7.50405E-01
- 3 -1.68434E-01 -5.01025E-01
- 4 -4.67714E-01 4.99484E-01
- 5 3.72017E-01 -2.95722E-01
- 6 -3.29404E-01 -9.49312E-01
-6 0 *********** SCCC-trp-ile
- 1 4.47921E-01 6.79002E-01
- 2 1.51899E-01 7.52962E-01
- 3 -2.06371E-01 -3.56420E-01
- 4 -4.36025E-01 4.26899E-01
- 5 2.72879E-01 -2.42961E-01
- 6 -2.91889E-01 -8.10199E-01
-6 0 *********** SCCC-trp-leu
- 1 2.03976E-01 8.20070E-01
- 2 2.80079E-03 7.65309E-01
- 3 -2.44485E-01 -4.94975E-01
- 4 -4.68023E-01 4.41083E-01
- 5 3.69494E-01 -3.05596E-01
- 6 -3.02606E-01 -9.26160E-01
-6 0 *********** SCCC-trp-val
- 1 3.67124E-01 6.99197E-01
- 2 8.36434E-02 7.57620E-01
- 3 -2.31891E-01 -3.88297E-01
- 4 -4.40733E-01 4.20966E-01
- 5 2.99445E-01 -2.61174E-01
- 6 -2.86252E-01 -8.42604E-01
-6 0 *********** SCCC-trp-trp
- 1 2.30271E-01 7.50229E-01
- 2 1.71560E-01 7.22312E-01
- 3 -1.22583E-01 -4.55072E-01
- 4 -4.50360E-01 5.11055E-01
- 5 3.47353E-01 -2.70500E-01
- 6 -3.31030E-01 -9.03172E-01
-6 0 *********** SCCC-trp-tyr
- 1 1.78834E-01 8.16387E-01
- 2 9.07623E-02 7.47537E-01
- 3 -1.65156E-01 -4.95962E-01
- 4 -4.67431E-01 5.02163E-01
- 5 3.68875E-01 -2.92992E-01
- 6 -3.30262E-01 -9.36530E-01
-6 0 *********** SCCC-trp-ala
- 1 6.86380E-02 6.92189E-01
- 2 5.63145E-02 6.91403E-01
- 3 -1.90592E-01 -4.34094E-01
- 4 -4.43969E-01 4.57393E-01
- 5 3.35512E-01 -2.66348E-01
- 6 -3.04003E-01 -8.68638E-01
-6 0 *********** SCCC-trp-gly
- 1 -3.45354E-01 -1.54306E+00
- 2 2.11460E-01 -5.44853E-02
- 3 -1.36962E-01 -3.27616E-01
- 4 -1.09838E-01 9.20244E-02
- 5 2.45033E-02 -1.15751E-01
- 6 -1.00027E-01 -5.58324E-01
-6 0 *********** SCCC-trp-thr
- 1 8.99073E-02 8.26441E-01
- 2 -2.52994E-02 7.09003E-01
- 3 -1.90315E-01 -6.33005E-01
- 4 -4.17490E-01 4.41903E-01
- 5 4.18769E-01 -3.18521E-01
- 6 -3.14079E-01 -9.67357E-01
-6 0 *********** SCCC-trp-ser
- 1 7.42704E-01 1.12034E+00
- 2 3.83798E-01 9.17963E-01
- 3 6.60610E-02 -7.08740E-01
- 4 -3.70109E-01 6.38153E-01
- 5 5.59051E-01 -3.31966E-01
- 6 -3.85606E-01 -1.18095E+00
-6 0 *********** SCCC-trp-gln
- 1 3.10196E-01 7.76165E-01
- 2 2.39625E-01 7.40437E-01
- 3 -1.01625E-01 -4.18185E-01
- 4 -4.43114E-01 5.02142E-01
- 5 3.38783E-01 -2.62519E-01
- 6 -3.27065E-01 -8.80261E-01
-6 0 *********** SCCC-trp-asn
- 1 1.22021E-01 8.86028E-01
- 2 3.80031E-01 6.55884E-01
- 3 9.93551E-02 -4.81570E-01
- 4 -3.95301E-01 5.80544E-01
- 5 4.56302E-01 -2.86007E-01
- 6 -3.32539E-01 -9.52488E-01
-6 0 *********** SCCC-trp-glu
- 1 3.67498E-01 8.51136E-01
- 2 2.12658E-01 7.78789E-01
- 3 -1.14620E-01 -4.57853E-01
- 4 -4.52338E-01 5.08623E-01
- 5 3.58685E-01 -2.81119E-01
- 6 -3.32412E-01 -9.23366E-01
-6 0 *********** SCCC-trp-asp
- 1 3.25471E-02 9.79745E-01
- 2 1.41385E-01 7.15914E-01
- 3 -4.34295E-02 -6.35287E-01
- 4 -4.81601E-01 5.85842E-01
- 5 4.66118E-01 -3.51560E-01
- 6 -3.64698E-01 -1.08730E+00
-6 0 *********** SCCC-trp-his
- 1 5.04062E-01 1.05289E+00
- 2 3.49783E-01 8.54838E-01
- 3 -4.76426E-03 -4.41925E-01
- 4 -4.22115E-01 5.66702E-01
- 5 4.02071E-01 -2.74061E-01
- 6 -3.44885E-01 -9.43163E-01
-6 0 *********** SCCC-trp-arg
- 1 2.14940E-01 7.57486E-01
- 2 7.02036E-02 7.47202E-01
- 3 -2.09561E-01 -4.30390E-01
- 4 -4.52958E-01 4.48647E-01
- 5 3.33891E-01 -2.75377E-01
- 6 -3.02099E-01 -8.70498E-01
-6 0 *********** SCCC-trp-lys
- 1 1.87248E-01 7.57461E-01
- 2 5.84439E-02 7.51977E-01
- 3 -2.19657E-01 -4.13751E-01
- 4 -4.51601E-01 4.36660E-01
- 5 3.25226E-01 -2.71906E-01
- 6 -2.96126E-01 -8.65398E-01
-6 0 *********** SCCC-trp-pro
- 1 2.05089E+00 -2.11116E+00
- 2 -1.06341E+00 -1.79907E+00
- 3 1.23995E+00 1.13593E+00
- 4 -8.47945E-01 -1.91831E+00
- 5 9.63432E-03 8.20902E-01
- 6 -1.86913E-01 2.76267E+00
-6 0 *********** SCCC-tyr-cys
- 1 6.24987E-01 1.15600E+00
- 2 1.38543E-01 2.05470E-01
- 3 -1.60708E-01 -3.38185E-02
- 4 -4.82787E-02 8.41805E-02
- 5 -1.59545E-01 -4.12736E-02
- 6 -1.53462E-02 1.26006E-02
-6 0 *********** SCCC-tyr-met
- 1 5.27289E-01 9.88530E-01
- 2 -2.70752E-02 3.27078E-01
- 3 -2.98182E-01 1.90322E-03
- 4 -1.37498E-01 8.07606E-02
- 5 -1.33565E-01 -4.47601E-02
- 6 -3.77703E-02 -3.85862E-02
-6 0 *********** SCCC-tyr-phe
- 1 4.83602E-01 1.06812E+00
- 2 -5.64058E-02 2.85156E-01
- 3 -2.72616E-01 -1.59982E-02
- 4 -1.23063E-01 8.96891E-02
- 5 -1.45266E-01 -4.25057E-02
- 6 -3.52482E-02 -2.43408E-02
-6 0 *********** SCCC-tyr-ile
- 1 7.00681E-01 8.80187E-01
- 2 7.79750E-03 3.90088E-01
- 3 -3.00525E-01 8.72277E-03
- 4 -1.63017E-01 8.88579E-02
- 5 -1.16223E-01 -4.79997E-02
- 6 -5.33477E-02 -7.81778E-02
-6 0 *********** SCCC-tyr-leu
- 1 5.02019E-01 1.05572E+00
- 2 -1.42403E-01 3.30564E-01
- 3 -3.37974E-01 -3.32434E-02
- 4 -1.42606E-01 6.44307E-02
- 5 -1.16191E-01 -5.73138E-02
- 6 -2.96851E-02 -4.27292E-02
-6 0 *********** SCCC-tyr-val
- 1 6.36163E-01 9.09527E-01
- 2 -6.19285E-02 3.89862E-01
- 3 -3.18010E-01 -1.15151E-03
- 4 -1.65628E-01 8.19066E-02
- 5 -1.06425E-01 -5.63880E-02
- 6 -4.90251E-02 -8.03480E-02
-6 0 *********** SCCC-tyr-trp
- 1 5.23074E-01 9.84639E-01
- 2 3.45286E-02 2.73716E-01
- 3 -2.32869E-01 7.00200E-03
- 4 -1.16097E-01 1.04172E-01
- 5 -1.49185E-01 -3.19522E-02
- 6 -4.26037E-02 -2.56455E-02
-6 0 *********** SCCC-tyr-tyr
- 1 4.82991E-01 1.05925E+00
- 2 -5.00905E-02 2.84085E-01
- 3 -2.70095E-01 -1.20070E-02
- 4 -1.23759E-01 9.25586E-02
- 5 -1.46579E-01 -4.10850E-02
- 6 -3.62205E-02 -1.91292E-02
-6 0 *********** SCCC-tyr-ala
- 1 3.50972E-01 9.18529E-01
- 2 -6.39874E-02 2.94071E-01
- 3 -2.97026E-01 1.17327E-02
- 4 -1.32511E-01 9.53654E-02
- 5 -1.33880E-01 -3.48586E-02
- 6 -3.89830E-02 -3.20247E-02
-6 0 *********** SCCC-tyr-gly
- 1 -3.10423E-01 -1.44986E+00
- 2 2.68664E-01 -1.23816E-01
- 3 -1.40153E-01 -2.63547E-01
- 4 -5.56126E-02 6.16195E-02
- 5 -6.48660E-03 -7.50127E-02
- 6 -6.30250E-02 -4.38229E-01
-6 0 *********** SCCC-tyr-thr
- 1 4.22990E-01 1.07838E+00
- 2 -1.91985E-01 2.51424E-01
- 3 -2.65052E-01 -1.50556E-01
- 4 -1.07905E-01 4.36114E-02
- 5 -8.76546E-02 -5.99876E-02
- 6 -3.78330E-02 -6.14384E-02
-6 0 *********** SCCC-tyr-ser
- 1 9.87886E-01 1.36339E+00
- 2 9.32898E-02 1.73190E-01
- 3 -7.77915E-02 -1.89577E-01
- 4 6.69395E-02 4.79750E-02
- 5 -9.58565E-02 -3.99793E-02
- 6 2.44360E-03 1.18981E-02
-6 0 *********** SCCC-tyr-gln
- 1 5.78628E-01 9.99929E-01
- 2 1.12167E-01 2.92817E-01
- 3 -2.26094E-01 1.80037E-02
- 4 -1.01705E-01 9.05918E-02
- 5 -1.50426E-01 -3.30887E-02
- 6 -3.61936E-02 -1.03155E-02
-6 0 *********** SCCC-tyr-asn
- 1 3.64161E-01 1.12751E+00
- 2 3.06439E-01 1.28891E-01
- 3 -8.29484E-02 1.66061E-02
- 4 1.93738E-02 1.02736E-01
- 5 -1.68598E-01 -2.94224E-02
- 6 1.33536E-02 6.09864E-02
-6 0 *********** SCCC-tyr-glu
- 1 6.43778E-01 1.07914E+00
- 2 6.68468E-02 2.98558E-01
- 3 -2.30189E-01 -1.09329E-02
- 4 -9.92603E-02 8.05593E-02
- 5 -1.42769E-01 -4.23907E-02
- 6 -3.25037E-02 -1.59568E-02
-6 0 *********** SCCC-tyr-asp
- 1 3.53271E-01 1.25806E+00
- 2 2.64172E-02 1.43050E-01
- 3 -1.84971E-01 -4.59769E-02
- 4 -5.52261E-02 9.99940E-02
- 5 -1.93195E-01 -5.15819E-02
- 6 1.08132E-03 2.32952E-02
-6 0 *********** SCCC-tyr-his
- 1 7.03805E-01 1.25026E+00
- 2 1.98988E-01 2.71874E-01
- 3 -1.48827E-01 -3.21828E-02
- 4 -2.55129E-03 6.90244E-02
- 5 -1.32259E-01 -3.59772E-02
- 6 5.56321E-04 2.98027E-02
-6 0 *********** SCCC-tyr-arg
- 1 4.95442E-01 9.82505E-01
- 2 -6.30979E-02 3.42137E-01
- 3 -3.09784E-01 3.64336E-03
- 4 -1.40592E-01 8.34503E-02
- 5 -1.23934E-01 -4.52381E-02
- 6 -3.71473E-02 -4.02231E-02
-6 0 *********** SCCC-tyr-lys
- 1 4.60818E-01 9.77265E-01
- 2 -6.85366E-02 3.59299E-01
- 3 -3.18552E-01 8.36295E-03
- 4 -1.46488E-01 7.99203E-02
- 5 -1.24764E-01 -4.75067E-02
- 6 -3.86440E-02 -4.75867E-02
-6 0 *********** SCCC-tyr-pro
- 1 -1.43358E+01 -2.10206E+00
- 2 1.53249E+01 -2.32030E-01
- 3 -1.40349E+01 -5.69962E-01
- 4 1.39352E+01 -1.53945E-01
- 5 -1.39867E+01 -1.71566E-01
- 6 6.84512E+00 -7.11341E-01
-6 0 *********** SCCC-ala-cys
- 1 -4.72234E-02 -4.57745E-01
- 2 3.56775E-01 -4.90053E-01
- 3 -2.61589E-01 -1.47351E-01
- 4 1.52747E-01 -2.54017E-02
- 5 -2.65539E-01 -2.29734E-02
- 6 8.33854E-02 3.07298E-03
-6 0 *********** SCCC-ala-met
- 1 -1.03127E-01 -4.08371E-01
- 2 1.82092E-01 -3.50028E-01
- 3 -2.59257E-01 -9.65053E-02
- 4 1.40834E-01 1.16843E-02
- 5 -2.38310E-01 -1.23107E-02
- 6 7.10268E-02 -1.98458E-02
-6 0 *********** SCCC-ala-phe
- 1 -8.17274E-02 -4.06801E-01
- 2 2.20384E-01 -3.65099E-01
- 3 -2.45776E-01 -1.07379E-01
- 4 1.52841E-01 2.39586E-04
- 5 -2.41882E-01 -1.95839E-02
- 6 7.57888E-02 -1.73280E-02
-6 0 *********** SCCC-ala-ile
- 1 -1.19760E-01 -4.46679E-01
- 2 7.95757E-02 -3.59717E-01
- 3 -2.80051E-01 -1.02623E-01
- 4 8.18465E-02 2.41845E-02
- 5 -2.24914E-01 -7.94906E-03
- 6 4.80583E-02 -3.02887E-02
-6 0 *********** SCCC-ala-leu
- 1 -8.56590E-02 -4.04951E-01
- 2 1.48218E-01 -3.49390E-01
- 3 -2.49709E-01 -1.04514E-01
- 4 1.43924E-01 9.09383E-03
- 5 -2.36775E-01 -1.74153E-02
- 6 6.79240E-02 -2.50369E-02
-6 0 *********** SCCC-ala-val
- 1 -1.10682E-01 -4.31077E-01
- 2 7.47146E-02 -3.38920E-01
- 3 -2.66845E-01 -1.04154E-01
- 4 9.10318E-02 1.56650E-02
- 5 -2.26267E-01 -1.52883E-02
- 6 4.82302E-02 -3.43669E-02
-6 0 *********** SCCC-ala-trp
- 1 -9.80232E-02 -4.11407E-01
- 2 2.23312E-01 -3.67078E-01
- 3 -2.51113E-01 -1.02750E-01
- 4 1.43110E-01 2.11031E-03
- 5 -2.39177E-01 -1.75085E-02
- 6 7.36262E-02 -1.22768E-02
-6 0 *********** SCCC-ala-tyr
- 1 -8.35871E-02 -4.05962E-01
- 2 2.19559E-01 -3.63114E-01
- 3 -2.45825E-01 -1.06221E-01
- 4 1.53566E-01 7.31578E-04
- 5 -2.41598E-01 -1.93763E-02
- 6 7.59375E-02 -2.17717E-02
-6 0 *********** SCCC-ala-ala
- 1 -1.12072E-01 -3.55877E-01
- 2 1.79448E-01 -2.69909E-01
- 3 -2.46881E-01 -7.17584E-02
- 4 1.77527E-01 1.58803E-02
- 5 -2.42365E-01 -1.05245E-02
- 6 7.90238E-02 -2.15854E-02
-6 0 *********** SCCC-ala-gly
- 1 -1.14363E+00 1.31306E-01
- 2 4.79888E-01 2.36611E-01
- 3 -7.90134E-02 -1.27081E-01
- 4 -5.99170E-02 8.76003E-02
- 5 -2.76277E-02 -1.06128E-05
- 6 -2.45918E-02 -1.68238E-01
-6 0 *********** SCCC-ala-thr
- 1 -5.15330E-02 -4.00985E-01
- 2 1.80424E-01 -3.62093E-01
- 3 -2.33610E-01 -1.18466E-01
- 4 9.15995E-02 9.48742E-03
- 5 -2.35524E-01 -1.99568E-02
- 6 4.94697E-02 -3.93897E-02
-6 0 *********** SCCC-ala-ser
- 1 7.50194E-02 -5.78525E-01
- 2 3.01747E-01 -6.93358E-01
- 3 -2.86366E-01 -2.68207E-01
- 4 6.21866E-02 -8.34327E-02
- 5 -3.13864E-01 -5.42099E-02
- 6 4.17846E-02 -5.25894E-04
-6 0 *********** SCCC-ala-gln
- 1 -1.04064E-01 -4.21506E-01
- 2 2.65529E-01 -3.88428E-01
- 3 -2.65512E-01 -1.01935E-01
- 4 1.44301E-01 3.51838E-03
- 5 -2.45250E-01 -1.13032E-02
- 6 7.85852E-02 -5.72991E-03
-6 0 *********** SCCC-ala-asn
- 1 -7.09877E-02 -4.01600E-01
- 2 5.68618E-01 -4.04161E-01
- 3 -2.55980E-01 -1.15102E-01
- 4 2.44533E-01 -3.24625E-02
- 5 -2.97769E-01 -2.14430E-02
- 6 1.16416E-01 9.17882E-03
-6 0 *********** SCCC-ala-glu
- 1 -7.56173E-02 -4.46306E-01
- 2 2.53680E-01 -4.32546E-01
- 3 -2.64285E-01 -1.27345E-01
- 4 1.25118E-01 -7.55815E-03
- 5 -2.48157E-01 -1.80572E-02
- 6 7.05856E-02 -7.98159E-03
-6 0 *********** SCCC-ala-asp
- 1 -3.71504E-02 -4.13112E-01
- 2 4.32148E-01 -4.26733E-01
- 3 -2.35568E-01 -1.25450E-01
- 4 2.13724E-01 -2.56847E-02
- 5 -2.64058E-01 -2.05016E-02
- 6 1.00963E-01 8.29918E-03
-6 0 *********** SCCC-ala-his
- 1 -3.33788E-02 -4.71157E-01
- 2 4.27097E-01 -5.11784E-01
- 3 -2.78457E-01 -1.65469E-01
- 4 1.53039E-01 -3.99350E-02
- 5 -2.95105E-01 -2.36970E-02
- 6 8.02113E-02 1.46523E-02
-6 0 *********** SCCC-ala-arg
- 1 -1.04573E-01 -3.97009E-01
- 2 1.65555E-01 -3.22867E-01
- 3 -2.55674E-01 -9.28299E-02
- 4 1.46464E-01 9.69913E-03
- 5 -2.38133E-01 -1.22190E-02
- 6 6.76459E-02 -2.41947E-02
-6 0 *********** SCCC-ala-lys
- 1 -1.07988E-01 -3.83821E-01
- 2 1.73039E-01 -2.98455E-01
- 3 -2.56152E-01 -8.52959E-02
- 4 1.50522E-01 1.26872E-02
- 5 -2.42498E-01 -1.15646E-02
- 6 7.07238E-02 -2.52455E-02
-6 0 *********** SCCC-ala-pro
- 1 -3.65783E+01 -1.73364E-01
- 2 2.05370E+01 3.29453E-01
- 3 3.61601E-01 2.95808E-01
- 4 -2.02371E+01 -1.26263E-01
- 5 3.48729E+01 -6.63178E-02
- 6 -2.02682E+01 1.96069E-01
-6 0 *********** SCCC-gly-cys
+20
+1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20
+4 0 *********** SCCC-cys-cys
+ 1 -4.55603E-01 9.65298E-01
+ 2 1.95846E-01 3.64979E-02
+ 3 1.27866E-01 -3.36766E-02
+ 4 -7.49954E-02 5.32498E-02
+4 0 *********** SCCC-cys-met
+ 1 -4.71114E-01 7.60987E-01
+ 2 2.41181E-01 -1.03322E-01
+ 3 1.43073E-01 -2.21854E-02
+ 4 -2.93892E-02 1.08616E-02
+4 0 *********** SCCC-cys-phe
+ 1 -5.43396E-01 7.51679E-01
+ 2 2.52192E-01 -7.71157E-02
+ 3 1.40708E-01 -3.86572E-02
+ 4 -4.11594E-02 2.05621E-02
+4 0 *********** SCCC-cys-ile
+ 1 -4.15806E-01 8.73796E-01
+ 2 2.29085E-01 -1.02595E-01
+ 3 1.21883E-01 -9.13890E-03
+ 4 -2.22851E-02 1.91175E-02
+4 0 *********** SCCC-cys-leu
+ 1 -5.26311E-01 7.03011E-01
+ 2 2.80452E-01 -1.19168E-01
+ 3 1.34515E-01 -3.58673E-02
+ 4 -2.40376E-02 9.69179E-03
+4 0 *********** SCCC-cys-val
+ 1 -4.50652E-01 8.05820E-01
+ 2 2.48129E-01 -1.17441E-01
+ 3 1.28793E-01 -1.49132E-02
+ 4 -1.99449E-02 1.32748E-02
+4 0 *********** SCCC-cys-trp
+ 1 -4.95125E-01 8.17010E-01
+ 2 2.15768E-01 -6.24687E-02
+ 3 1.40598E-01 -2.33209E-02
+ 4 -4.46050E-02 1.94235E-02
+4 0 *********** SCCC-cys-tyr
+ 1 -5.34800E-01 7.50959E-01
+ 2 2.51394E-01 -8.01634E-02
+ 3 1.41953E-01 -3.79765E-02
+ 4 -4.01579E-02 2.01270E-02
+4 0 *********** SCCC-cys-ala
+ 1 -4.83889E-01 6.03960E-01
+ 2 2.55589E-01 -1.33319E-01
+ 3 1.49137E-01 -5.00761E-02
+ 4 -2.06741E-02 1.06316E-03
+4 0 *********** SCCC-cys-gly
+ 1 1.20094E+00 2.04058E-01
+ 2 -2.22725E-01 3.56473E-02
+ 3 3.83425E-02 1.81060E-02
+ 4 2.28548E-02 8.61259E-02
+4 0 *********** SCCC-cys-thr
+ 1 -3.77258E-01 7.85308E-01
+ 2 1.49953E-01 -7.25764E-03
+ 3 1.49630E-01 -3.22510E-02
+ 4 -4.07046E-02 2.90824E-02
+4 0 *********** SCCC-cys-ser
+ 1 -4.81540E-01 1.07811E+00
+ 2 2.09279E-01 9.45944E-02
+ 3 9.23704E-02 -2.88524E-02
+ 4 -1.02030E-01 6.70852E-02
+4 0 *********** SCCC-cys-gln
+ 1 -3.87554E-01 9.02705E-01
+ 2 1.74805E-01 -3.32422E-02
+ 3 1.45982E-01 -1.62072E-02
+ 4 -5.27937E-02 2.83693E-02
+4 0 *********** SCCC-cys-asn
+ 1 -3.70700E-01 9.94732E-01
+ 2 1.34714E-01 1.19083E-01
+ 3 1.16032E-01 -5.44814E-02
+ 4 -8.00815E-02 6.18519E-02
+4 0 *********** SCCC-cys-glu
+ 1 -4.29864E-01 9.28142E-01
+ 2 2.02016E-01 -2.67383E-02
+ 3 1.35661E-01 -2.12449E-02
+ 4 -5.61243E-02 3.68305E-02
+4 0 *********** SCCC-cys-asp
+ 1 -2.52349E-01 1.04564E+00
+ 2 7.83457E-02 9.28812E-02
+ 3 1.44901E-01 -1.95968E-02
+ 4 -9.85960E-02 4.74697E-02
+4 0 *********** SCCC-cys-his
+ 1 -4.66699E-01 1.01960E+00
+ 2 1.98413E-01 2.61999E-02
+ 3 1.09956E-01 -8.07657E-03
+ 4 -7.45758E-02 4.28546E-02
+4 0 *********** SCCC-cys-arg
+ 1 -4.30417E-01 7.40954E-01
+ 2 2.24651E-01 -1.22910E-01
+ 3 1.50932E-01 -2.40954E-02
+ 4 -2.74423E-02 8.27042E-03
+4 0 *********** SCCC-cys-lys
+ 1 -4.67892E-01 6.80128E-01
+ 2 2.62052E-01 -1.43745E-01
+ 3 1.37999E-01 -3.02356E-02
+ 4 -1.46706E-02 2.84023E-03
+4 0 *********** SCCC-cys-pro
+ 1 -7.02091E-01 1.00140E+00
+ 2 2.07932E-01 1.73568E-01
+ 3 1.52497E-01 4.91816E-02
+ 4 -1.66631E-01 -4.06736E-02
+4 0 *********** SCCC-met-cys
+ 1 -4.42033E-01 5.40221E-01
+ 2 -7.19269E-02 -5.83381E-02
+ 3 5.06300E-02 5.91374E-03
+ 4 -3.06477E-02 7.69493E-03
+4 0 *********** SCCC-met-met
+ 1 -3.80151E-01 4.08235E-01
+ 2 -1.32467E-02 -2.03466E-02
+ 3 2.32344E-02 1.47494E-02
+ 4 -2.18032E-02 -1.81317E-03
+4 0 *********** SCCC-met-phe
+ 1 -4.12081E-01 3.97153E-01
+ 2 -1.01234E-02 -2.48314E-02
+ 3 2.61280E-02 1.71898E-02
+ 4 -2.43607E-02 -2.72779E-03
+4 0 *********** SCCC-met-ile
+ 1 -3.70397E-01 4.83444E-01
+ 2 -3.81252E-02 -2.93627E-02
+ 3 2.84816E-02 6.10235E-03
+ 4 -2.03401E-02 3.65369E-03
+4 0 *********** SCCC-met-leu
+ 1 -3.84551E-01 3.68011E-01
+ 2 4.38518E-03 -1.18971E-02
+ 3 2.00069E-02 1.65791E-02
+ 4 -2.13427E-02 -2.57694E-03
+4 0 *********** SCCC-met-val
+ 1 -3.71389E-01 4.38942E-01
+ 2 -2.05676E-02 -2.22868E-02
+ 3 2.41561E-02 1.09053E-02
+ 4 -2.05373E-02 8.06848E-04
+4 0 *********** SCCC-met-trp
+ 1 -4.10891E-01 4.37976E-01
+ 2 -2.77981E-02 -3.48201E-02
+ 3 3.03730E-02 1.46661E-02
+ 4 -2.46401E-02 -1.20686E-03
+4 0 *********** SCCC-met-tyr
+ 1 -4.08076E-01 3.97592E-01
+ 2 -1.01833E-02 -2.39038E-02
+ 3 2.57854E-02 1.69156E-02
+ 4 -2.41161E-02 -2.56675E-03
+4 0 *********** SCCC-met-ala
+ 1 -3.54616E-01 3.02973E-01
+ 2 2.16168E-02 -3.67977E-04
+ 3 1.45739E-02 1.81415E-02
+ 4 -1.79436E-02 -3.96459E-03
+4 0 *********** SCCC-met-gly
+ 1 7.05567E-01 3.10084E-01
+ 2 1.25016E-01 2.75261E-02
+ 3 4.64330E-02 4.30485E-02
+ 4 7.31928E-04 3.22684E-02
+4 0 *********** SCCC-met-thr
+ 1 -3.77492E-01 4.31285E-01
+ 2 -3.91945E-02 -3.09277E-02
+ 3 2.78681E-02 1.16254E-02
+ 4 -2.06920E-02 -1.15606E-03
+4 0 *********** SCCC-met-ser
+ 1 -4.77373E-01 6.03159E-01
+ 2 -9.65197E-02 -8.07901E-02
+ 3 6.83339E-02 4.71440E-04
+ 4 -3.56763E-02 1.68021E-02
+4 0 *********** SCCC-met-gln
+ 1 -3.89750E-01 5.00505E-01
+ 2 -5.57875E-02 -4.01181E-02
+ 3 3.61437E-02 7.13884E-03
+ 4 -2.44424E-02 3.20141E-03
+4 0 *********** SCCC-met-asn
+ 1 -4.37272E-01 5.59017E-01
+ 2 -9.01724E-02 -6.36490E-02
+ 3 5.60663E-02 1.24581E-03
+ 4 -2.96767E-02 1.05188E-02
+4 0 *********** SCCC-met-glu
+ 1 -4.09213E-01 5.16766E-01
+ 2 -5.89015E-02 -4.48149E-02
+ 3 4.07367E-02 6.19682E-03
+ 4 -2.66186E-02 5.34112E-03
+4 0 *********** SCCC-met-asp
+ 1 -3.89525E-01 5.77519E-01
+ 2 -1.02402E-01 -5.64349E-02
+ 3 5.16894E-02 -3.22193E-03
+ 4 -2.65854E-02 1.07219E-02
+4 0 *********** SCCC-met-his
+ 1 -4.50410E-01 5.61700E-01
+ 2 -7.85717E-02 -6.63989E-02
+ 3 5.36455E-02 3.90730E-03
+ 4 -3.01252E-02 9.50125E-03
+4 0 *********** SCCC-met-arg
+ 1 -3.57078E-01 3.96667E-01
+ 2 -8.94391E-03 -1.59360E-02
+ 3 2.05189E-02 1.44722E-02
+ 4 -1.99195E-02 -1.46327E-03
+4 0 *********** SCCC-met-lys
+ 1 -3.54616E-01 3.55248E-01
+ 2 8.91179E-03 -7.06650E-03
+ 3 1.62862E-02 1.57910E-02
+ 4 -1.82233E-02 -2.25638E-03
+4 0 *********** SCCC-met-pro
+ 1 -6.09554E-01 5.47230E-01
+ 2 -6.90890E-02 -1.30340E-01
+ 3 6.56985E-02 3.67062E-02
+ 4 -4.53500E-02 -1.31158E-02
+4 0 *********** SCCC-phe-cys
+ 1 -4.62579E-01 4.10888E-01
+ 2 -2.26015E-01 -1.46696E-01
+ 3 -1.94976E-02 -1.11131E-01
+ 4 -5.01894E-02 -1.27132E-02
+4 0 *********** SCCC-phe-met
+ 1 -3.78872E-01 2.75711E-01
+ 2 -1.59495E-01 -4.07052E-02
+ 3 -7.52546E-02 -9.37566E-02
+ 4 -2.65095E-02 -3.99488E-02
+4 0 *********** SCCC-phe-phe
+ 1 -4.00143E-01 2.57150E-01
+ 2 -1.51048E-01 -5.67289E-02
+ 3 -7.24239E-02 -9.40932E-02
+ 4 -3.19414E-02 -3.87639E-02
+4 0 *********** SCCC-phe-ile
+ 1 -3.88149E-01 3.52969E-01
+ 2 -1.93576E-01 -5.53308E-02
+ 3 -6.39139E-02 -9.09914E-02
+ 4 -2.47252E-02 -2.93166E-02
+4 0 *********** SCCC-phe-leu
+ 1 -3.70079E-01 2.35036E-01
+ 2 -1.45513E-01 -2.07186E-02
+ 3 -9.01374E-02 -9.11654E-02
+ 4 -2.56875E-02 -4.08861E-02
+4 0 *********** SCCC-phe-val
+ 1 -3.77876E-01 3.07980E-01
+ 2 -1.74240E-01 -3.92289E-02
+ 3 -7.45993E-02 -9.02785E-02
+ 4 -2.30187E-02 -3.49072E-02
+4 0 *********** SCCC-phe-trp
+ 1 -4.12306E-01 2.98390E-01
+ 2 -1.65326E-01 -7.91134E-02
+ 3 -5.53723E-02 -9.47400E-02
+ 4 -3.33398E-02 -3.58108E-02
+4 0 *********** SCCC-phe-tyr
+ 1 -3.97064E-01 2.58593E-01
+ 2 -1.52086E-01 -5.41079E-02
+ 3 -7.35758E-02 -9.43540E-02
+ 4 -3.15097E-02 -3.87731E-02
+4 0 *********** SCCC-phe-ala
+ 1 -3.36157E-01 1.77519E-01
+ 2 -1.17424E-01 9.69066E-03
+ 3 -1.01062E-01 -8.78362E-02
+ 4 -2.22926E-02 -4.51096E-02
+4 0 *********** SCCC-phe-gly
+ 1 6.01182E-01 3.73727E-01
+ 2 3.30566E-01 4.52419E-02
+ 3 1.00750E-01 -6.31009E-02
+ 4 3.63753E-04 3.44768E-02
+4 0 *********** SCCC-phe-thr
+ 1 -3.95492E-01 3.00352E-01
+ 2 -1.60716E-01 -8.77644E-02
+ 3 -4.19793E-02 -9.88401E-02
+ 4 -2.69269E-02 -3.01506E-02
+4 0 *********** SCCC-phe-ser
+ 1 -5.09102E-01 4.86450E-01
+ 2 -2.67160E-01 -2.00589E-01
+ 3 1.62078E-02 -1.17665E-01
+ 4 -6.48941E-02 1.30471E-02
+4 0 *********** SCCC-phe-gln
+ 1 -4.13035E-01 3.70012E-01
+ 2 -1.99598E-01 -9.56424E-02
+ 3 -4.25024E-02 -1.02604E-01
+ 4 -3.86357E-02 -2.84432E-02
+4 0 *********** SCCC-phe-asn
+ 1 -4.74125E-01 4.37822E-01
+ 2 -2.34663E-01 -1.77057E-01
+ 3 4.97599E-04 -1.14090E-01
+ 4 -5.52800E-02 -2.01378E-03
+4 0 *********** SCCC-phe-glu
+ 1 -4.28227E-01 3.85340E-01
+ 2 -2.11873E-01 -1.05524E-01
+ 3 -4.15752E-02 -1.04415E-01
+ 4 -4.19641E-02 -2.34032E-02
+4 0 *********** SCCC-phe-asp
+ 1 -4.43901E-01 4.61468E-01
+ 2 -2.41169E-01 -1.58233E-01
+ 3 -2.36848E-03 -1.19346E-01
+ 4 -6.11572E-02 -6.37633E-03
+4 0 *********** SCCC-phe-his
+ 1 -4.75995E-01 4.33527E-01
+ 2 -2.35847E-01 -1.59983E-01
+ 3 -5.89940E-03 -1.10557E-01
+ 4 -4.73175E-02 -7.16909E-03
+4 0 *********** SCCC-phe-arg
+ 1 -3.59730E-01 2.67583E-01
+ 2 -1.52185E-01 -2.40627E-02
+ 3 -8.10757E-02 -8.94407E-02
+ 4 -2.49723E-02 -4.03733E-02
+4 0 *********** SCCC-phe-lys
+ 1 -3.46674E-01 2.28404E-01
+ 2 -1.39061E-01 -1.64743E-03
+ 3 -9.34945E-02 -8.62849E-02
+ 4 -1.92633E-02 -4.11896E-02
+4 0 *********** SCCC-phe-pro
+ 1 -6.17241E-01 4.52603E-01
+ 2 -1.85757E-01 -3.00525E-01
+ 3 7.35871E-02 -1.20146E-01
+ 4 -4.20338E-02 -8.11095E-02
+4 0 *********** SCCC-ile-cys
+ 1 -6.04603E-01 6.22953E-01
+ 2 -1.07202E-01 -9.11979E-02
+ 3 1.80581E-01 -5.32300E-02
+ 4 -5.33906E-02 2.69991E-02
+4 0 *********** SCCC-ile-met
+ 1 -4.98356E-01 4.32072E-01
+ 2 -8.68054E-03 -1.44039E-02
+ 3 9.97463E-02 -3.66053E-02
+ 4 -2.99125E-02 -1.76010E-03
+4 0 *********** SCCC-ile-phe
+ 1 -5.36203E-01 4.14006E-01
+ 2 -8.15075E-03 -1.25844E-02
+ 3 1.12158E-01 -3.54614E-02
+ 4 -3.86935E-02 -3.72408E-03
+4 0 *********** SCCC-ile-ile
+ 1 -4.98343E-01 5.32806E-01
+ 2 -4.01467E-02 -3.69391E-02
+ 3 1.01120E-01 -5.31072E-02
+ 4 -2.39305E-02 1.25986E-02
+4 0 *********** SCCC-ile-leu
+ 1 -4.98957E-01 3.77555E-01
+ 2 1.41813E-02 5.96541E-03
+ 3 9.45394E-02 -4.12774E-02
+ 4 -3.13142E-02 -1.96469E-03
+4 0 *********** SCCC-ile-val
+ 1 -4.92613E-01 4.72043E-01
+ 2 -1.58054E-02 -2.05223E-02
+ 3 9.47257E-02 -4.57798E-02
+ 4 -2.58082E-02 6.16207E-03
+4 0 *********** SCCC-ile-trp
+ 1 -5.40919E-01 4.71089E-01
+ 2 -3.11140E-02 -3.60351E-02
+ 3 1.19081E-01 -3.23843E-02
+ 4 -3.76778E-02 -8.72224E-04
+4 0 *********** SCCC-ile-tyr
+ 1 -5.31300E-01 4.14938E-01
+ 2 -7.95744E-03 -1.20449E-02
+ 3 1.10947E-01 -3.60107E-02
+ 4 -3.79362E-02 -3.40210E-03
+4 0 *********** SCCC-ile-ala
+ 1 -4.53534E-01 3.02214E-01
+ 2 3.54264E-02 2.04753E-02
+ 3 8.37150E-02 -3.51964E-02
+ 4 -2.54678E-02 -6.69398E-03
+4 0 *********** SCCC-ile-gly
+ 1 8.95801E-01 4.66810E-01
+ 2 2.18402E-01 6.07274E-02
+ 3 2.19337E-01 1.09960E-01
+ 4 4.59913E-02 9.51908E-02
+4 0 *********** SCCC-ile-thr
+ 1 -4.97030E-01 4.69824E-01
+ 2 -4.67561E-02 -4.01289E-02
+ 3 1.16124E-01 -2.32173E-02
+ 4 -3.33238E-02 -6.74730E-04
+4 0 *********** SCCC-ile-ser
+ 1 -6.82521E-01 7.46737E-01
+ 2 -1.66838E-01 -1.58009E-01
+ 3 2.50198E-01 -7.33204E-02
+ 4 -7.21986E-02 7.43273E-02
+4 0 *********** SCCC-ile-gln
+ 1 -5.25896E-01 5.61891E-01
+ 2 -7.20761E-02 -6.01625E-02
+ 3 1.32414E-01 -4.25460E-02
+ 4 -3.51978E-02 8.25566E-03
+4 0 *********** SCCC-ile-asn
+ 1 -6.07023E-01 6.64836E-01
+ 2 -1.42383E-01 -1.14830E-01
+ 3 2.05263E-01 -5.70534E-02
+ 4 -5.57412E-02 4.15312E-02
+4 0 *********** SCCC-ile-glu
+ 1 -5.54083E-01 5.82928E-01
+ 2 -7.96853E-02 -6.47652E-02
+ 3 1.44558E-01 -5.23117E-02
+ 4 -3.98567E-02 1.57250E-02
+4 0 *********** SCCC-ile-asp
+ 1 -5.50756E-01 6.98214E-01
+ 2 -1.58363E-01 -1.20098E-01
+ 3 1.94070E-01 -5.54957E-02
+ 4 -4.63837E-02 3.30493E-02
+4 0 *********** SCCC-ile-his
+ 1 -6.22802E-01 6.58897E-01
+ 2 -1.17083E-01 -1.10923E-01
+ 3 1.87541E-01 -5.44786E-02
+ 4 -5.27283E-02 3.60895E-02
+4 0 *********** SCCC-ile-arg
+ 1 -4.68316E-01 4.20180E-01
+ 2 -1.60693E-03 -1.14180E-02
+ 3 9.02561E-02 -3.53904E-02
+ 4 -2.60790E-02 -1.83804E-03
+4 0 *********** SCCC-ile-lys
+ 1 -4.60625E-01 3.66307E-01
+ 2 2.28230E-02 6.88499E-03
+ 3 8.09885E-02 -3.86622E-02
+ 4 -2.37433E-02 -8.00729E-04
+4 0 *********** SCCC-ile-pro
+ 1 -9.11814E-01 7.56200E-01
+ 2 -1.68031E-01 -3.15787E-01
+ 3 3.77243E-01 6.35252E-02
+ 4 -1.52893E-01 6.08670E-02
+4 0 *********** SCCC-leu-cys
+ 1 -5.92878E-01 2.63423E-01
+ 2 -4.46107E-01 1.45946E-02
+ 3 8.85691E-02 1.25335E-01
+ 4 3.46958E-03 -3.44148E-02
+4 0 *********** SCCC-leu-met
+ 1 -5.04044E-01 1.18074E-01
+ 2 -2.75735E-01 1.37015E-01
+ 3 1.80417E-02 1.20871E-01
+ 4 -1.96858E-02 -6.73149E-02
+4 0 *********** SCCC-leu-phe
+ 1 -5.23790E-01 7.82255E-02
+ 2 -3.03285E-01 1.12738E-01
+ 3 2.60212E-02 1.47188E-01
+ 4 -9.12905E-03 -6.95404E-02
+4 0 *********** SCCC-leu-ile
+ 1 -5.22824E-01 2.10748E-01
+ 2 -3.07049E-01 1.41478E-01
+ 3 4.78934E-02 8.75128E-02
+ 4 -2.40663E-02 -6.14111E-02
+4 0 *********** SCCC-leu-leu
+ 1 -4.96301E-01 5.48648E-02
+ 2 -2.65529E-01 1.68077E-01
+ 3 2.10832E-02 1.38336E-01
+ 4 -1.97833E-02 -7.72021E-02
+4 0 *********** SCCC-leu-val
+ 1 -5.09257E-01 1.53623E-01
+ 2 -2.82467E-01 1.55153E-01
+ 3 3.36493E-02 1.03923E-01
+ 4 -2.47317E-02 -6.84244E-02
+4 0 *********** SCCC-leu-trp
+ 1 -5.36915E-01 1.41614E-01
+ 2 -3.16123E-01 8.21513E-02
+ 3 3.10676E-02 1.28035E-01
+ 4 -1.05901E-02 -5.87549E-02
+4 0 *********** SCCC-leu-tyr
+ 1 -5.20832E-01 8.15940E-02
+ 2 -3.00203E-01 1.16652E-01
+ 3 2.49572E-02 1.45017E-01
+ 4 -1.03220E-02 -6.96037E-02
+4 0 *********** SCCC-leu-ala
+ 1 -4.53690E-01 1.60448E-02
+ 2 -2.01402E-01 1.80136E-01
+ 3 -6.40669E-03 1.38012E-01
+ 4 -2.27126E-02 -6.80365E-02
+4 0 *********** SCCC-leu-gly
+ 1 5.13032E-01 5.43657E-01
+ 2 4.85228E-01 -2.44057E-01
+ 3 6.72842E-02 1.86750E-01
+ 4 -1.00748E-02 -3.90944E-02
+4 0 *********** SCCC-leu-thr
+ 1 -5.11060E-01 1.84664E-01
+ 2 -2.91864E-01 4.05042E-02
+ 3 5.02939E-03 1.09568E-01
+ 4 -5.49041E-03 -4.27811E-02
+4 0 *********** SCCC-leu-ser
+ 1 -6.55966E-01 3.49434E-01
+ 2 -5.56569E-01 -4.24392E-02
+ 3 1.67513E-01 1.18900E-01
+ 4 1.08718E-02 3.65601E-03
+4 0 *********** SCCC-leu-gln
+ 1 -5.39982E-01 2.45285E-01
+ 2 -3.44086E-01 6.50880E-02
+ 3 4.03263E-02 1.00921E-01
+ 4 -1.28837E-02 -4.48029E-02
+4 0 *********** SCCC-leu-asn
+ 1 -6.07636E-01 3.30162E-01
+ 2 -4.72874E-01 -5.25555E-02
+ 3 1.03963E-01 1.19980E-01
+ 4 5.25450E-03 -4.88500E-03
+4 0 *********** SCCC-leu-glu
+ 1 -5.58718E-01 2.42544E-01
+ 2 -3.81869E-01 6.88831E-02
+ 3 6.30436E-02 1.09829E-01
+ 4 -9.56560E-03 -4.83048E-02
+4 0 *********** SCCC-leu-asp
+ 1 -5.76809E-01 3.97867E-01
+ 2 -4.25845E-01 -4.30068E-02
+ 3 7.14207E-02 8.60899E-02
+ 4 -5.73144E-03 1.54473E-03
+4 0 *********** SCCC-leu-his
+ 1 -6.10042E-01 2.93401E-01
+ 2 -4.60094E-01 7.29031E-03
+ 3 1.05630E-01 1.06369E-01
+ 4 2.94319E-03 -2.77707E-02
+4 0 *********** SCCC-leu-arg
+ 1 -4.84492E-01 1.24026E-01
+ 2 -2.41674E-01 1.50040E-01
+ 3 7.75272E-03 1.12210E-01
+ 4 -2.47593E-02 -6.27088E-02
+4 0 *********** SCCC-leu-lys
+ 1 -4.71699E-01 6.92459E-02
+ 2 -2.22373E-01 1.85162E-01
+ 3 8.73867E-03 1.19745E-01
+ 4 -2.71969E-02 -7.09850E-02
+4 0 *********** SCCC-leu-pro
+ 1 -7.44731E-01 2.85611E-01
+ 2 -5.87121E-01 -2.89125E-01
+ 3 1.11616E-01 2.21559E-01
+ 4 -2.15154E-02 3.19252E-02
+4 0 *********** SCCC-val-cys
+ 1 -6.37671E-01 4.29531E-01
+ 2 -3.54652E-01 -9.45011E-02
+ 3 1.30803E-01 5.39195E-02
+ 4 1.68066E-02 -5.89187E-03
+4 0 *********** SCCC-val-met
+ 1 -5.19785E-01 2.30211E-01
+ 2 -2.02858E-01 5.02491E-02
+ 3 3.89614E-02 5.37683E-02
+ 4 1.11168E-02 -3.69718E-02
+4 0 *********** SCCC-val-phe
+ 1 -5.44730E-01 2.00795E-01
+ 2 -2.15635E-01 3.21726E-02
+ 3 4.76527E-02 7.31636E-02
+ 4 1.53060E-02 -4.12280E-02
+4 0 *********** SCCC-val-ile
+ 1 -5.37729E-01 3.36320E-01
+ 2 -2.39123E-01 3.72545E-02
+ 3 6.13247E-02 2.26126E-02
+ 4 6.42153E-03 -2.79011E-02
+4 0 *********** SCCC-val-leu
+ 1 -5.08982E-01 1.69477E-01
+ 2 -1.85919E-01 8.01706E-02
+ 3 3.52565E-02 6.27795E-02
+ 4 1.04221E-02 -4.18706E-02
+4 0 *********** SCCC-val-val
+ 1 -5.22276E-01 2.71776E-01
+ 2 -2.11599E-01 5.73754E-02
+ 3 4.72046E-02 3.69249E-02
+ 4 6.29363E-03 -3.41850E-02
+4 0 *********** SCCC-val-trp
+ 1 -5.61184E-01 2.64153E-01
+ 2 -2.34313E-01 -3.03607E-04
+ 3 5.74963E-02 6.30770E-02
+ 4 1.37481E-02 -3.39654E-02
+4 0 *********** SCCC-val-tyr
+ 1 -5.41140E-01 2.02967E-01
+ 2 -2.14128E-01 3.53404E-02
+ 3 4.65146E-02 7.12986E-02
+ 4 1.48945E-02 -4.10807E-02
+4 0 *********** SCCC-val-ala
+ 1 -4.63528E-01 1.08009E-01
+ 2 -1.37427E-01 1.04421E-01
+ 3 1.47077E-02 6.60091E-02
+ 4 1.01403E-02 -3.82779E-02
+4 0 *********** SCCC-val-gly
+ 1 7.80222E-01 5.62809E-01
+ 2 4.98015E-01 -5.06927E-02
+ 3 1.96403E-01 1.85531E-01
+ 4 5.49617E-02 3.22318E-02
+4 0 *********** SCCC-val-thr
+ 1 -5.36024E-01 2.87204E-01
+ 2 -2.23081E-01 -2.57248E-02
+ 3 4.58625E-02 5.62526E-02
+ 4 1.49919E-02 -2.83341E-02
+4 0 *********** SCCC-val-ser
+ 1 -7.36521E-01 5.92936E-01
+ 2 -4.71167E-01 -2.09715E-01
+ 3 2.46981E-01 3.63319E-02
+ 4 2.49886E-03 7.07794E-02
+4 0 *********** SCCC-val-gln
+ 1 -5.67291E-01 3.71453E-01
+ 2 -2.74806E-01 -2.75425E-02
+ 3 7.39046E-02 4.04525E-02
+ 4 1.46551E-02 -2.27218E-02
+4 0 *********** SCCC-val-asn
+ 1 -6.64590E-01 5.01935E-01
+ 2 -3.89259E-01 -1.62453E-01
+ 3 1.66000E-01 5.45842E-02
+ 4 9.89117E-03 2.04990E-02
+4 0 *********** SCCC-val-glu
+ 1 -5.89071E-01 3.85900E-01
+ 2 -3.02715E-01 -3.38776E-02
+ 3 9.27025E-02 4.14834E-02
+ 4 1.51151E-02 -2.06967E-02
+4 0 *********** SCCC-val-asp
+ 1 -6.27245E-01 5.48540E-01
+ 2 -3.72164E-01 -1.46947E-01
+ 3 1.39515E-01 2.80768E-02
+ 4 1.64719E-02 1.88088E-02
+4 0 *********** SCCC-val-his
+ 1 -6.59237E-01 4.70083E-01
+ 2 -3.71977E-01 -1.13978E-01
+ 3 1.50304E-01 3.90954E-02
+ 4 1.44891E-02 8.97853E-03
+4 0 *********** SCCC-val-arg
+ 1 -4.97016E-01 2.25840E-01
+ 2 -1.78561E-01 6.55208E-02
+ 3 2.88421E-02 4.79617E-02
+ 4 7.81065E-03 -3.59868E-02
+4 0 *********** SCCC-val-lys
+ 1 -4.80377E-01 1.69852E-01
+ 2 -1.56685E-01 9.80185E-02
+ 3 2.38504E-02 5.07570E-02
+ 4 5.44637E-03 -3.75260E-02
+4 0 *********** SCCC-val-pro
+ 1 -9.65053E-01 6.96480E-01
+ 2 -4.20317E-01 -5.55247E-01
+ 3 3.34534E-01 1.03603E-01
+ 4 -1.90510E-01 1.26764E-01
+4 0 *********** SCCC-trp-cys
+ 1 -2.78524E-01 4.85646E-01
+ 2 6.41275E-02 -2.16323E-01
+ 3 3.18075E-02 -2.93624E-02
+ 4 -2.22648E-02 7.05087E-03
+4 0 *********** SCCC-trp-met
+ 1 -2.30591E-01 4.06685E-01
+ 2 3.77207E-02 -1.78384E-01
+ 3 1.43886E-02 -4.18351E-02
+ 4 -1.23092E-02 4.18442E-03
+4 0 *********** SCCC-trp-phe
+ 1 -2.60440E-01 4.03440E-01
+ 2 5.68400E-02 -1.80060E-01
+ 3 1.15195E-02 -3.96156E-02
+ 4 -1.25504E-02 3.13314E-03
+4 0 *********** SCCC-trp-ile
+ 1 -2.16552E-01 4.53965E-01
+ 2 2.09254E-02 -1.95954E-01
+ 3 2.14445E-02 -3.54838E-02
+ 4 -1.43223E-02 6.53411E-03
+4 0 *********** SCCC-trp-leu
+ 1 -2.39189E-01 3.84951E-01
+ 2 4.15813E-02 -1.76380E-01
+ 3 6.21918E-03 -4.42101E-02
+ 4 -1.02856E-02 3.23994E-03
+4 0 *********** SCCC-trp-val
+ 1 -2.20970E-01 4.27583E-01
+ 2 2.66601E-02 -1.87827E-01
+ 3 1.61804E-02 -3.85142E-02
+ 4 -1.25531E-02 4.99406E-03
+4 0 *********** SCCC-trp-trp
+ 1 -2.54225E-01 4.25270E-01
+ 2 5.31925E-02 -1.83758E-01
+ 3 1.94121E-02 -3.58574E-02
+ 4 -1.48848E-02 3.88371E-03
+4 0 *********** SCCC-trp-tyr
+ 1 -2.56868E-01 4.03337E-01
+ 2 5.45916E-02 -1.79887E-01
+ 3 1.15892E-02 -4.02659E-02
+ 4 -1.24425E-02 3.36618E-03
+4 0 *********** SCCC-trp-ala
+ 1 -2.17129E-01 3.33640E-01
+ 2 3.23038E-02 -1.51703E-01
+ 3 -1.01237E-03 -5.25382E-02
+ 4 -6.86667E-03 2.97654E-03
+4 0 *********** SCCC-trp-gly
+ 1 5.94221E-01 1.67050E-01
+ 2 6.49413E-02 2.51562E-01
+ 3 4.24071E-02 2.99356E-02
+ 4 7.25430E-04 2.69304E-02
+4 0 *********** SCCC-trp-thr
+ 1 -2.22689E-01 4.05291E-01
+ 2 4.89623E-02 -1.57996E-01
+ 3 2.17295E-02 -4.04462E-02
+ 4 -1.10784E-02 5.11588E-03
+4 0 *********** SCCC-trp-ser
+ 1 -3.09857E-01 5.25488E-01
+ 2 7.36706E-02 -2.46687E-01
+ 3 4.02618E-02 -1.84896E-02
+ 4 -2.98467E-02 7.31333E-03
+4 0 *********** SCCC-trp-gln
+ 1 -2.30145E-01 4.56534E-01
+ 2 3.82070E-02 -1.90604E-01
+ 3 2.79157E-02 -3.82039E-02
+ 4 -1.71306E-02 7.82471E-03
+4 0 *********** SCCC-trp-asn
+ 1 -2.69658E-01 4.83847E-01
+ 2 6.85080E-02 -2.04815E-01
+ 3 3.21313E-02 -3.18899E-02
+ 4 -2.04228E-02 7.53084E-03
+4 0 *********** SCCC-trp-glu
+ 1 -2.49321E-01 4.72181E-01
+ 2 4.47376E-02 -2.05998E-01
+ 3 2.81910E-02 -3.45353E-02
+ 4 -1.92147E-02 7.74112E-03
+4 0 *********** SCCC-trp-asp
+ 1 -2.19803E-01 4.83941E-01
+ 2 3.98107E-02 -1.88327E-01
+ 3 3.78892E-02 -4.46591E-02
+ 4 -1.94208E-02 1.40890E-02
+4 0 *********** SCCC-trp-his
+ 1 -2.83887E-01 5.00226E-01
+ 2 6.19914E-02 -2.25158E-01
+ 3 3.72174E-02 -2.30486E-02
+ 4 -2.49218E-02 6.60551E-03
+4 0 *********** SCCC-trp-arg
+ 1 -2.09871E-01 3.95271E-01
+ 2 2.57150E-02 -1.69532E-01
+ 3 1.21004E-02 -4.50086E-02
+ 4 -1.03571E-02 4.93005E-03
+4 0 *********** SCCC-trp-lys
+ 1 -2.12544E-01 3.71164E-01
+ 2 2.58459E-02 -1.66757E-01
+ 3 5.22659E-03 -4.62493E-02
+ 4 -8.27350E-03 3.41783E-03
+4 0 *********** SCCC-trp-pro
+ 1 -4.42199E-01 5.02993E-01
+ 2 1.65099E-01 -2.50806E-01
+ 3 5.62381E-02 -9.12310E-03
+ 4 -3.65576E-02 2.98371E-03
+4 0 *********** SCCC-tyr-cys
+ 1 -4.45048E-01 3.51850E-01
+ 2 -1.56000E-01 -2.07395E-01
+ 3 4.54257E-02 -1.13902E-01
+ 4 -2.94059E-02 1.01806E-02
+4 0 *********** SCCC-tyr-met
+ 1 -3.59076E-01 2.42112E-01
+ 2 -1.24780E-01 -1.04515E-01
+ 3 -7.86907E-03 -1.11506E-01
+ 4 -4.63654E-03 -1.08826E-02
+4 0 *********** SCCC-tyr-phe
+ 1 -3.77667E-01 2.25542E-01
+ 2 -1.12647E-01 -1.16054E-01
+ 3 -5.00073E-03 -1.11364E-01
+ 4 -1.03726E-02 -1.09456E-02
+4 0 *********** SCCC-tyr-ile
+ 1 -3.72246E-01 3.08265E-01
+ 2 -1.52206E-01 -1.24337E-01
+ 3 -4.21208E-04 -1.07332E-01
+ 4 -2.98009E-03 -1.72568E-03
+4 0 *********** SCCC-tyr-leu
+ 1 -3.48424E-01 2.08197E-01
+ 2 -1.17477E-01 -8.54272E-02
+ 3 -2.08894E-02 -1.14484E-01
+ 4 -2.97589E-03 -1.22439E-02
+4 0 *********** SCCC-tyr-val
+ 1 -3.60127E-01 2.70511E-01
+ 2 -1.38881E-01 -1.07027E-01
+ 3 -9.07811E-03 -1.09077E-01
+ 4 -1.42119E-03 -6.39666E-03
+4 0 *********** SCCC-tyr-trp
+ 1 -3.90987E-01 2.59420E-01
+ 2 -1.19812E-01 -1.36990E-01
+ 3 8.92199E-03 -1.06309E-01
+ 4 -1.31699E-02 -8.39469E-03
+4 0 *********** SCCC-tyr-tyr
+ 1 -3.74966E-01 2.26930E-01
+ 2 -1.14291E-01 -1.14163E-01
+ 3 -5.85492E-03 -1.11965E-01
+ 4 -9.72865E-03 -1.08598E-02
+4 0 *********** SCCC-tyr-ala
+ 1 -3.12234E-01 1.57801E-01
+ 2 -1.01142E-01 -5.08100E-02
+ 3 -3.20892E-02 -1.13819E-01
+ 4 -3.03066E-04 -1.71860E-02
+4 0 *********** SCCC-tyr-gly
+ 1 5.21249E-01 3.73505E-01
+ 2 2.77449E-01 1.38874E-01
+ 3 1.28523E-01 -1.16458E-02
+ 4 2.12469E-02 4.66123E-02
+4 0 *********** SCCC-tyr-thr
+ 1 -3.74902E-01 2.58212E-01
+ 2 -1.11953E-01 -1.38220E-01
+ 3 1.84392E-02 -1.01615E-01
+ 4 -1.27215E-02 -6.08377E-03
+4 0 *********** SCCC-tyr-ser
+ 1 -4.90127E-01 4.11518E-01
+ 2 -1.80164E-01 -2.59300E-01
+ 3 7.59210E-02 -1.14620E-01
+ 4 -4.35756E-02 2.91465E-02
+4 0 *********** SCCC-tyr-gln
+ 1 -3.96272E-01 3.19344E-01
+ 2 -1.46228E-01 -1.57896E-01
+ 3 2.24448E-02 -1.10761E-01
+ 4 -1.60657E-02 -1.82447E-03
+4 0 *********** SCCC-tyr-asn
+ 1 -4.55058E-01 3.69713E-01
+ 2 -1.55377E-01 -2.29677E-01
+ 3 6.06865E-02 -1.10740E-01
+ 4 -3.66774E-02 1.57932E-02
+4 0 *********** SCCC-tyr-glu
+ 1 -4.11987E-01 3.32970E-01
+ 2 -1.54730E-01 -1.70628E-01
+ 3 2.47803E-02 -1.14047E-01
+ 4 -1.83778E-02 2.69377E-03
+4 0 *********** SCCC-tyr-asp
+ 1 -4.27679E-01 3.89628E-01
+ 2 -1.67273E-01 -2.13504E-01
+ 3 5.99795E-02 -1.17236E-01
+ 4 -3.51338E-02 1.27111E-02
+4 0 *********** SCCC-tyr-his
+ 1 -4.57549E-01 3.69384E-01
+ 2 -1.61130E-01 -2.19712E-01
+ 3 5.49814E-02 -1.08614E-01
+ 4 -3.01313E-02 1.46920E-02
+4 0 *********** SCCC-tyr-arg
+ 1 -3.40333E-01 2.35484E-01
+ 2 -1.23496E-01 -8.78982E-02
+ 3 -1.48072E-02 -1.09426E-01
+ 4 -2.20178E-03 -1.20122E-02
+4 0 *********** SCCC-tyr-lys
+ 1 -3.25541E-01 2.02599E-01
+ 2 -1.17571E-01 -6.65914E-02
+ 3 -2.65377E-02 -1.10293E-01
+ 4 2.04292E-03 -1.28717E-02
+4 0 *********** SCCC-tyr-pro
+ 1 -5.63016E-01 3.51117E-01
+ 2 -8.02641E-02 -3.73003E-01
+ 3 1.39426E-01 -1.23307E-01
+ 4 -8.75532E-02 -7.51550E-02
+4 0 *********** SCCC-ala-cys
+ 1 -3.77726E-01 5.98890E-01
+ 2 -2.97365E-01 1.52563E-01
+ 3 2.45306E-01 9.87104E-02
+ 4 -3.32744E-02 -4.90398E-03
+4 0 *********** SCCC-ala-met
+ 1 -3.37099E-01 4.08982E-01
+ 2 -1.14201E-01 1.59266E-01
+ 3 2.01176E-01 1.30610E-01
+ 4 -4.51059E-02 1.97629E-03
+4 0 *********** SCCC-ala-phe
+ 1 -3.77173E-01 3.94631E-01
+ 2 -1.44796E-01 1.47119E-01
+ 3 2.25901E-01 1.43875E-01
+ 4 -4.94759E-02 -8.09483E-03
+4 0 *********** SCCC-ala-ile
+ 1 -3.08743E-01 5.00302E-01
+ 2 -1.42373E-01 1.83090E-01
+ 3 1.90801E-01 8.07317E-02
+ 4 -3.96607E-02 1.15764E-02
+4 0 *********** SCCC-ala-leu
+ 1 -3.52027E-01 3.52741E-01
+ 2 -9.00989E-02 1.67136E-01
+ 3 2.21634E-01 1.37574E-01
+ 4 -5.19605E-02 -2.58277E-03
+4 0 *********** SCCC-ala-val
+ 1 -3.20525E-01 4.42837E-01
+ 2 -1.13915E-01 1.75920E-01
+ 3 1.97451E-01 1.03258E-01
+ 4 -4.55199E-02 9.28782E-03
+4 0 *********** SCCC-ala-trp
+ 1 -3.65472E-01 4.53849E-01
+ 2 -1.72051E-01 1.40110E-01
+ 3 2.07740E-01 1.29915E-01
+ 4 -4.16369E-02 -2.77301E-03
+4 0 *********** SCCC-ala-tyr
+ 1 -3.72513E-01 3.94795E-01
+ 2 -1.40660E-01 1.49201E-01
+ 3 2.24346E-01 1.43019E-01
+ 4 -4.93708E-02 -7.27975E-03
+4 0 *********** SCCC-ala-ala
+ 1 -3.35311E-01 2.89927E-01
+ 2 -3.40832E-02 1.42388E-01
+ 3 1.94384E-01 1.32260E-01
+ 4 -4.40129E-02 6.83620E-03
+4 0 *********** SCCC-ala-gly
+ 1 8.22151E-01 1.90559E-01
+ 2 2.80038E-01 -3.33499E-01
+ 3 1.83010E-01 1.85465E-01
+ 4 1.76027E-02 1.47276E-02
+4 0 *********** SCCC-ala-thr
+ 1 -3.33347E-01 4.61786E-01
+ 2 -1.71559E-01 1.22081E-01
+ 3 1.67931E-01 1.38621E-01
+ 4 -3.43815E-02 -4.49115E-03
+4 0 *********** SCCC-ala-ser
+ 1 -4.06949E-01 7.14967E-01
+ 2 -4.06057E-01 1.53751E-01
+ 3 2.89739E-01 4.70485E-02
+ 4 -1.53989E-02 3.02970E-03
+4 0 *********** SCCC-ala-gln
+ 1 -3.26276E-01 5.37287E-01
+ 2 -2.01614E-01 1.55365E-01
+ 3 1.92868E-01 1.08395E-01
+ 4 -3.12948E-02 -7.08043E-05
+4 0 *********** SCCC-ala-asn
+ 1 -3.75404E-01 6.51825E-01
+ 2 -3.45384E-01 1.30874E-01
+ 3 2.45000E-01 9.04840E-02
+ 4 -2.17245E-02 -7.23659E-05
+4 0 *********** SCCC-ala-glu
+ 1 -3.43866E-01 5.54211E-01
+ 2 -2.28051E-01 1.66137E-01
+ 3 2.18724E-01 9.82461E-02
+ 4 -3.50013E-02 -1.14697E-03
+4 0 *********** SCCC-ala-asp
+ 1 -3.12738E-01 6.68777E-01
+ 2 -3.05225E-01 1.41344E-01
+ 3 1.92434E-01 9.72087E-02
+ 4 -9.11393E-03 -8.32133E-03
+4 0 *********** SCCC-ala-his
+ 1 -3.76833E-01 6.34999E-01
+ 2 -3.15185E-01 1.55491E-01
+ 3 2.33508E-01 7.55190E-02
+ 4 -2.55150E-02 -1.56111E-03
+4 0 *********** SCCC-ala-arg
+ 1 -3.16390E-01 3.97000E-01
+ 2 -8.43265E-02 1.56751E-01
+ 3 1.90132E-01 1.26901E-01
+ 4 -4.23054E-02 7.02945E-03
+4 0 *********** SCCC-ala-lys
+ 1 -3.22229E-01 3.43068E-01
+ 2 -5.16360E-02 1.65308E-01
+ 3 1.99295E-01 1.28740E-01
+ 4 -4.76730E-02 7.50734E-03
+4 0 *********** SCCC-ala-pro
+ 1 -5.56238E-01 6.96095E-01
+ 2 -5.44022E-01 4.66789E-04
+ 3 3.39968E-01 2.04296E-01
+ 4 -8.56865E-03 7.00255E-02
+4 0 *********** SCCC-gly-cys
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-met
+4 0 *********** SCCC-gly-met
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-phe
+4 0 *********** SCCC-gly-phe
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-ile
+4 0 *********** SCCC-gly-ile
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-leu
+4 0 *********** SCCC-gly-leu
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-val
+4 0 *********** SCCC-gly-val
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-trp
+4 0 *********** SCCC-gly-trp
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-tyr
+4 0 *********** SCCC-gly-tyr
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-ala
+4 0 *********** SCCC-gly-ala
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-gly
+4 0 *********** SCCC-gly-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-thr
+4 0 *********** SCCC-gly-thr
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-ser
+4 0 *********** SCCC-gly-ser
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-gln
+4 0 *********** SCCC-gly-gln
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-asn
+4 0 *********** SCCC-gly-asn
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-glu
+4 0 *********** SCCC-gly-glu
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-asp
+4 0 *********** SCCC-gly-asp
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-his
+4 0 *********** SCCC-gly-his
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-arg
+4 0 *********** SCCC-gly-arg
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-lys
+4 0 *********** SCCC-gly-lys
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-gly-pro
+4 0 *********** SCCC-gly-pro
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCC-thr-cys
- 1 8.32563E-01 8.08879E-01
- 2 3.57328E-01 9.78401E-02
- 3 -3.63137E-01 -9.70564E-03
- 4 2.66765E-01 1.17309E-01
- 5 -4.37874E-01 3.16611E-02
- 6 1.16901E-01 4.67637E-02
-6 0 *********** SCCC-thr-met
- 1 5.98636E-01 6.99714E-01
- 2 3.33001E-01 2.93033E-01
- 3 -4.75809E-01 1.82632E-01
- 4 2.24419E-01 1.68548E-01
- 5 -5.07322E-01 5.23455E-02
- 6 1.03476E-01 3.73493E-02
-6 0 *********** SCCC-thr-phe
- 1 5.88356E-01 7.88856E-01
- 2 2.66394E-01 2.79391E-01
- 3 -4.74637E-01 1.30112E-01
- 4 2.42054E-01 1.54923E-01
- 5 -4.92848E-01 5.25536E-02
- 6 1.05678E-01 4.26401E-02
-6 0 *********** SCCC-thr-ile
- 1 7.05281E-01 5.48646E-01
- 2 4.38507E-01 3.15510E-01
- 3 -4.98788E-01 2.27750E-01
- 4 2.33374E-01 1.75804E-01
- 5 -5.34601E-01 6.37072E-02
- 6 1.07677E-01 3.65862E-02
-6 0 *********** SCCC-thr-leu
- 1 5.86404E-01 7.78484E-01
- 2 2.55581E-01 3.74103E-01
- 3 -5.38578E-01 2.01393E-01
- 4 2.20606E-01 1.65948E-01
- 5 -5.30680E-01 5.31875E-02
- 6 1.00590E-01 3.45381E-02
-6 0 *********** SCCC-thr-val
- 1 6.43916E-01 6.00922E-01
- 2 3.87998E-01 3.60398E-01
- 3 -5.24131E-01 2.36106E-01
- 4 2.33285E-01 1.74430E-01
- 5 -5.51531E-01 6.30644E-02
- 6 1.05033E-01 3.86181E-02
-6 0 *********** SCCC-thr-trp
- 1 5.96859E-01 6.90340E-01
- 2 3.32129E-01 2.02591E-01
- 3 -4.29449E-01 1.03608E-01
- 4 2.61626E-01 1.41779E-01
- 5 -4.68141E-01 4.37905E-02
- 6 1.18551E-01 3.49514E-02
-6 0 *********** SCCC-thr-tyr
- 1 5.83316E-01 7.80132E-01
- 2 2.70011E-01 2.73516E-01
- 3 -4.70458E-01 1.29151E-01
- 4 2.44468E-01 1.54790E-01
- 5 -4.91058E-01 5.21678E-02
- 6 1.06702E-01 4.47762E-02
-6 0 *********** SCCC-thr-ala
- 1 3.97083E-01 6.93290E-01
- 2 2.70774E-01 2.83717E-01
- 3 -4.66583E-01 1.71510E-01
- 4 2.36669E-01 1.50950E-01
- 5 -4.88763E-01 3.86267E-02
- 6 1.08873E-01 3.85994E-02
-6 0 *********** SCCC-thr-gly
- 1 -1.02721E+00 -1.33067E+00
- 2 4.63522E-01 -3.81224E-01
- 3 -5.76703E-01 -1.14932E-01
- 4 3.20096E-01 -1.40888E-01
- 5 -5.62349E-01 -4.72779E-02
- 6 1.30272E-01 -1.29983E-01
-6 0 *********** SCCC-thr-thr
- 1 5.48269E-01 8.35271E-01
- 2 1.54579E-01 3.26590E-01
- 3 -5.77112E-01 7.37547E-02
- 4 2.21575E-01 9.24808E-02
- 5 -4.71171E-01 4.35522E-02
- 6 1.05411E-01 3.62209E-02
-6 0 *********** SCCC-thr-ser
- 1 1.32606E+00 8.98733E-01
- 2 3.98753E-01 8.37870E-02
- 3 -4.00202E-01 -2.03287E-01
- 4 3.92374E-01 -7.12615E-03
- 5 -4.15711E-01 3.72993E-02
- 6 1.28295E-01 5.38160E-02
-6 0 *********** SCCC-thr-gln
- 1 6.85037E-01 6.82197E-01
- 2 4.02586E-01 1.74420E-01
- 3 -3.92886E-01 1.06238E-01
- 4 2.41866E-01 1.46791E-01
- 5 -4.60859E-01 3.95459E-02
- 6 1.13622E-01 4.29170E-02
-6 0 *********** SCCC-thr-asn
- 1 6.57885E-01 8.63875E-01
- 2 3.75405E-01 -6.01477E-02
- 3 -2.04212E-01 -9.19281E-02
- 4 2.58741E-01 9.43649E-02
- 5 -3.65557E-01 -1.76104E-02
- 6 1.21870E-01 2.97593E-02
-6 0 *********** SCCC-thr-glu
- 1 7.75619E-01 7.38694E-01
- 2 3.83901E-01 2.13260E-01
- 3 -4.24967E-01 1.01456E-01
- 4 2.43435E-01 1.45638E-01
- 5 -4.77337E-01 4.62659E-02
- 6 1.10827E-01 3.10636E-02
-6 0 *********** SCCC-thr-asp
- 1 6.23849E-01 1.01012E+00
- 2 1.67001E-01 1.37058E-01
- 3 -3.77943E-01 -2.15966E-02
- 4 2.47393E-01 1.48768E-01
- 5 -4.45190E-01 5.06968E-02
- 6 9.20057E-02 5.77854E-02
-6 0 *********** SCCC-thr-his
- 1 1.00870E+00 8.73694E-01
- 2 4.69437E-01 1.29476E-01
- 3 -3.08284E-01 3.06236E-03
- 4 2.55697E-01 1.03148E-01
- 5 -4.08824E-01 1.28049E-02
- 6 1.16857E-01 5.43271E-02
-6 0 *********** SCCC-thr-arg
- 1 5.58705E-01 7.08321E-01
- 2 3.18998E-01 3.26964E-01
- 3 -4.86797E-01 1.97854E-01
- 4 2.26461E-01 1.65600E-01
- 5 -5.12786E-01 5.03267E-02
- 6 1.02765E-01 3.93492E-02
-6 0 *********** SCCC-thr-lys
- 1 5.26444E-01 7.17485E-01
- 2 3.21766E-01 3.44961E-01
- 3 -4.86557E-01 2.13152E-01
- 4 2.11916E-01 1.71711E-01
- 5 -5.17160E-01 5.24634E-02
- 6 9.62397E-02 4.47782E-02
-6 0 *********** SCCC-thr-pro
- 1 -4.91137E+01 1.05163E+01
- 2 3.95211E+01 -2.26299E+01
- 3 -2.51407E+01 2.52838E+01
- 4 1.27288E+01 -2.25806E+01
- 5 -3.01432E+00 1.27718E+01
- 6 -5.89347E-02 4.71121E+01
-6 0 *********** SCCC-ser-cys
- 1 5.96568E-02 -2.64486E-02
- 2 2.90314E-01 -1.77525E-01
- 3 1.08183E-02 -3.16420E-01
- 4 -3.03842E-01 2.44837E-01
- 5 1.45360E-01 -1.48637E-01
- 6 -1.71990E-01 -3.94255E-01
-6 0 *********** SCCC-ser-met
- 1 3.82460E-02 -6.50637E-04
- 2 1.30530E-01 -9.03176E-02
- 3 -3.07079E-02 -2.20618E-01
- 4 -2.09057E-01 2.45648E-01
- 5 1.08448E-01 -9.65036E-02
- 6 -1.20940E-01 -3.24224E-01
-6 0 *********** SCCC-ser-phe
- 1 3.16874E-02 1.51406E-02
- 2 1.49908E-01 -1.02225E-01
- 3 -1.21842E-02 -2.21147E-01
- 4 -2.15510E-01 2.47439E-01
- 5 1.17487E-01 -1.03605E-01
- 6 -1.24396E-01 -3.29061E-01
-6 0 *********** SCCC-ser-ile
- 1 8.02785E-02 -4.88144E-02
- 2 7.19947E-02 -1.07412E-01
- 3 -6.19658E-02 -2.40820E-01
- 4 -1.90729E-01 2.23428E-01
- 5 8.67548E-02 -8.83213E-02
- 6 -1.12671E-01 -3.16937E-01
-6 0 *********** SCCC-ser-leu
- 1 3.61863E-02 1.15400E-02
- 2 8.20527E-02 -1.02535E-01
- 3 -2.80915E-02 -2.03699E-01
- 4 -1.93852E-01 2.57197E-01
- 5 1.03572E-01 -9.02309E-02
- 6 -1.09038E-01 -3.06033E-01
-6 0 *********** SCCC-ser-val
- 1 6.76412E-02 -2.87681E-02
- 2 5.10756E-02 -9.39284E-02
- 3 -5.22726E-02 -2.22931E-01
- 4 -1.71271E-01 2.19417E-01
- 5 8.62457E-02 -8.65418E-02
- 6 -1.09418E-01 -3.08644E-01
-6 0 *********** SCCC-ser-trp
- 1 3.99646E-02 -8.68878E-04
- 2 1.70158E-01 -1.03379E-01
- 3 -1.51019E-02 -2.36384E-01
- 4 -2.20868E-01 2.37546E-01
- 5 1.19729E-01 -1.07667E-01
- 6 -1.31324E-01 -3.35997E-01
-6 0 *********** SCCC-ser-tyr
- 1 3.14511E-02 1.47403E-02
- 2 1.49614E-01 -1.01222E-01
- 3 -1.25592E-02 -2.20533E-01
- 4 -2.14980E-01 2.47535E-01
- 5 1.17541E-01 -1.03255E-01
- 6 -1.24167E-01 -3.19233E-01
-6 0 *********** SCCC-ser-ala
- 1 1.59316E-03 3.25206E-02
- 2 1.02072E-01 -3.08049E-02
- 3 -3.74334E-02 -1.70457E-01
- 4 -1.86500E-01 2.46005E-01
- 5 9.38317E-02 -8.28787E-02
- 6 -1.10836E-01 -3.06507E-01
-6 0 *********** SCCC-ser-gly
- 1 -6.91339E-01 -3.35750E-01
- 2 3.48382E-01 1.28857E-01
- 3 3.87594E-02 -2.88128E-02
- 4 -4.67894E-02 6.29824E-02
- 5 7.48372E-02 -3.80196E-02
- 6 -8.72946E-02 -1.89737E-01
-6 0 *********** SCCC-ser-thr
- 1 4.00985E-02 2.34336E-02
- 2 1.20183E-01 -1.09421E-01
- 3 -2.72808E-02 -2.17048E-01
- 4 -2.20068E-01 2.04931E-01
- 5 9.42640E-02 -9.75846E-02
- 6 -1.09821E-01 -2.85694E-01
-6 0 *********** SCCC-ser-ser
- 1 1.40588E-01 -7.79212E-02
- 2 2.20739E-01 -3.38745E-01
- 3 1.47935E-02 -3.73264E-01
- 4 -3.28036E-01 2.86341E-01
- 5 1.30602E-01 -1.57721E-01
- 6 -1.54242E-01 -4.10916E-01
-6 0 *********** SCCC-ser-gln
- 1 4.36549E-02 -1.44905E-02
- 2 2.21604E-01 -1.04888E-01
- 3 -1.64046E-02 -2.63291E-01
- 4 -2.47573E-01 2.34899E-01
- 5 1.26273E-01 -1.18725E-01
- 6 -1.47698E-01 -3.55301E-01
-6 0 *********** SCCC-ser-asn
- 1 -1.59205E-02 -4.55770E-03
- 2 4.53040E-01 -6.12706E-02
- 3 2.02264E-02 -3.29615E-01
- 4 -3.37749E-01 2.05347E-01
- 5 1.87789E-01 -1.71679E-01
- 6 -2.24535E-01 -4.28821E-01
-6 0 *********** SCCC-ser-glu
- 1 6.26798E-02 -2.02219E-02
- 2 2.08694E-01 -1.43014E-01
- 3 -8.43012E-03 -2.77504E-01
- 4 -2.49906E-01 2.37234E-01
- 5 1.25206E-01 -1.23453E-01
- 6 -1.45452E-01 -3.64876E-01
-6 0 *********** SCCC-ser-asp
- 1 -2.06605E-03 2.20246E-02
- 2 3.12050E-01 -1.03313E-01
- 3 1.57789E-02 -2.66623E-01
- 4 -2.98573E-01 2.62920E-01
- 5 1.65979E-01 -1.38166E-01
- 6 -1.67273E-01 -3.84371E-01
-6 0 *********** SCCC-ser-his
- 1 6.08383E-02 -3.57776E-02
- 2 3.54080E-01 -1.64782E-01
- 3 1.17786E-02 -3.49443E-01
- 4 -3.33582E-01 2.29328E-01
- 5 1.46423E-01 -1.66063E-01
- 6 -1.93310E-01 -4.16547E-01
-6 0 *********** SCCC-ser-arg
- 1 3.00992E-02 8.83367E-03
- 2 1.06994E-01 -6.99820E-02
- 3 -3.25076E-02 -2.03833E-01
- 4 -1.91898E-01 2.46992E-01
- 5 1.04150E-01 -8.99912E-02
- 6 -1.12257E-01 -3.22987E-01
-6 0 *********** SCCC-ser-lys
- 1 2.12652E-02 1.82776E-02
- 2 1.10454E-01 -4.58432E-02
- 3 -3.63510E-02 -1.93235E-01
- 4 -1.88380E-01 2.35245E-01
- 5 9.60389E-02 -8.79188E-02
- 6 -1.13128E-01 -3.11062E-01
-6 0 *********** SCCC-ser-pro
- 1 -5.17468E+01 1.34634E+01
- 2 4.14445E+01 -2.37927E+01
- 3 -2.70753E+01 2.77597E+01
- 4 1.37519E+01 -2.34356E+01
- 5 -3.50940E+00 1.34343E+01
- 6 1.01337E-01 5.09372E+01
-6 0 *********** SCCC-gln-cys
- 1 6.19920E-01 8.13881E-01
- 2 1.49287E-01 -1.64915E-01
- 3 -5.69623E-02 -9.08789E-02
- 4 1.46020E-02 1.04750E-01
- 5 -1.40402E-01 -4.99878E-02
- 6 2.49452E-02 3.03150E-02
-6 0 *********** SCCC-gln-met
- 1 5.05788E-01 7.24826E-01
- 2 3.66015E-02 9.02199E-02
- 3 -2.36417E-01 2.97539E-02
- 4 2.11385E-02 1.07834E-01
- 5 -1.63119E-01 -9.81862E-03
- 6 2.16788E-02 2.12837E-02
-6 0 *********** SCCC-gln-phe
- 1 4.70961E-01 7.98361E-01
- 2 2.54748E-03 3.76038E-02
- 3 -1.85176E-01 7.79596E-03
- 4 1.89187E-02 1.37878E-01
- 5 -1.74129E-01 -1.37478E-02
- 6 2.25815E-02 1.98994E-02
-6 0 *********** SCCC-gln-ile
- 1 6.28377E-01 6.04000E-01
- 2 6.35174E-02 1.33723E-01
- 3 -2.97090E-01 1.34064E-02
- 4 4.98742E-02 6.90106E-02
- 5 -1.66040E-01 -8.02895E-03
- 6 3.69449E-02 5.56713E-03
-6 0 *********** SCCC-gln-leu
- 1 4.72890E-01 7.79488E-01
- 2 -6.28442E-02 1.03885E-01
- 3 -2.51321E-01 2.08490E-02
- 4 3.39730E-02 1.24225E-01
- 5 -1.76517E-01 -4.80265E-03
- 6 2.23859E-02 1.71108E-02
-6 0 *********** SCCC-gln-val
- 1 5.74721E-01 6.46458E-01
- 2 1.06278E-02 1.57654E-01
- 3 -2.97707E-01 2.43488E-02
- 4 4.86666E-02 8.12344E-02
- 5 -1.80013E-01 -8.52930E-03
- 6 3.68176E-02 4.07321E-03
-6 0 *********** SCCC-gln-trp
- 1 5.13153E-01 7.30318E-01
- 2 7.54208E-02 2.21936E-02
- 3 -1.73995E-01 7.50318E-03
- 4 2.11849E-02 1.20679E-01
- 5 -1.64720E-01 -1.74507E-02
- 6 2.51947E-02 1.72030E-02
-6 0 *********** SCCC-gln-tyr
- 1 4.70921E-01 7.92874E-01
- 2 6.77366E-03 3.82328E-02
- 3 -1.84698E-01 1.05276E-02
- 4 1.88059E-02 1.38061E-01
- 5 -1.73829E-01 -1.36343E-02
- 6 2.25507E-02 1.36583E-02
-6 0 *********** SCCC-gln-ala
- 1 3.69251E-01 7.27444E-01
- 2 6.63929E-03 1.36479E-01
- 3 -2.45551E-01 8.02141E-02
- 4 9.06175E-03 1.28499E-01
- 5 -1.77548E-01 -4.38042E-03
- 6 9.20073E-03 2.85368E-02
-6 0 *********** SCCC-gln-gly
- 1 -7.22745E-01 -1.09045E+00
- 2 5.44142E-01 -2.09872E-01
- 3 -2.18223E-01 -1.29760E-01
- 4 2.46786E-01 -8.85457E-02
- 5 -2.13314E-01 -3.32257E-02
- 6 1.01561E-01 -1.39519E-01
-6 0 *********** SCCC-gln-thr
- 1 4.22293E-01 8.31313E-01
- 2 -8.32731E-02 4.80400E-02
- 3 -2.35615E-01 -6.42757E-02
- 4 2.22581E-02 1.48531E-01
- 5 -2.21094E-01 -2.36333E-02
- 6 3.54847E-02 -2.75290E-02
-6 0 *********** SCCC-gln-ser
- 1 8.69877E-01 8.46565E-01
- 2 7.30682E-02 -3.98258E-01
- 3 4.51137E-02 -3.06602E-01
- 4 5.38263E-02 7.88580E-02
- 5 -2.01244E-01 -1.06450E-01
- 6 3.67810E-02 -1.98634E-02
-6 0 *********** SCCC-gln-gln
- 1 5.67770E-01 7.16574E-01
- 2 1.50798E-01 2.45099E-03
- 3 -1.64339E-01 -5.00639E-03
- 4 1.63129E-02 9.22049E-02
- 5 -1.42578E-01 -2.16609E-02
- 6 2.00936E-02 3.52049E-02
-6 0 *********** SCCC-gln-asn
- 1 4.62889E-01 8.68838E-01
- 2 3.11602E-01 -2.06151E-01
- 3 3.61334E-02 -5.29737E-02
- 4 -1.11575E-02 1.01190E-01
- 5 -9.44999E-02 -5.65185E-02
- 6 3.78825E-03 6.85606E-02
-6 0 *********** SCCC-gln-glu
- 1 6.09398E-01 7.52307E-01
- 2 1.07718E-01 -2.77827E-02
- 3 -1.52611E-01 -4.61129E-02
- 4 3.19422E-02 9.27534E-02
- 5 -1.47599E-01 -2.55141E-02
- 6 2.67408E-02 2.14595E-02
-6 0 *********** SCCC-gln-asp
- 1 3.97986E-01 9.69397E-01
- 2 5.71165E-02 -1.68059E-01
- 3 -2.55939E-02 -3.65483E-02
- 4 -3.84171E-02 1.82735E-01
- 5 -1.69647E-01 -6.00285E-02
- 6 1.51944E-02 2.41515E-02
-6 0 *********** SCCC-gln-his
- 1 6.88039E-01 8.30782E-01
- 2 2.41703E-01 -1.64020E-01
- 3 -3.34982E-02 -1.27367E-01
- 4 5.09587E-02 6.00642E-02
- 5 -9.87080E-02 -4.28469E-02
- 6 1.53293E-02 5.48758E-02
-6 0 *********** SCCC-gln-arg
- 1 4.76559E-01 7.32603E-01
- 2 1.32051E-02 1.26312E-01
- 3 -2.47640E-01 4.30225E-02
- 4 2.92951E-02 1.08682E-01
- 5 -1.69216E-01 -1.01814E-02
- 6 2.00014E-02 1.54620E-02
-6 0 *********** SCCC-gln-lys
- 1 4.47638E-01 7.37720E-01
- 2 1.93114E-02 1.55042E-01
- 3 -2.60444E-01 5.62681E-02
- 4 2.06389E-02 1.10199E-01
- 5 -1.72985E-01 -5.46247E-03
- 6 1.69432E-02 2.26239E-02
-6 0 *********** SCCC-gln-pro
- 1 -4.27841E+01 9.97581E+00
- 2 3.50155E+01 -1.92289E+01
- 3 -2.18771E+01 2.26068E+01
- 4 1.12115E+01 -1.93011E+01
- 5 -2.67923E+00 1.13642E+01
- 6 -1.44351E-01 4.14659E+01
-6 0 *********** SCCC-asn-cys
- 1 7.57387E-01 1.17372E+00
- 2 2.08398E-01 3.61800E-01
- 3 -1.28940E-01 -1.34420E-01
- 4 -3.78568E-01 2.55784E-01
- 5 1.27969E-02 -9.23544E-02
- 6 -2.14845E-01 -2.48316E-01
-6 0 *********** SCCC-asn-met
- 1 6.58423E-01 1.08695E+00
- 2 -1.01501E-02 5.41949E-01
- 3 -3.24950E-01 -6.13778E-03
- 4 -3.78494E-01 2.75292E-01
- 5 -2.17686E-02 -4.45267E-02
- 6 -1.80203E-01 -2.28603E-01
-6 0 *********** SCCC-asn-phe
- 1 6.04183E-01 1.15616E+00
- 2 -2.22415E-02 4.88891E-01
- 3 -2.74865E-01 -1.35301E-02
- 4 -3.89501E-01 2.94722E-01
- 5 -2.66922E-02 -4.88006E-02
- 6 -1.93140E-01 -2.14603E-01
-6 0 *********** SCCC-asn-ile
- 1 8.68767E-01 1.00859E+00
- 2 1.08194E-02 5.96323E-01
- 3 -3.55379E-01 2.69439E-02
- 4 -3.65665E-01 2.69668E-01
- 5 -6.80051E-02 -2.87496E-02
- 6 -1.69257E-01 -2.23131E-01
-6 0 *********** SCCC-asn-leu
- 1 6.39806E-01 1.18521E+00
- 2 -1.47182E-01 5.47256E-01
- 3 -3.79392E-01 -2.05691E-02
- 4 -3.87483E-01 2.62638E-01
- 5 -9.68320E-03 -5.49221E-02
- 6 -1.63309E-01 -2.17459E-01
-6 0 *********** SCCC-asn-val
- 1 8.01419E-01 1.05188E+00
- 2 -6.25009E-02 6.01031E-01
- 3 -3.69780E-01 3.37962E-02
- 4 -3.66816E-01 2.58004E-01
- 5 -6.44692E-02 -4.02186E-02
- 6 -1.67954E-01 -2.15854E-01
-6 0 *********** SCCC-asn-trp
- 1 6.29497E-01 1.04140E+00
- 2 7.64047E-02 4.51765E-01
- 3 -2.25870E-01 -1.59904E-02
- 4 -3.62734E-01 2.90501E-01
- 5 -2.33286E-02 -4.19931E-02
- 6 -1.96059E-01 -2.15681E-01
-6 0 *********** SCCC-asn-tyr
- 1 6.03020E-01 1.14475E+00
- 2 -1.42640E-02 4.87177E-01
- 3 -2.71612E-01 -8.62896E-03
- 4 -3.89546E-01 2.98438E-01
- 5 -2.81881E-02 -4.66818E-02
- 6 -1.94007E-01 -2.18886E-01
-6 0 *********** SCCC-asn-ala
- 1 4.44178E-01 9.82931E-01
- 2 -3.99901E-02 4.87516E-01
- 3 -3.01729E-01 1.18280E-03
- 4 -3.58125E-01 2.98468E-01
- 5 -1.25165E-02 -3.03695E-02
- 6 -1.78807E-01 -2.23879E-01
-6 0 *********** SCCC-asn-gly
- 1 -4.09165E-01 -1.51631E+00
- 2 4.37973E-01 -1.76964E-01
- 3 -2.26521E-01 -1.86394E-01
- 4 2.98630E-02 1.18900E-01
- 5 3.27733E-03 -2.59213E-03
- 6 -1.39487E-02 -3.69516E-01
-6 0 *********** SCCC-asn-thr
- 1 4.96208E-01 1.18979E+00
- 2 -2.28681E-01 3.61901E-01
- 3 -2.94898E-01 -2.11223E-01
- 4 -3.14997E-01 1.24589E-01
- 5 3.17801E-02 -9.16300E-02
- 6 -1.27034E-01 -1.86999E-01
-6 0 *********** SCCC-asn-ser
- 1 1.23481E+00 1.37669E+00
- 2 1.99543E-01 1.94487E-01
- 3 -1.48591E-02 -3.48656E-01
- 4 -2.78271E-01 1.86041E-01
- 5 5.08018E-02 -1.38951E-01
- 6 -1.77798E-01 -2.50169E-01
-6 0 *********** SCCC-asn-gln
- 1 7.05576E-01 1.05754E+00
- 2 1.58314E-01 4.94734E-01
- 3 -2.25017E-01 -3.59773E-02
- 4 -3.65323E-01 2.70171E-01
- 5 -9.78863E-03 -5.55620E-02
- 6 -2.00555E-01 -2.36492E-01
-6 0 *********** SCCC-asn-asn
- 1 4.56341E-01 1.06248E+00
- 2 4.15620E-01 2.75930E-01
- 3 3.50941E-02 -1.79722E-01
- 4 -3.60820E-01 2.53045E-01
- 5 8.30759E-02 -1.28723E-01
- 6 -2.35606E-01 -2.85719E-01
-6 0 *********** SCCC-asn-glu
- 1 7.87120E-01 1.15846E+00
- 2 1.06329E-01 4.95932E-01
- 3 -2.35554E-01 -5.44747E-02
- 4 -3.71067E-01 2.59159E-01
- 5 -1.40937E-02 -6.53582E-02
- 6 -1.96601E-01 -2.27803E-01
-6 0 *********** SCCC-asn-asp
- 1 4.57735E-01 1.29630E+00
- 2 1.08738E-01 3.62424E-01
- 3 -1.16064E-01 -7.77284E-02
- 4 -4.46510E-01 3.50590E-01
- 5 1.34213E-02 -9.38743E-02
- 6 -2.18759E-01 -2.57333E-01
-6 0 *********** SCCC-asn-his
- 1 8.95034E-01 1.28940E+00
- 2 2.81060E-01 4.57974E-01
- 3 -1.06631E-01 -1.77331E-01
- 4 -3.43081E-01 2.33512E-01
- 5 4.07713E-02 -1.01495E-01
- 6 -2.10261E-01 -2.74472E-01
-6 0 *********** SCCC-asn-arg
- 1 6.23023E-01 1.08801E+00
- 2 -5.19791E-02 5.56089E-01
- 3 -3.36815E-01 6.89070E-03
- 4 -3.67225E-01 2.81556E-01
- 5 -1.55243E-02 -3.76958E-02
- 6 -1.69889E-01 -2.21766E-01
-6 0 *********** SCCC-asn-lys
- 1 5.95443E-01 1.09271E+00
- 2 -5.50234E-02 5.88178E-01
- 3 -3.48887E-01 1.39484E-02
- 4 -3.76230E-01 2.72531E-01
- 5 -2.99277E-02 -4.43221E-02
- 6 -1.74704E-01 -2.29840E-01
-6 0 *********** SCCC-asn-pro
- 1 -4.36021E+01 9.31235E+00
- 2 3.61388E+01 -2.08332E+01
- 3 -2.29444E+01 2.28950E+01
- 4 1.11539E+01 -2.03052E+01
- 5 -2.99632E+00 1.12710E+01
- 6 -1.81921E-01 4.34059E+01
-6 0 *********** SCCC-glu-cys
- 1 3.33512E-01 4.66991E-01
- 2 1.59731E-01 -4.01375E-01
- 3 -3.44602E-02 -1.51384E-01
- 4 5.19689E-03 6.91636E-02
- 5 -1.38117E-01 -6.87922E-02
- 6 2.46165E-02 2.36173E-02
-6 0 *********** SCCC-glu-met
- 1 2.56991E-01 4.21078E-01
- 2 4.76280E-02 -1.53929E-01
- 3 -1.55020E-01 -6.06431E-02
- 4 6.80921E-02 8.66971E-02
- 5 -1.32350E-01 -1.54234E-02
- 6 3.03586E-02 1.75688E-02
-6 0 *********** SCCC-glu-phe
- 1 2.35017E-01 4.69454E-01
- 2 3.87623E-02 -1.96182E-01
- 3 -1.12899E-01 -6.76006E-02
- 4 5.66148E-02 1.06752E-01
- 5 -1.36615E-01 -2.78645E-02
- 6 3.59205E-02 1.53178E-02
-6 0 *********** SCCC-glu-ile
- 1 3.39594E-01 3.25064E-01
- 2 3.06237E-02 -1.22277E-01
- 3 -2.24279E-01 -8.99189E-02
- 4 9.20531E-02 5.77965E-02
- 5 -1.54817E-01 -2.89931E-03
- 6 3.39350E-02 5.44686E-03
-6 0 *********** SCCC-glu-leu
- 1 2.34542E-01 4.50329E-01
- 2 -2.42988E-02 -1.42929E-01
- 3 -1.56639E-01 -5.72378E-02
- 4 8.04432E-02 1.06976E-01
- 5 -1.41417E-01 -1.31820E-02
- 6 3.37294E-02 7.81027E-03
-6 0 *********** SCCC-glu-val
- 1 3.04441E-01 3.57569E-01
- 2 -1.82237E-03 -9.72650E-02
- 3 -2.13031E-01 -7.56021E-02
- 4 9.67684E-02 6.88332E-02
- 5 -1.59675E-01 -5.53540E-03
- 6 3.78832E-02 -2.20207E-03
-6 0 *********** SCCC-glu-trp
- 1 2.66542E-01 4.32477E-01
- 2 8.08095E-02 -2.06363E-01
- 3 -1.16454E-01 -7.70560E-02
- 4 5.41125E-02 8.82847E-02
- 5 -1.35835E-01 -3.01160E-02
- 6 3.47368E-02 1.85433E-02
-6 0 *********** SCCC-glu-tyr
- 1 2.35221E-01 4.67152E-01
- 2 4.04274E-02 -1.94587E-01
- 3 -1.13486E-01 -6.62534E-02
- 4 5.69888E-02 1.06227E-01
- 5 -1.36087E-01 -2.76945E-02
- 6 3.58774E-02 1.27312E-02
-6 0 *********** SCCC-glu-ala
- 1 1.69035E-01 4.42803E-01
- 2 2.89655E-02 -7.52938E-02
- 3 -1.63365E-01 -7.44405E-03
- 4 6.54211E-02 1.00646E-01
- 5 -1.29408E-01 -1.14088E-02
- 6 2.27846E-02 1.60999E-02
-6 0 *********** SCCC-glu-gly
- 1 -8.22924E-01 -6.34724E-01
- 2 6.76612E-01 -9.84566E-02
- 3 -1.68396E-01 -1.15440E-01
- 4 2.46173E-01 -4.77953E-02
- 5 -1.51223E-01 -1.97809E-02
- 6 1.04465E-01 -1.11350E-01
-6 0 *********** SCCC-glu-thr
- 1 2.09783E-01 4.78479E-01
- 2 -3.90372E-03 -1.78651E-01
- 3 -1.45133E-01 -1.04531E-01
- 4 4.69095E-02 1.37830E-01
- 5 -1.87970E-01 -3.53152E-02
- 6 4.61696E-02 -4.02489E-02
-6 0 *********** SCCC-glu-ser
- 1 4.98899E-01 4.37018E-01
- 2 6.44045E-02 -6.41362E-01
- 3 6.21033E-03 -3.17047E-01
- 4 -4.79588E-02 5.38711E-02
- 5 -2.56969E-01 -1.43913E-01
- 6 1.99031E-02 -3.10343E-02
-6 0 *********** SCCC-glu-gln
- 1 2.97195E-01 4.17592E-01
- 2 1.41035E-01 -2.37389E-01
- 3 -1.12095E-01 -9.31183E-02
- 4 4.31058E-02 6.44466E-02
- 5 -1.25040E-01 -3.15769E-02
- 6 2.50882E-02 2.66721E-02
-6 0 *********** SCCC-glu-asn
- 1 2.29189E-01 5.21923E-01
- 2 3.46864E-01 -3.90701E-01
- 3 2.45942E-02 -1.02180E-01
- 4 -1.74140E-02 3.97879E-02
- 5 -7.74177E-02 -6.87613E-02
- 6 2.36128E-04 8.19054E-02
-6 0 *********** SCCC-glu-glu
- 1 3.24613E-01 4.28595E-01
- 2 1.08077E-01 -2.77879E-01
- 3 -1.00919E-01 -1.23536E-01
- 4 4.50556E-02 6.94494E-02
- 5 -1.39812E-01 -3.87442E-02
- 6 2.94975E-02 2.38997E-02
-6 0 *********** SCCC-glu-asp
- 1 1.92328E-01 5.62603E-01
- 2 1.54220E-01 -3.59290E-01
- 3 -5.51252E-03 -8.00701E-02
- 4 -1.02797E-02 1.10605E-01
- 5 -1.12974E-01 -6.69321E-02
- 6 2.21348E-02 4.10611E-02
-6 0 *********** SCCC-glu-his
- 1 3.61271E-01 4.62013E-01
- 2 2.39313E-01 -4.17066E-01
- 3 -2.69128E-02 -1.78088E-01
- 4 6.86302E-03 3.31232E-02
- 5 -1.27321E-01 -6.85221E-02
- 6 5.82074E-03 4.29599E-02
-6 0 *********** SCCC-glu-arg
- 1 2.36243E-01 4.27868E-01
- 2 3.00951E-02 -1.15300E-01
- 3 -1.61246E-01 -4.69868E-02
- 4 7.99735E-02 8.78959E-02
- 5 -1.35201E-01 -1.49564E-02
- 6 2.89505E-02 1.16463E-02
-6 0 *********** SCCC-glu-lys
- 1 2.14334E-01 4.32615E-01
- 2 3.99828E-02 -8.56384E-02
- 3 -1.68950E-01 -3.51767E-02
- 4 7.57784E-02 8.95872E-02
- 5 -1.33896E-01 -9.75700E-03
- 6 2.75828E-02 1.12341E-02
-6 0 *********** SCCC-glu-pro
- 1 -6.03395E+01 1.53246E+01
- 2 4.89956E+01 -2.73422E+01
- 3 -3.13918E+01 3.21252E+01
- 4 1.58801E+01 -2.73551E+01
- 5 -4.12205E+00 1.60651E+01
- 6 -1.48054E-01 5.94634E+01
-6 0 *********** SCCC-asp-cys
- 1 1.01398E-01 1.01843E+00
- 2 2.96713E-01 7.77802E-01
- 3 -4.55789E-02 -6.04555E-01
- 4 -4.81945E-01 5.47073E-01
- 5 4.96561E-01 -3.47182E-01
- 6 -3.68281E-01 -1.03058E+00
-6 0 *********** SCCC-asp-met
- 1 8.64902E-02 8.97343E-01
- 2 6.60725E-02 7.60140E-01
- 3 -2.33228E-01 -5.34709E-01
- 4 -4.78839E-01 4.19404E-01
- 5 3.94621E-01 -3.16580E-01
- 6 -3.12523E-01 -9.24131E-01
-6 0 *********** SCCC-asp-phe
- 1 -6.78943E-03 9.44651E-01
- 2 6.92742E-02 7.51693E-01
- 3 -1.95415E-01 -5.85413E-01
- 4 -5.01166E-01 4.72714E-01
- 5 4.34243E-01 -3.37999E-01
- 6 -3.38153E-01 -9.88144E-01
-6 0 *********** SCCC-asp-ile
- 1 3.12614E-01 8.47119E-01
- 2 7.40958E-02 7.84262E-01
- 3 -2.59309E-01 -4.76651E-01
- 4 -4.56980E-01 3.78389E-01
- 5 3.40993E-01 -2.96626E-01
- 6 -2.88272E-01 -8.56722E-01
-6 0 *********** SCCC-asp-leu
- 1 3.55098E-02 9.60300E-01
- 2 -3.88031E-02 7.51152E-01
- 3 -2.69089E-01 -6.01118E-01
- 4 -4.89976E-01 4.13485E-01
- 5 4.25671E-01 -3.39868E-01
- 6 -3.11910E-01 -9.66482E-01
-6 0 *********** SCCC-asp-val
- 1 2.29753E-01 8.63296E-01
- 2 1.01385E-02 7.76378E-01
- 3 -2.79216E-01 -5.06076E-01
- 4 -4.63388E-01 3.78804E-01
- 5 3.67536E-01 -3.11700E-01
- 6 -2.86511E-01 -8.93944E-01
-6 0 *********** SCCC-asp-trp
- 1 5.69106E-02 8.67403E-01
- 2 1.59223E-01 7.45429E-01
- 3 -1.58954E-01 -5.29807E-01
- 4 -4.84359E-01 4.83913E-01
- 5 4.06436E-01 -3.10669E-01
- 6 -3.40126E-01 -9.54656E-01
-6 0 *********** SCCC-asp-tyr
- 1 -5.10236E-03 9.35541E-01
- 2 7.58840E-02 7.50839E-01
- 3 -1.93921E-01 -5.79236E-01
- 4 -5.01772E-01 4.74580E-01
- 5 4.31052E-01 -3.35790E-01
- 6 -3.38679E-01 -9.86093E-01
-6 0 *********** SCCC-asp-ala
- 1 -8.08351E-02 7.94725E-01
- 2 3.70684E-02 7.02856E-01
- 3 -2.29891E-01 -5.20819E-01
- 4 -4.73518E-01 4.32160E-01
- 5 3.84946E-01 -2.99467E-01
- 6 -3.12142E-01 -9.09367E-01
-6 0 *********** SCCC-asp-gly
- 1 -1.65198E-01 -1.51943E+00
- 2 3.27189E-01 1.89363E-02
- 3 -8.58367E-02 -3.34181E-01
- 4 -9.91970E-02 1.41845E-01
- 5 7.61626E-02 -9.77067E-02
- 6 -8.86111E-02 -6.11984E-01
-6 0 *********** SCCC-asp-thr
- 1 -1.12033E-01 9.35801E-01
- 2 -3.89147E-02 6.61969E-01
- 3 -1.48782E-01 -7.27168E-01
- 4 -4.32844E-01 4.58700E-01
- 5 4.62044E-01 -3.32022E-01
- 6 -3.43672E-01 -1.01887E+00
-6 0 *********** SCCC-asp-ser
- 1 3.81392E-01 1.24313E+00
- 2 3.41849E-01 8.26265E-01
- 3 9.29866E-02 -8.18342E-01
- 4 -4.20737E-01 6.50498E-01
- 5 6.27310E-01 -3.96091E-01
- 6 -3.96315E-01 -1.24023E+00
-6 0 *********** SCCC-asp-gln
- 1 1.32284E-01 9.00285E-01
- 2 2.14708E-01 7.79347E-01
- 3 -1.48803E-01 -5.02366E-01
- 4 -4.65926E-01 4.63513E-01
- 5 4.03169E-01 -3.03228E-01
- 6 -3.29913E-01 -9.20420E-01
-6 0 *********** SCCC-asp-asn
- 1 -1.31518E-01 9.31468E-01
- 2 4.59779E-01 7.46661E-01
- 3 5.92646E-02 -5.21946E-01
- 4 -4.53030E-01 5.87231E-01
- 5 5.37192E-01 -3.17063E-01
- 6 -3.68526E-01 -1.00485E+00
-6 0 *********** SCCC-asp-glu
- 1 1.70171E-01 9.85753E-01
- 2 1.80671E-01 7.94937E-01
- 3 -1.48722E-01 -5.49940E-01
- 4 -4.72931E-01 4.71782E-01
- 5 4.29471E-01 -3.23801E-01
- 6 -3.35350E-01 -9.57310E-01
-6 0 *********** SCCC-asp-asp
- 1 -2.45680E-01 1.04072E+00
- 2 2.09688E-01 7.42404E-01
- 3 -5.74763E-02 -7.04516E-01
- 4 -5.51587E-01 5.89004E-01
- 5 5.69082E-01 -4.13143E-01
- 6 -3.89834E-01 -1.15660E+00
-6 0 *********** SCCC-asp-his
- 1 2.28403E-01 1.15853E+00
- 2 3.19682E-01 8.47017E-01
- 3 -2.47299E-02 -5.51595E-01
- 4 -4.27205E-01 5.27373E-01
- 5 4.85977E-01 -3.12781E-01
- 6 -3.44694E-01 -9.72863E-01
-6 0 *********** SCCC-asp-arg
- 1 5.81290E-02 8.90656E-01
- 2 2.63559E-02 7.57680E-01
- 3 -2.49384E-01 -5.31822E-01
- 4 -4.75607E-01 4.15715E-01
- 5 3.92803E-01 -3.12919E-01
- 6 -3.06376E-01 -9.03384E-01
-6 0 *********** SCCC-asp-lys
- 1 3.45183E-02 8.88160E-01
- 2 1.04661E-02 7.67404E-01
- 3 -2.62443E-01 -5.18705E-01
- 4 -4.73298E-01 4.01501E-01
- 5 3.84520E-01 -3.11496E-01
- 6 -2.99554E-01 -9.04348E-01
-6 0 *********** SCCC-asp-pro
- 1 -5.87032E+01 1.37268E+01
- 2 4.84918E+01 -2.75769E+01
- 3 -3.14348E+01 3.13599E+01
- 4 1.56551E+01 -2.75889E+01
- 5 -3.90336E+00 1.57657E+01
- 6 -2.15304E-01 5.73576E+01
-6 0 *********** SCCC-his-cys
- 1 4.26129E-01 1.05254E+00
- 2 1.06591E-01 5.80282E-02
- 3 -9.69817E-02 -1.30659E-01
- 4 -1.57220E-02 5.58248E-02
- 5 -1.00912E-01 -4.78612E-02
- 6 -1.55872E-02 1.15355E-02
-6 0 *********** SCCC-his-met
- 1 3.90240E-01 9.14229E-01
- 2 -4.39902E-02 2.16123E-01
- 3 -2.36615E-01 -8.17604E-02
- 4 -1.03937E-01 7.07957E-02
- 5 -8.79604E-02 -4.01881E-02
- 6 -4.45437E-02 -4.22953E-02
-6 0 *********** SCCC-his-phe
- 1 3.42384E-01 9.84345E-01
- 2 -6.26647E-02 1.68303E-01
- 3 -2.05466E-01 -9.04311E-02
- 4 -9.42496E-02 8.27885E-02
- 5 -1.01060E-01 -3.88787E-02
- 6 -4.23188E-02 -2.61596E-02
-6 0 *********** SCCC-his-ile
- 1 5.51948E-01 8.15879E-01
- 2 -3.24603E-02 2.75203E-01
- 3 -2.48522E-01 -9.63950E-02
- 4 -1.22515E-01 6.59116E-02
- 5 -6.14312E-02 -5.14852E-02
- 6 -5.38528E-02 -9.07396E-02
-6 0 *********** SCCC-his-leu
- 1 3.66037E-01 9.69061E-01
- 2 -1.41041E-01 2.07952E-01
- 3 -2.58212E-01 -1.05945E-01
- 4 -1.08600E-01 7.56909E-02
- 5 -8.50347E-02 -3.86772E-02
- 6 -4.62328E-02 -4.63988E-02
-6 0 *********** SCCC-his-val
- 1 4.99194E-01 8.44327E-01
- 2 -8.87063E-02 2.78190E-01
- 3 -2.59519E-01 -9.28997E-02
- 4 -1.28532E-01 7.26125E-02
- 5 -6.13436E-02 -5.18005E-02
- 6 -5.56577E-02 -8.97205E-02
-6 0 *********** SCCC-his-trp
- 1 3.84661E-01 9.17199E-01
- 2 1.15855E-02 1.71292E-01
- 3 -1.84602E-01 -7.41864E-02
- 4 -9.07639E-02 8.09113E-02
- 5 -9.56377E-02 -3.98505E-02
- 6 -4.26114E-02 -3.02919E-02
-6 0 *********** SCCC-his-tyr
- 1 3.42967E-01 9.77574E-01
- 2 -5.78579E-02 1.69299E-01
- 3 -2.05359E-01 -8.69298E-02
- 4 -9.55979E-02 8.36455E-02
- 5 -1.01229E-01 -3.89276E-02
- 6 -4.23963E-02 -2.67324E-02
-6 0 *********** SCCC-his-ala
- 1 2.53050E-01 8.64863E-01
- 2 -7.16073E-02 2.20693E-01
- 3 -2.54647E-01 -4.72402E-02
- 4 -1.18961E-01 8.84736E-02
- 5 -9.61349E-02 -3.48066E-02
- 6 -4.62511E-02 -4.54801E-02
-6 0 *********** SCCC-his-gly
- 1 -2.66886E-01 -1.24960E+00
- 2 3.78467E-01 -8.13890E-02
- 3 -9.73528E-02 -2.68074E-01
- 4 -3.27788E-02 5.12697E-02
- 5 -4.43474E-03 -7.16114E-02
- 6 -5.29240E-02 -4.11709E-01
-6 0 *********** SCCC-his-thr
- 1 3.03006E-01 9.96978E-01
- 2 -1.71501E-01 1.47903E-01
- 3 -1.80822E-01 -1.91221E-01
- 4 -9.22776E-02 7.26861E-02
- 5 -7.27722E-02 -4.24418E-02
- 6 -5.89019E-02 -6.61935E-02
-6 0 *********** SCCC-his-ser
- 1 6.53637E-01 1.19984E+00
- 2 1.66168E-02 -6.22641E-02
- 3 -1.08329E-02 -3.02487E-01
- 4 6.24382E-02 4.28881E-02
- 5 -9.14373E-02 -4.65228E-02
- 6 -1.92292E-02 3.36503E-03
-6 0 *********** SCCC-his-gln
- 1 4.19198E-01 9.21543E-01
- 2 7.86171E-02 1.75810E-01
- 3 -1.74106E-01 -7.84628E-02
- 4 -6.65013E-02 6.09945E-02
- 5 -9.00536E-02 -4.05240E-02
- 6 -3.41653E-02 -2.03566E-02
-6 0 *********** SCCC-his-asn
- 1 2.01316E-01 1.04213E+00
- 2 2.84094E-01 3.14468E-02
- 3 -4.46043E-02 -4.81519E-02
- 4 2.98118E-02 6.87913E-02
- 5 -1.09795E-01 -4.08500E-02
- 6 1.34180E-02 5.75471E-02
-6 0 *********** SCCC-his-glu
- 1 4.61317E-01 9.82251E-01
- 2 3.64251E-02 1.54663E-01
- 3 -1.61095E-01 -1.13872E-01
- 4 -5.61697E-02 5.88642E-02
- 5 -8.55417E-02 -4.25759E-02
- 6 -3.42847E-02 -2.46142E-02
-6 0 *********** SCCC-his-asp
- 1 1.92782E-01 1.14634E+00
- 2 4.09709E-02 1.62176E-02
- 3 -1.09297E-01 -1.00603E-01
- 4 -3.70310E-02 9.06706E-02
- 5 -1.44374E-01 -5.18442E-02
- 6 -4.40291E-03 2.88404E-02
-6 0 *********** SCCC-his-his
- 1 4.50166E-01 1.10493E+00
- 2 1.54484E-01 7.75369E-02
- 3 -6.69497E-02 -1.52702E-01
- 4 4.25305E-02 4.50278E-02
- 5 -7.72572E-02 -3.42156E-02
- 6 -4.13087E-03 2.05909E-02
-6 0 *********** SCCC-his-arg
- 1 3.66429E-01 9.10027E-01
- 2 -7.58621E-02 2.35845E-01
- 3 -2.48634E-01 -7.41660E-02
- 4 -1.10138E-01 7.88516E-02
- 5 -8.24854E-02 -3.84730E-02
- 6 -4.56445E-02 -4.91189E-02
-6 0 *********** SCCC-his-lys
- 1 3.36164E-01 9.03706E-01
- 2 -7.88277E-02 2.55694E-01
- 3 -2.56257E-01 -6.70004E-02
- 4 -1.15889E-01 7.82520E-02
- 5 -8.53364E-02 -3.89155E-02
- 6 -4.83454E-02 -5.72482E-02
-6 0 *********** SCCC-his-pro
- 1 -5.46443E+00 -1.47564E+00
- 2 6.52671E+00 7.04314E-02
- 3 -4.97142E+00 -3.16609E-01
- 4 5.19594E+00 -3.65501E-03
- 5 -4.84378E+00 -8.14439E-02
- 6 2.50003E+00 -4.59432E-01
-6 0 *********** SCCC-arg-cys
- 1 -2.25457E-01 5.67972E-01
- 2 3.42882E-01 2.61249E-01
- 3 1.46928E-01 -6.26437E-01
- 4 -3.62334E-01 4.74250E-01
- 5 4.61470E-01 -3.01303E-01
- 6 -3.16685E-01 -8.88472E-01
-6 0 *********** SCCC-arg-met
- 1 -1.24118E-01 5.29801E-01
- 2 1.28743E-01 3.16688E-01
- 3 -1.83513E-02 -5.14423E-01
- 4 -3.22792E-01 3.96598E-01
- 5 3.20530E-01 -2.12375E-01
- 6 -2.77398E-01 -7.12452E-01
-6 0 *********** SCCC-arg-phe
- 1 -1.84054E-01 5.68944E-01
- 2 1.40271E-01 2.85097E-01
- 3 1.67048E-02 -5.15989E-01
- 4 -3.44075E-01 4.19413E-01
- 5 3.35360E-01 -2.30276E-01
- 6 -2.82041E-01 -7.19142E-01
-6 0 *********** SCCC-arg-ile
- 1 1.55346E-02 4.71838E-01
- 2 1.01262E-01 3.43326E-01
- 3 -4.64782E-02 -5.48703E-01
- 4 -2.97131E-01 3.78357E-01
- 5 3.10700E-01 -2.05767E-01
- 6 -2.74514E-01 -7.42689E-01
-6 0 *********** SCCC-arg-leu
- 1 -1.40090E-01 5.67735E-01
- 2 5.82977E-02 2.83795E-01
- 3 -2.77983E-02 -5.16684E-01
- 4 -3.30435E-01 4.04163E-01
- 5 3.04039E-01 -2.08328E-01
- 6 -2.74806E-01 -7.01813E-01
-6 0 *********** SCCC-arg-val
- 1 -2.14751E-02 4.94226E-01
- 2 6.06540E-02 3.41011E-01
- 3 -5.59566E-02 -5.30383E-01
- 4 -3.05072E-01 3.87245E-01
- 5 3.06080E-01 -2.04132E-01
- 6 -2.71571E-01 -7.32951E-01
-6 0 *********** SCCC-arg-trp
- 1 -1.53752E-01 5.26041E-01
- 2 1.89677E-01 3.11777E-01
- 3 2.06427E-02 -5.25678E-01
- 4 -3.37160E-01 4.17728E-01
- 5 3.54707E-01 -2.35608E-01
- 6 -2.85561E-01 -7.59638E-01
-6 0 *********** SCCC-arg-tyr
- 1 -1.82462E-01 5.65355E-01
- 2 1.42110E-01 2.87551E-01
- 3 1.48546E-02 -5.14617E-01
- 4 -3.44050E-01 4.18743E-01
- 5 3.35568E-01 -2.29759E-01
- 6 -2.82126E-01 -7.35547E-01
-6 0 *********** SCCC-arg-ala
- 1 -1.74358E-01 5.22331E-01
- 2 7.81634E-02 3.27369E-01
- 3 -6.62612E-02 -4.33995E-01
- 4 -3.22963E-01 3.69254E-01
- 5 2.76934E-01 -1.86144E-01
- 6 -2.58222E-01 -6.38771E-01
-6 0 *********** SCCC-arg-gly
- 1 -2.82779E-01 -9.15168E-01
- 2 5.31762E-01 1.58568E-01
- 3 2.00000E-02 -2.43011E-01
- 4 2.06969E-02 9.98012E-02
- 5 7.49582E-02 -6.84532E-02
- 6 -2.79170E-02 -4.53229E-01
-6 0 *********** SCCC-arg-thr
- 1 -1.84418E-01 5.95126E-01
- 2 6.77534E-02 2.42319E-01
- 3 3.57926E-02 -5.26318E-01
- 4 -3.32711E-01 4.05580E-01
- 5 2.88171E-01 -2.37246E-01
- 6 -2.63058E-01 -7.22033E-01
-6 0 *********** SCCC-arg-ser
- 1 -2.41180E-01 5.89876E-01
- 2 3.60799E-01 1.83892E-01
- 3 2.70668E-01 -8.94535E-01
- 4 -4.59965E-01 6.30017E-01
- 5 5.48395E-01 -4.54071E-01
- 6 -3.73720E-01 -1.20895E+00
-6 0 *********** SCCC-arg-gln
- 1 -1.43252E-01 5.16458E-01
- 2 2.50493E-01 3.25862E-01
- 3 4.27416E-02 -5.43829E-01
- 4 -3.22353E-01 4.14656E-01
- 5 3.77999E-01 -2.39455E-01
- 6 -2.88794E-01 -7.81924E-01
-6 0 *********** SCCC-arg-asn
- 1 -3.75961E-01 5.63067E-01
- 2 4.97401E-01 3.18238E-01
- 3 1.77799E-01 -5.16703E-01
- 4 -3.45707E-01 4.62013E-01
- 5 5.20409E-01 -2.77766E-01
- 6 -3.09191E-01 -8.09121E-01
-6 0 *********** SCCC-arg-glu
- 1 -1.43203E-01 5.43960E-01
- 2 2.38763E-01 2.96997E-01
- 3 7.07663E-02 -5.86704E-01
- 4 -3.32321E-01 4.38538E-01
- 5 3.94225E-01 -2.58363E-01
- 6 -2.97135E-01 -8.12682E-01
-6 0 *********** SCCC-arg-asp
- 1 -3.50193E-01 6.43602E-01
- 2 2.98857E-01 2.09804E-01
- 3 1.31500E-01 -5.08409E-01
- 4 -3.81928E-01 4.39909E-01
- 5 4.11013E-01 -2.70170E-01
- 6 -2.97422E-01 -7.44492E-01
-6 0 *********** SCCC-arg-his
- 1 -2.32389E-01 5.78747E-01
- 2 4.01715E-01 2.84016E-01
- 3 1.86732E-01 -6.38404E-01
- 4 -3.35151E-01 4.85710E-01
- 5 4.91499E-01 -3.03397E-01
- 6 -3.12691E-01 -8.88012E-01
-6 0 *********** SCCC-arg-arg
- 1 -1.29656E-01 5.32369E-01
- 2 9.49252E-02 3.26845E-01
- 3 -3.69210E-02 -4.95022E-01
- 4 -3.19943E-01 3.94507E-01
- 5 3.08362E-01 -2.02564E-01
- 6 -2.71706E-01 -7.01639E-01
-6 0 *********** SCCC-arg-lys
- 1 -1.39161E-01 5.32424E-01
- 2 8.57496E-02 3.41146E-01
- 3 -4.81295E-02 -4.70281E-01
- 4 -3.15563E-01 3.83893E-01
- 5 2.91910E-01 -1.93891E-01
- 6 -2.65753E-01 -6.74302E-01
-6 0 *********** SCCC-arg-pro
- 1 -2.08968E+01 -7.11420E-01
- 2 1.64941E+01 4.30835E-01
- 3 -7.34251E+00 5.49948E-01
- 4 2.86843E-04 -2.10932E-02
- 5 5.62115E+00 3.21222E-01
- 6 -3.95025E+00 1.70430E-01
-6 0 *********** SCCC-lys-cys
- 1 -5.42720E-01 3.12999E-01
- 2 3.68442E-01 1.38047E-01
- 3 1.60306E-01 -7.10412E-01
- 4 -3.42653E-01 4.52025E-01
- 5 4.66251E-01 -2.99678E-01
- 6 -3.31138E-01 -9.08035E-01
-6 0 *********** SCCC-lys-met
- 1 -3.89792E-01 2.79118E-01
- 2 1.80705E-01 1.97709E-01
- 3 1.92015E-02 -6.10719E-01
- 4 -2.95412E-01 3.84344E-01
- 5 3.47854E-01 -2.18423E-01
- 6 -2.89281E-01 -7.72021E-01
-6 0 *********** SCCC-lys-phe
- 1 -4.68655E-01 2.79610E-01
- 2 2.25775E-01 2.07030E-01
- 3 4.06352E-02 -6.42198E-01
- 4 -3.29870E-01 4.23752E-01
- 5 3.95701E-01 -2.49825E-01
- 6 -3.11593E-01 -8.46987E-01
-6 0 *********** SCCC-lys-ile
- 1 -2.47983E-01 2.83280E-01
- 2 9.54783E-02 1.69539E-01
- 3 -3.72299E-03 -5.99401E-01
- 4 -2.67261E-01 3.46269E-01
- 5 2.93146E-01 -1.95308E-01
- 6 -2.69224E-01 -6.94742E-01
-6 0 *********** SCCC-lys-leu
- 1 -4.06469E-01 2.86851E-01
- 2 1.45336E-01 1.98590E-01
- 3 -1.83581E-03 -6.37613E-01
- 4 -3.15501E-01 4.01855E-01
- 5 3.59173E-01 -2.23985E-01
- 6 -3.03819E-01 -7.92088E-01
-6 0 *********** SCCC-lys-val
- 1 -2.78646E-01 2.80852E-01
- 2 8.58492E-02 1.87851E-01
- 3 -1.75277E-02 -5.92547E-01
- 4 -2.85639E-01 3.63589E-01
- 5 3.08732E-01 -2.05794E-01
- 6 -2.72583E-01 -7.25760E-01
-6 0 *********** SCCC-lys-trp
- 1 -4.33202E-01 2.74302E-01
- 2 2.37621E-01 1.98114E-01
- 3 4.97520E-02 -6.23541E-01
- 4 -3.13508E-01 4.05198E-01
- 5 3.84083E-01 -2.44089E-01
- 6 -2.98660E-01 -8.13969E-01
-6 0 *********** SCCC-lys-tyr
- 1 -4.66366E-01 2.78189E-01
- 2 2.25655E-01 2.08088E-01
- 3 3.91325E-02 -6.40535E-01
- 4 -3.28849E-01 4.22309E-01
- 5 3.94782E-01 -2.48695E-01
- 6 -3.11008E-01 -8.30544E-01
-6 0 *********** SCCC-lys-ala
- 1 -4.23171E-01 2.43232E-01
- 2 1.63525E-01 2.59023E-01
- 3 -2.95240E-02 -5.69759E-01
- 4 -2.99258E-01 3.84530E-01
- 5 3.37869E-01 -2.03933E-01
- 6 -2.85762E-01 -7.66860E-01
-6 0 *********** SCCC-lys-gly
- 1 -2.61171E-01 -5.08968E-01
- 2 6.39254E-01 2.38609E-01
- 3 -1.22228E-03 -1.85240E-01
- 4 3.65466E-02 1.17449E-01
- 5 3.58733E-02 -3.59188E-02
- 6 -5.65221E-03 -3.72145E-01
-6 0 *********** SCCC-lys-thr
- 1 -4.60898E-01 2.91872E-01
- 2 1.82050E-01 1.90419E-01
- 3 6.37789E-02 -6.39614E-01
- 4 -3.37333E-01 4.33803E-01
- 5 3.60259E-01 -2.56430E-01
- 6 -3.14000E-01 -8.55935E-01
-6 0 *********** SCCC-lys-ser
- 1 -5.60991E-01 3.64126E-01
- 2 3.39685E-01 3.15454E-02
- 3 2.13973E-01 -9.20063E-01
- 4 -4.38578E-01 5.22642E-01
- 5 5.07183E-01 -3.96482E-01
- 6 -3.98286E-01 -1.09478E+00
-6 0 *********** SCCC-lys-gln
- 1 -4.23898E-01 2.82983E-01
- 2 2.70250E-01 1.81391E-01
- 3 7.92010E-02 -6.15073E-01
- 4 -2.90111E-01 3.90694E-01
- 5 3.77395E-01 -2.37630E-01
- 6 -2.87336E-01 -7.78800E-01
-6 0 *********** SCCC-lys-asn
- 1 -6.85236E-01 2.74181E-01
- 2 5.37122E-01 2.25619E-01
- 3 2.08574E-01 -6.16476E-01
- 4 -3.23743E-01 4.75809E-01
- 5 5.29305E-01 -2.97807E-01
- 6 -3.13426E-01 -9.02178E-01
-6 0 *********** SCCC-lys-glu
- 1 -4.33894E-01 3.05107E-01
- 2 2.62490E-01 1.51528E-01
- 3 9.64930E-02 -6.52116E-01
- 4 -3.10245E-01 4.08217E-01
- 5 3.92892E-01 -2.57230E-01
- 6 -2.99949E-01 -7.94285E-01
-6 0 *********** SCCC-lys-asp
- 1 -7.29156E-01 2.57351E-01
- 2 4.51858E-01 2.59511E-01
- 3 1.41673E-01 -7.51786E-01
- 4 -3.99817E-01 5.34306E-01
- 5 5.66692E-01 -3.27218E-01
- 6 -3.87000E-01 -1.04673E+00
-6 0 *********** SCCC-lys-his
- 1 -5.33792E-01 3.39798E-01
- 2 3.93177E-01 1.11429E-01
- 3 2.02530E-01 -6.68503E-01
- 4 -3.07473E-01 4.32888E-01
- 5 4.43312E-01 -2.83785E-01
- 6 -3.05073E-01 -8.43564E-01
-6 0 *********** SCCC-lys-arg
- 1 -3.86581E-01 2.72758E-01
- 2 1.58151E-01 2.15924E-01
- 3 -2.21757E-03 -5.95358E-01
- 4 -2.94550E-01 3.82756E-01
- 5 3.43477E-01 -2.08764E-01
- 6 -2.87826E-01 -7.55516E-01
-6 0 *********** SCCC-lys-lys
- 1 -3.92038E-01 2.64193E-01
- 2 1.56184E-01 2.35412E-01
- 3 -7.34176E-03 -5.72639E-01
- 4 -2.91507E-01 3.81741E-01
- 5 3.31098E-01 -2.05458E-01
- 6 -2.80892E-01 -7.51249E-01
-6 0 *********** SCCC-lys-pro
- 1 -2.91173E+01 7.01501E+00
- 2 2.44183E+01 -1.28436E+01
- 3 -1.52367E+01 1.52397E+01
- 4 7.35246E+00 -1.35950E+01
- 5 -2.07135E+00 7.67088E+00
- 6 -3.80734E-01 2.84745E+01
-6 0 *********** SCCC-pro-cys
- 1 -1.67732E+00 -1.88290E+00
- 2 5.04230E-02 4.44126E-01
- 3 2.69948E-01 -7.68592E-01
- 4 -3.71141E-01 5.35451E-01
- 5 4.41385E-01 -4.00571E-01
- 6 -3.21157E-01 -1.53964E+00
-6 0 *********** SCCC-pro-met
- 1 -1.37356E+00 -1.97801E+00
- 2 -2.80114E-01 5.99548E-01
- 3 1.04133E-01 -6.65641E-01
- 4 -2.18489E-01 5.71603E-01
- 5 4.73404E-01 -4.07078E-01
- 6 -3.85237E-01 -1.58381E+00
-6 0 *********** SCCC-pro-phe
- 1 -1.34069E+00 -1.96169E+00
- 2 -1.84307E-01 5.85846E-01
- 3 1.56691E-01 -7.60590E-01
- 4 -2.96895E-01 5.18536E-01
- 5 4.41350E-01 -3.78271E-01
- 6 -3.64750E-01 -1.56830E+00
-6 0 *********** SCCC-pro-ile
- 1 -1.56778E+00 -2.11190E+00
- 2 -4.70335E-01 6.60598E-01
- 3 8.18942E-02 -5.51189E-01
- 4 -1.60381E-01 5.96065E-01
- 5 4.59210E-01 -4.61075E-01
- 6 -4.15776E-01 -1.64600E+00
-6 0 *********** SCCC-pro-leu
- 1 -1.22353E+00 -2.08215E+00
- 2 -4.14520E-01 5.15048E-01
- 3 3.21619E-02 -6.61637E-01
- 4 -1.81700E-01 5.82300E-01
- 5 4.71747E-01 -4.32947E-01
- 6 -4.18487E-01 -1.60776E+00
-6 0 *********** SCCC-pro-val
- 1 -1.43641E+00 -2.12344E+00
- 2 -5.01202E-01 6.34031E-01
- 3 5.15234E-02 -5.52367E-01
- 4 -1.65833E-01 5.88697E-01
- 5 4.64253E-01 -4.72521E-01
- 6 -4.20447E-01 -1.64086E+00
-6 0 *********** SCCC-pro-trp
- 1 -1.46741E+00 -1.82010E+00
- 2 -6.19586E-02 6.25770E-01
- 3 1.78044E-01 -7.85048E-01
- 4 -3.35361E-01 5.24906E-01
- 5 4.46837E-01 -3.45456E-01
- 6 -3.35359E-01 -1.55832E+00
-6 0 *********** SCCC-pro-tyr
- 1 -1.35100E+00 -1.95249E+00
- 2 -1.76243E-01 5.99418E-01
- 3 1.63870E-01 -7.65471E-01
- 4 -2.98811E-01 5.14151E-01
- 5 4.39580E-01 -3.73949E-01
- 6 -3.62622E-01 -1.56735E+00
-6 0 *********** SCCC-pro-ala
- 1 -1.17650E+00 -1.73164E+00
- 2 -1.37735E-01 6.31757E-01
- 3 9.84337E-02 -7.84943E-01
- 4 -2.81918E-01 5.47824E-01
- 5 4.73760E-01 -3.23515E-01
- 6 -3.59031E-01 -1.52796E+00
-6 0 *********** SCCC-pro-gly
- 1 -1.04162E+00 1.18134E+00
- 2 4.68550E-01 8.23358E-01
- 3 -9.21165E-02 -5.98772E-01
- 4 -8.89726E-02 4.77407E-01
- 5 2.59409E-01 -1.46359E-02
- 6 -2.44069E-01 -7.12548E-01
-6 0 *********** SCCC-pro-thr
- 1 -9.65987E-01 -1.76950E+00
- 2 -2.35867E-01 1.59760E-01
- 3 -9.05434E-02 -6.83679E-01
- 4 -3.24679E-01 6.81381E-01
- 5 4.56582E-01 -4.18455E-01
- 6 -3.92698E-01 -1.49977E+00
-6 0 *********** SCCC-pro-ser
- 1 -2.10042E+00 -1.93474E+00
- 2 1.18785E-01 -1.10217E-02
- 3 1.55161E-01 -8.27855E-01
- 4 -4.73521E-01 5.06755E-01
- 5 3.36582E-01 -4.55938E-01
- 6 -3.44135E-01 -1.45545E+00
-6 0 *********** SCCC-pro-gln
- 1 -1.58591E+00 -1.91004E+00
- 2 -8.49389E-02 6.14066E-01
- 3 1.96943E-01 -6.81036E-01
- 4 -2.80559E-01 5.50499E-01
- 5 4.69871E-01 -3.96173E-01
- 6 -3.47409E-01 -1.56811E+00
-6 0 *********** SCCC-pro-asn
- 1 -1.59213E+00 -1.64717E+00
- 2 4.24801E-01 4.32002E-01
- 3 3.61758E-01 -7.78850E-01
- 4 -4.24629E-01 5.04511E-01
- 5 4.61223E-01 -3.73766E-01
- 6 -2.73411E-01 -1.47307E+00
-6 0 *********** SCCC-pro-glu
- 1 -1.60854E+00 -2.03208E+00
- 2 -1.60715E-01 5.49578E-01
- 3 1.74180E-01 -6.71794E-01
- 4 -2.80768E-01 5.53145E-01
- 5 4.58059E-01 -4.22328E-01
- 6 -3.61176E-01 -1.60459E+00
-6 0 *********** SCCC-pro-asp
- 1 -1.32840E+00 -2.00553E+00
- 2 3.28393E-02 5.12413E-01
- 3 3.93885E-01 -8.35558E-01
- 4 -4.26656E-01 3.64434E-01
- 5 4.24414E-01 -3.10258E-01
- 6 -3.41923E-01 -1.41921E+00
-6 0 *********** SCCC-pro-his
- 1 -1.94718E+00 -2.15304E+00
- 2 9.76240E-02 4.80223E-01
- 3 2.49290E-01 -7.27307E-01
- 4 -3.80464E-01 5.61481E-01
- 5 4.35333E-01 -3.80314E-01
- 6 -2.96993E-01 -1.58028E+00
-6 0 *********** SCCC-pro-arg
- 1 -1.30907E+00 -1.96321E+00
- 2 -2.81577E-01 6.05268E-01
- 3 6.47645E-02 -6.87110E-01
- 4 -2.26167E-01 5.64475E-01
- 5 4.80269E-01 -3.73378E-01
- 6 -3.89758E-01 -1.54774E+00
-6 0 *********** SCCC-pro-lys
- 1 -1.28039E+00 -2.02427E+00
- 2 -3.27808E-01 6.30072E-01
- 3 7.22401E-02 -6.32455E-01
- 4 -1.91723E-01 5.76167E-01
- 5 4.73378E-01 -4.23485E-01
- 6 -3.99281E-01 -1.59757E+00
-6 0 *********** SCCC-pro-pro
- 1 -2.18431E+01 3.85091E+01
- 2 1.68382E+01 2.79941E+01
- 3 1.68049E+01 -6.75771E-01
- 4 -3.33389E-02 -1.11280E+00
- 5 5.03821E+00 9.40226E+00
- 6 7.45544E+00 5.53280E+00
-6 0 *********** CCCS-cys-cys
- 1 -9.81745E-02 1.05860E-01
- 2 -1.54034E-01 4.57802E-01
- 3 -1.62409E-01 -4.95721E-02
- 4 -1.63960E-01 1.76700E-01
- 5 2.11840E-02 -8.95466E-02
- 6 -1.29535E-01 -3.54785E-01
-6 0 *********** CCCS-cys-met
- 1 -1.61382E-01 4.41823E-02
- 2 2.04047E-01 2.36528E-01
- 3 -8.42628E-02 -3.79565E-02
- 4 -1.35987E-02 7.32780E-02
- 5 -6.18599E-02 -1.98650E-02
- 6 -2.57727E-02 -1.58606E-01
-6 0 *********** CCCS-cys-phe
- 1 -1.70407E-01 5.66838E-02
- 2 3.11945E-01 1.24446E-01
- 3 -1.13676E-01 -6.09070E-02
- 4 2.63575E-03 3.55910E-02
- 5 -7.76774E-02 -2.80114E-02
- 6 -1.51044E-02 -1.08868E-01
-6 0 *********** CCCS-cys-ile
- 1 -1.96794E-01 7.21041E-02
- 2 3.01761E-01 2.06343E-01
- 3 -1.60990E-01 2.24058E-02
- 4 1.35673E-01 4.06216E-02
- 5 -1.92407E-01 1.06326E-02
- 6 5.59099E-02 -5.83858E-02
-6 0 *********** CCCS-cys-leu
- 1 -1.94629E-01 2.08782E-02
- 2 4.63980E-01 1.48911E-01
- 3 -4.12062E-02 -7.83901E-02
- 4 4.50108E-02 4.53411E-02
- 5 -1.56283E-02 -2.98441E-02
- 6 -5.31545E-03 -1.35551E-01
-6 0 *********** CCCS-cys-val
- 1 -1.58667E-01 5.07564E-02
- 2 2.80077E-01 1.69397E-01
- 3 -7.46638E-02 -2.62789E-02
- 4 3.07309E-02 7.06392E-02
- 5 -7.07689E-02 -1.24936E-02
- 6 -6.84213E-03 -1.20979E-01
-6 0 *********** CCCS-cys-trp
- 1 -1.70350E-01 6.23057E-02
- 2 2.90370E-01 1.53125E-01
- 3 -1.36668E-01 -3.18448E-02
- 4 3.70789E-02 3.32821E-02
- 5 -1.18722E-01 -1.59826E-02
- 6 5.39639E-03 -9.53532E-02
-6 0 *********** CCCS-cys-tyr
- 1 -1.63243E-01 5.21610E-02
- 2 2.86898E-01 1.29025E-01
- 3 -1.03150E-01 -7.23908E-02
- 4 -2.22920E-02 4.55200E-02
- 5 -5.64695E-02 -3.42481E-02
- 6 -3.00337E-02 -1.28343E-01
-6 0 *********** CCCS-cys-ala
- 1 -1.82384E-01 -1.97317E-02
- 2 1.50788E-01 4.42957E-01
- 3 -3.60925E-02 1.10769E-02
- 4 -5.10233E-02 1.29235E-01
- 5 -4.75376E-02 -1.00092E-02
- 6 -5.57854E-02 -2.39740E-01
-6 0 *********** CCCS-cys-gly
+4 0 *********** SCCC-thr-cys
+ 1 -4.90024E-01 4.99375E-01
+ 2 -2.61455E-01 3.68842E-01
+ 3 1.46841E-01 -4.96766E-02
+ 4 -6.38052E-02 9.61894E-03
+4 0 *********** SCCC-thr-met
+ 1 -4.61647E-01 3.24030E-01
+ 2 -5.21712E-02 3.12550E-01
+ 3 1.12628E-01 1.92250E-02
+ 4 -7.86351E-02 3.52093E-02
+4 0 *********** SCCC-thr-phe
+ 1 -5.02279E-01 2.89948E-01
+ 2 -8.82445E-02 3.22638E-01
+ 3 1.43670E-01 1.65575E-02
+ 4 -8.61400E-02 2.09730E-02
+4 0 *********** SCCC-thr-ile
+ 1 -4.39048E-01 4.23823E-01
+ 2 -7.03309E-02 3.37190E-01
+ 3 8.91131E-02 -1.89793E-02
+ 4 -7.23148E-02 4.60728E-02
+4 0 *********** SCCC-thr-leu
+ 1 -4.82373E-01 2.57188E-01
+ 2 -2.08155E-02 3.29115E-01
+ 3 1.30920E-01 1.96853E-02
+ 4 -8.86284E-02 3.57762E-02
+4 0 *********** SCCC-thr-val
+ 1 -4.50873E-01 3.61471E-01
+ 2 -4.26064E-02 3.28680E-01
+ 3 1.00254E-01 -8.35167E-04
+ 4 -7.82746E-02 4.47010E-02
+4 0 *********** SCCC-thr-trp
+ 1 -4.86353E-01 3.59613E-01
+ 2 -1.21384E-01 3.08268E-01
+ 3 1.26119E-01 7.29395E-03
+ 4 -7.52840E-02 2.30441E-02
+4 0 *********** SCCC-thr-tyr
+ 1 -4.97418E-01 2.92414E-01
+ 2 -8.32210E-02 3.22340E-01
+ 3 1.40823E-01 1.72882E-02
+ 4 -8.55928E-02 2.26879E-02
+4 0 *********** SCCC-thr-ala
+ 1 -4.54346E-01 2.04123E-01
+ 2 2.90041E-02 2.84000E-01
+ 3 1.20336E-01 4.83944E-02
+ 4 -7.64249E-02 3.42573E-02
+4 0 *********** SCCC-thr-gly
+ 1 7.28446E-01 3.43991E-01
+ 2 1.15445E-01 -5.45032E-01
+ 3 2.09564E-01 -1.56868E-02
+ 4 -2.74504E-02 5.70935E-02
+4 0 *********** SCCC-thr-thr
+ 1 -4.38661E-01 3.94990E-01
+ 2 -1.41118E-01 2.56087E-01
+ 3 9.83967E-02 2.83491E-02
+ 4 -5.71865E-02 1.25208E-02
+4 0 *********** SCCC-thr-ser
+ 1 -5.14363E-01 6.01150E-01
+ 2 -3.83309E-01 4.28468E-01
+ 3 1.70922E-01 -1.32749E-01
+ 4 -3.71082E-02 -6.03075E-03
+4 0 *********** SCCC-thr-gln
+ 1 -4.41395E-01 4.65881E-01
+ 2 -1.55335E-01 3.14635E-01
+ 3 1.02257E-01 -6.64029E-03
+ 4 -6.18051E-02 2.89429E-02
+4 0 *********** SCCC-thr-asn
+ 1 -4.72320E-01 5.74738E-01
+ 2 -3.35595E-01 3.41979E-01
+ 3 1.46187E-01 -6.66184E-02
+ 4 -3.67170E-02 3.49577E-03
+4 0 *********** SCCC-thr-glu
+ 1 -4.62449E-01 4.68203E-01
+ 2 -1.76282E-01 3.50327E-01
+ 3 1.19657E-01 -2.73218E-02
+ 4 -6.87305E-02 2.78182E-02
+4 0 *********** SCCC-thr-asp
+ 1 -4.08611E-01 6.38711E-01
+ 2 -3.01493E-01 3.03020E-01
+ 3 1.00627E-01 -4.21641E-02
+ 4 -2.20284E-02 1.95056E-02
+4 0 *********** SCCC-thr-his
+ 1 -4.92681E-01 5.36284E-01
+ 2 -2.78324E-01 3.74692E-01
+ 3 1.33112E-01 -7.34918E-02
+ 4 -5.65971E-02 1.01269E-02
+4 0 *********** SCCC-thr-arg
+ 1 -4.38676E-01 3.23477E-01
+ 2 -2.00344E-02 2.91896E-01
+ 3 9.97282E-02 2.83136E-02
+ 4 -7.14757E-02 3.99299E-02
+4 0 *********** SCCC-thr-lys
+ 1 -4.49493E-01 2.63701E-01
+ 2 2.00045E-02 3.02440E-01
+ 3 1.06750E-01 2.81631E-02
+ 4 -7.80944E-02 4.32498E-02
+4 0 *********** SCCC-thr-pro
+ 1 -6.16861E-01 5.06683E-01
+ 2 -5.59323E-01 3.36619E-01
+ 3 2.94052E-01 -2.36924E-03
+ 4 -4.94889E-02 -7.00470E-03
+4 0 *********** SCCC-ser-cys
+ 1 -6.14117E-01 1.22660E+00
+ 2 3.23261E-01 7.23900E-02
+ 3 2.41012E-01 4.97487E-03
+ 4 -2.49760E-02 9.82312E-02
+4 0 *********** SCCC-ser-met
+ 1 -7.07862E-01 9.52492E-01
+ 2 4.09950E-01 -2.20340E-01
+ 3 2.88134E-01 5.89095E-02
+ 4 7.10558E-03 2.29656E-02
+4 0 *********** SCCC-ser-phe
+ 1 -8.29809E-01 9.37670E-01
+ 2 4.27039E-01 -1.78466E-01
+ 3 2.74963E-01 2.72161E-02
+ 4 -8.49620E-03 4.09213E-02
+4 0 *********** SCCC-ser-ile
+ 1 -6.59256E-01 1.11401E+00
+ 2 4.22297E-01 -2.32032E-01
+ 3 2.53826E-01 8.84966E-02
+ 4 2.36811E-02 2.29557E-02
+4 0 *********** SCCC-ser-leu
+ 1 -8.26008E-01 8.81905E-01
+ 2 4.94684E-01 -2.48984E-01
+ 3 2.57634E-01 4.86923E-02
+ 4 1.86146E-02 1.20043E-02
+4 0 *********** SCCC-ser-val
+ 1 -7.12861E-01 1.02145E+00
+ 2 4.48908E-01 -2.56107E-01
+ 3 2.61644E-01 8.33860E-02
+ 4 2.22000E-02 1.47398E-02
+4 0 *********** SCCC-ser-trp
+ 1 -7.35939E-01 1.02731E+00
+ 2 3.56372E-01 -1.55509E-01
+ 3 2.80891E-01 4.49671E-02
+ 4 -1.09244E-02 4.27441E-02
+4 0 *********** SCCC-ser-tyr
+ 1 -8.13365E-01 9.36889E-01
+ 2 4.24170E-01 -1.83317E-01
+ 3 2.79732E-01 2.92346E-02
+ 4 -8.21499E-03 3.97292E-02
+4 0 *********** SCCC-ser-ala
+ 1 -6.94355E-01 7.47595E-01
+ 2 4.01523E-01 -2.42266E-01
+ 3 3.03588E-01 3.89900E-03
+ 4 7.86446E-03 2.13287E-02
+4 0 *********** SCCC-ser-gly
+ 1 1.77164E+00 3.10725E-01
+ 2 -5.85324E-01 -7.31660E-02
+ 3 -1.01387E-01 -4.59069E-02
+ 4 1.34316E-01 8.63920E-02
+4 0 *********** SCCC-ser-thr
+ 1 -4.84627E-01 9.53395E-01
+ 2 2.17104E-01 -2.83582E-02
+ 3 2.94659E-01 6.90198E-03
+ 4 -1.19554E-02 7.05146E-02
+4 0 *********** SCCC-ser-ser
+ 1 -6.21312E-01 1.49267E+00
+ 2 3.92170E-01 3.28443E-01
+ 3 4.93930E-02 3.05009E-02
+ 4 -6.14712E-02 1.08455E-01
+4 0 *********** SCCC-ser-gln
+ 1 -5.33111E-01 1.14069E+00
+ 2 2.83721E-01 -9.01366E-02
+ 3 3.01803E-01 4.71410E-02
+ 4 -1.19502E-02 5.74736E-02
+4 0 *********** SCCC-ser-asn
+ 1 -3.84750E-01 1.32124E+00
+ 2 1.61357E-01 2.77083E-01
+ 3 2.03604E-01 -4.29290E-02
+ 4 -4.13240E-02 1.18300E-01
+4 0 *********** SCCC-ser-glu
+ 1 -6.14153E-01 1.17658E+00
+ 2 3.45757E-01 -7.75638E-02
+ 3 2.75174E-01 4.37628E-02
+ 4 -7.45559E-03 6.14123E-02
+4 0 *********** SCCC-ser-asp
+ 1 -1.86171E-01 1.47209E+00
+ 2 7.09682E-02 2.36619E-01
+ 3 2.43295E-01 5.22303E-02
+ 4 -7.72583E-02 7.89627E-02
+4 0 *********** SCCC-ser-his
+ 1 -6.69450E-01 1.34906E+00
+ 2 3.61362E-01 5.03783E-02
+ 3 1.78236E-01 7.50658E-02
+ 4 -2.01136E-02 7.16205E-02
+4 0 *********** SCCC-ser-arg
+ 1 -6.37662E-01 9.32217E-01
+ 2 3.70289E-01 -2.52955E-01
+ 3 3.15748E-01 5.65638E-02
+ 4 -4.68488E-03 2.00131E-02
+4 0 *********** SCCC-ser-lys
+ 1 -7.09024E-01 8.53952E-01
+ 2 4.41752E-01 -2.78632E-01
+ 3 2.81905E-01 5.04275E-02
+ 4 1.69044E-02 1.04063E-02
+4 0 *********** SCCC-ser-pro
+ 1 -9.67425E-01 1.39575E+00
+ 2 4.11182E-01 6.44769E-01
+ 3 1.03654E-01 1.95730E-02
+ 4 -1.72233E-01 9.52962E-02
+4 0 *********** SCCC-gln-cys
+ 1 -1.34193E-01 6.95126E-01
+ 2 1.36249E-01 -1.25291E-01
+ 3 -4.39939E-02 1.41835E-02
+ 4 -3.51733E-02 1.31322E-02
+4 0 *********** SCCC-gln-met
+ 1 -1.40747E-01 5.93268E-01
+ 2 9.50158E-02 -1.57052E-01
+ 3 -3.29856E-02 -3.69531E-03
+ 4 -3.20695E-02 1.00777E-03
+4 0 *********** SCCC-gln-phe
+ 1 -1.85231E-01 6.00285E-01
+ 2 1.17086E-01 -1.55367E-01
+ 3 -4.40100E-02 -1.46880E-04
+ 4 -2.94278E-02 -5.55207E-04
+4 0 *********** SCCC-gln-ile
+ 1 -9.10324E-02 6.44284E-01
+ 2 8.31625E-02 -1.60026E-01
+ 3 -2.21222E-02 1.02181E-02
+ 4 -3.45467E-02 4.52397E-03
+4 0 *********** SCCC-gln-leu
+ 1 -1.75889E-01 5.70684E-01
+ 2 1.03674E-01 -1.74521E-01
+ 3 -4.09702E-02 -8.32933E-04
+ 4 -2.97803E-02 -3.97702E-03
+4 0 *********** SCCC-gln-val
+ 1 -1.17794E-01 6.14597E-01
+ 2 8.70584E-02 -1.66263E-01
+ 3 -2.69350E-02 4.96618E-03
+ 4 -3.28492E-02 6.00545E-04
+4 0 *********** SCCC-gln-trp
+ 1 -1.53299E-01 6.24973E-01
+ 2 1.08601E-01 -1.40354E-01
+ 3 -3.62284E-02 -1.33675E-05
+ 4 -3.25877E-02 3.49419E-03
+4 0 *********** SCCC-gln-tyr
+ 1 -1.80419E-01 5.98660E-01
+ 2 1.14837E-01 -1.55866E-01
+ 3 -4.31960E-02 -8.29990E-04
+ 4 -2.94669E-02 -2.09085E-04
+4 0 *********** SCCC-gln-ala
+ 1 -1.72648E-01 5.03529E-01
+ 2 8.54986E-02 -1.66546E-01
+ 3 -4.37300E-02 -1.74088E-02
+ 4 -2.66354E-02 -3.54927E-03
+4 0 *********** SCCC-gln-gly
+ 1 7.68867E-01 -4.83872E-02
+ 2 -5.98158E-02 1.93480E-01
+ 3 -5.95897E-02 8.53053E-04
+ 4 -2.02137E-02 2.28224E-02
+4 0 *********** SCCC-gln-thr
+ 1 -1.03983E-01 5.91488E-01
+ 2 9.45148E-02 -9.78836E-02
+ 3 -3.46218E-02 -1.91000E-02
+ 4 -2.38546E-02 7.09047E-03
+4 0 *********** SCCC-gln-ser
+ 1 -1.49127E-01 7.45891E-01
+ 2 1.58965E-01 -1.33384E-01
+ 3 -4.81319E-02 3.50647E-02
+ 4 -4.05732E-02 1.50022E-02
+4 0 *********** SCCC-gln-gln
+ 1 -8.96216E-02 6.51434E-01
+ 2 9.66373E-02 -1.23163E-01
+ 3 -2.96888E-02 -1.83816E-03
+ 4 -3.51919E-02 1.35639E-02
+4 0 *********** SCCC-gln-asn
+ 1 -1.04911E-01 6.91553E-01
+ 2 1.37545E-01 -8.88920E-02
+ 3 -5.17290E-02 6.11594E-03
+ 4 -3.12069E-02 1.68626E-02
+4 0 *********** SCCC-gln-glu
+ 1 -1.10601E-01 6.73042E-01
+ 2 1.11771E-01 -1.36486E-01
+ 3 -3.39155E-02 9.31456E-03
+ 4 -3.62744E-02 1.23069E-02
+4 0 *********** SCCC-gln-asp
+ 1 -2.98098E-02 6.82432E-01
+ 2 1.00861E-01 -6.79492E-02
+ 3 -3.73643E-02 -1.07486E-02
+ 4 -3.56411E-02 3.22553E-02
+4 0 *********** SCCC-gln-his
+ 1 -1.32299E-01 7.16173E-01
+ 2 1.32475E-01 -1.31555E-01
+ 3 -3.64503E-02 2.25037E-02
+ 4 -3.97687E-02 1.09480E-02
+4 0 *********** SCCC-gln-arg
+ 1 -1.19110E-01 5.73573E-01
+ 2 7.84065E-02 -1.55219E-01
+ 3 -2.99762E-02 -1.01147E-02
+ 4 -2.99750E-02 3.08938E-03
+4 0 *********** SCCC-gln-lys
+ 1 -1.45598E-01 5.45942E-01
+ 2 8.13527E-02 -1.73132E-01
+ 3 -3.41550E-02 -7.35472E-03
+ 4 -2.87123E-02 -3.80024E-03
+4 0 *********** SCCC-gln-pro
+ 1 -2.90448E-01 7.30120E-01
+ 2 2.27678E-01 -9.03995E-02
+ 3 -7.91464E-02 1.76609E-03
+ 4 -6.82776E-02 -3.21575E-02
+4 0 *********** SCCC-asn-cys
+ 1 -1.62150E-01 9.56855E-01
+ 2 3.46774E-01 6.06181E-02
+ 3 -2.48439E-03 -1.07124E-01
+ 4 -1.93826E-02 -5.75492E-03
+4 0 *********** SCCC-asn-met
+ 1 -2.65641E-01 7.96242E-01
+ 2 2.76915E-01 -1.64132E-01
+ 3 5.36865E-02 -1.30750E-01
+ 4 6.16549E-03 -4.87446E-02
+4 0 *********** SCCC-asn-phe
+ 1 -3.43347E-01 7.96600E-01
+ 2 3.02311E-01 -1.26055E-01
+ 3 3.07028E-02 -1.49390E-01
+ 4 9.55578E-03 -3.33538E-02
+4 0 *********** SCCC-asn-ile
+ 1 -1.76683E-01 8.81392E-01
+ 2 2.91790E-01 -1.55566E-01
+ 3 3.48252E-02 -8.64962E-02
+ 4 8.49137E-03 -5.88552E-02
+4 0 *********** SCCC-asn-leu
+ 1 -3.48201E-01 7.56475E-01
+ 2 3.06465E-01 -2.02490E-01
+ 3 3.34965E-02 -1.42360E-01
+ 4 1.40298E-02 -5.24899E-02
+4 0 *********** SCCC-asn-val
+ 1 -2.35641E-01 8.31220E-01
+ 2 2.90214E-01 -1.84412E-01
+ 3 4.13827E-02 -1.06222E-01
+ 4 1.25033E-02 -5.92918E-02
+4 0 *********** SCCC-asn-trp
+ 1 -2.66358E-01 8.45706E-01
+ 2 2.78264E-01 -8.90219E-02
+ 3 4.03001E-02 -1.27723E-01
+ 4 1.20405E-03 -3.48995E-02
+4 0 *********** SCCC-asn-tyr
+ 1 -3.34660E-01 7.94759E-01
+ 2 2.99689E-01 -1.31033E-01
+ 3 3.36287E-02 -1.49084E-01
+ 4 9.12004E-03 -3.43792E-02
+4 0 *********** SCCC-asn-ala
+ 1 -3.30662E-01 6.69391E-01
+ 2 2.48345E-01 -2.23211E-01
+ 3 5.77542E-02 -1.72134E-01
+ 4 3.82538E-03 -4.57734E-02
+4 0 *********** SCCC-asn-gly
+ 1 1.10894E+00 -1.29810E-01
+ 2 -4.78939E-01 7.85185E-02
+ 3 -7.36233E-02 -1.00234E-01
+ 4 2.99417E-02 -9.03175E-03
+4 0 *********** SCCC-asn-thr
+ 1 -1.51014E-01 8.07619E-01
+ 2 2.17752E-01 -1.99694E-02
+ 3 7.28192E-02 -1.41545E-01
+ 4 3.57693E-03 -7.97927E-03
+4 0 *********** SCCC-asn-ser
+ 1 -1.31708E-01 1.06546E+00
+ 2 4.34947E-01 1.74209E-01
+ 3 -7.78470E-02 -4.52594E-02
+ 4 -4.85106E-02 1.14087E-02
+4 0 *********** SCCC-asn-gln
+ 1 -1.21385E-01 8.99405E-01
+ 2 2.65511E-01 -4.19733E-02
+ 3 5.20222E-02 -1.10583E-01
+ 4 -1.46111E-02 -2.96657E-02
+4 0 *********** SCCC-asn-asn
+ 1 -5.08046E-02 9.88061E-01
+ 2 3.16621E-01 1.83519E-01
+ 3 -1.77269E-02 -1.06868E-01
+ 4 -4.05749E-02 1.86697E-02
+4 0 *********** SCCC-asn-glu
+ 1 -1.57210E-01 9.22129E-01
+ 2 3.11531E-01 -3.52836E-02
+ 3 2.48361E-02 -1.04413E-01
+ 4 -1.10658E-02 -3.04204E-02
+4 0 *********** SCCC-asn-asp
+ 1 9.55026E-02 1.01758E+00
+ 2 2.48931E-01 1.71751E-01
+ 3 3.33383E-02 -7.99290E-02
+ 4 -7.93974E-02 1.49526E-02
+4 0 *********** SCCC-asn-his
+ 1 -1.50728E-01 1.00865E+00
+ 2 3.59980E-01 6.26670E-02
+ 3 -1.59120E-02 -6.06809E-02
+ 4 -2.20277E-02 -1.97543E-02
+4 0 *********** SCCC-asn-arg
+ 1 -2.31193E-01 7.75213E-01
+ 2 2.43046E-01 -1.87487E-01
+ 3 6.78871E-02 -1.37402E-01
+ 4 8.71368E-04 -4.71793E-02
+4 0 *********** SCCC-asn-lys
+ 1 -2.94462E-01 7.32113E-01
+ 2 2.65544E-01 -2.33553E-01
+ 3 5.34956E-02 -1.38595E-01
+ 4 1.06220E-02 -5.66873E-02
+4 0 *********** SCCC-asn-pro
+ 1 -3.40017E-01 1.01307E+00
+ 2 4.38875E-01 3.77154E-01
+ 3 -3.01538E-02 -1.07491E-01
+ 4 -1.02658E-01 -4.59325E-02
+4 0 *********** SCCC-glu-cys
+ 1 -1.75028E-01 7.93185E-01
+ 2 1.39923E-01 -1.97325E-01
+ 3 5.11717E-03 -4.48841E-02
+ 4 -2.09619E-02 4.12788E-03
+4 0 *********** SCCC-glu-met
+ 1 -1.73920E-01 6.75570E-01
+ 2 9.16265E-02 -2.19977E-01
+ 3 5.01779E-03 -6.20543E-02
+ 4 -1.83131E-02 -7.12865E-03
+4 0 *********** SCCC-glu-phe
+ 1 -2.26687E-01 6.83802E-01
+ 2 1.18721E-01 -2.18522E-01
+ 3 -5.53577E-03 -5.69417E-02
+ 4 -1.52122E-02 -7.95138E-03
+4 0 *********** SCCC-glu-ile
+ 1 -1.22022E-01 7.37308E-01
+ 2 7.53497E-02 -2.28979E-01
+ 3 1.52193E-02 -4.74620E-02
+ 4 -2.20326E-02 -5.38584E-03
+4 0 *********** SCCC-glu-leu
+ 1 -2.13868E-01 6.50347E-01
+ 2 1.02371E-01 -2.38147E-01
+ 3 -6.84325E-03 -5.99558E-02
+ 4 -1.60185E-02 -1.25296E-02
+4 0 *********** SCCC-glu-val
+ 1 -1.50483E-01 7.02101E-01
+ 2 8.11514E-02 -2.33310E-01
+ 3 9.48777E-03 -5.28115E-02
+ 4 -1.98443E-02 -8.59830E-03
+4 0 *********** SCCC-glu-trp
+ 1 -1.90709E-01 7.12034E-01
+ 2 1.08397E-01 -2.03549E-01
+ 3 5.93232E-03 -5.50367E-02
+ 4 -1.87646E-02 -3.46632E-03
+4 0 *********** SCCC-glu-tyr
+ 1 -2.20808E-01 6.81845E-01
+ 2 1.15825E-01 -2.18922E-01
+ 3 -4.88019E-03 -5.82385E-02
+ 4 -1.52258E-02 -7.67458E-03
+4 0 *********** SCCC-glu-ala
+ 1 -2.02807E-01 5.71139E-01
+ 2 8.14762E-02 -2.19988E-01
+ 3 -1.40082E-02 -7.89186E-02
+ 4 -1.19888E-02 -1.04592E-02
+4 0 *********** SCCC-glu-gly
+ 1 8.97790E-01 -2.27123E-02
+ 2 -2.62402E-02 2.74987E-01
+ 3 7.65727E-03 1.24542E-02
+ 4 -1.52370E-02 8.04106E-03
+4 0 *********** SCCC-glu-thr
+ 1 -1.26316E-01 6.66038E-01
+ 2 9.50929E-02 -1.45733E-01
+ 3 6.48408E-03 -7.28985E-02
+ 4 -7.56382E-03 2.86168E-03
+4 0 *********** SCCC-glu-ser
+ 1 -2.03413E-01 8.58359E-01
+ 2 1.66860E-01 -2.20439E-01
+ 3 6.60586E-03 -2.01982E-02
+ 4 -2.94999E-02 3.44116E-03
+4 0 *********** SCCC-glu-gln
+ 1 -1.16987E-01 7.41144E-01
+ 2 9.21413E-02 -1.86101E-01
+ 3 1.45002E-02 -6.22335E-02
+ 4 -2.07142E-02 5.13481E-03
+4 0 *********** SCCC-glu-asn
+ 1 -1.34928E-01 7.81608E-01
+ 2 1.43251E-01 -1.48459E-01
+ 3 -4.90144E-03 -5.56245E-02
+ 4 -1.31215E-02 7.87766E-03
+4 0 *********** SCCC-glu-glu
+ 1 -1.45328E-01 7.68498E-01
+ 2 1.09251E-01 -2.06419E-01
+ 3 1.10565E-02 -5.13099E-02
+ 4 -2.27145E-02 2.62237E-03
+4 0 *********** SCCC-glu-asp
+ 1 -4.44767E-02 7.71662E-01
+ 2 9.57822E-02 -1.23086E-01
+ 3 1.18016E-02 -7.93886E-02
+ 4 -1.81803E-02 2.32727E-02
+4 0 *********** SCCC-glu-his
+ 1 -1.77390E-01 8.22192E-01
+ 2 1.35512E-01 -2.10222E-01
+ 3 1.66831E-02 -3.09861E-02
+ 4 -2.79671E-02 2.59738E-03
+4 0 *********** SCCC-glu-arg
+ 1 -1.46782E-01 6.52472E-01
+ 2 7.13978E-02 -2.14584E-01
+ 3 5.11771E-03 -7.00618E-02
+ 4 -1.59487E-02 -4.55723E-03
+4 0 *********** SCCC-glu-lys
+ 1 -1.76250E-01 6.21346E-01
+ 2 7.58678E-02 -2.33049E-01
+ 3 -2.59398E-03 -6.66189E-02
+ 4 -1.48581E-02 -1.15323E-02
+4 0 *********** SCCC-glu-pro
+ 1 -3.72547E-01 8.37364E-01
+ 2 2.71202E-01 -1.95828E-01
+ 3 -7.88203E-03 -1.39372E-02
+ 4 -6.89503E-02 -3.81628E-02
+4 0 *********** SCCC-asp-cys
+ 1 6.89146E-03 9.62901E-01
+ 2 2.89389E-01 2.34632E-01
+ 3 6.71682E-02 -1.58876E-01
+ 4 9.88754E-02 9.45503E-03
+4 0 *********** SCCC-asp-met
+ 1 -1.63376E-01 7.49125E-01
+ 2 2.66037E-01 -2.98849E-02
+ 3 1.20566E-01 -1.84298E-01
+ 4 1.11529E-01 -1.32414E-02
+4 0 *********** SCCC-asp-phe
+ 1 -2.29384E-01 7.55678E-01
+ 2 2.61144E-01 6.87120E-03
+ 3 1.08042E-01 -2.08570E-01
+ 4 1.11254E-01 9.27824E-04
+4 0 *********** SCCC-asp-ile
+ 1 -5.28974E-02 8.29422E-01
+ 2 2.91790E-01 4.88933E-03
+ 3 9.00759E-02 -1.52680E-01
+ 4 1.19320E-01 -2.24447E-02
+4 0 *********** SCCC-asp-leu
+ 1 -2.40931E-01 7.02691E-01
+ 2 2.86859E-01 -6.60185E-02
+ 3 1.08285E-01 -2.05115E-01
+ 4 1.14096E-01 -1.03636E-02
+4 0 *********** SCCC-asp-val
+ 1 -1.21797E-01 7.76321E-01
+ 2 2.86876E-01 -3.45549E-02
+ 3 1.02586E-01 -1.70534E-01
+ 4 1.19843E-01 -1.94708E-02
+4 0 *********** SCCC-asp-trp
+ 1 -1.54704E-01 8.11497E-01
+ 2 2.42768E-01 4.74845E-02
+ 3 1.07068E-01 -1.83322E-01
+ 4 1.08048E-01 -4.05058E-03
+4 0 *********** SCCC-asp-tyr
+ 1 -2.22323E-01 7.53145E-01
+ 2 2.62355E-01 1.71466E-03
+ 3 1.10226E-01 -2.07274E-01
+ 4 1.11028E-01 -4.76266E-04
+4 0 *********** SCCC-asp-ala
+ 1 -2.58419E-01 6.24448E-01
+ 2 2.47257E-01 -1.18176E-01
+ 3 1.31675E-01 -2.10078E-01
+ 4 8.96703E-02 -1.46616E-02
+4 0 *********** SCCC-asp-gly
+ 1 1.11938E+00 -4.79483E-01
+ 2 -5.39968E-01 -2.59984E-01
+ 3 -4.20150E-02 -6.95953E-02
+ 4 6.07620E-02 -6.31520E-03
+4 0 *********** SCCC-asp-thr
+ 1 -7.14183E-02 7.90607E-01
+ 2 1.99141E-01 8.39682E-02
+ 3 1.38223E-01 -1.56640E-01
+ 4 8.44660E-02 6.23549E-03
+4 0 *********** SCCC-asp-ser
+ 1 1.48522E-01 1.14542E+00
+ 2 3.41212E-01 4.51183E-01
+ 3 -4.27583E-02 -8.22659E-02
+ 4 4.58009E-02 1.89451E-02
+4 0 *********** SCCC-asp-gln
+ 1 -3.80731E-03 8.76195E-01
+ 2 2.52369E-01 1.02246E-01
+ 3 1.12769E-01 -1.53550E-01
+ 4 9.98621E-02 -1.12339E-02
+4 0 *********** SCCC-asp-asn
+ 1 1.22758E-01 1.04207E+00
+ 2 2.53169E-01 3.63126E-01
+ 3 3.65086E-02 -1.26146E-01
+ 4 5.72966E-02 1.44893E-02
+4 0 *********** SCCC-asp-glu
+ 1 -1.60424E-02 8.99494E-01
+ 2 2.84138E-01 1.27096E-01
+ 3 9.00957E-02 -1.62470E-01
+ 4 1.09158E-01 -7.72673E-03
+4 0 *********** SCCC-asp-asp
+ 1 2.59374E-01 1.06658E+00
+ 2 2.34343E-01 3.50566E-01
+ 3 7.94228E-02 -7.82301E-02
+ 4 3.04771E-02 3.42785E-03
+4 0 *********** SCCC-asp-his
+ 1 4.14244E-02 1.01882E+00
+ 2 3.00553E-01 2.68657E-01
+ 3 3.96480E-02 -1.19962E-01
+ 4 9.49039E-02 8.52413E-03
+4 0 *********** SCCC-asp-arg
+ 1 -1.43057E-01 7.27323E-01
+ 2 2.47012E-01 -6.37525E-02
+ 3 1.29984E-01 -1.81607E-01
+ 4 9.96790E-02 -1.96414E-02
+4 0 *********** SCCC-asp-lys
+ 1 -2.06415E-01 6.77904E-01
+ 2 2.68843E-01 -1.08164E-01
+ 3 1.19636E-01 -1.89430E-01
+ 4 1.04245E-01 -1.92013E-02
+4 0 *********** SCCC-asp-pro
+ 1 -1.38898E-01 1.27123E+00
+ 2 1.99963E-01 7.69688E-01
+ 3 1.91683E-01 -3.21063E-01
+ 4 -1.48049E-01 2.78634E-01
+4 0 *********** SCCC-his-cys
+ 1 -3.69345E-01 1.02232E+00
+ 2 2.73396E-01 -1.37066E-01
+ 3 5.51468E-02 -1.69168E-01
+ 4 -7.02196E-02 2.82981E-02
+4 0 *********** SCCC-his-met
+ 1 -3.81561E-01 8.61414E-01
+ 2 2.24917E-01 -2.76206E-01
+ 3 6.00277E-02 -1.65478E-01
+ 4 -4.49430E-02 -4.76821E-02
+4 0 *********** SCCC-his-phe
+ 1 -4.68949E-01 8.57245E-01
+ 2 2.62629E-01 -2.41380E-01
+ 3 4.20567E-02 -1.82999E-01
+ 4 -4.95250E-02 -3.34942E-02
+4 0 *********** SCCC-his-ile
+ 1 -3.28031E-01 9.70230E-01
+ 2 2.22628E-01 -3.00284E-01
+ 3 4.74535E-02 -1.22181E-01
+ 4 -3.95713E-02 -4.37272E-02
+4 0 *********** SCCC-his-leu
+ 1 -4.56076E-01 8.14821E-01
+ 2 2.65737E-01 -2.99845E-01
+ 3 2.74991E-02 -1.75545E-01
+ 4 -3.45093E-02 -5.38870E-02
+4 0 *********** SCCC-his-val
+ 1 -3.66815E-01 9.09384E-01
+ 2 2.32540E-01 -3.08934E-01
+ 3 4.54471E-02 -1.39055E-01
+ 4 -3.53282E-02 -5.26108E-02
+4 0 *********** SCCC-his-trp
+ 1 -4.04562E-01 9.12636E-01
+ 2 2.29576E-01 -2.23804E-01
+ 3 6.41183E-02 -1.61855E-01
+ 4 -5.73424E-02 -3.13866E-02
+4 0 *********** SCCC-his-tyr
+ 1 -4.58121E-01 8.55671E-01
+ 2 2.57802E-01 -2.45122E-01
+ 3 4.46526E-02 -1.83509E-01
+ 4 -4.96869E-02 -3.37290E-02
+4 0 *********** SCCC-his-ala
+ 1 -3.95989E-01 7.05652E-01
+ 2 2.07209E-01 -2.84327E-01
+ 3 4.39849E-02 -2.13866E-01
+ 4 -4.07812E-02 -5.09985E-02
+4 0 *********** SCCC-his-gly
+ 1 1.25852E+00 1.76141E-01
+ 2 -2.77315E-01 3.24357E-01
+ 3 4.54429E-02 -7.91989E-02
+ 4 1.99718E-02 4.65286E-02
+4 0 *********** SCCC-his-thr
+ 1 -2.58759E-01 8.49473E-01
+ 2 1.63800E-01 -1.27977E-01
+ 3 9.93722E-02 -1.98211E-01
+ 4 -4.68005E-02 1.04977E-03
+4 0 *********** SCCC-his-ser
+ 1 -4.42381E-01 1.12152E+00
+ 2 3.64904E-01 -1.17923E-01
+ 3 1.22945E-02 -1.22412E-01
+ 4 -8.14961E-02 5.24886E-02
+4 0 *********** SCCC-his-gln
+ 1 -2.74803E-01 9.71741E-01
+ 2 1.86757E-01 -1.96807E-01
+ 3 9.06279E-02 -1.60756E-01
+ 4 -7.07205E-02 -7.42647E-03
+4 0 *********** SCCC-his-asn
+ 1 -2.59373E-01 1.01077E+00
+ 2 2.37818E-01 -1.69224E-02
+ 3 5.04090E-02 -2.04248E-01
+ 4 -6.44461E-02 6.27076E-02
+4 0 *********** SCCC-his-glu
+ 1 -3.34689E-01 1.00225E+00
+ 2 2.34058E-01 -2.08542E-01
+ 3 6.62179E-02 -1.52845E-01
+ 4 -6.77561E-02 -2.88808E-03
+4 0 *********** SCCC-his-asp
+ 1 -1.13489E-01 1.05146E+00
+ 2 1.36018E-01 -4.44790E-02
+ 3 1.26749E-01 -1.82384E-01
+ 4 -1.23555E-01 6.77906E-02
+4 0 *********** SCCC-his-his
+ 1 -3.94646E-01 1.08754E+00
+ 2 2.91579E-01 -1.75765E-01
+ 3 5.16481E-02 -1.10558E-01
+ 4 -7.10761E-02 5.27062E-03
+4 0 *********** SCCC-his-arg
+ 1 -3.30066E-01 8.37721E-01
+ 2 1.84874E-01 -2.86796E-01
+ 3 7.31266E-02 -1.74279E-01
+ 4 -5.31747E-02 -4.43825E-02
+4 0 *********** SCCC-his-lys
+ 1 -3.81706E-01 7.86125E-01
+ 2 2.18531E-01 -3.16421E-01
+ 3 4.33274E-02 -1.75276E-01
+ 4 -3.24525E-02 -5.78990E-02
+4 0 *********** SCCC-his-pro
+ 1 -7.30659E-01 1.01721E+00
+ 2 4.71006E-01 1.74010E-02
+ 3 6.27875E-02 -1.49403E-01
+ 4 -1.64736E-01 2.55952E-02
+4 0 *********** SCCC-arg-cys
+ 1 -4.73342E-01 2.53493E-01
+ 2 -1.04818E-01 -1.89795E-02
+ 3 7.72408E-02 4.49749E-02
+ 4 -7.40174E-02 1.81466E-04
+4 0 *********** SCCC-arg-met
+ 1 -4.05113E-01 1.78167E-01
+ 2 -6.21818E-02 2.92029E-02
+ 3 4.53693E-02 3.55998E-02
+ 4 -5.40860E-02 -8.65102E-03
+4 0 *********** SCCC-arg-phe
+ 1 -4.23597E-01 1.58949E-01
+ 2 -6.66038E-02 2.47021E-02
+ 3 5.03868E-02 4.11327E-02
+ 4 -5.78930E-02 -1.16976E-02
+4 0 *********** SCCC-arg-ile
+ 1 -4.15299E-01 2.35567E-01
+ 2 -7.24346E-02 2.09376E-02
+ 3 5.24164E-02 2.56747E-02
+ 4 -5.30972E-02 2.01269E-03
+4 0 *********** SCCC-arg-leu
+ 1 -3.98462E-01 1.45644E-01
+ 2 -5.52901E-02 4.37980E-02
+ 3 4.47608E-02 3.54917E-02
+ 4 -5.30811E-02 -9.74845E-03
+4 0 *********** SCCC-arg-val
+ 1 -4.06142E-01 2.03001E-01
+ 2 -6.40740E-02 3.03356E-02
+ 3 4.75051E-02 2.89481E-02
+ 4 -5.20303E-02 -2.96945E-03
+4 0 *********** SCCC-arg-trp
+ 1 -4.32196E-01 1.90354E-01
+ 2 -7.31097E-02 1.01073E-02
+ 3 5.22349E-02 4.08552E-02
+ 4 -5.90120E-02 -1.00659E-02
+4 0 *********** SCCC-arg-tyr
+ 1 -4.21075E-01 1.60625E-01
+ 2 -6.61055E-02 2.56922E-02
+ 3 4.99396E-02 4.05342E-02
+ 4 -5.75701E-02 -1.11830E-02
+4 0 *********** SCCC-arg-ala
+ 1 -3.62189E-01 1.07613E-01
+ 2 -3.86273E-02 5.48172E-02
+ 3 3.46412E-02 3.64830E-02
+ 4 -4.69961E-02 -1.27651E-02
+4 0 *********** SCCC-arg-gly
+ 1 4.00182E-01 4.17668E-01
+ 2 1.17543E-01 -2.63219E-02
+ 3 3.09356E-02 8.67132E-02
+ 4 -2.98912E-02 6.19530E-02
+4 0 *********** SCCC-arg-thr
+ 1 -4.09575E-01 1.99549E-01
+ 2 -7.32878E-02 -1.88423E-03
+ 3 4.29009E-02 4.11909E-02
+ 4 -5.15602E-02 -1.08618E-02
+4 0 *********** SCCC-arg-ser
+ 1 -5.05874E-01 2.84182E-01
+ 2 -1.22501E-01 -3.54938E-02
+ 3 9.70116E-02 4.64495E-02
+ 4 -8.46584E-02 8.18824E-03
+4 0 *********** SCCC-arg-gln
+ 1 -4.32396E-01 2.43546E-01
+ 2 -8.51436E-02 -2.74496E-03
+ 3 5.82585E-02 3.79556E-02
+ 4 -6.26550E-02 -2.04682E-03
+4 0 *********** SCCC-arg-asn
+ 1 -4.75275E-01 2.70643E-01
+ 2 -1.13187E-01 -3.66262E-02
+ 3 8.06719E-02 4.89900E-02
+ 4 -7.54243E-02 1.54695E-03
+4 0 *********** SCCC-arg-glu
+ 1 -4.47872E-01 2.47488E-01
+ 2 -9.19302E-02 -2.85206E-03
+ 3 6.66418E-02 3.77559E-02
+ 4 -6.67127E-02 9.88276E-04
+4 0 *********** SCCC-arg-asp
+ 1 -4.50217E-01 3.01442E-01
+ 2 -1.09243E-01 -3.98998E-02
+ 3 7.44890E-02 4.61206E-02
+ 4 -7.56613E-02 6.91330E-03
+4 0 *********** SCCC-arg-his
+ 1 -4.81948E-01 2.64773E-01
+ 2 -1.06189E-01 -2.30736E-02
+ 3 7.85526E-02 4.26425E-02
+ 4 -7.31967E-02 7.22995E-04
+4 0 *********** SCCC-arg-arg
+ 1 -3.87081E-01 1.77815E-01
+ 2 -5.42853E-02 3.40488E-02
+ 3 4.03228E-02 3.28638E-02
+ 4 -5.03760E-02 -6.84053E-03
+4 0 *********** SCCC-arg-lys
+ 1 -3.75245E-01 1.46792E-01
+ 2 -4.51987E-02 4.94359E-02
+ 3 3.73444E-02 3.13716E-02
+ 4 -4.69384E-02 -8.52284E-03
+4 0 *********** SCCC-arg-pro
+ 1 -5.95886E-01 2.06751E-01
+ 2 -8.81570E-02 -8.15618E-02
+ 3 7.14983E-02 1.19196E-01
+ 4 -9.18050E-02 -5.95070E-02
+4 0 *********** SCCC-lys-cys
+ 1 -5.47372E-01 3.16605E-01
+ 2 -2.87129E-01 -4.87277E-02
+ 3 6.85147E-02 7.82231E-02
+ 4 -2.52364E-02 4.46998E-03
+4 0 *********** SCCC-lys-met
+ 1 -4.60087E-01 1.84547E-01
+ 2 -1.81462E-01 5.61335E-02
+ 3 1.04843E-02 7.62134E-02
+ 4 -2.33361E-02 -2.58159E-02
+4 0 *********** SCCC-lys-phe
+ 1 -4.80395E-01 1.59179E-01
+ 2 -1.92525E-01 3.81188E-02
+ 3 1.47921E-02 9.02307E-02
+ 4 -2.21454E-02 -2.78217E-02
+4 0 *********** SCCC-lys-ile
+ 1 -4.74587E-01 2.65560E-01
+ 2 -2.07996E-01 5.01665E-02
+ 3 3.24299E-02 5.54556E-02
+ 4 -2.36470E-02 -1.53426E-02
+4 0 *********** SCCC-lys-leu
+ 1 -4.50611E-01 1.36362E-01
+ 2 -1.69617E-01 7.94878E-02
+ 3 7.67290E-03 8.55450E-02
+ 4 -2.33045E-02 -3.10951E-02
+4 0 *********** SCCC-lys-val
+ 1 -4.62113E-01 2.17145E-01
+ 2 -1.88623E-01 6.44282E-02
+ 3 2.02094E-02 6.54751E-02
+ 4 -2.39116E-02 -2.27431E-02
+4 0 *********** SCCC-lys-trp
+ 1 -4.93534E-01 2.07583E-01
+ 2 -2.05569E-01 1.39425E-02
+ 3 2.22329E-02 8.05416E-02
+ 4 -2.31722E-02 -2.09946E-02
+4 0 *********** SCCC-lys-tyr
+ 1 -4.77446E-01 1.61184E-01
+ 2 -1.91261E-01 4.10369E-02
+ 3 1.41410E-02 8.90870E-02
+ 4 -2.22685E-02 -2.77056E-02
+4 0 *********** SCCC-lys-ala
+ 1 -4.11165E-01 8.80741E-02
+ 2 -1.28881E-01 9.94373E-02
+ 3 -1.00122E-02 8.75506E-02
+ 4 -2.35571E-02 -3.16775E-02
+4 0 *********** SCCC-lys-gly
+ 1 5.25954E-01 4.79788E-01
+ 2 3.34916E-01 -8.65974E-02
+ 3 4.33983E-02 1.24438E-01
+ 4 -4.31657E-04 3.26861E-02
+4 0 *********** SCCC-lys-thr
+ 1 -4.71676E-01 2.27090E-01
+ 2 -1.95394E-01 -8.01890E-03
+ 3 9.16728E-03 7.08142E-02
+ 4 -1.90784E-02 -1.71305E-02
+4 0 *********** SCCC-lys-ser
+ 1 -5.98217E-01 3.88338E-01
+ 2 -3.47037E-01 -9.79754E-02
+ 3 1.20162E-01 7.50527E-02
+ 4 -3.17903E-02 3.51891E-02
+4 0 *********** SCCC-lys-gln
+ 1 -4.96946E-01 2.88272E-01
+ 2 -2.31370E-01 -2.69509E-03
+ 3 3.46963E-02 6.54058E-02
+ 4 -2.40756E-02 -7.89120E-03
+4 0 *********** SCCC-lys-asn
+ 1 -5.59296E-01 3.57317E-01
+ 2 -3.04425E-01 -9.17428E-02
+ 3 8.18186E-02 7.82304E-02
+ 4 -2.80689E-02 1.91804E-02
+4 0 *********** SCCC-lys-glu
+ 1 -5.13847E-01 2.95140E-01
+ 2 -2.52457E-01 -6.09678E-03
+ 3 4.88495E-02 6.92841E-02
+ 4 -2.43858E-02 -5.26692E-03
+4 0 *********** SCCC-lys-asp
+ 1 -5.31340E-01 3.98318E-01
+ 2 -2.85858E-01 -8.13740E-02
+ 3 6.60168E-02 6.04862E-02
+ 4 -2.90134E-02 2.37989E-02
+4 0 *********** SCCC-lys-his
+ 1 -5.61080E-01 3.38925E-01
+ 2 -2.96162E-01 -5.72318E-02
+ 3 7.95857E-02 6.88026E-02
+ 4 -2.57550E-02 1.00336E-02
+4 0 *********** SCCC-lys-arg
+ 1 -4.40771E-01 1.83017E-01
+ 2 -1.61779E-01 6.94934E-02
+ 3 3.89153E-03 7.17533E-02
+ 4 -2.44256E-02 -2.49766E-02
+4 0 *********** SCCC-lys-lys
+ 1 -4.26222E-01 1.38297E-01
+ 2 -1.45744E-01 9.62439E-02
+ 3 1.82849E-04 7.59947E-02
+ 4 -2.42978E-02 -2.99072E-02
+4 0 *********** SCCC-lys-pro
+ 1 -6.87509E-01 3.29153E-01
+ 2 -3.35348E-01 -2.51436E-01
+ 3 9.98007E-02 1.67332E-01
+ 4 -6.37424E-02 2.57929E-02
+4 0 *********** SCCC-pro-cys
+ 1 4.82339E-01 1.42614E+00
+ 2 2.73463E-03 -2.46321E-01
+ 3 -7.23621E-02 -1.95558E-01
+ 4 4.91904E-02 -1.21700E-01
+4 0 *********** SCCC-pro-met
+ 1 1.68794E-01 1.23060E+00
+ 2 -2.47973E-01 -3.80756E-01
+ 3 -4.89137E-02 -2.85234E-01
+ 4 7.05047E-02 -3.45015E-02
+4 0 *********** SCCC-pro-phe
+ 1 7.60068E-02 1.33126E+00
+ 2 -2.43027E-01 -4.13656E-01
+ 3 -4.27590E-02 -2.69401E-01
+ 4 8.27960E-02 -4.00862E-02
+4 0 *********** SCCC-pro-ile
+ 1 3.32850E-01 1.34111E+00
+ 2 -2.82477E-01 -3.67684E-01
+ 3 -2.03285E-02 -3.17522E-01
+ 4 7.74037E-02 -4.01822E-02
+4 0 *********** SCCC-pro-leu
+ 1 3.23707E-02 1.27574E+00
+ 2 -2.95285E-01 -4.75463E-01
+ 3 -1.57196E-02 -2.72307E-01
+ 4 6.35484E-02 -5.02080E-03
+4 0 *********** SCCC-pro-val
+ 1 2.19698E-01 1.30074E+00
+ 2 -2.99856E-01 -4.07424E-01
+ 3 -1.76088E-02 -3.10886E-01
+ 4 7.62449E-02 -2.36822E-02
+4 0 *********** SCCC-pro-trp
+ 1 2.11003E-01 1.32354E+00
+ 2 -2.08207E-01 -3.28018E-01
+ 3 -5.88735E-02 -2.76918E-01
+ 4 8.41015E-02 -5.71559E-02
+4 0 *********** SCCC-pro-tyr
+ 1 8.63762E-02 1.31518E+00
+ 2 -2.42393E-01 -4.09271E-01
+ 3 -4.62516E-02 -2.71177E-01
+ 4 8.18826E-02 -4.06253E-02
+4 0 *********** SCCC-pro-ala
+ 1 1.64853E-02 1.04884E+00
+ 2 -2.43450E-01 -3.94165E-01
+ 3 -8.69073E-02 -2.30146E-01
+ 4 4.56232E-02 -2.01726E-02
+4 0 *********** SCCC-pro-gly
+ 1 2.23240E+00 -2.14457E+00
+ 2 -3.37741E-01 -2.83765E-01
+ 3 -1.50305E-01 1.76072E-01
+ 4 -3.74656E-02 1.51697E-02
+4 0 *********** SCCC-pro-thr
+ 1 3.32017E-01 1.04626E+00
+ 2 -2.75534E-02 -1.86874E-01
+ 3 -1.12255E-01 -1.98801E-01
+ 4 3.64635E-02 -8.80600E-02
+4 0 *********** SCCC-pro-ser
+ 1 8.54398E-01 1.81527E+00
+ 2 2.24325E-01 -1.46596E-01
+ 3 8.57517E-02 -1.83586E-02
+ 4 6.03122E-02 -7.05508E-02
+4 0 *********** SCCC-pro-gln
+ 1 4.44934E-01 1.25153E+00
+ 2 -1.09365E-01 -2.30544E-01
+ 3 -9.20696E-02 -2.62958E-01
+ 4 5.94435E-02 -9.22573E-02
+4 0 *********** SCCC-pro-asn
+ 1 7.57578E-01 1.34308E+00
+ 2 2.45102E-01 -2.32651E-02
+ 3 -1.13890E-01 -5.77947E-02
+ 4 1.66961E-02 -1.36478E-01
+4 0 *********** SCCC-pro-glu
+ 1 4.22861E-01 1.36719E+00
+ 2 -1.29948E-01 -2.86940E-01
+ 3 -6.70773E-02 -2.68784E-01
+ 4 6.70893E-02 -9.16566E-02
+4 0 *********** SCCC-pro-asp
+ 1 1.06001E+00 1.34100E+00
+ 2 2.62307E-01 1.31717E-01
+ 3 -1.07909E-01 -9.61497E-02
+ 4 4.65401E-02 -1.17995E-01
+4 0 *********** SCCC-pro-his
+ 1 5.51527E-01 1.63451E+00
+ 2 -8.43776E-02 -2.48776E-01
+ 3 -4.05782E-03 -2.49672E-01
+ 4 9.46899E-02 -9.34989E-02
+4 0 *********** SCCC-pro-arg
+ 1 1.99155E-01 1.15004E+00
+ 2 -2.60709E-01 -3.42296E-01
+ 3 -7.54445E-02 -2.89494E-01
+ 4 7.36528E-02 -3.76496E-02
+4 0 *********** SCCC-pro-lys
+ 1 9.07982E-02 1.14370E+00
+ 2 -2.90373E-01 -4.16148E-01
+ 3 -4.75112E-02 -2.68886E-01
+ 4 5.70155E-02 -1.21007E-02
+4 0 *********** SCCC-pro-pro
+ 1 1.24017E+00 3.27182E+00
+ 2 -1.12460E-01 4.91637E-01
+ 3 -2.82130E-01 -1.04332E-01
+ 4 7.16332E-02 -3.05457E-01
+4 0 *********** CCCS-cys-cys
+ 1 -9.81529E-01 -4.99751E-01
+ 2 -1.09644E-01 -1.41325E-01
+ 3 1.66508E-01 -1.41587E-01
+ 4 -4.39297E-02 9.10503E-02
+4 0 *********** CCCS-cys-met
+ 1 -6.99952E-01 -1.25466E-02
+ 2 -2.85225E-01 1.14027E-01
+ 3 6.25110E-02 -1.10927E-01
+ 4 9.64240E-03 4.31923E-02
+4 0 *********** CCCS-cys-phe
+ 1 -7.96678E-01 7.62314E-03
+ 2 -1.22507E-01 3.16194E-01
+ 3 -9.63393E-02 -6.52523E-02
+ 4 6.16694E-02 3.56698E-02
+4 0 *********** CCCS-cys-ile
+ 1 -8.79423E-01 -5.23081E-02
+ 2 -4.10713E-01 1.40084E-01
+ 3 7.18166E-02 -1.91023E-01
+ 4 -6.05884E-03 3.82424E-02
+4 0 *********** CCCS-cys-leu
+ 1 -5.81163E-01 2.21705E-01
+ 2 -4.81013E-01 3.58596E-01
+ 3 5.49719E-03 -8.37178E-02
+ 4 -9.77924E-03 1.48720E-02
+4 0 *********** CCCS-cys-val
+ 1 -7.84291E-01 -2.84432E-03
+ 2 -4.57495E-01 1.99446E-01
+ 3 7.75864E-02 -1.60314E-01
+ 4 5.15416E-03 3.40983E-02
+4 0 *********** CCCS-cys-trp
+ 1 -8.29444E-01 4.82686E-02
+ 2 -1.53370E-01 2.12974E-01
+ 3 -6.19886E-02 -9.43079E-02
+ 4 5.74415E-02 3.56113E-02
+4 0 *********** CCCS-cys-tyr
+ 1 -7.86153E-01 1.26779E-02
+ 2 -1.02654E-01 2.97115E-01
+ 3 -9.95401E-02 -6.43182E-02
+ 4 7.04470E-02 4.13411E-02
+4 0 *********** CCCS-cys-ala
+ 1 -5.17854E-01 7.94199E-03
+ 2 -5.79857E-01 -2.26360E-01
+ 3 1.02776E-01 -3.73167E-02
+ 4 -7.85419E-03 -2.22182E-02
+4 0 *********** CCCS-cys-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-cys-thr
- 1 -2.03248E-01 5.51263E-02
- 2 3.07864E-01 3.35407E-01
- 3 -1.31526E-01 5.76879E-02
- 4 7.76138E-02 4.93284E-02
- 5 -2.03731E-01 2.87956E-02
- 6 3.61882E-02 -8.21649E-02
-6 0 *********** CCCS-cys-ser
- 1 -6.48842E-02 1.36898E-01
- 2 -2.85369E-01 7.40534E-01
- 3 -2.30651E-01 -5.16896E-02
- 4 -2.32559E-01 2.76752E-01
- 5 9.56038E-02 -1.75199E-01
- 6 -1.97013E-01 -5.81647E-01
-6 0 *********** CCCS-cys-gln
- 1 -1.19089E-01 6.39442E-02
- 2 4.15720E-02 3.88808E-01
- 3 -1.11318E-01 -1.10958E-02
- 4 -6.28745E-02 9.33107E-02
- 5 -6.14000E-02 -2.63730E-02
- 6 -5.23861E-02 -2.09296E-01
-6 0 *********** CCCS-cys-asn
- 1 -6.61606E-02 1.85503E-01
- 2 -3.57518E-01 3.10699E-01
- 3 -2.66973E-01 -9.44250E-02
- 4 -1.73004E-01 1.61665E-01
- 5 5.18439E-02 -1.19069E-01
- 6 -1.15785E-01 -3.27812E-01
-6 0 *********** CCCS-cys-glu
- 1 -1.17844E-01 6.06832E-02
- 2 1.21560E-01 4.13331E-01
- 3 -9.32532E-02 4.89565E-03
- 4 -2.69192E-02 9.16398E-02
- 5 -7.55637E-02 -1.09408E-02
- 6 -3.02019E-02 -1.96423E-01
-6 0 *********** CCCS-cys-asp
- 1 -4.71794E-02 1.49414E-01
- 2 -3.44561E-01 3.54102E-01
- 3 -2.33539E-01 1.73815E-02
- 4 -1.21900E-01 1.55722E-01
- 5 -2.29310E-02 -9.35304E-02
- 6 -1.09390E-01 -2.70399E-01
-6 0 *********** CCCS-cys-his
- 1 -1.55821E-02 2.14894E-01
- 2 -3.18337E-01 2.50889E-01
- 3 -2.76280E-01 5.03498E-02
- 4 -5.66532E-02 9.58135E-02
- 5 -1.15559E-01 -4.55931E-02
- 6 -4.50136E-02 -1.25442E-01
-6 0 *********** CCCS-cys-arg
- 1 -1.72816E-01 2.76509E-02
- 2 2.85707E-01 1.72018E-01
- 3 -6.59164E-02 -7.43103E-02
- 4 -1.07827E-02 6.06648E-02
- 5 -3.12455E-02 -3.30765E-02
- 6 -3.11861E-02 -1.57759E-01
-6 0 *********** CCCS-cys-lys
- 1 -1.89653E-01 3.09404E-02
- 2 3.35374E-01 1.48211E-01
- 3 -7.36330E-02 -5.62915E-02
- 4 2.94976E-02 4.52978E-02
- 5 -5.82360E-02 -2.29557E-02
- 6 -6.81123E-03 -1.19752E-01
-6 0 *********** CCCS-cys-pro
- 1 2.25358E-01 -5.76858E-01
- 2 -6.53319E-01 -6.51871E-01
- 3 -2.90103E-01 -4.75061E-01
- 4 -1.86345E-01 4.74952E-01
- 5 2.36789E-01 -9.96302E-02
- 6 -1.64613E-01 -5.16826E-01
-6 0 *********** CCCS-met-cys
- 1 -7.34487E-01 3.09506E-01
- 2 -1.39018E-01 4.32778E-01
- 3 -1.92234E-01 -6.32933E-02
- 4 -1.21518E-01 7.41625E-02
- 5 -6.77158E-02 -4.29534E-02
- 6 -5.92468E-02 -2.18930E-01
-6 0 *********** CCCS-met-met
- 1 -5.38620E-01 4.44836E-01
- 2 1.93475E-01 1.34595E-01
- 3 -1.07309E-01 1.13417E-02
- 4 -5.92730E-03 8.34853E-02
- 5 -1.17862E-01 -1.15213E-02
- 6 -1.13171E-02 -3.37062E-02
-6 0 *********** CCCS-met-phe
- 1 -4.83090E-01 5.63426E-01
- 2 1.74892E-01 3.47418E-02
- 3 -5.34814E-02 -6.82614E-02
- 4 -2.15618E-02 6.91379E-02
- 5 -6.09399E-02 -3.46480E-02
- 6 -2.25282E-02 -3.01455E-02
-6 0 *********** CCCS-met-ile
- 1 -5.75739E-01 5.47566E-01
- 2 2.52908E-01 1.03034E-01
- 3 -1.41761E-01 7.81617E-02
- 4 4.22093E-02 8.28848E-02
- 5 -1.64437E-01 2.79027E-03
- 6 1.18836E-02 4.28437E-02
-6 0 *********** CCCS-met-leu
- 1 -4.62855E-01 4.96060E-01
- 2 3.75177E-01 6.70144E-03
- 3 7.00004E-02 -1.55550E-02
- 4 -2.89849E-02 9.18811E-02
- 5 4.07282E-02 -3.92495E-02
- 6 -2.99345E-02 -2.49611E-02
-6 0 *********** CCCS-met-val
- 1 -5.30011E-01 5.34488E-01
- 2 2.55351E-01 3.50534E-02
- 3 -8.43881E-02 5.41744E-02
- 4 -7.14225E-03 8.91348E-02
- 5 -1.02092E-01 -9.93436E-03
- 6 -1.26755E-02 3.60313E-02
-6 0 *********** CCCS-met-trp
- 1 -4.50958E-01 5.35591E-01
- 2 1.56596E-01 1.03637E-01
- 3 -7.30201E-02 -4.82778E-02
- 4 -2.59621E-02 7.66675E-02
- 5 -6.64170E-02 -2.92903E-02
- 6 -2.50582E-02 -4.72217E-02
-6 0 *********** CCCS-met-tyr
- 1 -4.59146E-01 5.43189E-01
- 2 1.35086E-01 6.22810E-02
- 3 -2.61321E-02 -1.01795E-01
- 4 -6.90679E-02 9.18397E-02
- 5 -1.00117E-02 -4.86673E-02
- 6 -5.24642E-02 -8.88875E-02
-6 0 *********** CCCS-met-ala
- 1 -6.49265E-01 1.57538E-01
- 2 2.94074E-01 4.38016E-01
- 3 -7.55584E-02 3.20068E-02
- 4 -1.49637E-01 1.84947E-01
- 5 9.80198E-03 -2.37352E-02
- 6 -1.18694E-01 -2.48590E-01
-6 0 *********** CCCS-met-gly
+4 0 *********** CCCS-cys-thr
+ 1 -8.30177E-01 -3.53848E-02
+ 2 -3.94740E-01 -2.22237E-03
+ 3 7.19076E-02 -1.22610E-01
+ 4 -7.73690E-03 1.97299E-02
+4 0 *********** CCCS-cys-ser
+ 1 -1.11675E+00 -9.04310E-01
+ 2 7.00369E-03 -1.63392E-01
+ 3 1.63316E-01 -1.70663E-01
+ 4 -6.93816E-02 2.63151E-02
+4 0 *********** CCCS-cys-gln
+ 1 -8.54563E-01 -1.07630E-01
+ 2 -1.87343E-01 -9.34115E-02
+ 3 -5.30520E-02 -1.16920E-01
+ 4 1.54047E-02 5.70308E-02
+4 0 *********** CCCS-cys-asn
+ 1 -9.28088E-01 -6.02095E-01
+ 2 6.86611E-02 -2.44584E-01
+ 3 6.24537E-02 -7.51201E-02
+ 4 3.79455E-03 6.64844E-02
+4 0 *********** CCCS-cys-glu
+ 1 -9.51407E-01 -6.55904E-02
+ 2 -2.34702E-01 -7.11047E-03
+ 3 -5.47458E-02 -1.46273E-01
+ 4 2.51454E-02 3.57427E-02
+4 0 *********** CCCS-cys-asp
+ 1 -1.01534E+00 -7.17179E-01
+ 2 9.03379E-03 -2.23320E-01
+ 3 9.16158E-02 -5.34428E-02
+ 4 8.89365E-03 4.84009E-02
+4 0 *********** CCCS-cys-his
+ 1 -9.54598E-01 -5.73454E-01
+ 2 1.16190E-01 -1.27483E-01
+ 3 1.71071E-01 -1.29127E-01
+ 4 -2.06691E-02 2.05881E-03
+4 0 *********** CCCS-cys-arg
+ 1 -6.59082E-01 1.28634E-01
+ 2 -2.34765E-01 2.44536E-01
+ 3 -2.41314E-02 -9.57468E-02
+ 4 -7.47069E-03 1.40142E-02
+4 0 *********** CCCS-cys-lys
+ 1 -5.54585E-01 1.93256E-01
+ 2 -3.58461E-01 2.39395E-01
+ 3 5.44631E-02 -7.44114E-02
+ 4 5.48193E-03 1.04960E-02
+4 0 *********** CCCS-cys-pro
+ 1 -1.57268E+00 -7.21704E-01
+ 2 -4.01256E-02 5.03049E-02
+ 3 -4.96014E-02 -4.51269E-01
+ 4 -9.56046E-02 1.16484E-01
+4 0 *********** CCCS-met-cys
+ 1 -8.66203E-01 -4.35658E-01
+ 2 7.94597E-02 -4.44697E-02
+ 3 9.94323E-02 -1.10620E-01
+ 4 -8.77444E-04 3.10846E-02
+4 0 *********** CCCS-met-met
+ 1 -6.13072E-01 2.17128E-02
+ 2 -1.48139E-01 -1.24288E-02
+ 3 2.29492E-02 -5.93085E-02
+ 4 -9.03098E-03 4.49343E-02
+4 0 *********** CCCS-met-phe
+ 1 -6.58045E-01 8.08007E-02
+ 2 -8.59951E-02 1.04368E-01
+ 3 -1.01504E-01 -3.30910E-02
+ 4 5.29134E-02 5.26243E-02
+4 0 *********** CCCS-met-ile
+ 1 -7.69788E-01 1.00031E-02
+ 2 -1.68608E-01 -3.98670E-02
+ 3 1.35835E-02 -1.08701E-01
+ 4 -3.93300E-02 3.99990E-02
+4 0 *********** CCCS-met-leu
+ 1 -5.35859E-01 2.37305E-01
+ 2 -3.01175E-01 7.29295E-02
+ 3 -1.45616E-02 -3.71859E-02
+ 4 -2.09997E-02 8.33643E-02
+4 0 *********** CCCS-met-val
+ 1 -6.85812E-01 6.09897E-02
+ 2 -2.24886E-01 -1.19862E-02
+ 3 1.67065E-02 -8.80205E-02
+ 4 -3.09468E-02 6.03288E-02
+4 0 *********** CCCS-met-trp
+ 1 -7.04443E-01 9.44303E-02
+ 2 -8.35085E-02 3.90069E-02
+ 3 -6.82070E-02 -4.74457E-02
+ 4 3.89369E-02 4.52790E-02
+4 0 *********** CCCS-met-tyr
+ 1 -6.48983E-01 7.76534E-02
+ 2 -7.60514E-02 1.00872E-01
+ 3 -9.86517E-02 -3.30396E-02
+ 4 5.61998E-02 5.41831E-02
+4 0 *********** CCCS-met-ala
+ 1 -4.83644E-01 -5.25651E-03
+ 2 -2.57531E-01 -2.26794E-01
+ 3 5.53271E-02 -1.77366E-02
+ 4 -6.24025E-02 -6.47984E-02
+4 0 *********** CCCS-met-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-met-thr
- 1 -7.69075E-01 3.76115E-01
- 2 4.14929E-01 2.57125E-01
- 3 -1.53909E-01 8.25365E-02
- 4 -5.13141E-03 1.09179E-01
- 5 -1.71437E-01 1.61365E-02
- 6 -1.34392E-02 -3.07864E-02
-6 0 *********** CCCS-met-ser
- 1 -9.07193E-01 1.68373E-01
- 2 -2.88639E-01 8.65869E-01
- 3 -2.21049E-01 -1.20509E-01
- 4 -2.27648E-01 5.83930E-02
- 5 1.97080E-02 -9.41836E-02
- 6 -8.38721E-02 -4.48484E-01
-6 0 *********** CCCS-met-gln
- 1 -5.93482E-01 3.93832E-01
- 2 5.98647E-02 3.40968E-01
- 3 -1.66852E-01 6.29466E-03
- 4 -3.41352E-02 7.27062E-02
- 5 -1.35957E-01 -6.24105E-03
- 6 -2.08760E-02 -1.05664E-01
-6 0 *********** CCCS-met-asn
- 1 -7.22476E-01 1.26125E-01
- 2 -3.98561E-01 3.79292E-01
- 3 -2.21557E-01 -1.38797E-01
- 4 -1.05891E-01 5.17197E-02
- 5 -2.63333E-02 -6.16737E-02
- 6 -6.52542E-02 -2.61900E-01
-6 0 *********** CCCS-met-glu
- 1 -6.05155E-01 4.77734E-01
- 2 1.42747E-01 3.44824E-01
- 3 -1.62993E-01 4.35318E-02
- 4 -2.85344E-02 8.67631E-02
- 5 -1.28201E-01 1.95046E-05
- 6 -2.29850E-02 -7.21142E-02
-6 0 *********** CCCS-met-asp
- 1 -8.17165E-01 -9.92268E-02
- 2 -2.96896E-01 4.95997E-01
- 3 -1.73975E-01 -7.18698E-03
- 4 -1.11204E-01 4.30202E-02
- 5 -8.74157E-02 -4.95023E-02
- 6 -5.30422E-02 -2.55125E-01
-6 0 *********** CCCS-met-his
- 1 -6.69783E-01 3.41680E-01
- 2 -3.38944E-01 3.23020E-01
- 3 -3.10841E-01 -5.76625E-02
- 4 -2.76787E-02 2.02445E-02
- 5 -1.20742E-01 -3.28862E-02
- 6 -1.88590E-02 -1.19370E-01
-6 0 *********** CCCS-met-arg
- 1 -4.23522E-01 4.49574E-01
- 2 1.99695E-01 8.52442E-02
- 3 -8.89823E-03 -4.10933E-02
- 4 -4.70793E-02 9.93867E-02
- 5 -2.64343E-02 -3.90948E-02
- 6 -3.61360E-02 -7.52071E-02
-6 0 *********** CCCS-met-lys
- 1 -4.55844E-01 4.44740E-01
- 2 2.82442E-01 3.74083E-02
- 3 -3.10465E-02 -4.02216E-04
- 4 5.14216E-03 7.42740E-02
- 5 -6.77792E-02 -2.49729E-02
- 6 -5.15147E-03 -1.60042E-02
-6 0 *********** CCCS-met-pro
- 1 1.03716E+00 2.12432E-01
- 2 -8.96469E-01 -4.75144E-01
- 3 -7.25667E-01 -7.76986E-01
- 4 -2.97956E-01 4.13991E-01
- 5 2.70151E-01 1.51386E-01
- 6 -1.30370E-01 -3.52118E-01
-6 0 *********** CCCS-phe-cys
- 1 -8.75866E-01 8.02341E-01
- 2 -7.43017E-02 3.05266E-01
- 3 -2.00033E-01 -9.44923E-03
- 4 -5.31874E-02 9.53384E-02
- 5 -1.64369E-01 -1.03167E-02
- 6 -2.69415E-02 -5.62436E-02
-6 0 *********** CCCS-phe-met
- 1 -4.25798E-01 7.01409E-01
- 2 9.51487E-02 4.84016E-02
- 3 -6.42424E-02 -6.06696E-02
- 4 3.22998E-02 9.79369E-02
- 5 -1.24677E-01 -1.75984E-02
- 6 2.20636E-03 -8.00234E-03
-6 0 *********** CCCS-phe-phe
- 1 -2.70491E-01 8.60280E-01
- 2 -3.28107E-02 1.65233E-02
- 3 -6.50143E-02 -1.85787E-01
- 4 -2.37802E-02 6.99972E-02
- 5 -5.14470E-02 -3.40117E-02
- 6 -4.48839E-02 -3.33341E-02
-6 0 *********** CCCS-phe-ile
- 1 -4.32705E-01 8.93811E-01
- 2 5.99170E-02 -1.72911E-02
- 3 -1.70760E-04 -4.25378E-02
- 4 8.06998E-02 1.45841E-01
- 5 -1.77861E-01 -3.51218E-02
- 6 4.64841E-02 2.00795E-03
-6 0 *********** CCCS-phe-leu
- 1 -2.59015E-01 7.21621E-01
- 2 2.00353E-01 -1.36702E-01
- 3 1.13915E-01 -1.46197E-01
- 4 1.62792E-03 1.05742E-01
- 5 -1.57547E-02 -7.03507E-02
- 6 -6.35271E-03 -4.32138E-02
-6 0 *********** CCCS-phe-val
- 1 -3.79690E-01 8.34919E-01
- 2 6.30869E-02 -9.27999E-02
- 3 4.25173E-02 -4.87624E-02
- 4 2.78515E-02 1.52874E-01
- 5 -1.33283E-01 -5.42872E-02
- 6 2.86656E-02 -1.05697E-02
-6 0 *********** CCCS-phe-trp
- 1 -2.64689E-01 8.13134E-01
- 2 2.01594E-02 7.80805E-02
- 3 -1.01997E-01 -1.25120E-01
- 4 6.34574E-03 6.34687E-02
- 5 -8.98983E-02 -2.27110E-02
- 6 -2.22645E-02 -1.56062E-02
-6 0 *********** CCCS-phe-tyr
- 1 -2.56103E-01 8.27283E-01
- 2 -5.69698E-02 5.96913E-02
- 3 -4.92783E-02 -2.17641E-01
- 4 -7.21825E-02 9.32166E-02
- 5 4.77401E-03 -4.74386E-02
- 6 -7.84155E-02 -9.11324E-02
-6 0 *********** CCCS-phe-ala
- 1 -6.37247E-01 3.68657E-01
- 2 3.13579E-01 2.31488E-01
- 3 6.16279E-02 3.86003E-03
- 4 -1.40953E-01 1.75144E-01
- 5 8.64393E-02 -4.42932E-02
- 6 -1.02731E-01 -1.70337E-01
-6 0 *********** CCCS-phe-gly
+4 0 *********** CCCS-met-thr
+ 1 -7.50182E-01 -7.13862E-03
+ 2 -1.48158E-01 -9.85241E-02
+ 3 1.94110E-02 -7.67674E-02
+ 4 -4.58864E-02 1.16702E-02
+4 0 *********** CCCS-met-ser
+ 1 -1.07466E+00 -7.84380E-01
+ 2 2.10572E-01 1.30160E-01
+ 3 1.52089E-01 -2.05490E-01
+ 4 -2.60098E-03 2.08907E-02
+4 0 *********** CCCS-met-gln
+ 1 -7.74784E-01 -9.34274E-02
+ 2 -2.29268E-02 -1.00496E-01
+ 3 -3.94836E-02 -1.04385E-01
+ 4 -1.86197E-02 2.35040E-02
+4 0 *********** CCCS-met-asn
+ 1 -8.44036E-01 -5.57180E-01
+ 2 1.78936E-01 -2.85897E-02
+ 3 6.62377E-02 -9.25476E-02
+ 4 4.13624E-02 4.11267E-02
+4 0 *********** CCCS-met-glu
+ 1 -8.55736E-01 -3.94036E-02
+ 2 -4.11801E-02 -8.11488E-02
+ 3 -5.44869E-02 -1.09475E-01
+ 4 -1.65591E-02 1.37735E-02
+4 0 *********** CCCS-met-asp
+ 1 -9.36592E-01 -6.29915E-01
+ 2 1.82784E-01 9.07202E-03
+ 3 7.49978E-02 -1.06031E-01
+ 4 4.70710E-02 3.33531E-02
+4 0 *********** CCCS-met-his
+ 1 -8.21352E-01 -5.34210E-01
+ 2 1.69094E-01 3.83050E-03
+ 3 1.30048E-01 -7.46808E-02
+ 4 4.58805E-02 -1.08123E-02
+4 0 *********** CCCS-met-arg
+ 1 -5.77822E-01 1.50675E-01
+ 2 -1.54964E-01 6.02103E-02
+ 3 -3.15758E-02 -4.90978E-02
+ 4 -4.68353E-03 3.30582E-02
+4 0 *********** CCCS-met-lys
+ 1 -4.99865E-01 1.99580E-01
+ 2 -2.33587E-01 4.70035E-02
+ 3 1.86719E-02 -2.35417E-02
+ 4 -4.26733E-03 4.46749E-02
+4 0 *********** CCCS-met-pro
+ 1 -1.57885E+00 -5.75661E-01
+ 2 4.14501E-01 1.72252E-01
+ 3 -1.15299E-01 -4.69122E-01
+ 4 -4.85505E-02 7.85129E-02
+4 0 *********** CCCS-phe-cys
+ 1 -9.12821E-01 -3.77321E-01
+ 2 5.08327E-02 -9.85651E-02
+ 3 1.43259E-01 -1.00092E-01
+ 4 -3.00755E-02 4.69906E-02
+4 0 *********** CCCS-phe-met
+ 1 -6.23026E-01 5.94970E-02
+ 2 -1.77008E-01 -6.12113E-03
+ 3 3.13060E-02 -7.63763E-02
+ 4 -2.52265E-03 4.90769E-02
+4 0 *********** CCCS-phe-phe
+ 1 -6.64167E-01 1.14750E-01
+ 2 -9.79301E-02 1.28721E-01
+ 3 -1.13137E-01 -4.57718E-02
+ 4 5.83560E-02 4.68812E-02
+4 0 *********** CCCS-phe-ile
+ 1 -7.81793E-01 6.96795E-02
+ 2 -2.22359E-01 -3.45911E-02
+ 3 2.71752E-02 -1.44893E-01
+ 4 -2.01122E-02 5.20491E-02
+4 0 *********** CCCS-phe-leu
+ 1 -5.21894E-01 2.87467E-01
+ 2 -3.41532E-01 1.18849E-01
+ 3 -3.47587E-02 -5.97313E-02
+ 4 -9.43166E-03 6.08606E-02
+4 0 *********** CCCS-phe-val
+ 1 -6.92182E-01 1.14383E-01
+ 2 -2.74014E-01 3.81588E-03
+ 3 2.32172E-02 -1.21091E-01
+ 4 -1.19473E-02 6.27734E-02
+4 0 *********** CCCS-phe-trp
+ 1 -7.10971E-01 1.34770E-01
+ 2 -1.05461E-01 5.39577E-02
+ 3 -7.20510E-02 -6.44354E-02
+ 4 4.74478E-02 4.36588E-02
+4 0 *********** CCCS-phe-tyr
+ 1 -6.55805E-01 1.10372E-01
+ 2 -8.64232E-02 1.23200E-01
+ 3 -1.09276E-01 -4.46766E-02
+ 4 6.11438E-02 4.92978E-02
+4 0 *********** CCCS-phe-ala
+ 1 -4.94923E-01 4.12141E-02
+ 2 -3.17716E-01 -2.32467E-01
+ 3 7.38477E-02 -4.18254E-02
+ 4 -4.40483E-02 -4.39782E-02
+4 0 *********** CCCS-phe-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-phe-thr
- 1 -7.04004E-01 7.01768E-01
- 2 3.06269E-01 2.38893E-03
- 3 2.04523E-02 2.96475E-02
- 4 -4.14356E-02 1.42473E-01
- 5 -7.46043E-02 -2.53375E-02
- 6 -1.99975E-02 1.40425E-02
-6 0 *********** CCCS-phe-ser
- 1 -1.32469E+00 9.83020E-01
- 2 -6.43813E-02 6.39437E-01
- 3 -2.71913E-01 -1.61845E-02
- 4 -1.66139E-01 7.55123E-02
- 5 -9.88461E-02 -4.28548E-02
- 6 -5.04866E-02 -1.49380E-01
-6 0 *********** CCCS-phe-gln
- 1 -5.53128E-01 7.10054E-01
- 2 6.10555E-02 2.88718E-01
- 3 -1.67463E-01 -3.61561E-02
- 4 9.52812E-03 8.05631E-02
- 5 -1.41053E-01 5.82288E-04
- 6 -1.36401E-02 -5.26782E-02
-6 0 *********** CCCS-phe-asn
- 1 -9.76155E-01 4.91425E-01
- 2 -2.02354E-01 4.09462E-01
- 3 -2.89774E-01 -3.94480E-02
- 4 -7.07615E-02 4.76484E-02
- 5 -1.18713E-01 -4.26408E-02
- 6 -2.73394E-02 -1.44275E-01
-6 0 *********** CCCS-phe-glu
- 1 -5.12362E-01 8.65667E-01
- 2 6.87941E-02 2.59288E-01
- 3 -1.12944E-01 -2.73526E-02
- 4 1.76515E-02 1.00946E-01
- 5 -1.21820E-01 -1.82981E-03
- 6 -1.12696E-02 -2.95446E-02
-6 0 *********** CCCS-phe-asp
- 1 -1.29226E+00 1.87274E-01
- 2 8.66474E-02 5.02081E-01
- 3 -2.01799E-01 3.13381E-02
- 4 -9.88631E-02 9.26440E-02
- 5 -1.39372E-01 -1.57149E-03
- 6 -5.21250E-02 -1.95147E-01
-6 0 *********** CCCS-phe-his
- 1 -8.31552E-01 8.41300E-01
- 2 -3.21347E-01 3.17100E-01
- 3 -2.74849E-01 -9.16845E-04
- 4 -3.62619E-02 5.04124E-02
- 5 -1.51347E-01 -3.46561E-02
- 6 -2.06124E-02 -3.74396E-02
-6 0 *********** CCCS-phe-arg
- 1 -2.59406E-01 6.48163E-01
- 2 7.98773E-02 2.50510E-02
- 3 1.10208E-02 -1.42972E-01
- 4 -2.67348E-02 1.05750E-01
- 5 -3.11528E-02 -4.20598E-02
- 6 -4.18776E-02 -8.05745E-02
-6 0 *********** CCCS-phe-lys
- 1 -2.97664E-01 6.37126E-01
- 2 1.60797E-01 -5.88156E-02
- 3 2.10598E-03 -9.88539E-02
- 4 3.20552E-02 8.59916E-02
- 5 -9.53357E-02 -4.25523E-02
- 6 8.74750E-03 -2.68642E-02
-6 0 *********** CCCS-phe-pro
- 1 2.15341E+00 1.14340E-01
- 2 -4.88289E-01 4.75870E-01
- 3 -8.75525E-01 -4.53977E-02
- 4 -5.15634E-01 5.34940E-01
- 5 2.17152E-01 -1.25030E-01
- 6 -1.56500E-01 -6.35025E-01
-6 0 *********** CCCS-ile-cys
- 1 -5.73011E-01 2.52405E-03
- 2 -1.07437E-01 5.10441E-01
- 3 -1.75866E-01 -6.95184E-02
- 4 -1.53361E-01 1.05673E-01
- 5 -3.27841E-02 -5.95557E-02
- 6 -8.39226E-02 -3.25037E-01
-6 0 *********** CCCS-ile-met
- 1 -5.18834E-01 2.25246E-01
- 2 2.45879E-01 1.58040E-01
- 3 -1.10918E-01 1.23421E-02
- 4 -7.03527E-03 7.42941E-02
- 5 -9.96143E-02 -9.48177E-03
- 6 -1.73472E-02 -6.55431E-02
-6 0 *********** CCCS-ile-phe
- 1 -5.09094E-01 3.25674E-01
- 2 2.70363E-01 2.49135E-02
- 3 -6.44719E-02 -3.72628E-02
- 4 1.00078E-02 5.21076E-02
- 5 -8.45311E-02 -2.69845E-02
- 6 -4.43885E-03 -2.77091E-02
-6 0 *********** CCCS-ile-ile
- 1 -5.81496E-01 2.84982E-01
- 2 3.36025E-01 1.32887E-01
- 3 -1.77483E-01 7.15057E-02
- 4 6.04409E-02 5.98672E-02
- 5 -1.52115E-01 7.84380E-03
- 6 1.19657E-02 4.93603E-03
-6 0 *********** CCCS-ile-leu
- 1 -5.30792E-01 3.05216E-01
- 2 4.37190E-01 6.90465E-03
- 3 5.56775E-02 -1.00981E-02
- 4 -3.16785E-02 7.32942E-02
- 5 6.18049E-02 -3.36712E-02
- 6 -4.03159E-02 -3.42927E-02
-6 0 *********** CCCS-ile-val
- 1 -5.49509E-01 2.96691E-01
- 2 3.34550E-01 6.47504E-02
- 3 -1.27608E-01 3.64371E-02
- 4 2.38475E-02 6.44173E-02
- 5 -9.98895E-02 -3.89407E-03
- 6 -6.99273E-03 -3.24192E-03
-6 0 *********** CCCS-ile-trp
- 1 -4.74263E-01 2.94535E-01
- 2 2.33950E-01 9.58430E-02
- 3 -6.29003E-02 -3.09844E-02
- 4 -2.13975E-02 6.92349E-02
- 5 -5.85647E-02 -2.73006E-02
- 6 -2.36735E-02 -6.64104E-02
-6 0 *********** CCCS-ile-tyr
- 1 -4.79586E-01 3.12223E-01
- 2 2.27558E-01 4.36960E-02
- 3 -3.68880E-02 -6.20833E-02
- 4 -3.31701E-02 6.91398E-02
- 5 -4.22499E-02 -3.78308E-02
- 6 -2.94874E-02 -7.25669E-02
-6 0 *********** CCCS-ile-ala
- 1 -6.12077E-01 6.76544E-03
- 2 3.17361E-01 4.73605E-01
- 3 -1.04502E-01 1.62438E-02
- 4 -1.27505E-01 1.82777E-01
- 5 -7.28617E-03 -2.51552E-02
- 6 -1.07551E-01 -2.97104E-01
-6 0 *********** CCCS-ile-gly
+4 0 *********** CCCS-phe-thr
+ 1 -7.64567E-01 5.15089E-02
+ 2 -2.00158E-01 -1.03471E-01
+ 3 3.79001E-02 -1.05455E-01
+ 4 -3.12385E-02 2.81603E-02
+4 0 *********** CCCS-phe-ser
+ 1 -1.12981E+00 -7.16208E-01
+ 2 1.91507E-01 4.50295E-02
+ 3 1.90069E-01 -1.65163E-01
+ 4 -3.93849E-02 9.87696E-03
+4 0 *********** CCCS-phe-gln
+ 1 -7.94613E-01 -4.34063E-02
+ 2 -5.91753E-02 -1.15293E-01
+ 3 -2.44069E-02 -1.20060E-01
+ 4 -1.20418E-02 3.83564E-02
+4 0 *********** CCCS-phe-asn
+ 1 -8.98304E-01 -5.03805E-01
+ 2 1.72085E-01 -9.29972E-02
+ 3 9.05312E-02 -6.36999E-02
+ 4 1.59051E-02 3.47806E-02
+4 0 *********** CCCS-phe-glu
+ 1 -8.71997E-01 1.95591E-02
+ 2 -8.81181E-02 -8.83272E-02
+ 3 -4.08957E-02 -1.37569E-01
+ 4 -1.16297E-03 3.02536E-02
+4 0 *********** CCCS-phe-asp
+ 1 -9.94054E-01 -5.70525E-01
+ 2 1.72008E-01 -6.27533E-02
+ 3 1.05089E-01 -7.20248E-02
+ 4 1.66953E-02 2.56074E-02
+4 0 *********** CCCS-phe-his
+ 1 -8.75873E-01 -4.84068E-01
+ 2 1.65507E-01 -5.37154E-02
+ 3 1.55029E-01 -5.28101E-02
+ 4 1.71628E-02 -1.43560E-02
+4 0 *********** CCCS-phe-arg
+ 1 -5.76788E-01 1.88733E-01
+ 2 -1.78800E-01 8.30768E-02
+ 3 -3.94017E-02 -6.62495E-02
+ 4 2.87128E-03 2.73581E-02
+4 0 *********** CCCS-phe-lys
+ 1 -4.94552E-01 2.37310E-01
+ 2 -2.61761E-01 7.37263E-02
+ 3 1.27529E-02 -3.97466E-02
+ 4 2.80516E-03 3.62896E-02
+4 0 *********** CCCS-phe-pro
+ 1 -1.58954E+00 -4.98158E-01
+ 2 3.17655E-01 1.36275E-01
+ 3 -3.54154E-02 -4.99251E-01
+ 4 -9.54859E-02 1.19848E-01
+4 0 *********** CCCS-ile-cys
+ 1 -7.99072E-01 -5.88558E-01
+ 2 1.23647E-01 -3.55532E-03
+ 3 4.75751E-02 -8.07983E-02
+ 4 1.51485E-02 -1.48954E-03
+4 0 *********** CCCS-ile-met
+ 1 -6.12852E-01 -8.96823E-02
+ 2 -1.25015E-01 -4.06714E-02
+ 3 2.90473E-02 -1.99685E-02
+ 4 -1.74554E-02 3.34820E-02
+4 0 *********** CCCS-ile-phe
+ 1 -6.67701E-01 -3.50544E-02
+ 2 -1.10110E-01 7.16807E-02
+ 3 -5.44385E-02 -2.49255E-02
+ 4 3.62755E-02 5.45292E-02
+4 0 *********** CCCS-ile-ile
+ 1 -7.70788E-01 -1.34307E-01
+ 2 -1.27139E-01 -8.17419E-02
+ 3 2.84869E-02 -4.30272E-02
+ 4 -5.56717E-02 2.66720E-02
+4 0 *********** CCCS-ile-leu
+ 1 -5.80727E-01 1.31484E-01
+ 2 -3.01341E-01 -1.90859E-02
+ 3 3.30606E-02 -1.28841E-02
+ 4 -1.60604E-02 9.24141E-02
+4 0 *********** CCCS-ile-val
+ 1 -6.94111E-01 -7.08022E-02
+ 2 -1.94394E-01 -6.79855E-02
+ 3 3.72644E-02 -2.84876E-02
+ 4 -4.27067E-02 5.25059E-02
+4 0 *********** CCCS-ile-trp
+ 1 -7.17546E-01 -2.94128E-02
+ 2 -8.09592E-02 1.46264E-02
+ 3 -3.45915E-02 -2.71973E-02
+ 4 2.06150E-02 4.58232E-02
+4 0 *********** CCCS-ile-tyr
+ 1 -6.57428E-01 -3.53664E-02
+ 2 -9.94968E-02 7.16473E-02
+ 3 -5.42507E-02 -2.56544E-02
+ 4 3.84820E-02 5.48977E-02
+4 0 *********** CCCS-ile-ala
+ 1 -4.76455E-01 -1.00541E-01
+ 2 -1.74184E-01 -2.85022E-01
+ 3 3.73976E-02 3.22917E-02
+ 4 -7.65591E-02 -6.07851E-02
+4 0 *********** CCCS-ile-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-ile-thr
- 1 -7.20520E-01 1.52370E-01
- 2 4.47203E-01 3.06725E-01
- 3 -1.70009E-01 6.15707E-02
- 4 2.86504E-02 1.01161E-01
- 5 -1.89243E-01 1.99947E-02
- 6 2.18471E-03 -9.53606E-02
-6 0 *********** CCCS-ile-ser
- 1 -7.07592E-01 -2.08315E-01
- 2 -2.42370E-01 9.12389E-01
- 3 -2.06028E-01 -8.03538E-02
- 4 -2.46328E-01 1.14242E-01
- 5 3.63014E-02 -1.19776E-01
- 6 -1.16208E-01 -5.56712E-01
-6 0 *********** CCCS-ile-gln
- 1 -5.26889E-01 1.35829E-01
- 2 1.08716E-01 3.62910E-01
- 3 -1.49245E-01 2.90572E-02
- 4 -4.93779E-02 7.70785E-02
- 5 -1.19565E-01 -6.65903E-03
- 6 -3.08893E-02 -1.42120E-01
-6 0 *********** CCCS-ile-asn
- 1 -4.85394E-01 -1.02890E-01
- 2 -4.01240E-01 4.21931E-01
- 3 -2.38066E-01 -1.31306E-01
- 4 -1.23665E-01 6.40262E-02
- 5 -6.81329E-04 -8.44120E-02
- 6 -8.05069E-02 -3.41929E-01
-6 0 *********** CCCS-ile-glu
- 1 -5.71877E-01 1.82794E-01
- 2 2.13713E-01 3.64811E-01
- 3 -1.51832E-01 5.95781E-02
- 4 -3.44665E-02 8.61727E-02
- 5 -1.11370E-01 2.90599E-03
- 6 -3.08437E-02 -1.17011E-01
-6 0 *********** CCCS-ile-asp
- 1 -5.30826E-01 -2.23806E-01
- 2 -3.44451E-01 5.05943E-01
- 3 -2.21175E-01 -1.70086E-03
- 4 -1.05065E-01 3.92083E-02
- 5 -7.58232E-02 -6.39607E-02
- 6 -5.51117E-02 -2.89655E-01
-6 0 *********** CCCS-ile-his
- 1 -4.52130E-01 4.77438E-02
- 2 -3.06429E-01 3.64720E-01
- 3 -3.27357E-01 -2.02378E-02
- 4 -3.29100E-02 5.63917E-03
- 5 -1.37403E-01 -3.13320E-02
- 6 -6.97865E-03 -1.50268E-01
-6 0 *********** CCCS-ile-arg
- 1 -4.55087E-01 2.59936E-01
- 2 2.62757E-01 7.98537E-02
- 3 -2.06894E-02 -2.45616E-02
- 4 -3.82156E-02 8.20783E-02
- 5 -2.32183E-02 -3.41068E-02
- 6 -3.39236E-02 -7.34418E-02
-6 0 *********** CCCS-ile-lys
- 1 -4.85284E-01 2.65430E-01
- 2 3.31206E-01 4.23026E-02
- 3 -3.64308E-02 3.02512E-03
- 4 5.85108E-04 6.14099E-02
- 5 -4.68705E-02 -2.19729E-02
- 6 -1.38392E-02 -2.86941E-02
-6 0 *********** CCCS-ile-pro
- 1 6.64786E-01 3.79192E-01
- 2 -1.11100E+00 -5.06965E-01
- 3 -7.33920E-01 -7.89389E-01
- 4 -2.55024E-01 4.50527E-01
- 5 2.66792E-01 2.10900E-01
- 6 -1.43080E-01 -2.90779E-01
-6 0 *********** CCCS-leu-cys
- 1 -8.40251E-01 1.00802E-01
- 2 -8.16807E-02 4.20015E-01
- 3 -2.16289E-01 -2.06175E-02
- 4 -1.11132E-01 5.87930E-02
- 5 -9.12802E-02 -3.83205E-02
- 6 -5.20517E-02 -2.13383E-01
-6 0 *********** CCCS-leu-met
- 1 -6.63069E-01 3.77457E-01
- 2 2.12062E-01 1.23060E-01
- 3 -9.30805E-02 3.43046E-02
- 4 -1.60892E-02 8.21935E-02
- 5 -1.17614E-01 -1.09955E-02
- 6 -1.20346E-02 -2.90977E-02
-6 0 *********** CCCS-leu-phe
- 1 -6.46549E-01 5.23379E-01
- 2 1.99176E-01 1.78638E-02
- 3 -3.20141E-02 -7.43670E-02
- 4 1.56120E-02 7.30362E-02
- 5 -8.81635E-02 -3.02478E-02
- 6 -1.05236E-03 -2.87964E-02
-6 0 *********** CCCS-leu-ile
- 1 -7.53106E-01 4.91008E-01
- 2 3.01038E-01 5.96699E-02
- 3 -1.36821E-01 1.28990E-01
- 4 6.55114E-03 7.39211E-02
- 5 -1.39762E-01 7.66045E-03
- 6 -6.21255E-03 8.78048E-02
-6 0 *********** CCCS-leu-leu
- 1 -6.38289E-01 4.66345E-01
- 2 3.88354E-01 1.30425E-02
- 3 1.07787E-01 -6.10914E-03
- 4 -5.55110E-02 1.03077E-01
- 5 6.76938E-02 -4.48706E-02
- 6 -3.86635E-02 -3.86073E-02
-6 0 *********** CCCS-leu-val
- 1 -7.14354E-01 4.90254E-01
- 2 3.18672E-01 1.17585E-02
- 3 -9.85575E-02 9.25170E-02
- 4 -3.15035E-02 7.56187E-02
- 5 -8.54301E-02 -3.04924E-03
- 6 -2.68849E-02 6.21866E-02
-6 0 *********** CCCS-leu-trp
- 1 -5.91617E-01 4.79218E-01
- 2 1.55865E-01 9.49150E-02
- 3 -2.59928E-02 -6.36427E-02
- 4 -3.42631E-02 9.31772E-02
- 5 -4.73945E-02 -3.49061E-02
- 6 -2.89798E-02 -7.90483E-02
-6 0 *********** CCCS-leu-tyr
- 1 -6.09338E-01 5.04880E-01
- 2 1.52227E-01 4.22541E-02
- 3 -9.30336E-04 -1.04882E-01
- 4 -3.32304E-02 9.21869E-02
- 5 -3.72053E-02 -4.23444E-02
- 6 -3.07426E-02 -8.27124E-02
-6 0 *********** CCCS-leu-ala
- 1 -7.38767E-01 7.96087E-02
- 2 3.07720E-01 4.58239E-01
- 3 -1.11960E-01 8.02842E-02
- 4 -1.60821E-01 1.90180E-01
- 5 1.51814E-03 -1.92657E-02
- 6 -1.34659E-01 -2.40499E-01
-6 0 *********** CCCS-leu-gly
+4 0 *********** CCCS-ile-thr
+ 1 -7.47386E-01 -1.46975E-01
+ 2 -9.51584E-02 -1.29410E-01
+ 3 1.91541E-02 -1.92006E-02
+ 4 -5.86822E-02 -1.65503E-03
+4 0 *********** CCCS-ile-ser
+ 1 -9.94110E-01 -9.71102E-01
+ 2 2.52325E-01 2.10757E-01
+ 3 1.03093E-01 -2.16366E-01
+ 4 1.74220E-02 8.41007E-03
+4 0 *********** CCCS-ile-gln
+ 1 -7.57305E-01 -2.28078E-01
+ 2 2.23368E-02 -1.03830E-01
+ 3 -3.93002E-02 -6.68295E-02
+ 4 -3.18245E-02 1.14887E-02
+4 0 *********** CCCS-ile-asn
+ 1 -7.61152E-01 -7.05377E-01
+ 2 2.10926E-01 3.89055E-02
+ 3 2.44067E-02 -1.02457E-01
+ 4 5.35503E-02 3.20461E-02
+4 0 *********** CCCS-ile-glu
+ 1 -8.50983E-01 -1.89340E-01
+ 2 5.54311E-03 -9.61889E-02
+ 3 -4.10803E-02 -6.16716E-02
+ 4 -3.77471E-02 5.80756E-03
+4 0 *********** CCCS-ile-asp
+ 1 -8.52091E-01 -7.95489E-01
+ 2 2.15112E-01 8.00541E-02
+ 3 2.82425E-02 -1.16007E-01
+ 4 6.29191E-02 2.54734E-02
+4 0 *********** CCCS-ile-his
+ 1 -7.46169E-01 -6.79484E-01
+ 2 1.93835E-01 7.73916E-02
+ 3 9.23711E-02 -7.77609E-02
+ 4 5.89622E-02 -2.07259E-02
+4 0 *********** CCCS-ile-arg
+ 1 -6.03530E-01 4.49668E-02
+ 2 -1.50381E-01 1.57574E-02
+ 3 1.94766E-03 -2.86723E-02
+ 4 -9.81849E-03 3.56490E-02
+4 0 *********** CCCS-ile-lys
+ 1 -5.32611E-01 1.04805E-01
+ 2 -2.25289E-01 -1.27024E-02
+ 3 4.20610E-02 3.97173E-05
+ 4 -5.82282E-03 4.52674E-02
+4 0 *********** CCCS-ile-pro
+ 1 -1.66140E+00 -8.34673E-01
+ 2 5.62777E-01 2.67693E-01
+ 3 -1.53787E-01 -4.90724E-01
+ 4 -7.63610E-02 1.03160E-01
+4 0 *********** CCCS-leu-cys
+ 1 -8.83472E-01 -3.69309E-01
+ 2 1.30546E-01 -8.87150E-02
+ 3 1.24376E-01 -7.94938E-02
+ 4 -1.34697E-02 2.23745E-02
+4 0 *********** CCCS-leu-met
+ 1 -6.01407E-01 6.00353E-02
+ 2 -1.49399E-01 -6.36190E-02
+ 3 2.99718E-02 -6.02270E-02
+ 4 -1.27417E-02 5.22786E-02
+4 0 *********** CCCS-leu-phe
+ 1 -6.27773E-01 1.18058E-01
+ 2 -1.11521E-01 5.87123E-02
+ 3 -1.10639E-01 -4.50077E-02
+ 4 5.50946E-02 5.85454E-02
+4 0 *********** CCCS-leu-ile
+ 1 -7.59421E-01 7.79081E-02
+ 2 -1.70199E-01 -1.16861E-01
+ 3 3.22644E-02 -1.19301E-01
+ 4 -4.07583E-02 5.36117E-02
+4 0 *********** CCCS-leu-leu
+ 1 -5.18840E-01 2.89879E-01
+ 2 -3.31220E-01 8.23065E-03
+ 3 -2.64552E-02 -5.21540E-02
+ 4 -1.59381E-02 9.00404E-02
+4 0 *********** CCCS-leu-val
+ 1 -6.73797E-01 1.23189E-01
+ 2 -2.32712E-01 -8.68288E-02
+ 3 2.67392E-02 -9.91950E-02
+ 4 -3.09881E-02 7.45260E-02
+4 0 *********** CCCS-leu-trp
+ 1 -6.79078E-01 1.33816E-01
+ 2 -1.03038E-01 -9.55088E-03
+ 3 -6.76500E-02 -5.67908E-02
+ 4 3.96792E-02 5.27205E-02
+4 0 *********** CCCS-leu-tyr
+ 1 -6.19580E-01 1.12348E-01
+ 2 -1.00853E-01 5.77271E-02
+ 3 -1.06287E-01 -4.38666E-02
+ 4 5.70379E-02 6.01592E-02
+4 0 *********** CCCS-leu-ala
+ 1 -4.92916E-01 3.87462E-02
+ 2 -2.21693E-01 -2.82741E-01
+ 3 6.98050E-02 -2.62396E-02
+ 4 -6.80469E-02 -6.42838E-02
+4 0 *********** CCCS-leu-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-leu-thr
- 1 -9.44976E-01 2.81662E-01
- 2 4.57023E-01 2.69065E-01
- 3 -1.67209E-01 1.24601E-01
- 4 -1.53398E-03 8.22582E-02
- 5 -1.92059E-01 2.92207E-02
- 6 -6.80514E-03 -1.35932E-02
-6 0 *********** CCCS-leu-ser
- 1 -1.08287E+00 -2.15647E-01
- 2 -2.07611E-01 8.12190E-01
- 3 -2.28541E-01 2.00641E-02
- 4 -1.85992E-01 4.50519E-02
- 5 -7.00618E-02 -6.68383E-02
- 6 -6.21199E-02 -3.93147E-01
-6 0 *********** CCCS-leu-gln
- 1 -6.98790E-01 2.70156E-01
- 2 6.12661E-02 3.08678E-01
- 3 -1.38534E-01 4.38656E-02
- 4 -3.60664E-02 7.31595E-02
- 5 -1.48461E-01 -3.28734E-03
- 6 -1.77037E-02 -8.85479E-02
-6 0 *********** CCCS-leu-asn
- 1 -7.54994E-01 -1.16709E-01
- 2 -3.52580E-01 3.83384E-01
- 3 -2.71652E-01 -1.20290E-01
- 4 -1.15614E-01 6.27016E-03
- 5 -5.33093E-02 -5.05946E-02
- 6 -3.80107E-02 -2.60580E-01
-6 0 *********** CCCS-leu-glu
- 1 -7.53419E-01 3.56209E-01
- 2 1.53377E-01 2.96526E-01
- 3 -1.26185E-01 8.40089E-02
- 4 -4.22315E-02 9.01787E-02
- 5 -1.29072E-01 9.33139E-04
- 6 -2.31643E-02 -6.46703E-02
-6 0 *********** CCCS-leu-asp
- 1 -8.66276E-01 -3.31253E-01
- 2 -2.78418E-01 5.02737E-01
- 3 -2.69254E-01 1.77367E-02
- 4 -9.34069E-02 2.18574E-02
- 5 -1.10387E-01 -5.72619E-02
- 6 -3.09226E-02 -2.82398E-01
-6 0 *********** CCCS-leu-his
- 1 -7.43431E-01 9.36579E-02
- 2 -2.27067E-01 3.21488E-01
- 3 -3.82464E-01 -4.32883E-02
- 4 -6.49708E-02 1.42101E-02
- 5 -1.14016E-01 -4.26873E-02
- 6 -8.45458E-03 -1.53789E-01
-6 0 *********** CCCS-leu-arg
- 1 -5.52704E-01 4.13274E-01
- 2 2.09452E-01 7.23066E-02
- 3 1.45104E-02 -2.16023E-02
- 4 -4.58486E-02 1.03337E-01
- 5 -3.15514E-02 -4.09788E-02
- 6 -2.81009E-02 -7.00674E-02
-6 0 *********** CCCS-leu-lys
- 1 -5.85557E-01 4.08022E-01
- 2 2.94199E-01 3.78251E-02
- 3 -8.05245E-03 1.87303E-02
- 4 -9.35505E-03 7.69004E-02
- 5 -5.36147E-02 -2.46563E-02
- 6 -1.00591E-02 -6.38502E-03
-6 0 *********** CCCS-leu-pro
- 1 9.37267E-01 1.09257E+00
- 2 -1.28178E+00 -1.32431E-01
- 3 -8.40609E-01 -6.47204E-01
- 4 -2.62117E-01 3.61860E-01
- 5 3.22252E-01 8.87552E-02
- 6 -1.22798E-01 -2.75118E-01
-6 0 *********** CCCS-val-cys
- 1 -9.31733E-01 7.95694E-01
- 2 -1.09754E-01 2.73388E-01
- 3 -1.94723E-01 -2.57618E-02
- 4 -5.31735E-02 8.76989E-02
- 5 -1.61679E-01 -1.94824E-02
- 6 -2.07609E-02 -5.05500E-02
-6 0 *********** CCCS-val-met
- 1 -4.68807E-01 6.91549E-01
- 2 9.89204E-02 5.77414E-02
- 3 -6.82308E-02 -4.24866E-02
- 4 2.04072E-02 1.02593E-01
- 5 -1.30538E-01 -1.96040E-02
- 6 1.54853E-03 -7.85266E-03
-6 0 *********** CCCS-val-phe
- 1 -3.28219E-01 8.59353E-01
- 2 -2.46470E-02 1.72249E-02
- 3 -5.02301E-02 -1.74244E-01
- 4 -1.78072E-02 7.96368E-02
- 5 -5.19923E-02 -3.08529E-02
- 6 -4.26532E-02 -2.91724E-02
-6 0 *********** CCCS-val-ile
- 1 -4.86424E-01 8.87967E-01
- 2 6.83523E-02 -1.21687E-02
- 3 -8.91055E-03 -1.28102E-02
- 4 5.57300E-02 1.54714E-01
- 5 -1.88677E-01 -4.01679E-02
- 6 4.39675E-02 4.29683E-03
-6 0 *********** CCCS-val-leu
- 1 -3.07630E-01 7.12302E-01
- 2 2.24875E-01 -1.01911E-01
- 3 1.14643E-01 -1.07445E-01
- 4 -5.95384E-03 1.13843E-01
- 5 -4.42700E-03 -6.75108E-02
- 6 -5.53945E-03 -3.57943E-02
-6 0 *********** CCCS-val-val
- 1 -4.29242E-01 8.24832E-01
- 2 8.22405E-02 -7.97123E-02
- 3 3.27294E-02 -1.75155E-02
- 4 3.95067E-03 1.56381E-01
- 5 -1.36706E-01 -5.62789E-02
- 6 2.41571E-02 2.81685E-03
-6 0 *********** CCCS-val-trp
- 1 -3.14388E-01 8.13012E-01
- 2 1.70565E-02 8.36171E-02
- 3 -9.16184E-02 -1.18553E-01
- 4 4.45647E-03 7.18890E-02
- 5 -8.61243E-02 -2.17649E-02
- 6 -2.33130E-02 -2.14881E-02
-6 0 *********** CCCS-val-tyr
- 1 -3.12025E-01 8.26923E-01
- 2 -5.11317E-02 5.88251E-02
- 3 -3.32706E-02 -2.08271E-01
- 4 -6.58936E-02 1.02342E-01
- 5 4.60532E-03 -4.42193E-02
- 6 -7.63638E-02 -9.41839E-02
-6 0 *********** CCCS-val-ala
- 1 -6.59296E-01 3.43805E-01
- 2 3.04834E-01 2.74204E-01
- 3 2.42929E-02 1.97779E-02
- 4 -1.53481E-01 1.75727E-01
- 5 7.10213E-02 -3.60654E-02
- 6 -1.13199E-01 -1.77736E-01
-6 0 *********** CCCS-val-gly
+4 0 *********** CCCS-leu-thr
+ 1 -7.48126E-01 5.36400E-02
+ 2 -1.36944E-01 -1.66974E-01
+ 3 3.79913E-02 -8.60512E-02
+ 4 -5.13726E-02 2.28052E-02
+4 0 *********** CCCS-leu-ser
+ 1 -1.15042E+00 -7.04513E-01
+ 2 3.26201E-01 1.12553E-01
+ 3 1.49148E-01 -1.77258E-01
+ 4 1.05327E-02 1.48867E-02
+4 0 *********** CCCS-leu-gln
+ 1 -7.72562E-01 -4.87872E-02
+ 2 -4.88318E-03 -1.43881E-01
+ 3 -1.59783E-02 -1.17718E-01
+ 4 -2.80108E-02 2.86915E-02
+4 0 *********** CCCS-leu-asn
+ 1 -8.87326E-01 -5.02879E-01
+ 2 2.51793E-01 -3.85589E-02
+ 3 7.67035E-02 -6.57596E-02
+ 4 4.15438E-02 2.99316E-02
+4 0 *********** CCCS-leu-glu
+ 1 -8.47484E-01 1.78466E-02
+ 2 -3.32501E-02 -1.40402E-01
+ 3 -3.12201E-02 -1.26185E-01
+ 4 -2.13970E-02 2.31718E-02
+4 0 *********** CCCS-leu-asp
+ 1 -9.93265E-01 -5.60702E-01
+ 2 2.77596E-01 -1.04388E-02
+ 3 7.34092E-02 -7.85378E-02
+ 4 5.41183E-02 2.29368E-02
+4 0 *********** CCCS-leu-his
+ 1 -8.46472E-01 -4.84671E-01
+ 2 2.20827E-01 -1.54265E-02
+ 3 1.43643E-01 -3.01633E-02
+ 4 4.99535E-02 -2.51100E-02
+4 0 *********** CCCS-leu-arg
+ 1 -5.57785E-01 1.85912E-01
+ 2 -1.76423E-01 1.42674E-02
+ 3 -3.34123E-02 -5.84849E-02
+ 4 -1.83894E-05 3.72004E-02
+4 0 *********** CCCS-leu-lys
+ 1 -4.86399E-01 2.34143E-01
+ 2 -2.51865E-01 -3.85145E-03
+ 3 1.29808E-02 -2.60015E-02
+ 4 -1.91373E-03 5.05694E-02
+4 0 *********** CCCS-leu-pro
+ 1 -1.67903E+00 -4.70773E-01
+ 2 5.54447E-01 8.50613E-02
+ 3 -1.34828E-01 -4.71213E-01
+ 4 -2.44529E-02 7.41320E-02
+4 0 *********** CCCS-val-cys
+ 1 -8.11321E-01 -5.17223E-01
+ 2 1.51724E-01 -1.99653E-02
+ 3 6.31270E-02 -6.52135E-02
+ 4 5.14056E-03 -1.25929E-03
+4 0 *********** CCCS-val-met
+ 1 -6.01096E-01 -4.45278E-02
+ 2 -1.13496E-01 -6.61089E-02
+ 3 3.02441E-02 -2.41046E-02
+ 4 -1.84852E-02 3.38525E-02
+4 0 *********** CCCS-val-phe
+ 1 -6.42676E-01 1.42475E-02
+ 2 -1.06398E-01 4.14502E-02
+ 3 -6.27418E-02 -3.39537E-02
+ 4 3.33549E-02 5.44284E-02
+4 0 *********** CCCS-val-ile
+ 1 -7.58454E-01 -6.72337E-02
+ 2 -1.10880E-01 -1.16333E-01
+ 3 3.27005E-02 -5.39716E-02
+ 4 -5.04593E-02 2.90219E-02
+4 0 *********** CCCS-val-leu
+ 1 -5.60959E-01 1.79672E-01
+ 2 -2.92865E-01 -4.58013E-02
+ 3 1.71482E-02 -2.37541E-02
+ 4 -1.52076E-02 8.04829E-02
+4 0 *********** CCCS-val-val
+ 1 -6.80817E-01 -9.47510E-03
+ 2 -1.78723E-01 -1.00930E-01
+ 3 3.64941E-02 -4.04977E-02
+ 4 -3.93449E-02 5.11311E-02
+4 0 *********** CCCS-val-trp
+ 1 -6.93612E-01 2.05325E-02
+ 2 -7.83321E-02 -1.61338E-02
+ 3 -3.68244E-02 -3.41858E-02
+ 4 1.92010E-02 4.64430E-02
+4 0 *********** CCCS-val-tyr
+ 1 -6.32868E-01 1.15912E-02
+ 2 -9.66461E-02 4.26149E-02
+ 3 -6.11962E-02 -3.36105E-02
+ 4 3.45472E-02 5.48246E-02
+4 0 *********** CCCS-val-ala
+ 1 -4.80804E-01 -6.01286E-02
+ 2 -1.51599E-01 -2.89045E-01
+ 3 4.55108E-02 1.82308E-02
+ 4 -6.30640E-02 -5.31570E-02
+4 0 *********** CCCS-val-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-val-thr
- 1 -7.47951E-01 6.75964E-01
- 2 3.21877E-01 4.09560E-02
- 3 -1.36681E-02 6.10249E-02
- 4 -5.47045E-02 1.35170E-01
- 5 -8.81747E-02 -1.86486E-02
- 6 -2.58343E-02 2.25461E-02
-6 0 *********** CCCS-val-ser
- 1 -1.42726E+00 1.08638E+00
- 2 -2.04211E-01 5.57211E-01
- 3 -2.52679E-01 -8.66213E-02
- 4 -1.28479E-01 5.26400E-02
- 5 -1.00717E-01 -4.21256E-02
- 6 -3.41090E-02 -1.28864E-01
-6 0 *********** CCCS-val-gln
- 1 -5.90631E-01 7.02754E-01
- 2 3.32836E-02 2.86757E-01
- 3 -1.69451E-01 -3.69050E-02
- 4 5.87834E-03 8.14178E-02
- 5 -1.47893E-01 6.51650E-04
- 6 -1.36200E-02 -5.65464E-02
-6 0 *********** CCCS-val-asn
- 1 -1.01693E+00 4.69995E-01
- 2 -2.43651E-01 3.57862E-01
- 3 -2.75440E-01 -6.71032E-02
- 4 -6.00956E-02 3.50603E-02
- 5 -1.11978E-01 -4.30591E-02
- 6 -2.24426E-02 -1.33332E-01
-6 0 *********** CCCS-val-glu
- 1 -5.59980E-01 8.65508E-01
- 2 4.11141E-02 2.62655E-01
- 3 -1.22103E-01 -2.42915E-02
- 4 9.34924E-03 1.04475E-01
- 5 -1.32434E-01 -9.42781E-04
- 6 -1.35726E-02 -2.83718E-02
-6 0 *********** CCCS-val-asp
- 1 -1.31348E+00 1.44330E-01
- 2 4.79496E-02 4.85842E-01
- 3 -2.14355E-01 2.04123E-02
- 4 -8.99395E-02 6.82523E-02
- 5 -1.45692E-01 -9.49633E-03
- 6 -3.69758E-02 -1.81553E-01
-6 0 *********** CCCS-val-his
- 1 -8.99073E-01 8.53730E-01
- 2 -3.73013E-01 2.49257E-01
- 3 -2.52540E-01 -4.56975E-02
- 4 -2.56035E-02 5.33466E-02
- 5 -1.41568E-01 -3.64147E-02
- 6 -2.02090E-02 -3.58438E-02
-6 0 *********** CCCS-val-arg
- 1 -3.02527E-01 6.43574E-01
- 2 8.91040E-02 3.91895E-02
- 3 1.34633E-02 -1.18997E-01
- 4 -3.33846E-02 1.12908E-01
- 5 -3.14435E-02 -4.40267E-02
- 6 -3.86711E-02 -7.78766E-02
-6 0 *********** CCCS-val-lys
- 1 -3.39807E-01 6.29389E-01
- 2 1.75850E-01 -3.66938E-02
- 3 -1.10228E-05 -7.12032E-02
- 4 2.48918E-02 9.08821E-02
- 5 -9.22117E-02 -4.10071E-02
- 6 8.92198E-03 -1.86038E-02
-6 0 *********** CCCS-val-pro
- 1 3.21307E+00 -3.94220E-02
- 2 -2.78755E-02 1.89446E-02
- 3 -9.87983E-01 -2.92751E-01
- 4 -7.55573E-01 6.16164E-01
- 5 1.74247E-01 9.52974E-02
- 6 -8.93030E-02 -4.86632E-01
-6 0 *********** CCCS-trp-cys
- 1 -3.97134E-01 1.05061E+00
- 2 -3.85648E-03 3.02391E-01
- 3 -1.82440E-01 1.13105E-03
- 4 -3.77466E-02 9.38833E-02
- 5 -1.30142E-01 -1.04941E-02
- 6 -2.80018E-02 3.77225E-03
-6 0 *********** CCCS-trp-met
- 1 1.82023E-02 6.93022E-01
- 2 -2.85857E-03 6.82080E-02
- 3 -1.42618E-01 -1.22356E-01
- 4 2.77510E-02 4.43934E-02
- 5 -1.12740E-01 -2.48754E-02
- 6 -7.00662E-03 -1.75459E-02
-6 0 *********** CCCS-trp-phe
- 1 2.31905E-01 7.43031E-01
- 2 -1.28161E-01 1.38385E-01
- 3 -1.80478E-01 -1.48245E-01
- 4 -8.12194E-02 7.04150E-02
- 5 -5.61558E-02 -4.95481E-02
- 6 -5.20948E-02 -8.44131E-02
-6 0 *********** CCCS-trp-ile
- 1 9.75949E-02 8.35541E-01
- 2 -2.57778E-02 1.05144E-01
- 3 -1.78553E-01 -1.77678E-01
- 4 1.23933E-01 1.57000E-02
- 5 -1.50275E-01 4.01914E-03
- 6 1.32825E-02 3.38209E-03
-6 0 *********** CCCS-trp-leu
- 1 2.15784E-01 6.26957E-01
- 2 -6.18246E-02 -1.33064E-01
- 3 -1.39062E-01 -2.60829E-01
- 4 1.47643E-02 1.23307E-02
- 5 -1.42165E-01 -3.58314E-02
- 6 -3.04756E-02 -2.27094E-02
-6 0 *********** CCCS-trp-val
- 1 1.25631E-01 7.59136E-01
- 2 -8.43207E-02 4.63817E-02
- 3 -1.45060E-01 -2.05638E-01
- 4 1.03299E-01 2.86576E-02
- 5 -1.33009E-01 3.21596E-03
- 6 -5.07361E-03 -1.32676E-02
-6 0 *********** CCCS-trp-trp
- 1 1.77647E-01 7.20610E-01
- 2 -8.40165E-03 1.15882E-01
- 3 -2.17606E-01 -8.09954E-02
- 4 1.16264E-02 4.29526E-02
- 5 -1.55612E-01 -2.75210E-02
- 6 3.17444E-03 -1.44132E-02
-6 0 *********** CCCS-trp-tyr
- 1 2.24103E-01 7.14455E-01
- 2 -1.26090E-01 1.67622E-01
- 3 -1.68541E-01 -1.53912E-01
- 4 -1.12549E-01 9.01766E-02
- 5 -2.26787E-02 -6.11012E-02
- 6 -6.91377E-02 -1.23264E-01
-6 0 *********** CCCS-trp-ala
- 1 -2.67774E-01 5.54286E-01
- 2 1.62497E-01 -5.38060E-02
- 3 5.97171E-02 -1.50107E-01
- 4 -2.97727E-02 1.02047E-01
- 5 1.32197E-02 -6.16920E-02
- 6 -3.67700E-02 -8.49759E-02
-6 0 *********** CCCS-trp-gly
+4 0 *********** CCCS-val-thr
+ 1 -7.41105E-01 -8.58838E-02
+ 2 -7.65292E-02 -1.56129E-01
+ 3 2.61954E-02 -3.03294E-02
+ 4 -5.35762E-02 3.18180E-03
+4 0 *********** CCCS-val-ser
+ 1 -1.03479E+00 -8.80148E-01
+ 2 2.99630E-01 2.10209E-01
+ 3 1.08220E-01 -1.97563E-01
+ 4 1.03976E-02 1.23403E-02
+4 0 *********** CCCS-val-gln
+ 1 -7.52281E-01 -1.75271E-01
+ 2 3.61440E-02 -1.19884E-01
+ 3 -2.25685E-02 -7.45521E-02
+ 4 -3.14194E-02 1.38717E-02
+4 0 *********** CCCS-val-asn
+ 1 -7.89163E-01 -6.41908E-01
+ 2 2.38744E-01 3.99889E-02
+ 3 3.67868E-02 -8.34565E-02
+ 4 4.36729E-02 2.55220E-02
+4 0 *********** CCCS-val-glu
+ 1 -8.39244E-01 -1.26711E-01
+ 2 1.81508E-02 -1.21894E-01
+ 3 -2.83981E-02 -7.34440E-02
+ 4 -3.31335E-02 1.08919E-02
+4 0 *********** CCCS-val-asp
+ 1 -8.85374E-01 -7.18477E-01
+ 2 2.56118E-01 7.91874E-02
+ 3 3.64225E-02 -1.01706E-01
+ 4 5.26699E-02 2.33682E-02
+4 0 *********** CCCS-val-his
+ 1 -7.62378E-01 -6.17991E-01
+ 2 2.12535E-01 6.59066E-02
+ 3 9.61069E-02 -5.06113E-02
+ 4 5.03004E-02 -2.14882E-02
+4 0 *********** CCCS-val-arg
+ 1 -5.82822E-01 8.66612E-02
+ 2 -1.48760E-01 -1.05968E-02
+ 3 -3.89609E-03 -3.52453E-02
+ 4 -6.76220E-03 3.38389E-02
+4 0 *********** CCCS-val-lys
+ 1 -5.15770E-01 1.41804E-01
+ 2 -2.18761E-01 -3.71672E-02
+ 3 3.18685E-02 -4.50041E-03
+ 4 -6.12151E-03 4.17786E-02
+4 0 *********** CCCS-val-pro
+ 1 -1.69771E+00 -7.30645E-01
+ 2 6.21176E-01 2.56416E-01
+ 3 -1.48812E-01 -5.14417E-01
+ 4 -7.45039E-02 1.45455E-01
+4 0 *********** CCCS-trp-cys
+ 1 -8.77762E-01 -4.48673E-01
+ 2 1.40893E-02 -6.78055E-02
+ 3 1.30039E-01 -1.09771E-01
+ 4 -2.48853E-02 4.66347E-02
+4 0 *********** CCCS-trp-met
+ 1 -6.30061E-01 1.32246E-02
+ 2 -1.77339E-01 2.36419E-02
+ 3 3.20545E-02 -7.16448E-02
+ 4 -3.91275E-03 4.19304E-02
+4 0 *********** CCCS-trp-phe
+ 1 -6.85702E-01 6.67469E-02
+ 2 -8.95124E-02 1.59155E-01
+ 3 -9.94553E-02 -4.30629E-02
+ 4 4.97309E-02 4.48958E-02
+4 0 *********** CCCS-trp-ile
+ 1 -7.87149E-01 -4.93625E-03
+ 2 -2.22227E-01 1.19320E-02
+ 3 2.44076E-02 -1.31783E-01
+ 4 -2.27316E-02 3.93693E-02
+4 0 *********** CCCS-trp-leu
+ 1 -5.40530E-01 2.29644E-01
+ 2 -3.27799E-01 1.50827E-01
+ 3 -1.96314E-02 -4.78857E-02
+ 4 -1.73037E-02 5.22990E-02
+4 0 *********** CCCS-trp-val
+ 1 -7.01424E-01 4.61020E-02
+ 2 -2.71200E-01 4.65081E-02
+ 3 2.58690E-02 -1.07495E-01
+ 4 -1.61709E-02 4.94049E-02
+4 0 *********** CCCS-trp-trp
+ 1 -7.28796E-01 8.42478E-02
+ 2 -9.68316E-02 8.60848E-02
+ 3 -6.51644E-02 -6.08109E-02
+ 4 4.07017E-02 4.06057E-02
+4 0 *********** CCCS-trp-tyr
+ 1 -6.76477E-01 6.48958E-02
+ 2 -7.80312E-02 1.52082E-01
+ 3 -9.69848E-02 -4.24221E-02
+ 4 5.31404E-02 4.74066E-02
+4 0 *********** CCCS-trp-ala
+ 1 -4.85783E-01 -6.57016E-03
+ 2 -3.34110E-01 -2.08892E-01
+ 3 6.33967E-02 -2.88700E-02
+ 4 -3.46260E-02 -4.54350E-02
+4 0 *********** CCCS-trp-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-trp-thr
- 1 -1.33711E-01 8.17432E-01
- 2 -1.02112E-02 -9.19769E-02
- 3 4.19834E-02 -1.79869E-01
- 4 -9.29733E-03 1.05978E-01
- 5 -2.01058E-02 -4.84127E-02
- 6 -3.48484E-02 -3.62224E-02
-6 0 *********** CCCS-trp-ser
- 1 -6.89338E-01 1.52558E+00
- 2 1.70338E-03 5.33969E-01
- 3 -1.21646E-01 -4.78040E-02
- 4 -3.17402E-01 2.32192E-01
- 5 9.22405E-02 -7.06805E-02
- 6 -1.87593E-01 -1.64748E-01
-6 0 *********** CCCS-trp-gln
- 1 -1.12832E-01 7.85502E-01
- 2 9.54529E-02 2.06424E-01
- 3 -1.28797E-01 -2.71431E-02
- 4 -4.92651E-02 8.04872E-02
- 5 -7.21551E-02 -3.04355E-02
- 6 -3.21518E-02 -3.10111E-02
-6 0 *********** CCCS-trp-asn
- 1 -6.86239E-01 8.42747E-01
- 2 2.69186E-02 4.03207E-01
- 3 -1.94512E-01 6.01381E-02
- 4 -1.02355E-01 8.87088E-02
- 5 -1.26219E-01 -1.27314E-02
- 6 -4.63795E-02 -3.84224E-02
-6 0 *********** CCCS-trp-glu
- 1 1.44529E-02 9.00922E-01
- 2 7.20218E-02 2.08210E-01
- 3 -1.08150E-01 -6.56768E-02
- 4 -3.40755E-02 7.66866E-02
- 5 -6.10424E-02 -3.39727E-02
- 6 -2.86226E-02 -3.32357E-02
-6 0 *********** CCCS-trp-asp
- 1 -1.02470E+00 7.22539E-01
- 2 2.12162E-01 2.74323E-01
- 3 -4.62482E-02 -2.96736E-02
- 4 -1.77971E-01 1.60746E-01
- 5 5.32729E-02 -4.00140E-02
- 6 -1.18745E-01 -1.35881E-01
-6 0 *********** CCCS-trp-his
- 1 -4.22600E-01 1.06516E+00
- 2 -1.05595E-01 5.03339E-01
- 3 -2.42471E-01 1.75686E-02
- 4 -6.37491E-02 7.36291E-02
- 5 -1.68057E-01 -1.00104E-02
- 6 -2.17606E-02 -4.53861E-02
-6 0 *********** CCCS-trp-arg
- 1 1.47244E-01 5.70904E-01
- 2 -4.13970E-02 4.66966E-02
- 3 -1.21413E-01 -1.84092E-01
- 4 -5.57780E-02 5.98553E-02
- 5 -4.10924E-02 -4.84950E-02
- 6 -5.42543E-02 -9.47073E-02
-6 0 *********** CCCS-trp-lys
- 1 1.13950E-01 5.69648E-01
- 2 -1.84162E-02 -4.75211E-02
- 3 -1.56160E-01 -1.82586E-01
- 4 2.97052E-02 2.50834E-02
- 5 -1.35742E-01 -2.73430E-02
- 6 -1.16050E-02 -2.35796E-02
-6 0 *********** CCCS-trp-pro
- 1 2.23324E+00 -1.42887E+00
- 2 3.07739E-01 1.78965E-01
- 3 -2.86215E-01 1.28548E-02
- 4 -9.97448E-02 6.25659E-01
- 5 3.17447E-01 -1.17601E-01
- 6 -1.94426E-01 -8.11239E-01
-6 0 *********** CCCS-tyr-cys
- 1 -8.74910E-01 8.12394E-01
- 2 -7.70954E-02 3.01194E-01
- 3 -1.99725E-01 -1.16268E-02
- 4 -5.14576E-02 9.50848E-02
- 5 -1.64644E-01 -1.04927E-02
- 6 -2.62137E-02 -4.41084E-02
-6 0 *********** CCCS-tyr-met
- 1 -4.21087E-01 7.03401E-01
- 2 9.26359E-02 4.87118E-02
- 3 -6.54305E-02 -6.12420E-02
- 4 3.22947E-02 9.75565E-02
- 5 -1.24815E-01 -1.75518E-02
- 6 2.02043E-03 -1.58925E-02
-6 0 *********** CCCS-tyr-phe
- 1 -2.64457E-01 8.61701E-01
- 2 -3.63555E-02 1.83615E-02
- 3 -6.58356E-02 -1.85778E-01
- 4 -2.41505E-02 7.04592E-02
- 5 -5.10864E-02 -3.38210E-02
- 6 -4.53203E-02 -3.36515E-02
-6 0 *********** CCCS-tyr-ile
- 1 -4.26569E-01 8.95743E-01
- 2 5.63556E-02 -1.49566E-02
- 3 -2.37221E-03 -4.50355E-02
- 4 8.15204E-02 1.45289E-01
- 5 -1.78474E-01 -3.41528E-02
- 6 4.58348E-02 1.18181E-04
-6 0 *********** CCCS-tyr-leu
- 1 -2.53351E-01 7.22150E-01
- 2 1.96335E-01 -1.35416E-01
- 3 1.10728E-01 -1.45961E-01
- 4 2.26006E-03 1.05097E-01
- 5 -1.74685E-02 -6.96317E-02
- 6 -6.34319E-03 -4.24044E-02
-6 0 *********** CCCS-tyr-val
- 1 -3.73573E-01 8.35714E-01
- 2 5.96991E-02 -9.02958E-02
- 3 4.04047E-02 -5.07499E-02
- 4 2.90275E-02 1.52315E-01
- 5 -1.34453E-01 -5.36123E-02
- 6 2.86081E-02 -8.52329E-03
-6 0 *********** CCCS-tyr-trp
- 1 -2.59607E-01 8.14954E-01
- 2 1.78745E-02 7.89787E-02
- 3 -1.03772E-01 -1.24602E-01
- 4 6.81744E-03 6.32072E-02
- 5 -9.08015E-02 -2.25481E-02
- 6 -2.18776E-02 -1.78094E-02
-6 0 *********** CCCS-tyr-tyr
- 1 -2.50521E-01 8.28663E-01
- 2 -5.99588E-02 6.13240E-02
- 3 -5.03925E-02 -2.17278E-01
- 4 -7.22479E-02 9.34489E-02
- 5 4.84293E-03 -4.72076E-02
- 6 -7.85830E-02 -9.20778E-02
-6 0 *********** CCCS-tyr-ala
- 1 -6.33522E-01 3.71638E-01
- 2 3.11053E-01 2.28452E-01
- 3 6.05647E-02 1.78918E-03
- 4 -1.39879E-01 1.74405E-01
- 5 8.54206E-02 -4.45713E-02
- 6 -1.01848E-01 -1.69962E-01
-6 0 *********** CCCS-tyr-gly
+4 0 *********** CCCS-trp-thr
+ 1 -7.62215E-01 -1.66209E-02
+ 2 -2.05828E-01 -6.25774E-02
+ 3 3.09343E-02 -9.31738E-02
+ 4 -2.80790E-02 1.68598E-02
+4 0 *********** CCCS-trp-ser
+ 1 -1.03154E+00 -7.94259E-01
+ 2 1.02630E-01 4.54645E-02
+ 3 1.91038E-01 -1.62561E-01
+ 4 -3.94659E-02 3.14862E-03
+4 0 *********** CCCS-trp-gln
+ 1 -7.87206E-01 -9.82181E-02
+ 2 -7.02570E-02 -8.76610E-02
+ 3 -3.43813E-02 -1.09824E-01
+ 4 -7.50564E-03 3.42076E-02
+4 0 *********** CCCS-trp-asn
+ 1 -8.38710E-01 -5.63729E-01
+ 2 1.18971E-01 -8.41619E-02
+ 3 8.62810E-02 -7.55688E-02
+ 4 1.21475E-02 4.06533E-02
+4 0 *********** CCCS-trp-glu
+ 1 -8.70081E-01 -4.81074E-02
+ 2 -9.38332E-02 -4.96216E-02
+ 3 -4.83154E-02 -1.25695E-01
+ 4 1.54378E-04 2.43171E-02
+4 0 *********** CCCS-trp-asp
+ 1 -9.21223E-01 -6.43630E-01
+ 2 1.00987E-01 -4.96197E-02
+ 3 1.07722E-01 -8.08610E-02
+ 4 1.17774E-02 2.99547E-02
+4 0 *********** CCCS-trp-his
+ 1 -8.31417E-01 -5.39018E-01
+ 2 1.27308E-01 -3.60611E-02
+ 3 1.50432E-01 -7.61718E-02
+ 4 1.07643E-02 -5.57927E-03
+4 0 *********** CCCS-trp-arg
+ 1 -5.93732E-01 1.45068E-01
+ 2 -1.68473E-01 1.09384E-01
+ 3 -3.23216E-02 -6.11325E-02
+ 4 -2.80306E-03 2.38843E-02
+4 0 *********** CCCS-trp-lys
+ 1 -5.08905E-01 1.95584E-01
+ 2 -2.53051E-01 9.98052E-02
+ 3 2.09620E-02 -3.54569E-02
+ 4 -2.35324E-03 2.99840E-02
+4 0 *********** CCCS-trp-pro
+ 1 -1.44668E+00 -5.89494E-01
+ 2 1.83382E-01 1.54639E-01
+ 3 -5.66479E-03 -4.45790E-01
+ 4 -9.42532E-02 7.55533E-02
+4 0 *********** CCCS-tyr-cys
+ 1 -9.09006E-01 -3.79759E-01
+ 2 4.91124E-02 -9.52209E-02
+ 3 1.43726E-01 -1.01207E-01
+ 4 -2.96906E-02 4.71193E-02
+4 0 *********** CCCS-tyr-met
+ 1 -6.22207E-01 5.78449E-02
+ 2 -1.75559E-01 -5.22250E-03
+ 3 3.06699E-02 -7.62937E-02
+ 4 -2.83009E-03 4.88203E-02
+4 0 *********** CCCS-tyr-phe
+ 1 -6.63789E-01 1.13326E-01
+ 2 -9.63951E-02 1.28701E-01
+ 3 -1.13383E-01 -4.57057E-02
+ 4 5.77765E-02 4.72835E-02
+4 0 *********** CCCS-tyr-ile
+ 1 -7.80595E-01 6.65728E-02
+ 2 -2.19900E-01 -3.24672E-02
+ 3 2.60002E-02 -1.44710E-01
+ 4 -2.05834E-02 5.11673E-02
+4 0 *********** CCCS-tyr-leu
+ 1 -5.21881E-01 2.84544E-01
+ 2 -3.38132E-01 1.18754E-01
+ 3 -3.51877E-02 -5.87236E-02
+ 4 -1.08133E-02 6.11789E-02
+4 0 *********** CCCS-tyr-val
+ 1 -6.91368E-01 1.11588E-01
+ 2 -2.71285E-01 5.22627E-03
+ 3 2.21618E-02 -1.20641E-01
+ 4 -1.27789E-02 6.21999E-02
+4 0 *********** CCCS-tyr-trp
+ 1 -7.10331E-01 1.32960E-01
+ 2 -1.03873E-01 5.44967E-02
+ 3 -7.25142E-02 -6.43234E-02
+ 4 4.69414E-02 4.37841E-02
+4 0 *********** CCCS-tyr-tyr
+ 1 -6.55384E-01 1.09023E-01
+ 2 -8.50300E-02 1.23183E-01
+ 3 -1.09497E-01 -4.46240E-02
+ 4 6.06009E-02 4.96820E-02
+4 0 *********** CCCS-tyr-ala
+ 1 -4.93753E-01 3.88784E-02
+ 2 -3.15706E-01 -2.29990E-01
+ 3 7.28305E-02 -4.18762E-02
+ 4 -4.38649E-02 -4.54387E-02
+4 0 *********** CCCS-tyr-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-tyr-thr
- 1 -6.96774E-01 7.05012E-01
- 2 3.00191E-01 8.08979E-04
- 3 2.16170E-02 2.79656E-02
- 4 -4.32462E-02 1.42628E-01
- 5 -7.21369E-02 -2.67662E-02
- 6 -2.07074E-02 4.98846E-03
-6 0 *********** CCCS-tyr-ser
- 1 -1.32920E+00 1.01674E+00
- 2 -7.69095E-02 6.26341E-01
- 3 -2.68708E-01 -2.52823E-02
- 4 -1.65000E-01 7.64946E-02
- 5 -9.52082E-02 -4.46636E-02
- 6 -5.10471E-02 -1.47506E-01
-6 0 *********** CCCS-tyr-gln
- 1 -5.49194E-01 7.14487E-01
- 2 5.95044E-02 2.87362E-01
- 3 -1.68381E-01 -3.66365E-02
- 4 8.95640E-03 8.01203E-02
- 5 -1.40299E-01 3.72645E-04
- 6 -1.39944E-02 -5.22733E-02
-6 0 *********** CCCS-tyr-asn
- 1 -9.78500E-01 4.99941E-01
- 2 -2.01265E-01 4.05049E-01
- 3 -2.88032E-01 -3.96732E-02
- 4 -6.91792E-02 4.65139E-02
- 5 -1.18774E-01 -4.22230E-02
- 6 -2.69835E-02 -1.32417E-01
-6 0 *********** CCCS-tyr-glu
- 1 -5.07025E-01 8.71111E-01
- 2 6.53347E-02 2.58831E-01
- 3 -1.14301E-01 -2.89383E-02
- 4 1.71746E-02 1.00381E-01
- 5 -1.21433E-01 -1.63917E-03
- 6 -1.20017E-02 -2.37310E-02
-6 0 *********** CCCS-tyr-asp
- 1 -1.29545E+00 1.96747E-01
- 2 9.02428E-02 4.96857E-01
- 3 -2.01190E-01 2.93247E-02
- 4 -9.95175E-02 9.23017E-02
- 5 -1.36887E-01 -2.51745E-03
- 6 -5.21902E-02 -1.94364E-01
-6 0 *********** CCCS-tyr-his
- 1 -8.32839E-01 8.53486E-01
- 2 -3.26148E-01 3.13931E-01
- 3 -2.71164E-01 -5.87415E-03
- 4 -3.39861E-02 5.05028E-02
- 5 -1.52008E-01 -3.40467E-02
- 6 -2.00727E-02 -2.71200E-02
-6 0 *********** CCCS-tyr-arg
- 1 -2.54799E-01 6.48923E-01
- 2 7.74452E-02 2.60184E-02
- 3 9.31987E-03 -1.43055E-01
- 4 -2.70483E-02 1.05449E-01
- 5 -3.09097E-02 -4.19048E-02
- 6 -4.21302E-02 -8.15534E-02
-6 0 *********** CCCS-tyr-lys
- 1 -2.92966E-01 6.37739E-01
- 2 1.57946E-01 -5.78773E-02
- 3 6.54551E-05 -9.91841E-02
- 4 3.22857E-02 8.56176E-02
- 5 -9.58168E-02 -4.21040E-02
- 6 8.52339E-03 -1.65671E-02
-6 0 *********** CCCS-tyr-pro
- 1 2.22771E+00 9.52366E-02
- 2 -4.27668E-01 4.71305E-01
- 3 -8.63619E-01 -2.87620E-02
- 4 -5.28150E-01 5.68096E-01
- 5 1.99111E-01 -9.44542E-02
- 6 -1.62728E-01 -6.03297E-01
-6 0 *********** CCCS-ala-cys
- 1 2.09544E-01 1.51086E-01
- 2 -9.32640E-02 3.53246E-01
- 3 -1.87861E-01 -6.81242E-02
- 4 -1.58488E-01 1.78597E-01
- 5 2.36952E-02 -7.92151E-02
- 6 -1.16908E-01 -3.11933E-01
-6 0 *********** CCCS-ala-met
- 1 8.08658E-02 -7.98845E-02
- 2 1.64198E-01 2.11674E-01
- 3 -8.33974E-02 -2.40838E-02
- 4 -1.18256E-02 7.36953E-02
- 5 -6.02118E-02 -2.57788E-02
- 6 -2.91481E-02 -1.67912E-01
-6 0 *********** CCCS-ala-phe
- 1 6.94077E-02 -1.24168E-01
- 2 2.75029E-01 1.36820E-01
- 3 -8.70868E-02 -5.18404E-02
- 4 5.45502E-03 4.56749E-02
- 5 -7.55886E-02 -2.66537E-02
- 6 -1.60765E-02 -1.43502E-01
-6 0 *********** CCCS-ala-ile
- 1 6.57519E-02 -7.54499E-02
- 2 2.54933E-01 1.69169E-01
- 3 -1.54127E-01 4.20736E-02
- 4 1.42866E-01 2.85581E-02
- 5 -1.94794E-01 7.37758E-03
- 6 5.80261E-02 -5.91508E-02
-6 0 *********** CCCS-ala-leu
- 1 1.70521E-02 -1.52559E-01
- 2 3.69633E-01 1.81837E-01
- 3 -6.35927E-02 -2.82942E-02
- 4 7.09564E-02 3.26750E-02
- 5 -9.74730E-02 -8.68669E-03
- 6 2.06930E-02 -1.32808E-01
-6 0 *********** CCCS-ala-val
- 1 7.94939E-02 -1.19920E-01
- 2 2.26859E-01 1.78737E-01
- 3 -5.23242E-02 -2.45068E-02
- 4 1.92040E-02 7.36224E-02
- 5 -5.15181E-02 -1.95582E-02
- 6 -1.61085E-02 -1.56407E-01
-6 0 *********** CCCS-ala-trp
- 1 5.02124E-02 -1.02579E-01
- 2 2.69417E-01 1.26043E-01
- 3 -1.46006E-01 -6.62372E-03
- 4 7.47036E-02 2.14196E-02
- 5 -1.60095E-01 -8.58666E-03
- 6 2.64333E-02 -8.68919E-02
-6 0 *********** CCCS-ala-tyr
- 1 6.63612E-02 -1.23359E-01
- 2 2.61873E-01 1.32742E-01
- 3 -8.79662E-02 -5.78034E-02
- 4 -5.16327E-03 4.88838E-02
- 5 -6.94572E-02 -2.97959E-02
- 6 -2.23449E-02 -1.52417E-01
-6 0 *********** CCCS-ala-ala
- 1 8.51209E-02 -2.47944E-02
- 2 5.07424E-02 3.52086E-01
- 3 -1.00328E-01 4.72799E-02
- 4 -2.70699E-02 1.01296E-01
- 5 -7.57268E-02 -2.21811E-02
- 6 -4.67199E-02 -1.83470E-01
-6 0 *********** CCCS-ala-gly
+4 0 *********** CCCS-tyr-thr
+ 1 -7.63070E-01 4.85054E-02
+ 2 -1.98173E-01 -1.00968E-01
+ 3 3.67143E-02 -1.05619E-01
+ 4 -3.12982E-02 2.71395E-02
+4 0 *********** CCCS-tyr-ser
+ 1 -1.12069E+00 -7.18785E-01
+ 2 1.83787E-01 4.83379E-02
+ 3 1.94718E-01 -1.64962E-01
+ 4 -4.05226E-02 9.58595E-03
+4 0 *********** CCCS-tyr-gln
+ 1 -7.92835E-01 -4.56580E-02
+ 2 -5.84674E-02 -1.12935E-01
+ 3 -2.47702E-02 -1.20699E-01
+ 4 -1.19943E-02 3.78514E-02
+4 0 *********** CCCS-tyr-asn
+ 1 -8.92656E-01 -5.05654E-01
+ 2 1.67840E-01 -9.02306E-02
+ 3 9.28662E-02 -6.45290E-02
+ 4 1.52571E-02 3.55943E-02
+4 0 *********** CCCS-tyr-glu
+ 1 -8.70245E-01 1.66227E-02
+ 2 -8.67099E-02 -8.56785E-02
+ 3 -4.16259E-02 -1.38101E-01
+ 4 -1.21162E-03 2.96354E-02
+4 0 *********** CCCS-tyr-asp
+ 1 -9.87024E-01 -5.72803E-01
+ 2 1.66527E-01 -5.94872E-02
+ 3 1.08314E-01 -7.30065E-02
+ 4 1.55906E-02 2.64798E-02
+4 0 *********** CCCS-tyr-his
+ 1 -8.70789E-01 -4.85639E-01
+ 2 1.61844E-01 -5.15013E-02
+ 3 1.56654E-01 -5.32494E-02
+ 4 1.71858E-02 -1.36583E-02
+4 0 *********** CCCS-tyr-arg
+ 1 -5.76451E-01 1.86974E-01
+ 2 -1.77028E-01 8.31900E-02
+ 3 -3.97542E-02 -6.58250E-02
+ 4 2.32992E-03 2.74026E-02
+4 0 *********** CCCS-tyr-lys
+ 1 -4.94302E-01 2.35360E-01
+ 2 -2.59575E-01 7.37574E-02
+ 3 1.22432E-02 -3.91132E-02
+ 4 2.12332E-03 3.63422E-02
+4 0 *********** CCCS-tyr-pro
+ 1 -1.57814E+00 -5.05783E-01
+ 2 3.10335E-01 1.45772E-01
+ 3 -2.88148E-02 -5.03989E-01
+ 4 -9.96755E-02 1.20665E-01
+4 0 *********** CCCS-ala-cys
+ 1 -8.23119E-01 -2.98213E-01
+ 2 1.01944E-01 -3.12124E-02
+ 3 1.11175E-01 -1.12750E-01
+ 4 8.21128E-03 2.89820E-02
+4 0 *********** CCCS-ala-met
+ 1 -5.58872E-01 1.00798E-01
+ 2 -9.75431E-02 -3.76572E-02
+ 3 -8.93879E-04 -6.04168E-02
+ 4 -5.95098E-03 4.35541E-02
+4 0 *********** CCCS-ala-phe
+ 1 -5.82985E-01 1.69299E-01
+ 2 -4.93783E-02 4.21883E-02
+ 3 -1.23128E-01 -2.01764E-02
+ 4 5.47857E-02 4.91434E-02
+4 0 *********** CCCS-ala-ile
+ 1 -7.07307E-01 1.12039E-01
+ 2 -9.73446E-02 -6.42191E-02
+ 3 -1.97691E-02 -1.14987E-01
+ 4 -3.33150E-02 3.53489E-02
+4 0 *********** CCCS-ala-leu
+ 1 -4.77868E-01 2.92749E-01
+ 2 -2.15940E-01 2.53932E-02
+ 3 -5.38848E-02 -2.48878E-02
+ 4 -2.48870E-02 8.98947E-02
+4 0 *********** CCCS-ala-val
+ 1 -6.27675E-01 1.52286E-01
+ 2 -1.45924E-01 -4.27431E-02
+ 3 -2.12772E-02 -9.07665E-02
+ 4 -2.87085E-02 5.83967E-02
+4 0 *********** CCCS-ala-trp
+ 1 -6.25869E-01 1.79848E-01
+ 2 -5.04153E-02 -8.97269E-03
+ 3 -8.73481E-02 -3.76793E-02
+ 4 3.99514E-02 3.98532E-02
+4 0 *********** CCCS-ala-tyr
+ 1 -5.73991E-01 1.63445E-01
+ 2 -4.37848E-02 4.09536E-02
+ 3 -1.17701E-01 -2.02245E-02
+ 4 5.77646E-02 5.01472E-02
+4 0 *********** CCCS-ala-ala
+ 1 -4.56331E-01 4.60183E-02
+ 2 -1.76124E-01 -1.66119E-01
+ 3 4.46991E-02 -4.74663E-02
+ 4 -5.96800E-02 -5.29220E-02
+4 0 *********** CCCS-ala-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-ala-thr
- 1 1.13047E-01 -1.23960E-02
- 2 2.18880E-01 2.98764E-01
- 3 -1.51347E-01 1.03076E-01
- 4 7.51537E-02 5.26880E-02
- 5 -2.09815E-01 1.72523E-02
- 6 2.60870E-02 -7.22198E-02
-6 0 *********** CCCS-ala-ser
- 1 2.81029E-01 3.00033E-01
- 2 -2.10672E-01 6.34637E-01
- 3 -3.04209E-01 -1.43905E-01
- 4 -2.63362E-01 2.75132E-01
- 5 1.41483E-01 -1.59470E-01
- 6 -1.80790E-01 -5.44148E-01
-6 0 *********** CCCS-ala-gln
- 1 1.57779E-01 2.41022E-03
- 2 3.10357E-02 2.98564E-01
- 3 -1.28707E-01 -1.55013E-02
- 4 -6.15053E-02 1.03456E-01
- 5 -3.84837E-02 -4.39229E-02
- 6 -6.01907E-02 -2.12940E-01
-6 0 *********** CCCS-ala-asn
- 1 1.70297E-01 3.18618E-01
- 2 -2.30254E-01 2.49968E-01
- 3 -2.35872E-01 -1.73680E-01
- 4 -1.89383E-01 1.70956E-01
- 5 5.05196E-02 -9.24758E-02
- 6 -1.17843E-01 -3.08245E-01
-6 0 *********** CCCS-ala-glu
- 1 1.84988E-01 -2.89421E-02
- 2 8.40119E-02 3.20125E-01
- 3 -1.05228E-01 1.72245E-02
- 4 -2.42931E-02 9.53286E-02
- 5 -5.62194E-02 -2.89932E-02
- 6 -4.07861E-02 -1.93078E-01
-6 0 *********** CCCS-ala-asp
- 1 2.11813E-01 3.53614E-01
- 2 -2.65496E-01 3.04920E-01
- 3 -2.52910E-01 -9.99053E-02
- 4 -1.49552E-01 1.54690E-01
- 5 6.21563E-03 -6.88708E-02
- 6 -1.02592E-01 -2.53131E-01
-6 0 *********** CCCS-ala-his
- 1 2.34307E-01 2.85648E-01
- 2 -1.90718E-01 1.70237E-01
- 3 -2.53326E-01 -2.73589E-02
- 4 -7.61866E-02 1.13211E-01
- 5 -1.00401E-01 -2.25034E-02
- 6 -4.82999E-02 -1.17152E-01
-6 0 *********** CCCS-ala-arg
- 1 2.97079E-02 -1.31641E-01
- 2 2.32455E-01 1.76777E-01
- 3 -6.79132E-02 -5.56482E-02
- 4 -4.60863E-03 5.79520E-02
- 5 -5.01631E-02 -3.06966E-02
- 6 -2.55406E-02 -1.71339E-01
-6 0 *********** CCCS-ala-lys
- 1 1.04076E-02 -1.25139E-01
- 2 2.67193E-01 1.66676E-01
- 3 -8.10161E-02 -2.95132E-02
- 4 3.72983E-02 4.05951E-02
- 5 -9.00418E-02 -1.61797E-02
- 6 1.52228E-03 -1.32515E-01
-6 0 *********** CCCS-ala-pro
- 1 6.87749E-02 -9.39532E-01
- 2 -2.71845E-01 -6.79470E-01
- 3 -2.48730E-01 -4.40063E-01
- 4 -3.25926E-01 2.86940E-01
- 5 1.25922E-01 -2.21273E-01
- 6 -2.08755E-01 -5.38499E-01
-6 0 *********** CCCS-gly-cys
- 1 6.01435E-01 1.80977E-01
- 2 1.74454E-01 1.74251E-01
- 3 -9.03909E-02 -1.95994E-01
- 4 -1.35065E-01 9.16175E-02
- 5 -8.46503E-03 -5.52195E-02
- 6 -9.19744E-02 -2.34320E-01
-6 0 *********** CCCS-gly-met
- 1 3.53993E-01 -1.75955E-01
- 2 1.29616E-01 5.95656E-02
- 3 -1.50906E-01 -2.04218E-02
- 4 -3.24127E-02 7.64497E-02
- 5 -8.97846E-02 -2.82295E-02
- 6 -2.99701E-02 -1.35507E-01
-6 0 *********** CCCS-gly-phe
- 1 3.51795E-01 -2.84766E-01
- 2 1.62590E-01 5.93443E-02
- 3 -7.08266E-02 5.41716E-03
- 4 -2.88027E-03 8.09942E-02
- 5 -5.90019E-02 -3.11981E-02
- 6 -1.82615E-02 -1.44434E-01
-6 0 *********** CCCS-gly-ile
- 1 3.81749E-01 -2.29510E-01
- 2 2.01331E-01 -2.61401E-02
- 3 -2.48470E-01 4.44326E-03
- 4 9.80798E-02 5.05726E-02
- 5 -1.75030E-01 6.46738E-04
- 6 3.83858E-02 -6.40724E-02
-6 0 *********** CCCS-gly-leu
- 1 2.66112E-01 -3.35984E-01
- 2 1.23816E-01 7.72979E-02
- 3 -1.46219E-01 1.00603E-01
- 4 3.51830E-02 4.00618E-02
- 5 -2.08323E-01 -1.01636E-03
- 6 1.91208E-02 -5.76509E-02
-6 0 *********** CCCS-gly-val
- 1 3.52084E-01 -2.67382E-01
- 2 1.51180E-01 2.98225E-02
- 3 -1.42671E-01 -2.62835E-02
- 4 -1.13435E-03 8.19561E-02
- 5 -9.66041E-02 -3.18810E-03
- 6 -2.16153E-02 -1.28410E-01
-6 0 *********** CCCS-gly-trp
- 1 3.20821E-01 -2.55603E-01
- 2 1.99437E-01 -8.94510E-03
- 3 -1.80656E-01 3.67239E-02
- 4 9.62791E-02 2.31220E-02
- 5 -1.89895E-01 -1.62191E-02
- 6 3.33412E-02 -5.07471E-02
-6 0 *********** CCCS-gly-tyr
- 1 3.42685E-01 -2.75664E-01
- 2 1.63606E-01 5.62233E-02
- 3 -7.01064E-02 9.02606E-04
- 4 -3.54681E-03 7.64142E-02
- 5 -6.40909E-02 -3.04437E-02
- 6 -2.14171E-02 -1.42291E-01
-6 0 *********** CCCS-gly-ala
- 1 3.03649E-01 -1.03199E-02
- 2 1.70126E-02 1.19360E-01
- 3 -2.95039E-01 4.62437E-03
- 4 6.86487E-04 3.52072E-02
- 5 -1.18686E-01 -4.74139E-02
- 6 -2.58228E-02 -1.03776E-01
-6 0 *********** CCCS-gly-gly
+4 0 *********** CCCS-ala-thr
+ 1 -6.95288E-01 8.55479E-02
+ 2 -8.20308E-02 -1.00411E-01
+ 3 -5.82995E-03 -9.47505E-02
+ 4 -4.27445E-02 1.02087E-02
+4 0 *********** CCCS-ala-ser
+ 1 -1.00835E+00 -5.95504E-01
+ 2 1.93668E-01 1.39001E-01
+ 3 1.94025E-01 -1.73473E-01
+ 4 -1.09209E-03 6.13657E-03
+4 0 *********** CCCS-ala-gln
+ 1 -7.19265E-01 -1.05762E-03
+ 2 1.15061E-02 -9.06152E-02
+ 3 -3.77212E-02 -1.21326E-01
+ 4 -1.76413E-02 1.76405E-02
+4 0 *********** CCCS-ala-asn
+ 1 -8.10659E-01 -4.23361E-01
+ 2 1.67923E-01 1.70979E-03
+ 3 1.05131E-01 -8.22832E-02
+ 4 3.91616E-02 3.28299E-02
+4 0 *********** CCCS-ala-glu
+ 1 -7.84610E-01 6.15637E-02
+ 2 1.32832E-03 -8.67880E-02
+ 3 -6.37268E-02 -1.23711E-01
+ 4 -1.43390E-02 7.42007E-03
+4 0 *********** CCCS-ala-asp
+ 1 -8.93182E-01 -4.73106E-01
+ 2 1.79835E-01 3.43482E-02
+ 3 1.14421E-01 -9.97471E-02
+ 4 4.01887E-02 2.70028E-02
+4 0 *********** CCCS-ala-his
+ 1 -7.73834E-01 -4.02384E-01
+ 2 1.48911E-01 7.25476E-03
+ 3 1.51588E-01 -4.98250E-02
+ 4 5.04625E-02 -1.63792E-02
+4 0 *********** CCCS-ala-arg
+ 1 -5.12065E-01 2.16366E-01
+ 2 -1.12670E-01 1.55364E-02
+ 3 -5.43212E-02 -3.82911E-02
+ 4 -3.41771E-03 3.40400E-02
+4 0 *********** CCCS-ala-lys
+ 1 -4.43114E-01 2.49535E-01
+ 2 -1.72275E-01 9.35242E-03
+ 3 -1.23287E-02 -1.35432E-02
+ 4 -5.90737E-03 4.85906E-02
+4 0 *********** CCCS-ala-pro
+ 1 -1.31202E+00 -3.46891E-01
+ 2 3.15762E-01 9.73094E-02
+ 3 -2.67777E-02 -4.03770E-01
+ 4 -5.78122E-02 1.51256E-02
+4 0 *********** CCCS-gly-cys
+ 1 1.05530E+00 -2.71210E-01
+ 2 -2.81933E-01 7.48024E-02
+ 3 1.25272E-01 1.80323E-01
+ 4 1.43032E-01 -5.75962E-02
+4 0 *********** CCCS-gly-met
+ 1 5.59661E-01 -4.30726E-01
+ 2 1.59708E-02 3.21011E-01
+ 3 1.41705E-01 5.97102E-02
+ 4 6.16920E-03 -2.23828E-02
+4 0 *********** CCCS-gly-phe
+ 1 6.31592E-01 -4.93574E-01
+ 2 2.94775E-01 2.32488E-01
+ 3 8.39615E-02 -7.91540E-02
+ 4 9.13991E-03 -2.63888E-02
+4 0 *********** CCCS-gly-ile
+ 1 7.12981E-01 -5.34709E-01
+ 2 -1.27405E-02 5.03012E-01
+ 3 2.43981E-01 5.88027E-02
+ 4 -3.82917E-02 -2.25025E-02
+4 0 *********** CCCS-gly-leu
+ 1 3.09062E-01 -5.62007E-01
+ 2 2.56275E-01 6.35740E-01
+ 3 1.29028E-01 -3.73514E-02
+ 4 -3.11769E-02 1.22591E-01
+4 0 *********** CCCS-gly-val
+ 1 6.23875E-01 -5.04248E-01
+ 2 6.09769E-02 5.57747E-01
+ 3 2.26979E-01 6.63831E-02
+ 4 -4.14762E-02 1.60595E-02
+4 0 *********** CCCS-gly-trp
+ 1 6.24927E-01 -5.51690E-01
+ 2 1.61460E-01 2.34716E-01
+ 3 1.14487E-01 -5.02453E-02
+ 4 -7.56294E-03 -3.44011E-02
+4 0 *********** CCCS-gly-tyr
+ 1 6.17606E-01 -4.90395E-01
+ 2 2.79775E-01 2.04943E-01
+ 3 7.73478E-02 -8.23004E-02
+ 4 9.25598E-03 -4.02325E-02
+4 0 *********** CCCS-gly-ala
+ 1 3.79194E-01 -3.71425E-01
+ 2 -4.16749E-01 5.89014E-01
+ 3 1.03228E-01 1.14247E-01
+ 4 -1.09076E-01 -9.45324E-02
+4 0 *********** CCCS-gly-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-gly-thr
- 1 4.57424E-01 -8.67678E-02
- 2 1.28569E-01 1.09103E-01
- 3 -2.33037E-01 4.60976E-02
- 4 -5.93924E-02 1.08358E-02
- 5 -2.15120E-01 -6.32073E-02
- 6 -2.37075E-02 -8.99065E-02
-6 0 *********** CCCS-gly-ser
- 1 6.67576E-01 2.48115E-01
- 2 2.38248E-01 3.85789E-01
- 3 -1.28001E-01 -5.20498E-01
- 4 -2.18853E-01 2.92302E-01
- 5 1.91238E-01 -1.54118E-01
- 6 -2.04810E-01 -6.73284E-01
-6 0 *********** CCCS-gly-gln
- 1 4.76782E-01 -5.98358E-02
- 2 1.24267E-01 7.76858E-02
- 3 -1.69073E-01 -9.98932E-02
- 4 -8.12065E-02 9.06815E-02
- 5 -3.06432E-02 -4.47218E-02
- 6 -6.58390E-02 -1.85102E-01
-6 0 *********** CCCS-gly-asn
- 1 4.86179E-01 4.08421E-01
- 2 1.16672E-01 2.14662E-01
- 3 1.87335E-02 -2.47021E-01
- 4 -1.61836E-01 1.35914E-01
- 5 -7.66595E-03 -8.39430E-02
- 6 -1.15627E-01 -2.88805E-01
-6 0 *********** CCCS-gly-glu
- 1 5.44361E-01 -1.50876E-01
- 2 1.37788E-01 4.74025E-02
- 3 -2.00329E-01 -6.97037E-02
- 4 -3.74576E-02 1.09528E-01
- 5 -2.98151E-02 -5.92646E-02
- 6 -6.12747E-02 -2.00258E-01
-6 0 *********** CCCS-gly-asp
- 1 4.75990E-01 4.78872E-01
- 2 -9.63724E-03 2.27361E-01
- 3 -9.55173E-02 -2.98200E-01
- 4 -1.37522E-01 8.86822E-02
- 5 -3.18774E-02 -6.14416E-02
- 6 -1.06927E-01 -2.59530E-01
-6 0 *********** CCCS-gly-his
- 1 5.94418E-01 3.24725E-01
- 2 1.84943E-01 8.32994E-02
- 3 -2.74370E-02 -2.01278E-01
- 4 -4.19998E-02 5.08601E-02
- 5 -1.18496E-01 -2.77518E-02
- 6 -3.69596E-02 -1.30117E-01
-6 0 *********** CCCS-gly-arg
- 1 2.76896E-01 -2.70128E-01
- 2 1.05035E-01 6.31898E-02
- 3 -1.15581E-01 5.97726E-03
- 4 -2.61558E-02 5.42305E-02
- 5 -8.91478E-02 -3.61035E-02
- 6 -4.06115E-02 -1.30985E-01
-6 0 *********** CCCS-gly-lys
- 1 2.40455E-01 -2.59200E-01
- 2 1.17128E-01 6.12889E-02
- 3 -1.55424E-01 5.08981E-02
- 4 2.31521E-02 4.06903E-02
- 5 -1.55136E-01 -1.45200E-02
- 6 -4.88160E-04 -8.09440E-02
-6 0 *********** CCCS-gly-pro
- 1 -8.20714E-01 -1.07499E+00
- 2 1.19829E-01 -7.99437E-02
- 3 -3.15940E-01 -5.47967E-02
- 4 -3.13390E-01 -2.21335E-01
- 5 3.89615E-01 -4.80336E-01
- 6 -1.26530E-01 -4.35970E-01
-6 0 *********** CCCS-thr-cys
- 1 -9.73915E-01 7.35774E-01
- 2 -1.23609E-01 2.61624E-01
- 3 -1.92760E-01 -3.09095E-02
- 4 -5.81870E-02 7.80827E-02
- 5 -1.54105E-01 -2.55381E-02
- 6 -1.88546E-02 -5.50090E-02
-6 0 *********** CCCS-thr-met
- 1 -5.18933E-01 6.68105E-01
- 2 1.11495E-01 6.72371E-02
- 3 -7.20765E-02 -2.46471E-02
- 4 9.44287E-03 1.04709E-01
- 5 -1.34117E-01 -2.08467E-02
- 6 6.10031E-04 -1.04424E-02
-6 0 *********** CCCS-thr-phe
- 1 -3.97853E-01 8.41275E-01
- 2 -4.54986E-04 1.36538E-02
- 3 -3.78885E-02 -1.58583E-01
- 4 -1.52024E-02 8.64865E-02
- 5 -5.48202E-02 -3.08228E-02
- 6 -3.82294E-02 -3.01918E-02
-6 0 *********** CCCS-thr-ile
- 1 -5.49217E-01 8.62893E-01
- 2 9.33589E-02 -7.92132E-03
- 3 -2.10370E-02 2.15014E-02
- 4 3.30795E-02 1.54745E-01
- 5 -1.92171E-01 -4.17530E-02
- 6 3.95512E-02 9.72977E-03
-6 0 *********** CCCS-thr-leu
- 1 -3.68031E-01 6.93374E-01
- 2 2.56670E-01 -7.03700E-02
- 3 1.14024E-01 -7.56363E-02
- 4 -1.66834E-02 1.18747E-01
- 5 8.28342E-03 -6.35328E-02
- 6 -9.39555E-03 -3.39105E-02
-6 0 *********** CCCS-thr-val
- 1 -4.88856E-01 8.01321E-01
- 2 1.14009E-01 -6.78863E-02
- 3 1.89288E-02 1.53374E-02
- 4 -1.78451E-02 1.51567E-01
- 5 -1.31760E-01 -5.29118E-02
- 6 1.53807E-02 1.96228E-02
-6 0 *********** CCCS-thr-trp
- 1 -3.74161E-01 7.95824E-01
- 2 2.55345E-02 8.55719E-02
- 3 -7.83362E-02 -1.11102E-01
- 4 -1.87679E-03 8.02720E-02
- 5 -8.07349E-02 -2.29455E-02
- 6 -2.51424E-02 -2.56810E-02
-6 0 *********** CCCS-thr-tyr
- 1 -3.78591E-01 8.09980E-01
- 2 -3.08368E-02 5.37961E-02
- 3 -1.82949E-02 -1.95112E-01
- 4 -6.37520E-02 1.09526E-01
- 5 2.76774E-03 -4.42103E-02
- 6 -7.25785E-02 -9.24006E-02
-6 0 *********** CCCS-thr-ala
- 1 -6.83703E-01 3.09597E-01
- 2 3.00326E-01 3.21246E-01
- 3 -6.61942E-03 3.53475E-02
- 4 -1.64570E-01 1.78561E-01
- 5 5.63825E-02 -2.94821E-02
- 6 -1.22402E-01 -1.85362E-01
-6 0 *********** CCCS-thr-gly
+4 0 *********** CCCS-gly-thr
+ 1 6.57016E-01 -5.23203E-01
+ 2 -1.55691E-01 4.36606E-01
+ 3 1.63097E-01 7.72411E-02
+ 4 -5.08481E-02 -5.09956E-02
+4 0 *********** CCCS-gly-ser
+ 1 1.38111E+00 -7.82855E-02
+ 2 -4.27476E-01 -9.10809E-02
+ 3 4.91534E-02 1.05681E-01
+ 4 2.23522E-01 -1.77805E-02
+4 0 *********** CCCS-gly-gln
+ 1 7.31678E-01 -4.64989E-01
+ 2 -1.82075E-01 1.90454E-01
+ 3 9.44762E-02 -1.36678E-02
+ 4 -8.83443E-03 -7.23257E-02
+4 0 *********** CCCS-gly-asn
+ 1 1.10318E+00 -1.62883E-01
+ 2 -3.33718E-01 -1.57769E-01
+ 3 8.30386E-03 8.43924E-02
+ 4 1.23489E-01 -1.06169E-02
+4 0 *********** CCCS-gly-glu
+ 1 7.71618E-01 -5.64459E-01
+ 2 -1.20693E-01 2.82620E-01
+ 3 1.39428E-01 -3.01628E-02
+ 4 -4.97869E-02 -6.92910E-02
+4 0 *********** CCCS-gly-asp
+ 1 1.23444E+00 -1.45663E-01
+ 2 -3.65504E-01 -1.04661E-01
+ 3 -1.21221E-02 1.18730E-01
+ 4 1.36505E-01 -1.49867E-02
+4 0 *********** CCCS-gly-his
+ 1 1.09895E+00 -2.02858E-01
+ 2 -1.98594E-01 -1.80072E-01
+ 3 9.81912E-02 1.20783E-01
+ 4 1.24016E-01 1.69661E-03
+4 0 *********** CCCS-gly-arg
+ 1 4.39569E-01 -5.16540E-01
+ 2 1.63975E-01 3.16742E-01
+ 3 1.08828E-01 -4.63823E-02
+ 4 -3.80107E-03 2.77407E-02
+4 0 *********** CCCS-gly-lys
+ 1 3.13346E-01 -5.05745E-01
+ 2 1.34799E-01 4.28675E-01
+ 3 1.08750E-01 2.69008E-02
+ 4 -6.54716E-03 3.14417E-02
+4 0 *********** CCCS-gly-pro
+ 1 9.51272E-01 -2.20991E-01
+ 2 -1.33605E-01 -2.03419E-01
+ 3 9.40695E-02 4.48809E-01
+ 4 -2.76656E-01 -6.75602E-01
+4 0 *********** CCCS-thr-cys
+ 1 -9.08281E-01 -3.01908E-01
+ 2 1.22001E-01 -1.73580E-01
+ 3 9.59156E-02 -5.68275E-02
+ 4 -4.85807E-02 3.02211E-02
+4 0 *********** CCCS-thr-met
+ 1 -5.99276E-01 8.31179E-02
+ 2 -1.73015E-01 -4.98070E-02
+ 3 3.09270E-02 -4.60290E-02
+ 4 1.14955E-02 4.59420E-02
+4 0 *********** CCCS-thr-phe
+ 1 -6.12939E-01 1.38964E-01
+ 2 -1.40114E-01 8.16806E-02
+ 3 -7.88300E-02 -1.33683E-02
+ 4 5.48961E-02 1.08369E-02
+4 0 *********** CCCS-thr-ile
+ 1 -7.53367E-01 1.22220E-01
+ 2 -2.23915E-01 -1.18124E-01
+ 3 2.93067E-02 -1.05475E-01
+ 4 1.74803E-02 7.51009E-02
+4 0 *********** CCCS-thr-leu
+ 1 -5.00823E-01 3.19599E-01
+ 2 -3.79156E-01 6.48330E-02
+ 3 -2.52279E-02 -5.60938E-02
+ 4 6.15224E-02 3.48828E-02
+4 0 *********** CCCS-thr-val
+ 1 -6.66163E-01 1.57839E-01
+ 2 -2.82039E-01 -6.85402E-02
+ 3 2.84170E-02 -8.92678E-02
+ 4 3.68848E-02 7.29793E-02
+4 0 *********** CCCS-thr-trp
+ 1 -6.67197E-01 1.59905E-01
+ 2 -1.32462E-01 4.54309E-03
+ 3 -4.41262E-02 -2.98930E-02
+ 4 4.77017E-02 2.33546E-02
+4 0 *********** CCCS-thr-tyr
+ 1 -6.05186E-01 1.32909E-01
+ 2 -1.27191E-01 7.92306E-02
+ 3 -7.55896E-02 -1.24676E-02
+ 4 5.38346E-02 1.19690E-02
+4 0 *********** CCCS-thr-ala
+ 1 -4.92108E-01 7.29893E-02
+ 2 -2.94868E-01 -2.89306E-01
+ 3 7.57361E-02 -3.65210E-02
+ 4 -5.57898E-02 3.86971E-02
+4 0 *********** CCCS-thr-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-thr-thr
- 1 -8.04850E-01 6.34067E-01
- 2 3.53480E-01 8.59159E-02
- 3 -5.51317E-02 8.72910E-02
- 4 -5.34245E-02 1.25794E-01
- 5 -1.11279E-01 -7.55151E-03
- 6 -2.66515E-02 1.99144E-02
-6 0 *********** CCCS-thr-ser
- 1 -1.45861E+00 9.59043E-01
- 2 -2.38011E-01 5.51363E-01
- 3 -2.48847E-01 -9.56814E-02
- 4 -1.12450E-01 2.70957E-02
- 5 -1.00017E-01 -3.40204E-02
- 6 -2.86364E-02 -1.32637E-01
-6 0 *********** CCCS-thr-gln
- 1 -6.32372E-01 6.71550E-01
- 2 1.63728E-02 2.86149E-01
- 3 -1.66417E-01 -3.37439E-02
- 4 1.77423E-03 8.19872E-02
- 5 -1.53942E-01 -1.53292E-04
- 6 -1.23639E-02 -5.53743E-02
-6 0 *********** CCCS-thr-asn
- 1 -1.03433E+00 4.09047E-01
- 2 -2.77161E-01 3.24094E-01
- 3 -2.62541E-01 -8.78655E-02
- 4 -5.51330E-02 3.17565E-02
- 5 -1.05941E-01 -4.02931E-02
- 6 -2.30689E-02 -1.37470E-01
-6 0 *********** CCCS-thr-glu
- 1 -6.15271E-01 8.33101E-01
- 2 3.32850E-02 2.65117E-01
- 3 -1.25442E-01 -1.37410E-02
- 4 1.53345E-04 1.07136E-01
- 5 -1.41108E-01 -2.34588E-03
- 6 -1.35197E-02 -3.23064E-02
-6 0 *********** CCCS-thr-asp
- 1 -1.29908E+00 7.05288E-02
- 2 -1.02899E-02 4.83748E-01
- 3 -2.18954E-01 1.36122E-02
- 4 -8.30945E-02 4.89137E-02
- 5 -1.48283E-01 -1.60566E-02
- 6 -2.75662E-02 -1.94595E-01
-6 0 *********** CCCS-thr-his
- 1 -9.44876E-01 7.91166E-01
- 2 -3.79635E-01 2.05229E-01
- 3 -2.47076E-01 -6.06951E-02
- 4 -2.57910E-02 5.47849E-02
- 5 -1.30011E-01 -3.77452E-02
- 6 -2.29715E-02 -3.97199E-02
-6 0 *********** CCCS-thr-arg
- 1 -3.54177E-01 6.29749E-01
- 2 1.05175E-01 5.01073E-02
- 3 1.57998E-02 -9.68862E-02
- 4 -3.96656E-02 1.17640E-01
- 5 -3.29978E-02 -4.53935E-02
- 6 -3.60784E-02 -7.69516E-02
-6 0 *********** CCCS-thr-lys
- 1 -3.90529E-01 6.13558E-01
- 2 1.97040E-01 -1.71595E-02
- 3 -2.14843E-03 -4.64495E-02
- 4 1.69210E-02 9.34230E-02
- 5 -8.87130E-02 -3.88683E-02
- 6 7.46317E-03 -9.07747E-03
-6 0 *********** CCCS-thr-pro
- 1 2.59928E+00 8.74400E-02
- 2 -3.29028E-01 -1.48846E-01
- 3 -1.01892E+00 -5.35085E-01
- 4 -6.92488E-01 4.11673E-01
- 5 2.67418E-01 2.24527E-03
- 6 -2.38086E-02 -4.75161E-01
-6 0 *********** CCCS-ser-cys
- 1 -2.01357E-01 2.33386E-01
- 2 -5.79785E-02 3.69954E-01
- 3 -1.14049E-01 -5.67362E-02
- 4 -1.29814E-01 1.56102E-01
- 5 -2.51327E-03 -6.13662E-02
- 6 -1.01032E-01 -2.67833E-01
-6 0 *********** CCCS-ser-met
- 1 -1.40766E-01 1.79386E-01
- 2 1.58556E-01 1.48664E-01
- 3 -1.09079E-01 -5.49521E-02
- 4 -3.00591E-03 5.83452E-02
- 5 -7.75879E-02 -2.40944E-02
- 6 -1.92557E-02 -1.08483E-01
-6 0 *********** CCCS-ser-phe
- 1 -9.54761E-02 1.79887E-01
- 2 1.92788E-01 8.40652E-02
- 3 -1.27432E-01 -8.12442E-02
- 4 -3.59069E-02 4.67367E-02
- 5 -6.84345E-02 -3.72774E-02
- 6 -3.48405E-02 -1.00470E-01
-6 0 *********** CCCS-ser-ile
- 1 -1.55023E-01 2.13465E-01
- 2 2.30533E-01 1.25745E-01
- 3 -1.59405E-01 -1.36217E-02
- 4 1.05861E-01 3.24593E-02
- 5 -1.74385E-01 -4.36821E-03
- 6 4.20326E-02 -3.72277E-02
-6 0 *********** CCCS-ser-leu
- 1 -9.72519E-02 1.51748E-01
- 2 2.89010E-01 4.09925E-02
- 3 -9.53202E-02 -9.28013E-02
- 4 1.15867E-02 2.91369E-02
- 5 -6.70235E-02 -3.61754E-02
- 6 -1.62530E-02 -8.47683E-02
-6 0 *********** CCCS-ser-val
- 1 -1.11154E-01 1.85372E-01
- 2 1.92527E-01 9.21050E-02
- 3 -9.83184E-02 -4.32966E-02
- 4 2.26004E-02 5.34533E-02
- 5 -8.77735E-02 -2.26007E-02
- 6 -4.93527E-03 -7.82858E-02
-6 0 *********** CCCS-ser-trp
- 1 -1.15520E-01 1.92161E-01
- 2 2.09433E-01 9.51733E-02
- 3 -1.61579E-01 -4.67171E-02
- 4 2.51823E-02 3.19336E-02
- 5 -1.29825E-01 -2.16786E-02
- 6 2.36862E-03 -6.41219E-02
-6 0 *********** CCCS-ser-tyr
- 1 -9.40078E-02 1.70314E-01
- 2 1.74206E-01 9.85230E-02
- 3 -1.13731E-01 -9.69467E-02
- 4 -6.33172E-02 6.18644E-02
- 5 -3.87677E-02 -4.57224E-02
- 6 -5.17542E-02 -1.34357E-01
-6 0 *********** CCCS-ser-ala
- 1 -2.14778E-01 1.04168E-01
- 2 1.55360E-01 2.76206E-01
- 3 -2.42691E-02 -6.94838E-02
- 4 -4.80736E-02 1.14306E-01
- 5 1.26398E-04 -3.30005E-02
- 6 -5.25844E-02 -2.14116E-01
-6 0 *********** CCCS-ser-gly
+4 0 *********** CCCS-thr-thr
+ 1 -7.45482E-01 9.60972E-02
+ 2 -1.90156E-01 -1.75476E-01
+ 3 3.87974E-02 -7.26032E-02
+ 4 -1.74927E-02 6.66013E-02
+4 0 *********** CCCS-thr-ser
+ 1 -1.16265E+00 -5.77886E-01
+ 2 3.67680E-01 -6.64155E-02
+ 3 4.94013E-02 -1.47955E-01
+ 4 -2.71067E-02 -2.54014E-03
+4 0 *********** CCCS-thr-gln
+ 1 -7.72626E-01 -6.76124E-03
+ 2 -4.44939E-02 -1.74265E-01
+ 3 -2.88422E-02 -7.51459E-02
+ 4 -1.11548E-02 5.16024E-02
+4 0 *********** CCCS-thr-asn
+ 1 -9.17112E-01 -4.37406E-01
+ 2 2.66940E-01 -1.36434E-01
+ 3 3.00889E-02 -4.33786E-02
+ 4 9.23315E-03 -1.18078E-02
+4 0 *********** CCCS-thr-glu
+ 1 -8.40641E-01 6.81535E-02
+ 2 -8.78889E-02 -1.68137E-01
+ 3 -3.19566E-02 -9.00317E-02
+ 4 5.28663E-03 5.34595E-02
+4 0 *********** CCCS-thr-asp
+ 1 -1.02189E+00 -4.79146E-01
+ 2 2.95262E-01 -1.28086E-01
+ 3 2.31717E-02 -4.87398E-02
+ 4 1.39044E-02 -1.88108E-02
+4 0 *********** CCCS-thr-his
+ 1 -8.80916E-01 -4.26539E-01
+ 2 2.42448E-01 -9.14291E-02
+ 3 1.05248E-01 -4.81750E-02
+ 4 -1.92150E-02 -4.72863E-02
+4 0 *********** CCCS-thr-arg
+ 1 -5.48048E-01 2.09077E-01
+ 2 -1.99186E-01 4.01057E-02
+ 3 -2.39989E-02 -5.14240E-02
+ 4 2.87024E-02 2.01337E-02
+4 0 *********** CCCS-thr-lys
+ 1 -4.75450E-01 2.54118E-01
+ 2 -2.76141E-01 3.68121E-02
+ 3 1.98402E-02 -3.23959E-02
+ 4 3.17753E-02 2.41329E-02
+4 0 *********** CCCS-thr-pro
+ 1 -1.46596E+00 -1.78082E-01
+ 2 3.64356E-01 -2.36500E-01
+ 3 -2.18599E-01 -2.65481E-01
+ 4 2.98444E-02 -8.51331E-03
+4 0 *********** CCCS-ser-cys
+ 1 -1.04837E+00 -6.10995E-01
+ 2 -1.41701E-01 -2.85795E-01
+ 3 2.72913E-01 -5.66441E-02
+ 4 -1.15430E-01 1.18261E-01
+4 0 *********** CCCS-ser-met
+ 1 -7.53509E-01 -1.07956E-01
+ 2 -3.96696E-01 7.46363E-02
+ 3 1.45212E-01 -1.03265E-01
+ 4 -5.12330E-03 4.33481E-02
+4 0 *********** CCCS-ser-phe
+ 1 -8.86745E-01 -1.49766E-01
+ 2 -2.52304E-01 3.97771E-01
+ 3 -3.63396E-02 -1.43342E-01
+ 4 3.20231E-02 6.09485E-02
+4 0 *********** CCCS-ser-ile
+ 1 -9.81862E-01 -1.93356E-01
+ 2 -6.47003E-01 1.05026E-01
+ 3 2.60292E-01 -1.94239E-01
+ 4 -1.34015E-03 -6.87713E-04
+4 0 *********** CCCS-ser-leu
+ 1 -6.55843E-01 1.84284E-01
+ 2 -7.79829E-01 3.69260E-01
+ 3 9.90230E-02 -1.49577E-01
+ 4 2.84450E-02 -5.30532E-02
+4 0 *********** CCCS-ser-val
+ 1 -8.84912E-01 -1.43814E-01
+ 2 -7.19527E-01 1.80517E-01
+ 3 2.55997E-01 -1.65153E-01
+ 4 2.14705E-02 -1.71934E-02
+4 0 *********** CCCS-ser-trp
+ 1 -9.10824E-01 -7.98788E-02
+ 2 -2.66428E-01 2.50268E-01
+ 3 1.56151E-03 -1.57157E-01
+ 4 3.90715E-02 6.46676E-02
+4 0 *********** CCCS-ser-tyr
+ 1 -8.72452E-01 -1.33650E-01
+ 2 -2.16929E-01 3.71744E-01
+ 3 -4.87209E-02 -1.43150E-01
+ 4 4.01808E-02 7.72556E-02
+4 0 *********** CCCS-ser-ala
+ 1 -5.84042E-01 2.54320E-02
+ 2 -7.23774E-01 -4.84211E-01
+ 3 2.01131E-01 1.15642E-02
+ 4 2.58175E-02 4.67270E-02
+4 0 *********** CCCS-ser-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-ser-thr
- 1 -1.97745E-01 1.94350E-01
- 2 2.45763E-01 1.88788E-01
- 3 -1.29060E-01 -2.02534E-02
- 4 6.11179E-02 5.19690E-02
- 5 -1.31878E-01 -2.90480E-03
- 6 1.64361E-02 -7.65508E-02
-6 0 *********** CCCS-ser-ser
- 1 -2.59272E-01 2.20590E-01
- 2 -8.91058E-02 5.87615E-01
- 3 -7.83145E-02 -1.25140E-01
- 4 -2.04629E-01 2.79464E-01
- 5 8.99667E-02 -9.65788E-02
- 6 -1.92229E-01 -4.95892E-01
-6 0 *********** CCCS-ser-gln
- 1 -1.57205E-01 2.02914E-01
- 2 7.69219E-02 2.87705E-01
- 3 -1.06061E-01 -4.95700E-02
- 4 -4.76242E-02 8.41118E-02
- 5 -5.30026E-02 -2.77578E-02
- 6 -4.30948E-02 -1.67343E-01
-6 0 *********** CCCS-ser-asn
- 1 -2.42118E-01 2.33249E-01
- 2 -1.86843E-01 3.29565E-01
- 3 -1.67620E-01 -6.04880E-02
- 4 -1.59874E-01 1.75704E-01
- 5 2.45600E-02 -9.72523E-02
- 6 -1.17590E-01 -3.03357E-01
-6 0 *********** CCCS-ser-glu
- 1 -1.30009E-01 2.18036E-01
- 2 1.29245E-01 2.86502E-01
- 3 -9.11889E-02 -4.26156E-02
- 4 -1.88100E-02 7.31172E-02
- 5 -5.91435E-02 -1.66696E-02
- 6 -2.80203E-02 -1.41942E-01
-6 0 *********** CCCS-ser-asp
- 1 -2.47345E-01 2.00869E-01
- 2 -1.61372E-01 3.33032E-01
- 3 -1.23519E-01 -8.38555E-03
- 4 -1.23644E-01 1.68634E-01
- 5 -1.94355E-02 -7.11329E-02
- 6 -1.08142E-01 -2.56694E-01
-6 0 *********** CCCS-ser-his
- 1 -1.76492E-01 2.94431E-01
- 2 -1.61494E-01 2.67854E-01
- 3 -1.87059E-01 5.16473E-02
- 4 -5.30497E-02 1.06951E-01
- 5 -1.20051E-01 -3.62362E-02
- 6 -5.13175E-02 -1.17525E-01
-6 0 *********** CCCS-ser-arg
- 1 -1.09439E-01 1.45623E-01
- 2 1.86111E-01 1.04780E-01
- 3 -8.84665E-02 -9.85560E-02
- 4 -3.40626E-02 6.04373E-02
- 5 -3.74758E-02 -4.22340E-02
- 6 -3.85764E-02 -1.34467E-01
-6 0 *********** CCCS-ser-lys
- 1 -1.24755E-01 1.51129E-01
- 2 2.25444E-01 6.38137E-02
- 3 -1.11822E-01 -7.39267E-02
- 4 1.80943E-02 3.58601E-02
- 5 -9.00375E-02 -2.91304E-02
- 6 -7.55953E-03 -8.05218E-02
-6 0 *********** CCCS-ser-pro
- 1 1.23702E-01 -4.50490E-01
- 2 -4.02980E-01 -2.53802E-02
- 3 -1.16646E-01 -3.27125E-01
- 4 2.09094E-02 3.66850E-01
- 5 2.13675E-01 -1.35415E-01
- 6 -2.40190E-01 -5.90493E-01
-6 0 *********** CCCS-gln-cys
- 1 -9.11312E-01 4.86885E-01
- 2 -1.46991E-01 3.27481E-01
- 3 -1.98803E-01 -5.36682E-02
- 4 -8.46335E-02 5.74431E-02
- 5 -1.06336E-01 -3.30588E-02
- 6 -3.59060E-02 -1.25129E-01
-6 0 *********** CCCS-gln-met
- 1 -5.83890E-01 5.57960E-01
- 2 1.54372E-01 1.07370E-01
- 3 -9.64036E-02 1.08135E-02
- 4 -8.64409E-03 9.44125E-02
- 5 -1.31562E-01 -1.63110E-02
- 6 -6.61752E-03 -1.32402E-02
-6 0 *********** CCCS-gln-phe
- 1 -5.10151E-01 7.11157E-01
- 2 9.52633E-02 2.44852E-02
- 3 -3.42555E-02 -9.90817E-02
- 4 -2.15379E-02 8.59399E-02
- 5 -5.93982E-02 -3.53258E-02
- 6 -2.67572E-02 -2.43571E-02
-6 0 *********** CCCS-gln-ile
- 1 -6.26222E-01 7.06991E-01
- 2 1.88476E-01 5.54091E-02
- 3 -1.01818E-01 8.27453E-02
- 4 1.62938E-02 1.11930E-01
- 5 -1.77627E-01 -1.19435E-02
- 6 1.40951E-02 4.82151E-02
-6 0 *********** CCCS-gln-leu
- 1 -4.72781E-01 5.98271E-01
- 2 3.29982E-01 3.21820E-03
- 3 8.55752E-02 -1.49748E-02
- 4 -3.65208E-02 1.10640E-01
- 5 2.90995E-02 -4.52029E-02
- 6 -2.63046E-02 -2.09016E-02
-6 0 *********** CCCS-gln-val
- 1 -5.71526E-01 6.71004E-01
- 2 2.05800E-01 -2.14564E-03
- 3 -5.13530E-02 6.69360E-02
- 4 -3.45057E-02 1.12505E-01
- 5 -1.11706E-01 -2.25606E-02
- 6 -1.18741E-02 4.71185E-02
-6 0 *********** CCCS-gln-trp
- 1 -4.72439E-01 6.75729E-01
- 2 8.52127E-02 9.84391E-02
- 3 -6.43783E-02 -7.28928E-02
- 4 -2.35855E-02 8.75507E-02
- 5 -6.96126E-02 -2.92815E-02
- 6 -2.66099E-02 -4.08272E-02
-6 0 *********** CCCS-gln-tyr
- 1 -4.86038E-01 6.86094E-01
- 2 5.71755E-02 5.68739E-02
- 3 -8.13157E-03 -1.36463E-01
- 4 -6.98789E-02 1.09435E-01
- 5 -4.18579E-03 -4.95531E-02
- 6 -5.90516E-02 -9.01847E-02
-6 0 *********** CCCS-gln-ala
- 1 -6.95425E-01 2.17216E-01
- 2 2.84597E-01 4.17930E-01
- 3 -7.23778E-02 4.76704E-02
- 4 -1.68734E-01 1.85224E-01
- 5 1.82523E-02 -2.31172E-02
- 6 -1.28547E-01 -2.21400E-01
-6 0 *********** CCCS-gln-gly
+4 0 *********** CCCS-ser-thr
+ 1 -9.04091E-01 -1.14038E-01
+ 2 -5.51718E-01 -1.18229E-01
+ 3 1.98503E-01 -1.00926E-01
+ 4 -5.00525E-03 2.62573E-02
+4 0 *********** CCCS-ser-ser
+ 1 -1.21903E+00 -1.13590E+00
+ 2 1.10102E-01 -4.44413E-01
+ 3 8.51782E-02 -3.48694E-02
+ 4 -1.04601E-01 1.08914E-02
+4 0 *********** CCCS-ser-gln
+ 1 -9.00164E-01 -1.94782E-01
+ 2 -2.32413E-01 -1.81809E-01
+ 3 3.42637E-03 -1.34012E-01
+ 4 -1.13839E-02 8.78613E-02
+4 0 *********** CCCS-ser-asn
+ 1 -1.00506E+00 -7.20429E-01
+ 2 1.84999E-01 -3.76506E-01
+ 3 2.75927E-02 -1.52767E-02
+ 4 -3.90060E-02 7.92171E-02
+4 0 *********** CCCS-ser-glu
+ 1 -1.01415E+00 -1.64873E-01
+ 2 -3.38425E-01 -8.18384E-02
+ 3 2.91754E-02 -1.74557E-01
+ 4 2.24211E-02 6.18333E-02
+4 0 *********** CCCS-ser-asp
+ 1 -1.10875E+00 -8.78415E-01
+ 2 1.03249E-01 -4.25272E-01
+ 3 1.91494E-02 6.71157E-02
+ 4 -1.74906E-02 6.09993E-02
+4 0 *********** CCCS-ser-his
+ 1 -1.05074E+00 -6.95434E-01
+ 2 2.12439E-01 -1.69617E-01
+ 3 2.07914E-01 -5.80538E-02
+ 4 -2.43340E-02 -1.00341E-02
+4 0 *********** CCCS-ser-arg
+ 1 -7.23069E-01 4.20717E-02
+ 2 -3.65552E-01 2.58250E-01
+ 3 4.00962E-02 -1.34337E-01
+ 4 -1.39705E-02 -6.73942E-03
+4 0 *********** CCCS-ser-lys
+ 1 -6.17249E-01 1.39288E-01
+ 2 -5.23413E-01 2.16254E-01
+ 3 1.24271E-01 -8.68823E-02
+ 4 1.69791E-02 -1.07765E-02
+4 0 *********** CCCS-ser-pro
+ 1 -1.80852E+00 -1.13946E+00
+ 2 -2.23424E-01 -3.04544E-01
+ 3 -2.06562E-02 -2.72521E-01
+ 4 -1.05566E-01 1.34185E-01
+4 0 *********** CCCS-gln-cys
+ 1 -8.92424E-01 -5.07387E-01
+ 2 -2.42104E-02 -4.24023E-02
+ 3 1.02088E-01 -1.39458E-01
+ 4 -9.38427E-03 5.45754E-02
+4 0 *********** CCCS-gln-met
+ 1 -6.52447E-01 -1.51895E-02
+ 2 -1.90492E-01 6.94244E-02
+ 3 3.21838E-02 -7.49475E-02
+ 4 -2.23481E-03 3.86823E-02
+4 0 *********** CCCS-gln-phe
+ 1 -7.26817E-01 3.40560E-02
+ 2 -7.70293E-02 2.09886E-01
+ 3 -9.15611E-02 -3.53401E-02
+ 4 5.22865E-02 4.07427E-02
+4 0 *********** CCCS-gln-ile
+ 1 -8.16693E-01 -5.89724E-02
+ 2 -2.43021E-01 7.80091E-02
+ 3 2.10517E-02 -1.25236E-01
+ 4 -3.01370E-02 3.17542E-02
+4 0 *********** CCCS-gln-leu
+ 1 -5.65181E-01 1.91999E-01
+ 2 -3.29198E-01 2.16747E-01
+ 3 2.92818E-03 -4.08838E-02
+ 4 -2.38458E-02 5.62057E-02
+4 0 *********** CCCS-gln-val
+ 1 -7.29652E-01 -3.69959E-03
+ 2 -2.89669E-01 1.14813E-01
+ 3 3.10314E-02 -1.01801E-01
+ 4 -2.27825E-02 4.27327E-02
+4 0 *********** CCCS-gln-trp
+ 1 -7.66079E-01 5.39907E-02
+ 2 -9.03988E-02 1.34352E-01
+ 3 -6.45456E-02 -5.61522E-02
+ 4 4.25952E-02 3.57759E-02
+4 0 *********** CCCS-gln-tyr
+ 1 -7.16548E-01 3.52292E-02
+ 2 -6.46610E-02 1.99411E-01
+ 3 -9.15575E-02 -3.54834E-02
+ 4 5.79160E-02 4.34072E-02
+4 0 *********** CCCS-gln-ala
+ 1 -4.87342E-01 -3.86897E-02
+ 2 -3.86278E-01 -1.76526E-01
+ 3 5.77582E-02 -1.40930E-02
+ 4 -3.92891E-02 -5.27642E-02
+4 0 *********** CCCS-gln-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-gln-thr
- 1 -8.50426E-01 4.89491E-01
- 2 3.99478E-01 2.09026E-01
- 3 -1.41284E-01 1.10074E-01
- 4 -3.46067E-02 1.07820E-01
- 5 -1.58159E-01 1.26326E-02
- 6 -2.36300E-02 1.51098E-03
-6 0 *********** CCCS-gln-ser
- 1 -1.17660E+00 4.15931E-01
- 2 -3.09073E-01 7.38224E-01
- 3 -2.33517E-01 -1.31343E-01
- 4 -1.66299E-01 1.19421E-02
- 5 -2.90927E-02 -5.55764E-02
- 6 -5.19929E-02 -3.03291E-01
-6 0 *********** CCCS-gln-gln
- 1 -6.65168E-01 5.29683E-01
- 2 1.33416E-02 3.02582E-01
- 3 -1.66643E-01 -1.01792E-02
- 4 -1.88124E-02 7.46125E-02
- 5 -1.51702E-01 -5.00831E-03
- 6 -1.36721E-02 -7.48026E-02
-6 0 *********** CCCS-gln-asn
- 1 -9.21672E-01 2.24533E-01
- 2 -3.68596E-01 3.07480E-01
- 3 -2.19442E-01 -1.34108E-01
- 4 -7.48838E-02 3.57739E-02
- 5 -6.55911E-02 -3.98105E-02
- 6 -4.46918E-02 -1.89147E-01
-6 0 *********** CCCS-gln-glu
- 1 -6.71126E-01 6.53436E-01
- 2 7.06504E-02 3.01008E-01
- 3 -1.52336E-01 2.65357E-02
- 4 -2.46344E-02 9.46027E-02
- 5 -1.41873E-01 -2.62087E-03
- 6 -1.84508E-02 -4.30433E-02
-6 0 *********** CCCS-gln-asp
- 1 -1.07041E+00 -8.04267E-02
- 2 -2.16234E-01 4.79218E-01
- 3 -1.80989E-01 -9.83985E-03
- 4 -1.04428E-01 2.70860E-02
- 5 -1.09274E-01 -3.65505E-02
- 6 -3.50950E-02 -2.36589E-01
-6 0 *********** CCCS-gln-his
- 1 -8.73104E-01 5.15609E-01
- 2 -3.54744E-01 2.29926E-01
- 3 -2.83231E-01 -8.62836E-02
- 4 -2.19414E-02 3.58189E-02
- 5 -1.13149E-01 -2.96843E-02
- 6 -2.63492E-02 -8.21583E-02
-6 0 *********** CCCS-gln-arg
- 1 -4.39318E-01 5.47481E-01
- 2 1.54876E-01 8.03944E-02
- 3 3.33358E-03 -4.84185E-02
- 4 -5.17340E-02 1.13528E-01
- 5 -3.25373E-02 -4.28430E-02
- 6 -3.52592E-02 -7.06679E-02
-6 0 *********** CCCS-gln-lys
- 1 -4.73087E-01 5.33347E-01
- 2 2.48300E-01 3.16521E-02
- 3 -2.28692E-02 4.71487E-04
- 4 2.11293E-03 8.64580E-02
- 5 -7.88371E-02 -2.82020E-02
- 6 -1.78632E-03 -4.88562E-03
-6 0 *********** CCCS-gln-pro
- 1 1.45069E+00 2.94471E-01
- 2 -7.56812E-01 -4.03113E-01
- 3 -8.17387E-01 -7.63617E-01
- 4 -3.99971E-01 3.80166E-01
- 5 2.98555E-01 1.23289E-01
- 6 -7.36956E-02 -3.46063E-01
-6 0 *********** CCCS-asn-cys
- 1 -9.81243E-01 7.38947E-01
- 2 -1.27216E-01 2.64776E-01
- 3 -1.89802E-01 -2.42134E-02
- 4 -6.40229E-02 8.29857E-02
- 5 -1.58300E-01 -2.72951E-02
- 6 -1.91836E-02 -6.96382E-02
-6 0 *********** CCCS-asn-met
- 1 -5.28844E-01 6.71403E-01
- 2 1.13849E-01 6.62739E-02
- 3 -6.58071E-02 -2.43809E-02
- 4 9.86111E-03 1.07713E-01
- 5 -1.34817E-01 -2.10671E-02
- 6 1.44374E-03 -6.33229E-03
-6 0 *********** CCCS-asn-phe
- 1 -4.09384E-01 8.49907E-01
- 2 8.47627E-04 1.23925E-02
- 3 -3.57423E-02 -1.65132E-01
- 4 -1.03322E-02 8.46689E-02
- 5 -5.54326E-02 -2.93923E-02
- 6 -3.75781E-02 -3.35103E-02
-6 0 *********** CCCS-asn-ile
- 1 -5.64930E-01 8.72982E-01
- 2 9.55892E-02 -1.75407E-02
- 3 -9.29467E-03 2.53323E-02
- 4 3.21160E-02 1.61331E-01
- 5 -1.92475E-01 -4.48645E-02
- 6 4.18638E-02 1.77003E-02
-6 0 *********** CCCS-asn-leu
- 1 -3.78356E-01 6.97780E-01
- 2 2.66114E-01 -7.37090E-02
- 3 1.27426E-01 -7.85588E-02
- 4 -1.59465E-02 1.21971E-01
- 5 1.23339E-02 -6.63152E-02
- 6 -7.42130E-03 -4.14076E-02
-6 0 *********** CCCS-asn-val
- 1 -5.04308E-01 8.10321E-01
- 2 1.18691E-01 -7.66508E-02
- 3 2.96895E-02 1.85849E-02
- 4 -2.11599E-02 1.57982E-01
- 5 -1.30426E-01 -5.59587E-02
- 6 1.61186E-02 1.32968E-02
-6 0 *********** CCCS-asn-trp
- 1 -3.82884E-01 8.01736E-01
- 2 2.56529E-02 8.67306E-02
- 3 -7.40116E-02 -1.16420E-01
- 4 -3.60492E-04 8.04250E-02
- 5 -7.83570E-02 -2.24886E-02
- 6 -2.59654E-02 -2.75688E-02
-6 0 *********** CCCS-asn-tyr
- 1 -3.88971E-01 8.18540E-01
- 2 -3.06476E-02 5.30580E-02
- 3 -1.58166E-02 -2.02065E-01
- 4 -5.97860E-02 1.08157E-01
- 5 2.45092E-03 -4.32023E-02
- 6 -7.22697E-02 -9.84011E-02
-6 0 *********** CCCS-asn-ala
- 1 -6.90939E-01 3.08987E-01
- 2 3.07003E-01 3.25144E-01
- 3 -3.00035E-03 4.85177E-02
- 4 -1.66492E-01 1.79254E-01
- 5 5.68450E-02 -2.69275E-02
- 6 -1.24516E-01 -1.76014E-01
-6 0 *********** CCCS-asn-gly
+4 0 *********** CCCS-gln-thr
+ 1 -7.80760E-01 -6.13841E-02
+ 2 -2.35612E-01 -1.24991E-02
+ 3 2.49293E-02 -8.20607E-02
+ 4 -3.06675E-02 6.90262E-03
+4 0 *********** CCCS-gln-ser
+ 1 -1.03788E+00 -8.88069E-01
+ 2 5.34243E-02 5.10125E-02
+ 3 1.50205E-01 -2.08371E-01
+ 4 -3.01558E-02 2.63968E-02
+4 0 *********** CCCS-gln-gln
+ 1 -8.04285E-01 -1.29508E-01
+ 2 -9.34017E-02 -6.37414E-02
+ 3 -5.87788E-02 -9.53064E-02
+ 4 1.00333E-03 3.02731E-02
+4 0 *********** CCCS-gln-asn
+ 1 -8.38358E-01 -6.14264E-01
+ 2 8.17134E-02 -9.24163E-02
+ 3 5.51736E-02 -1.03468E-01
+ 4 2.68239E-02 5.56177E-02
+4 0 *********** CCCS-gln-glu
+ 1 -8.96027E-01 -8.93257E-02
+ 2 -1.12126E-01 -9.88092E-03
+ 3 -6.86206E-02 -1.06623E-01
+ 4 1.56355E-03 1.49187E-02
+4 0 *********** CCCS-gln-asp
+ 1 -9.22333E-01 -7.13812E-01
+ 2 5.02866E-02 -5.05264E-02
+ 3 7.80833E-02 -1.05819E-01
+ 4 2.92431E-02 4.29878E-02
+4 0 *********** CCCS-gln-his
+ 1 -8.45032E-01 -5.83060E-01
+ 2 1.08484E-01 -2.73417E-02
+ 3 1.30266E-01 -1.25573E-01
+ 4 1.45373E-02 5.90930E-03
+4 0 *********** CCCS-gln-arg
+ 1 -6.20503E-01 1.20432E-01
+ 2 -1.63002E-01 1.57146E-01
+ 3 -2.74049E-02 -5.80091E-02
+ 4 -8.73186E-03 2.35626E-02
+4 0 *********** CCCS-gln-lys
+ 1 -5.28575E-01 1.73025E-01
+ 2 -2.56094E-01 1.51170E-01
+ 3 3.46088E-02 -3.83785E-02
+ 4 -5.83263E-03 2.90363E-02
+4 0 *********** CCCS-gln-pro
+ 1 -1.54478E+00 -7.03617E-01
+ 2 1.77756E-01 2.22580E-01
+ 3 -8.84134E-02 -4.66760E-01
+ 4 -7.23375E-02 1.06350E-01
+4 0 *********** CCCS-asn-cys
+ 1 -9.82525E-01 -3.51632E-01
+ 2 -2.52515E-01 -1.11964E-01
+ 3 1.39576E-01 -1.96110E-01
+ 4 -4.65103E-03 8.79464E-02
+4 0 *********** CCCS-asn-met
+ 1 -6.91677E-01 7.41541E-02
+ 2 -2.56189E-01 2.36130E-01
+ 3 1.10713E-02 -1.44067E-01
+ 4 3.06039E-02 2.74767E-02
+4 0 *********** CCCS-asn-phe
+ 1 -8.00835E-01 1.00115E-01
+ 2 -1.07459E-02 3.91741E-01
+ 3 -1.24297E-01 -2.84366E-02
+ 4 6.54387E-02 -3.93435E-03
+4 0 *********** CCCS-asn-ile
+ 1 -8.79446E-01 4.35312E-02
+ 2 -3.90415E-01 3.37774E-01
+ 3 -7.49679E-03 -2.43611E-01
+ 4 6.60991E-03 3.25451E-02
+4 0 *********** CCCS-asn-leu
+ 1 -5.41915E-01 2.78822E-01
+ 2 -3.53500E-01 5.72411E-01
+ 3 -4.69218E-02 -8.76969E-02
+ 4 -2.13995E-02 -1.69204E-03
+4 0 *********** CCCS-asn-val
+ 1 -7.84056E-01 7.67350E-02
+ 2 -4.05088E-01 4.09834E-01
+ 3 6.41454E-03 -2.09256E-01
+ 4 1.00253E-02 1.59303E-02
+4 0 *********** CCCS-asn-trp
+ 1 -8.15609E-01 1.46881E-01
+ 2 -8.28472E-02 2.99037E-01
+ 3 -1.03392E-01 -7.04564E-02
+ 4 6.42105E-02 -3.85424E-03
+4 0 *********** CCCS-asn-tyr
+ 1 -7.88025E-01 1.06272E-01
+ 2 2.66433E-03 3.62107E-01
+ 3 -1.27500E-01 -2.45225E-02
+ 4 7.87480E-02 -3.57991E-03
+4 0 *********** CCCS-asn-ala
+ 1 -5.02302E-01 7.78595E-02
+ 2 -6.89111E-01 -3.28269E-03
+ 3 8.33343E-02 -1.01783E-01
+ 4 4.50539E-03 -2.04876E-02
+4 0 *********** CCCS-asn-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-asn-thr
- 1 -8.20768E-01 6.36954E-01
- 2 3.63215E-01 8.57219E-02
- 3 -4.68729E-02 9.70987E-02
- 4 -5.60658E-02 1.28204E-01
- 5 -1.17309E-01 -3.91918E-03
- 6 -2.61601E-02 3.27244E-02
-6 0 *********** CCCS-asn-ser
- 1 -1.48082E+00 9.73863E-01
- 2 -2.39555E-01 5.47266E-01
- 3 -2.48177E-01 -6.78655E-02
- 4 -1.22407E-01 3.06881E-02
- 5 -1.14624E-01 -3.91831E-02
- 6 -2.09710E-02 -1.05869E-01
-6 0 *********** CCCS-asn-gln
- 1 -6.38601E-01 6.72814E-01
- 2 1.27532E-02 2.90820E-01
- 3 -1.61997E-01 -3.36020E-02
- 4 3.71112E-03 8.47105E-02
- 5 -1.56262E-01 1.06251E-03
- 6 -1.20994E-02 -5.67135E-02
-6 0 *********** CCCS-asn-asn
- 1 -1.03529E+00 4.09695E-01
- 2 -2.82458E-01 3.32931E-01
- 3 -2.72391E-01 -8.49418E-02
- 4 -6.30248E-02 3.01867E-02
- 5 -1.08756E-01 -4.42677E-02
- 6 -1.90216E-02 -1.43975E-01
-6 0 *********** CCCS-asn-glu
- 1 -6.24444E-01 8.36389E-01
- 2 3.08403E-02 2.67311E-01
- 3 -1.18897E-01 -1.36358E-02
- 4 3.23561E-03 1.10909E-01
- 5 -1.41815E-01 -2.03370E-03
- 6 -1.20046E-02 -3.04993E-02
-6 0 *********** CCCS-asn-asp
- 1 -1.31230E+00 6.08324E-02
- 2 -4.66516E-03 4.89280E-01
- 3 -2.31381E-01 2.65240E-02
- 4 -7.91981E-02 5.00199E-02
- 5 -1.61024E-01 -1.30875E-02
- 6 -2.50555E-02 -1.88560E-01
-6 0 *********** CCCS-asn-his
- 1 -9.47521E-01 8.00586E-01
- 2 -3.84671E-01 2.07295E-01
- 3 -2.53791E-01 -5.33085E-02
- 4 -3.84714E-02 5.82850E-02
- 5 -1.28432E-01 -4.38477E-02
- 6 -2.18627E-02 -3.71136E-02
-6 0 *********** CCCS-asn-arg
- 1 -3.62848E-01 6.33833E-01
- 2 1.08980E-01 4.83759E-02
- 3 2.27920E-02 -9.80776E-02
- 4 -3.78147E-02 1.19442E-01
- 5 -3.38356E-02 -4.62190E-02
- 6 -3.48041E-02 -8.54747E-02
-6 0 *********** CCCS-asn-lys
- 1 -3.99732E-01 6.17116E-01
- 2 2.02924E-01 -1.94415E-02
- 3 6.02302E-03 -4.65917E-02
- 4 1.73784E-02 9.51469E-02
- 5 -8.75523E-02 -4.03373E-02
- 6 8.76732E-03 -1.66787E-02
-6 0 *********** CCCS-asn-pro
- 1 2.80167E+00 4.81081E-01
- 2 -2.07001E-01 4.08283E-01
- 3 -9.00332E-01 -5.09962E-02
- 4 -6.53642E-01 6.46736E-01
- 5 1.64194E-01 4.80608E-02
- 6 -1.25901E-01 -4.74117E-01
-6 0 *********** CCCS-glu-cys
- 1 -6.44744E-01 1.94963E-01
- 2 -1.23400E-01 4.72754E-01
- 3 -1.80354E-01 -6.53012E-02
- 4 -1.39261E-01 9.03505E-02
- 5 -4.92369E-02 -4.94551E-02
- 6 -7.20235E-02 -2.70591E-01
-6 0 *********** CCCS-glu-met
- 1 -5.11248E-01 3.59750E-01
- 2 2.15710E-01 1.46131E-01
- 3 -1.10520E-01 8.35251E-03
- 4 -4.87025E-03 7.79767E-02
- 5 -1.08686E-01 -1.06252E-02
- 6 -1.36649E-02 -4.54532E-02
-6 0 *********** CCCS-glu-phe
- 1 -4.70125E-01 4.63112E-01
- 2 2.17518E-01 3.42238E-02
- 3 -6.31706E-02 -5.49241E-02
- 4 -1.55684E-02 6.04560E-02
- 5 -6.59428E-02 -3.24503E-02
- 6 -1.88665E-02 -2.84531E-02
-6 0 *********** CCCS-glu-ile
- 1 -5.52165E-01 4.40316E-01
- 2 2.86501E-01 1.19971E-01
- 3 -1.57400E-01 7.00972E-02
- 4 5.58583E-02 7.03934E-02
- 5 -1.59460E-01 5.39092E-03
- 6 1.42226E-02 3.27814E-02
-6 0 *********** CCCS-glu-leu
- 1 -4.63638E-01 4.18084E-01
- 2 3.98640E-01 5.96325E-03
- 3 5.68312E-02 -1.85701E-02
- 4 -2.67309E-02 8.01931E-02
- 5 4.54554E-02 -3.67789E-02
- 6 -3.30695E-02 -2.59191E-02
-6 0 *********** CCCS-glu-val
- 1 -5.10509E-01 4.37881E-01
- 2 2.83195E-01 4.98836E-02
- 3 -1.01193E-01 4.27127E-02
- 4 9.21017E-03 7.68823E-02
- 5 -9.97160E-02 -6.91023E-03
- 6 -9.61703E-03 1.81664E-02
-6 0 *********** CCCS-glu-trp
- 1 -4.41061E-01 4.37295E-01
- 2 1.95095E-01 1.00936E-01
- 3 -7.60768E-02 -3.90511E-02
- 4 -2.35785E-02 7.06695E-02
- 5 -6.54462E-02 -2.81214E-02
- 6 -2.40580E-02 -4.58926E-02
-6 0 *********** CCCS-glu-tyr
- 1 -4.45689E-01 4.45616E-01
- 2 1.77315E-01 5.85893E-02
- 3 -3.58001E-02 -8.51341E-02
- 4 -6.16139E-02 8.15937E-02
- 5 -1.81915E-02 -4.55243E-02
- 6 -4.70711E-02 -8.39008E-02
-6 0 *********** CCCS-glu-ala
- 1 -6.18616E-01 1.05845E-01
- 2 2.99093E-01 4.46810E-01
- 3 -7.80112E-02 1.64218E-02
- 4 -1.36393E-01 1.82471E-01
- 5 7.08592E-03 -2.56853E-02
- 6 -1.11483E-01 -2.70616E-01
-6 0 *********** CCCS-glu-gly
+4 0 *********** CCCS-asn-thr
+ 1 -8.11013E-01 6.59891E-02
+ 2 -4.26966E-01 1.74948E-01
+ 3 1.65546E-02 -1.73767E-01
+ 4 1.62799E-02 1.83886E-02
+4 0 *********** CCCS-asn-ser
+ 1 -1.06150E+00 -7.20223E-01
+ 2 -2.64205E-01 -2.70668E-01
+ 3 1.82935E-01 -1.36872E-01
+ 4 -8.21001E-02 2.23903E-02
+4 0 *********** CCCS-asn-gln
+ 1 -8.31456E-01 6.94561E-03
+ 2 -2.57390E-01 -6.59889E-04
+ 3 -9.34647E-02 -1.03075E-01
+ 4 5.54687E-02 4.35942E-02
+4 0 *********** CCCS-asn-asn
+ 1 -9.21745E-01 -4.50877E-01
+ 2 -1.26524E-01 -3.04363E-01
+ 3 8.91806E-02 -6.87808E-02
+ 4 3.45027E-03 4.84865E-02
+4 0 *********** CCCS-asn-glu
+ 1 -9.20190E-01 5.35560E-02
+ 2 -2.79315E-01 1.17997E-01
+ 3 -1.06749E-01 -1.38302E-01
+ 4 4.73823E-02 2.11619E-02
+4 0 *********** CCCS-asn-asp
+ 1 -1.00292E+00 -5.61433E-01
+ 2 -2.15450E-01 -2.73663E-01
+ 3 1.43746E-01 -4.62991E-02
+ 4 -2.84376E-03 2.89608E-02
+4 0 *********** CCCS-asn-his
+ 1 -9.46800E-01 -4.06137E-01
+ 2 -2.58896E-02 -2.06499E-01
+ 3 1.62179E-01 -1.74252E-01
+ 4 -5.68963E-02 -5.58782E-03
+4 0 *********** CCCS-asn-arg
+ 1 -6.34581E-01 2.06273E-01
+ 2 -1.47943E-01 3.52432E-01
+ 3 -7.07501E-02 -8.73140E-02
+ 4 -7.27691E-03 1.39072E-02
+4 0 *********** CCCS-asn-lys
+ 1 -5.18691E-01 2.52763E-01
+ 2 -2.70015E-01 3.87332E-01
+ 3 1.24213E-02 -9.85008E-02
+ 4 -1.38280E-04 -9.05424E-04
+4 0 *********** CCCS-asn-pro
+ 1 -1.35260E+00 -5.40866E-01
+ 2 -4.23502E-01 7.57498E-02
+ 3 -9.66377E-03 -3.95838E-01
+ 4 -1.07416E-01 1.33385E-01
+4 0 *********** CCCS-glu-cys
+ 1 -9.26658E-01 -5.25130E-01
+ 2 -1.46141E-02 -8.43380E-02
+ 3 1.18348E-01 -1.11715E-01
+ 4 -2.52483E-02 5.22072E-02
+4 0 *********** CCCS-glu-met
+ 1 -6.70146E-01 -2.45277E-02
+ 2 -2.20947E-01 5.40152E-02
+ 3 5.24231E-02 -7.59906E-02
+ 4 -3.45329E-03 4.10627E-02
+4 0 *********** CCCS-glu-phe
+ 1 -7.46132E-01 1.54575E-02
+ 2 -1.12917E-01 2.21803E-01
+ 3 -8.16859E-02 -5.39614E-02
+ 4 5.01778E-02 4.34568E-02
+4 0 *********** CCCS-glu-ile
+ 1 -8.39765E-01 -6.34876E-02
+ 2 -2.92138E-01 4.98946E-02
+ 3 5.66111E-02 -1.30373E-01
+ 4 -2.67769E-02 3.74880E-02
+4 0 *********** CCCS-glu-leu
+ 1 -5.78575E-01 2.02103E-01
+ 2 -3.98231E-01 2.12278E-01
+ 3 1.49364E-02 -5.94025E-02
+ 4 -1.26158E-02 4.46635E-02
+4 0 *********** CCCS-glu-val
+ 1 -7.49311E-01 -7.45102E-03
+ 2 -3.44907E-01 9.25320E-02
+ 3 6.20556E-02 -1.08748E-01
+ 4 -1.58245E-02 4.46948E-02
+4 0 *********** CCCS-glu-trp
+ 1 -7.88016E-01 4.08201E-02
+ 2 -1.22548E-01 1.35274E-01
+ 3 -5.01657E-02 -7.13558E-02
+ 4 4.18897E-02 4.10282E-02
+4 0 *********** CCCS-glu-tyr
+ 1 -7.36009E-01 1.70572E-02
+ 2 -9.74425E-02 2.10864E-01
+ 3 -8.25035E-02 -5.34527E-02
+ 4 5.51966E-02 4.71361E-02
+4 0 *********** CCCS-glu-ala
+ 1 -5.03992E-01 -2.97856E-02
+ 2 -4.18076E-01 -2.36919E-01
+ 3 7.80568E-02 -7.41743E-03
+ 4 -3.12610E-02 -3.56243E-02
+4 0 *********** CCCS-glu-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-glu-thr
- 1 -7.21241E-01 2.93041E-01
- 2 4.22480E-01 2.75123E-01
- 3 -1.58471E-01 6.54361E-02
- 4 1.20432E-02 1.04930E-01
- 5 -1.74487E-01 1.65512E-02
- 6 -6.12906E-03 -6.50591E-02
-6 0 *********** CCCS-glu-ser
- 1 -7.96094E-01 2.61733E-02
- 2 -2.55872E-01 8.87296E-01
- 3 -1.97595E-01 -1.07366E-01
- 4 -2.41049E-01 9.81757E-02
- 5 3.03423E-02 -1.01531E-01
- 6 -1.05699E-01 -5.02121E-01
-6 0 *********** CCCS-glu-gln
- 1 -5.50017E-01 2.96221E-01
- 2 8.62141E-02 3.54391E-01
- 3 -1.59793E-01 1.20104E-02
- 4 -4.13417E-02 7.45607E-02
- 5 -1.25927E-01 -6.95700E-03
- 6 -2.55146E-02 -1.17098E-01
-6 0 *********** CCCS-glu-asn
- 1 -6.09527E-01 5.05370E-02
- 2 -3.94989E-01 4.05200E-01
- 3 -2.23811E-01 -1.29032E-01
- 4 -1.18679E-01 6.37159E-02
- 5 -1.07685E-02 -7.52060E-02
- 6 -7.51705E-02 -3.02381E-01
-6 0 *********** CCCS-glu-glu
- 1 -5.70372E-01 3.61149E-01
- 2 1.78779E-01 3.57460E-01
- 3 -1.59046E-01 4.52333E-02
- 4 -2.83182E-02 8.62852E-02
- 5 -1.19881E-01 6.03565E-04
- 6 -2.52658E-02 -9.67984E-02
-6 0 *********** CCCS-glu-asp
- 1 -6.78440E-01 -1.23587E-01
- 2 -3.18349E-01 4.98469E-01
- 3 -1.81267E-01 -2.37933E-04
- 4 -1.07773E-01 4.92910E-02
- 5 -8.05626E-02 -5.58527E-02
- 6 -5.97200E-02 -2.69735E-01
-6 0 *********** CCCS-glu-his
- 1 -5.61071E-01 2.29906E-01
- 2 -3.20855E-01 3.49371E-01
- 3 -3.09949E-01 -3.10144E-02
- 4 -3.18311E-02 1.79957E-02
- 5 -1.28616E-01 -3.38856E-02
- 6 -1.55391E-02 -1.38973E-01
-6 0 *********** CCCS-glu-arg
- 1 -4.17167E-01 3.73858E-01
- 2 2.26484E-01 8.44185E-02
- 3 -1.76010E-02 -3.85900E-02
- 4 -4.34399E-02 8.99905E-02
- 5 -2.37963E-02 -3.70675E-02
- 6 -3.63097E-02 -7.94303E-02
-6 0 *********** CCCS-glu-lys
- 1 -4.47727E-01 3.74205E-01
- 2 3.01625E-01 3.89187E-02
- 3 -3.71745E-02 -3.56318E-03
- 4 5.61010E-03 6.64647E-02
- 5 -6.05905E-02 -2.38101E-02
- 6 -7.99529E-03 -2.17338E-02
-6 0 *********** CCCS-glu-pro
- 1 7.79796E-01 2.98627E-01
- 2 -9.38815E-01 -3.78320E-01
- 3 -6.13159E-01 -7.45476E-01
- 4 -2.01332E-01 3.83505E-01
- 5 2.53644E-01 1.08493E-01
- 6 -1.68969E-01 -3.72029E-01
-6 0 *********** CCCS-asp-cys
- 1 -9.97031E-01 6.99023E-01
- 2 -1.26321E-01 2.57632E-01
- 3 -1.91182E-01 -2.36356E-02
- 4 -6.62200E-02 7.61185E-02
- 5 -1.53450E-01 -2.99479E-02
- 6 -1.83912E-02 -6.66655E-02
-6 0 *********** CCCS-asp-met
- 1 -5.49775E-01 6.55826E-01
- 2 1.18803E-01 7.13744E-02
- 3 -6.92404E-02 -1.54224E-02
- 4 4.08586E-03 1.07368E-01
- 5 -1.36154E-01 -2.14907E-02
- 6 5.70187E-04 -1.86158E-02
-6 0 *********** CCCS-asp-phe
- 1 -4.40009E-01 8.34433E-01
- 2 1.22408E-02 1.22408E-02
- 3 -3.01591E-02 -1.55765E-01
- 4 -1.03417E-02 8.83168E-02
- 5 -5.70103E-02 -3.00169E-02
- 6 -3.52175E-02 -2.88786E-02
-6 0 *********** CCCS-asp-ile
- 1 -5.90845E-01 8.52911E-01
- 2 1.08821E-01 -1.12148E-02
- 3 -2.10850E-02 4.10654E-02
- 4 2.23100E-02 1.57328E-01
- 5 -1.92537E-01 -4.25249E-02
- 6 3.74685E-02 2.14973E-02
-6 0 *********** CCCS-asp-leu
- 1 -4.04890E-01 6.84546E-01
- 2 2.76599E-01 -5.59060E-02
- 3 1.21962E-01 -6.29690E-02
- 4 -2.15471E-02 1.22683E-01
- 5 1.51119E-02 -6.30277E-02
- 6 -1.02194E-02 -3.84813E-02
-6 0 *********** CCCS-asp-val
- 1 -5.28959E-01 7.91975E-01
- 2 1.34050E-01 -6.57810E-02
- 3 1.70532E-02 3.28594E-02
- 4 -2.96533E-02 1.52338E-01
- 5 -1.28133E-01 -5.16307E-02
- 6 1.04984E-02 1.72839E-02
-6 0 *********** CCCS-asp-trp
- 1 -4.09982E-01 7.87692E-01
- 2 2.98843E-02 8.73770E-02
- 3 -6.82174E-02 -1.11088E-01
- 4 -3.77378E-03 8.44168E-02
- 5 -7.68584E-02 -2.35420E-02
- 6 -2.61672E-02 -2.81123E-02
-6 0 *********** CCCS-asp-tyr
- 1 -4.18556E-01 8.03896E-01
- 2 -2.05075E-02 5.15386E-02
- 3 -9.20229E-03 -1.93185E-01
- 4 -5.94545E-02 1.11660E-01
- 5 5.98079E-04 -4.38009E-02
- 6 -6.96195E-02 -8.90867E-02
-6 0 *********** CCCS-asp-ala
- 1 -6.98016E-01 2.92305E-01
- 2 3.01054E-01 3.44519E-01
- 3 -2.03807E-02 5.42119E-02
- 4 -1.69511E-01 1.79480E-01
- 5 4.78578E-02 -2.45370E-02
- 6 -1.27324E-01 -1.79644E-01
-6 0 *********** CCCS-asp-gly
+4 0 *********** CCCS-glu-thr
+ 1 -8.04543E-01 -6.20769E-02
+ 2 -2.72922E-01 -5.06136E-02
+ 3 5.50426E-02 -8.02036E-02
+ 4 -2.90912E-02 1.44716E-02
+4 0 *********** CCCS-glu-ser
+ 1 -1.10702E+00 -9.22384E-01
+ 2 1.12736E-01 8.19736E-03
+ 3 1.30474E-01 -1.88277E-01
+ 4 -3.04892E-02 2.35917E-02
+4 0 *********** CCCS-glu-gln
+ 1 -8.28918E-01 -1.37209E-01
+ 2 -1.06707E-01 -9.58291E-02
+ 3 -4.04594E-02 -9.53937E-02
+ 4 -3.91334E-03 3.89483E-02
+4 0 *********** CCCS-glu-asn
+ 1 -8.85321E-01 -6.34665E-01
+ 2 1.27028E-01 -1.28080E-01
+ 3 4.17177E-02 -8.32055E-02
+ 4 2.28902E-02 5.16544E-02
+4 0 *********** CCCS-glu-glu
+ 1 -9.23757E-01 -9.51260E-02
+ 2 -1.38889E-01 -4.10626E-02
+ 3 -4.33032E-02 -1.12057E-01
+ 4 7.27614E-04 2.53686E-02
+4 0 *********** CCCS-glu-asp
+ 1 -9.77706E-01 -7.38687E-01
+ 2 9.78649E-02 -9.31284E-02
+ 3 5.92724E-02 -7.92006E-02
+ 4 3.02832E-02 3.85875E-02
+4 0 *********** CCCS-glu-his
+ 1 -8.93583E-01 -6.06150E-01
+ 2 1.48877E-01 -4.86929E-02
+ 3 1.28527E-01 -1.05344E-01
+ 4 1.04248E-02 -9.87261E-05
+4 0 *********** CCCS-glu-arg
+ 1 -6.37452E-01 1.14969E-01
+ 2 -2.00239E-01 1.56626E-01
+ 3 -1.47293E-02 -7.20167E-02
+ 4 -6.09780E-03 2.15053E-02
+4 0 *********** CCCS-glu-lys
+ 1 -5.43918E-01 1.75298E-01
+ 2 -3.01529E-01 1.44322E-01
+ 3 4.75835E-02 -4.73502E-02
+ 4 -4.03201E-04 2.48047E-02
+4 0 *********** CCCS-glu-pro
+ 1 -1.67644E+00 -7.35341E-01
+ 2 2.37419E-01 1.70243E-01
+ 3 -1.04694E-01 -4.62205E-01
+ 4 -6.66424E-02 1.21892E-01
+4 0 *********** CCCS-asp-cys
+ 1 -1.03238E+00 -2.69353E-01
+ 2 -1.16102E-01 -1.92723E-01
+ 3 2.01706E-01 -1.68112E-01
+ 4 -5.06421E-02 1.21374E-01
+4 0 *********** CCCS-asp-met
+ 1 -6.63656E-01 1.16359E-01
+ 2 -2.65698E-01 1.09534E-01
+ 3 2.43880E-02 -1.33974E-01
+ 4 3.02189E-02 4.72081E-02
+4 0 *********** CCCS-asp-phe
+ 1 -7.28477E-01 1.52816E-01
+ 2 -8.33367E-02 2.72364E-01
+ 3 -1.44641E-01 -3.77114E-02
+ 4 8.48424E-02 1.22855E-02
+4 0 *********** CCCS-asp-ile
+ 1 -8.27894E-01 1.62544E-01
+ 2 -3.95099E-01 1.22719E-01
+ 3 5.87906E-03 -2.42851E-01
+ 4 3.67157E-02 5.84739E-02
+4 0 *********** CCCS-asp-leu
+ 1 -4.99550E-01 3.71081E-01
+ 2 -4.24432E-01 3.79671E-01
+ 3 -7.57202E-02 -9.18426E-02
+ 4 -2.69963E-03 1.11169E-02
+4 0 *********** CCCS-asp-val
+ 1 -7.27116E-01 1.90071E-01
+ 2 -4.23302E-01 1.91954E-01
+ 3 4.45001E-03 -2.05201E-01
+ 4 3.69698E-02 4.86853E-02
+4 0 *********** CCCS-asp-trp
+ 1 -7.63719E-01 1.93795E-01
+ 2 -1.35580E-01 1.80915E-01
+ 3 -1.04279E-01 -8.15742E-02
+ 4 8.03391E-02 1.55771E-02
+4 0 *********** CCCS-asp-tyr
+ 1 -7.21039E-01 1.50123E-01
+ 2 -6.83138E-02 2.55494E-01
+ 3 -1.41767E-01 -3.74128E-02
+ 4 9.22455E-02 1.67042E-02
+4 0 *********** CCCS-asp-ala
+ 1 -5.09884E-01 1.39071E-01
+ 2 -5.82229E-01 -1.54482E-01
+ 3 9.77774E-02 -1.06883E-01
+ 4 -2.92733E-03 -2.38612E-02
+4 0 *********** CCCS-asp-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-asp-thr
- 1 -8.38573E-01 6.13571E-01
- 2 3.69770E-01 1.07496E-01
- 3 -6.45620E-02 1.08295E-01
- 4 -5.86976E-02 1.21760E-01
- 5 -1.23664E-01 8.22144E-04
- 6 -2.83985E-02 5.10016E-02
-6 0 *********** CCCS-asp-ser
- 1 -1.48959E+00 8.64154E-01
- 2 -2.15943E-01 5.36815E-01
- 3 -2.46468E-01 -5.46087E-02
- 4 -1.22284E-01 2.46075E-02
- 5 -1.13558E-01 -3.72872E-02
- 6 -2.09380E-02 -1.19012E-01
-6 0 *********** CCCS-asp-gln
- 1 -6.56019E-01 6.52627E-01
- 2 5.79576E-03 2.86406E-01
- 3 -1.59419E-01 -3.00292E-02
- 4 -1.00441E-04 8.48135E-02
- 5 -1.57816E-01 -4.13425E-04
- 6 -1.16900E-02 -6.65338E-02
-6 0 *********** CCCS-asp-asn
- 1 -1.03975E+00 3.71734E-01
- 2 -2.89858E-01 3.14263E-01
- 3 -2.64437E-01 -9.13576E-02
- 4 -6.19805E-02 2.72515E-02
- 5 -1.06475E-01 -4.19360E-02
- 6 -1.93552E-02 -1.44348E-01
-6 0 *********** CCCS-asp-glu
- 1 -6.48369E-01 8.13660E-01
- 2 2.82459E-02 2.64689E-01
- 3 -1.19550E-01 -7.04718E-03
- 4 -3.36693E-03 1.11845E-01
- 5 -1.44559E-01 -3.58371E-03
- 6 -1.24614E-02 -3.46108E-02
-6 0 *********** CCCS-asp-asp
- 1 -1.29753E+00 2.65459E-02
- 2 -3.06469E-02 4.83209E-01
- 3 -2.33713E-01 2.04404E-02
- 4 -7.72705E-02 4.09645E-02
- 5 -1.58877E-01 -1.70410E-02
- 6 -2.10641E-02 -1.88636E-01
-6 0 *********** CCCS-asp-his
- 1 -9.65353E-01 7.47449E-01
- 2 -3.68693E-01 1.89461E-01
- 3 -2.53524E-01 -5.36286E-02
- 4 -4.34655E-02 5.60329E-02
- 5 -1.22341E-01 -4.53601E-02
- 6 -2.21752E-02 -4.11459E-02
-6 0 *********** CCCS-asp-arg
- 1 -3.85607E-01 6.23253E-01
- 2 1.14950E-01 5.46028E-02
- 3 2.17237E-02 -8.67396E-02
- 4 -4.15619E-02 1.20730E-01
- 5 -3.45807E-02 -4.66637E-02
- 6 -3.39816E-02 -8.10344E-02
-6 0 *********** CCCS-asp-lys
- 1 -4.21597E-01 6.05804E-01
- 2 2.10311E-01 -8.25029E-03
- 3 2.02289E-03 -3.46247E-02
- 4 1.31257E-02 9.51840E-02
- 5 -8.64350E-02 -3.84507E-02
- 6 7.18128E-03 -8.27121E-03
-6 0 *********** CCCS-asp-pro
- 1 2.26796E+00 6.23124E-01
- 2 -3.82677E-01 4.07630E-01
- 3 -8.18844E-01 -1.95232E-01
- 4 -5.05059E-01 4.13256E-01
- 5 2.75484E-01 -1.12268E-01
- 6 -7.84791E-02 -4.98608E-01
-6 0 *********** CCCS-his-cys
- 1 -8.63888E-01 6.76378E-01
- 2 -4.48144E-02 3.37429E-01
- 3 -2.10632E-01 2.30033E-03
- 4 -6.76010E-02 8.56385E-02
- 5 -1.51094E-01 -1.27568E-02
- 6 -3.19859E-02 -5.75892E-02
-6 0 *********** CCCS-his-met
- 1 -4.58613E-01 6.58648E-01
- 2 1.19148E-01 5.19708E-02
- 3 -6.44825E-02 -4.52051E-02
- 4 2.45626E-02 9.73142E-02
- 5 -1.23557E-01 -1.92512E-02
- 6 2.23192E-03 -1.10593E-02
-6 0 *********** CCCS-his-phe
- 1 -3.21031E-01 8.10404E-01
- 2 7.09563E-03 3.62991E-03
- 3 -5.24106E-02 -1.67958E-01
- 4 -2.47272E-02 7.35316E-02
- 5 -5.45630E-02 -3.72492E-02
- 6 -3.95690E-02 -3.04668E-02
-6 0 *********** CCCS-his-ile
- 1 -4.72358E-01 8.30524E-01
- 2 1.04724E-01 -1.35500E-02
- 3 -1.26273E-02 -9.34127E-03
- 4 6.51524E-02 1.35821E-01
- 5 -1.71130E-01 -3.57772E-02
- 6 4.36683E-02 6.58656E-03
-6 0 *********** CCCS-his-leu
- 1 -3.05106E-01 6.92156E-01
- 2 2.30653E-01 -1.28555E-01
- 3 1.21764E-01 -1.27078E-01
- 4 -6.44528E-03 1.08273E-01
- 5 -4.07436E-03 -7.19991E-02
- 6 -6.57272E-03 -4.08188E-02
-6 0 *********** CCCS-his-val
- 1 -4.18899E-01 7.85425E-01
- 2 1.03479E-01 -8.69921E-02
- 3 2.98356E-02 -2.24746E-02
- 4 1.54446E-02 1.42092E-01
- 5 -1.23853E-01 -5.13223E-02
- 6 2.31611E-02 3.44775E-03
-6 0 *********** CCCS-his-trp
- 1 -3.09869E-01 7.66338E-01
- 2 4.66758E-02 6.87273E-02
- 3 -8.61790E-02 -1.14845E-01
- 4 4.88486E-06 6.95167E-02
- 5 -8.52984E-02 -2.57814E-02
- 6 -2.24417E-02 -2.26035E-02
-6 0 *********** CCCS-his-tyr
- 1 -3.04282E-01 7.79295E-01
- 2 -2.07532E-02 4.57225E-02
- 3 -3.45587E-02 -2.01736E-01
- 4 -7.34067E-02 9.74022E-02
- 5 1.86468E-03 -5.05100E-02
- 6 -7.36737E-02 -9.41744E-02
-6 0 *********** CCCS-his-ala
- 1 -6.54579E-01 3.31854E-01
- 2 3.21740E-01 2.61530E-01
- 3 4.41461E-02 1.61607E-02
- 4 -1.47027E-01 1.75176E-01
- 5 8.30415E-02 -3.88945E-02
- 6 -1.10139E-01 -1.76884E-01
-6 0 *********** CCCS-his-gly
+4 0 *********** CCCS-asp-thr
+ 1 -7.99522E-01 1.54752E-01
+ 2 -3.92486E-01 1.11183E-03
+ 3 3.69199E-02 -1.83457E-01
+ 4 1.94077E-02 4.26303E-02
+4 0 *********** CCCS-asp-ser
+ 1 -1.25847E+00 -5.72311E-01
+ 2 2.41234E-02 -2.26461E-01
+ 3 2.55803E-01 -1.50901E-01
+ 4 -1.31135E-01 4.34524E-02
+4 0 *********** CCCS-asp-gln
+ 1 -8.42532E-01 4.91175E-02
+ 2 -1.97402E-01 -9.06725E-02
+ 3 -5.70772E-02 -1.42998E-01
+ 4 3.33244E-02 5.77983E-02
+4 0 *********** CCCS-asp-asn
+ 1 -1.01863E+00 -3.89292E-01
+ 2 5.89818E-02 -2.90567E-01
+ 3 1.22241E-01 -5.43853E-02
+ 4 -2.25735E-02 5.73810E-02
+4 0 *********** CCCS-asp-glu
+ 1 -9.17838E-01 1.24982E-01
+ 2 -2.43633E-01 -1.51522E-02
+ 3 -7.86179E-02 -1.80395E-01
+ 4 5.14711E-02 3.89096E-02
+4 0 *********** CCCS-asp-asp
+ 1 -1.12525E+00 -4.49970E-01
+ 2 2.53964E-02 -2.80697E-01
+ 3 1.65651E-01 -4.47945E-02
+ 4 -4.13656E-02 3.97728E-02
+4 0 *********** CCCS-asp-his
+ 1 -1.01495E+00 -3.76970E-01
+ 2 9.53177E-02 -2.00818E-01
+ 3 1.99753E-01 -1.02406E-01
+ 4 -4.17618E-02 4.63318E-03
+4 0 *********** CCCS-asp-arg
+ 1 -5.98206E-01 2.46214E-01
+ 2 -2.08682E-01 2.35004E-01
+ 3 -6.96239E-02 -8.82442E-02
+ 4 9.57137E-03 9.18069E-03
+4 0 *********** CCCS-asp-lys
+ 1 -4.95051E-01 2.98865E-01
+ 2 -3.21343E-01 2.49375E-01
+ 3 5.96272E-03 -8.47740E-02
+ 4 1.62699E-02 1.39569E-02
+4 0 *********** CCCS-asp-pro
+ 1 -1.81100E+00 -4.71232E-01
+ 2 -9.66277E-02 5.29642E-02
+ 3 1.70153E-01 -5.59350E-01
+ 4 -2.69981E-01 7.46327E-02
+4 0 *********** CCCS-his-cys
+ 1 -1.02326E+00 -5.38369E-01
+ 2 -1.32305E-01 -1.06083E-01
+ 3 1.17097E-01 -1.55663E-01
+ 4 -1.53219E-02 7.94010E-02
+4 0 *********** CCCS-his-met
+ 1 -7.26939E-01 -1.67835E-02
+ 2 -2.86022E-01 1.64223E-01
+ 3 6.04967E-02 -1.20698E-01
+ 4 1.14318E-02 4.16890E-02
+4 0 *********** CCCS-his-phe
+ 1 -8.46965E-01 -4.14579E-03
+ 2 -9.31771E-02 3.69304E-01
+ 3 -8.63275E-02 -6.75627E-02
+ 4 6.24307E-02 3.01409E-02
+4 0 *********** CCCS-his-ile
+ 1 -9.33521E-01 -9.30719E-02
+ 2 -4.16225E-01 2.26055E-01
+ 3 8.54612E-02 -1.90131E-01
+ 4 -3.00510E-02 3.43145E-02
+4 0 *********** CCCS-his-leu
+ 1 -6.13861E-01 2.03048E-01
+ 2 -4.71376E-01 4.34944E-01
+ 3 3.79951E-02 -1.01434E-01
+ 4 -6.25438E-03 2.82259E-02
+4 0 *********** CCCS-his-val
+ 1 -8.32966E-01 -4.00007E-02
+ 2 -4.62507E-01 2.88943E-01
+ 3 9.71576E-02 -1.66055E-01
+ 4 -1.14748E-02 2.99271E-02
+4 0 *********** CCCS-his-trp
+ 1 -8.72612E-01 4.41267E-02
+ 2 -1.32333E-01 2.60605E-01
+ 3 -6.21711E-02 -9.47167E-02
+ 4 5.89300E-02 3.00581E-02
+4 0 *********** CCCS-his-tyr
+ 1 -8.33077E-01 5.75024E-03
+ 2 -7.30970E-02 3.43517E-01
+ 3 -9.45024E-02 -6.46969E-02
+ 4 7.58655E-02 3.45212E-02
+4 0 *********** CCCS-his-ala
+ 1 -5.32467E-01 -8.03660E-03
+ 2 -6.24910E-01 -1.79773E-01
+ 3 1.14465E-01 -2.00410E-02
+ 4 -3.26442E-02 -2.13283E-02
+4 0 *********** CCCS-his-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-his-thr
- 1 -7.36235E-01 6.44239E-01
- 2 3.43857E-01 3.50071E-02
- 3 -9.35241E-03 4.74115E-02
- 4 -3.52879E-02 1.29880E-01
- 5 -8.52163E-02 -1.32760E-02
- 6 -2.13888E-02 2.27383E-02
-6 0 *********** CCCS-his-ser
- 1 -1.24130E+00 6.77893E-01
- 2 -6.33190E-04 7.29075E-01
- 3 -2.77197E-01 4.81052E-03
- 4 -1.77465E-01 7.80874E-02
- 5 -1.01869E-01 -3.80840E-02
- 6 -5.42853E-02 -2.16540E-01
-6 0 *********** CCCS-his-gln
- 1 -5.78786E-01 6.46575E-01
- 2 7.65898E-02 2.89929E-01
- 3 -1.61299E-01 -2.34924E-02
- 4 3.21698E-03 8.30028E-02
- 5 -1.44111E-01 -1.29599E-03
- 6 -1.25095E-02 -6.11898E-02
-6 0 *********** CCCS-his-asn
- 1 -9.35299E-01 3.91974E-01
- 2 -2.16197E-01 4.30637E-01
- 3 -2.89033E-01 -4.98258E-02
- 4 -8.33456E-02 4.49129E-02
- 5 -1.03857E-01 -4.67215E-02
- 6 -3.10077E-02 -1.75331E-01
-6 0 *********** CCCS-his-glu
- 1 -5.51318E-01 7.84378E-01
- 2 1.03068E-01 2.57869E-01
- 3 -1.10043E-01 -3.61504E-03
- 4 7.05936E-03 1.02703E-01
- 5 -1.24260E-01 -5.77171E-03
- 6 -9.19900E-03 -3.61945E-02
-6 0 *********** CCCS-his-asp
- 1 -1.20848E+00 1.03365E-01
- 2 2.79780E-02 5.35411E-01
- 3 -1.98611E-01 2.38889E-02
- 4 -1.01629E-01 8.66784E-02
- 5 -1.40819E-01 -4.72075E-03
- 6 -4.95627E-02 -2.14357E-01
-6 0 *********** CCCS-his-his
- 1 -8.11348E-01 6.88261E-01
- 2 -2.66593E-01 3.41290E-01
- 3 -3.05149E-01 2.11946E-02
- 4 -4.71392E-02 3.71800E-02
- 5 -1.41384E-01 -3.97507E-02
- 6 -2.02204E-02 -5.00102E-02
-6 0 *********** CCCS-his-arg
- 1 -2.97511E-01 6.19416E-01
- 2 1.01676E-01 2.40197E-02
- 3 1.74290E-02 -1.27742E-01
- 4 -3.05833E-02 1.08117E-01
- 5 -3.13679E-02 -4.50270E-02
- 6 -3.86925E-02 -7.84691E-02
-6 0 *********** CCCS-his-lys
- 1 -3.34450E-01 6.10628E-01
- 2 1.83074E-01 -5.44541E-02
- 3 6.67447E-03 -8.33039E-02
- 4 2.62249E-02 8.69086E-02
- 5 -9.03792E-02 -4.37099E-02
- 6 9.00931E-03 -1.70582E-02
-6 0 *********** CCCS-his-pro
- 1 1.63748E+00 2.22976E-01
- 2 -7.95758E-01 3.84620E-01
- 3 -9.28068E-01 -2.35653E-01
- 4 -4.29013E-01 3.18648E-01
- 5 3.54836E-01 -2.58958E-01
- 6 -8.05196E-02 -6.34735E-01
-6 0 *********** CCCS-arg-cys
- 1 -7.43848E-01 3.56902E-01
- 2 -8.24121E-02 4.44640E-01
- 3 -1.92858E-01 -4.09616E-02
- 4 -1.14124E-01 8.17029E-02
- 5 -8.58320E-02 -3.10637E-02
- 6 -5.56628E-02 -1.94905E-01
-6 0 *********** CCCS-arg-met
- 1 -5.14149E-01 4.85539E-01
- 2 1.94901E-01 1.02124E-01
- 3 -9.72442E-02 -5.12524E-03
- 4 5.67349E-03 8.23158E-02
- 5 -1.14161E-01 -1.44556E-02
- 6 -6.32732E-03 -3.11200E-02
-6 0 *********** CCCS-arg-phe
- 1 -4.37007E-01 6.06687E-01
- 2 1.53928E-01 4.63906E-03
- 3 -5.53030E-02 -8.77631E-02
- 4 -2.75897E-02 6.84397E-02
- 5 -6.00834E-02 -3.91405E-02
- 6 -2.62217E-02 -2.86815E-02
-6 0 *********** CCCS-arg-ile
- 1 -5.40411E-01 5.94259E-01
- 2 2.37999E-01 6.11202E-02
- 3 -1.07228E-01 5.86885E-02
- 4 5.02940E-02 8.13752E-02
- 5 -1.52822E-01 -6.44111E-03
- 6 2.04929E-02 4.45662E-02
-6 0 *********** CCCS-arg-leu
- 1 -4.21968E-01 5.39220E-01
- 2 3.48265E-01 -5.91477E-02
- 3 8.64748E-02 -5.23617E-02
- 4 -2.84161E-02 9.04500E-02
- 5 4.26981E-02 -5.29290E-02
- 6 -2.66049E-02 -2.32063E-02
-6 0 *********** CCCS-arg-val
- 1 -4.93698E-01 5.82116E-01
- 2 2.31842E-01 -1.57760E-02
- 3 -5.50727E-02 3.82381E-02
- 4 2.55357E-03 8.66277E-02
- 5 -9.48211E-02 -1.82950E-02
- 6 -3.51998E-03 4.60979E-02
-6 0 *********** CCCS-arg-trp
- 1 -4.10329E-01 5.74620E-01
- 2 1.48736E-01 7.62777E-02
- 3 -7.32776E-02 -6.34433E-02
- 4 -2.48010E-02 7.45463E-02
- 5 -6.72253E-02 -3.16917E-02
- 6 -2.52669E-02 -3.61220E-02
-6 0 *********** CCCS-arg-tyr
- 1 -4.13258E-01 5.83099E-01
- 2 1.14583E-01 3.84648E-02
- 3 -2.79029E-02 -1.23228E-01
- 4 -7.83538E-02 9.33207E-02
- 5 -4.35886E-03 -5.31921E-02
- 6 -5.94226E-02 -8.40323E-02
-6 0 *********** CCCS-arg-ala
- 1 -6.63524E-01 1.88102E-01
- 2 3.25433E-01 3.91884E-01
- 3 -2.77289E-02 4.00158E-03
- 4 -1.51767E-01 1.86905E-01
- 5 5.18823E-02 -3.15322E-02
- 6 -1.21096E-01 -2.53706E-01
-6 0 *********** CCCS-arg-gly
+4 0 *********** CCCS-his-thr
+ 1 -8.64016E-01 -5.70001E-02
+ 2 -4.14313E-01 5.71780E-02
+ 3 8.06841E-02 -1.11773E-01
+ 4 -2.45426E-02 1.30547E-02
+4 0 *********** CCCS-his-ser
+ 1 -1.18836E+00 -1.02027E+00
+ 2 -3.02832E-02 -1.63870E-01
+ 3 5.58247E-02 -1.64973E-01
+ 4 -1.26828E-02 3.25314E-02
+4 0 *********** CCCS-his-gln
+ 1 -8.82102E-01 -1.08999E-01
+ 2 -2.02016E-01 -7.18844E-02
+ 3 -7.27482E-02 -9.03949E-02
+ 4 2.13206E-02 5.10057E-02
+4 0 *********** CCCS-his-asn
+ 1 -9.72049E-01 -6.32958E-01
+ 2 5.23451E-02 -2.54655E-01
+ 3 -6.29446E-03 -7.50023E-02
+ 4 5.00907E-02 6.28422E-02
+4 0 *********** CCCS-his-glu
+ 1 -9.90556E-01 -7.69450E-02
+ 2 -2.40946E-01 3.04749E-02
+ 3 -6.43926E-02 -1.15558E-01
+ 4 1.53074E-02 2.73723E-02
+4 0 *********** CCCS-his-asp
+ 1 -1.06972E+00 -7.81364E-01
+ 2 -2.56562E-02 -2.26331E-01
+ 3 1.76280E-02 -3.63538E-02
+ 4 6.90605E-02 3.88689E-02
+4 0 *********** CCCS-his-his
+ 1 -1.01054E+00 -5.91953E-01
+ 2 1.27013E-01 -1.18587E-01
+ 3 1.17117E-01 -1.66741E-01
+ 4 -3.66351E-05 -6.02392E-03
+4 0 *********** CCCS-his-arg
+ 1 -6.86245E-01 1.26500E-01
+ 2 -2.16154E-01 2.92860E-01
+ 3 -1.88657E-02 -1.01456E-01
+ 4 -1.30023E-02 2.10232E-02
+4 0 *********** CCCS-his-lys
+ 1 -5.72868E-01 1.92764E-01
+ 2 -3.51296E-01 2.95718E-01
+ 3 6.67583E-02 -9.19463E-02
+ 4 5.95436E-03 1.30736E-02
+4 0 *********** CCCS-his-pro
+ 1 -1.81088E+00 -9.62880E-01
+ 2 -4.13290E-02 1.60325E-01
+ 3 -8.38799E-02 -3.98468E-01
+ 4 -1.26949E-01 6.56677E-02
+4 0 *********** CCCS-arg-cys
+ 1 -8.60019E-01 -4.02387E-01
+ 2 1.05000E-01 -3.71651E-02
+ 3 9.80543E-02 -9.57294E-02
+ 4 4.32441E-03 2.62327E-02
+4 0 *********** CCCS-arg-met
+ 1 -6.00045E-01 4.21913E-02
+ 2 -1.25392E-01 -3.14466E-02
+ 3 2.00347E-02 -5.65546E-02
+ 4 -1.25662E-02 4.42769E-02
+4 0 *********** CCCS-arg-phe
+ 1 -6.36634E-01 1.05698E-01
+ 2 -7.57701E-02 7.34952E-02
+ 3 -1.02513E-01 -3.72951E-02
+ 4 4.71804E-02 5.49243E-02
+4 0 *********** CCCS-arg-ile
+ 1 -7.57767E-01 3.93647E-02
+ 2 -1.35431E-01 -6.39326E-02
+ 3 1.45340E-02 -1.04796E-01
+ 4 -4.19706E-02 3.75250E-02
+4 0 *********** CCCS-arg-leu
+ 1 -5.26314E-01 2.56016E-01
+ 2 -2.72982E-01 3.62919E-02
+ 3 -2.01340E-02 -4.05168E-02
+ 4 -2.83457E-02 8.83989E-02
+4 0 *********** CCCS-arg-val
+ 1 -6.74523E-01 8.80890E-02
+ 2 -1.91585E-01 -3.94856E-02
+ 3 1.47026E-02 -8.64697E-02
+ 4 -3.60785E-02 6.07020E-02
+4 0 *********** CCCS-arg-trp
+ 1 -6.83791E-01 1.17301E-01
+ 2 -7.07344E-02 1.26248E-02
+ 3 -6.78684E-02 -4.78957E-02
+ 4 3.37021E-02 4.63795E-02
+4 0 *********** CCCS-arg-tyr
+ 1 -6.27300E-01 1.01348E-01
+ 2 -6.73912E-02 7.15082E-02
+ 3 -9.90035E-02 -3.67426E-02
+ 4 5.00826E-02 5.62243E-02
+4 0 *********** CCCS-arg-ala
+ 1 -4.82163E-01 8.76203E-03
+ 2 -2.13478E-01 -2.22078E-01
+ 3 5.66511E-02 -1.93504E-02
+ 4 -6.32620E-02 -7.50769E-02
+4 0 *********** CCCS-arg-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-arg-thr
- 1 -7.91994E-01 4.26935E-01
- 2 4.55623E-01 1.88859E-01
- 3 -1.52123E-01 5.50360E-02
- 4 3.11653E-02 1.10653E-01
- 5 -1.64886E-01 7.09059E-03
- 6 1.31920E-03 -2.85022E-02
-6 0 *********** CCCS-arg-ser
- 1 -9.59538E-01 1.82115E-01
- 2 -1.88992E-01 9.09706E-01
- 3 -1.80032E-01 -7.58705E-02
- 4 -2.34529E-01 6.24999E-02
- 5 -2.50220E-02 -6.07513E-02
- 6 -7.78592E-02 -4.04287E-01
-6 0 *********** CCCS-arg-gln
- 1 -5.90155E-01 4.33470E-01
- 2 1.01846E-01 3.31759E-01
- 3 -1.64869E-01 8.35225E-04
- 4 -2.25878E-02 7.47515E-02
- 5 -1.38890E-01 -3.62787E-03
- 6 -1.64462E-02 -9.31211E-02
-6 0 *********** CCCS-arg-asn
- 1 -7.43507E-01 1.54914E-01
- 2 -3.44468E-01 4.41200E-01
- 3 -2.36984E-01 -1.02789E-01
- 4 -1.08856E-01 5.65673E-02
- 5 -3.52958E-02 -6.42720E-02
- 6 -6.14817E-02 -2.64753E-01
-6 0 *********** CCCS-arg-glu
- 1 -5.95159E-01 5.22574E-01
- 2 1.78679E-01 3.18022E-01
- 3 -1.49200E-01 3.62404E-02
- 4 -1.39426E-02 8.49471E-02
- 5 -1.26580E-01 -4.83751E-04
- 6 -1.60877E-02 -6.47144E-02
-6 0 *********** CCCS-arg-asp
- 1 -8.74890E-01 -7.94188E-02
- 2 -2.30159E-01 5.51661E-01
- 3 -1.52693E-01 1.46517E-02
- 4 -1.10047E-01 5.21758E-02
- 5 -1.04372E-01 -3.47834E-02
- 6 -5.48866E-02 -2.65595E-01
-6 0 *********** CCCS-arg-his
- 1 -6.75499E-01 3.74803E-01
- 2 -2.91058E-01 3.70037E-01
- 3 -3.17633E-01 -8.96044E-03
- 4 -2.67837E-02 2.42223E-02
- 5 -1.30398E-01 -4.07534E-02
- 6 -1.86325E-02 -1.23619E-01
-6 0 *********** CCCS-arg-arg
- 1 -3.86964E-01 4.83295E-01
- 2 1.86480E-01 5.06476E-02
- 3 -6.73451E-04 -6.88351E-02
- 4 -4.32170E-02 9.86422E-02
- 5 -2.48919E-02 -4.35227E-02
- 6 -3.54270E-02 -7.29040E-02
-6 0 *********** CCCS-arg-lys
- 1 -4.20647E-01 4.80757E-01
- 2 2.65916E-01 -8.29208E-03
- 3 -1.85791E-02 -2.87947E-02
- 4 1.04131E-02 7.39742E-02
- 5 -6.86880E-02 -3.30806E-02
- 6 -6.07656E-04 -7.68201E-03
-6 0 *********** CCCS-arg-pro
- 1 9.74926E-01 5.19788E-01
- 2 -1.12683E+00 -1.72420E-01
- 3 -6.07089E-01 -8.60284E-01
- 4 -3.03973E-02 3.61044E-01
- 5 2.29955E-01 1.42384E-01
- 6 -2.56288E-01 -4.13432E-01
-6 0 *********** CCCS-lys-cys
- 1 -6.02230E-01 3.01995E-03
- 2 -2.98937E-02 5.17508E-01
- 3 -2.03256E-01 -5.36881E-02
- 4 -1.25282E-01 1.07190E-01
- 5 -6.94863E-02 -4.87774E-02
- 6 -6.81029E-02 -3.11690E-01
-6 0 *********** CCCS-lys-met
- 1 -5.22133E-01 2.39517E-01
- 2 2.59735E-01 1.16388E-01
- 3 -1.03895E-01 1.55879E-02
- 4 -6.12132E-04 7.09196E-02
- 5 -9.93577E-02 -1.05688E-02
- 6 -1.32654E-02 -5.42909E-02
-6 0 *********** CCCS-lys-phe
- 1 -4.95423E-01 3.45034E-01
- 2 2.49802E-01 -1.99069E-02
- 3 -4.15070E-02 -4.97516E-02
- 4 6.99357E-03 6.43529E-02
- 5 -9.28881E-02 -3.58657E-02
- 6 -7.42763E-04 -3.03637E-02
-6 0 *********** CCCS-lys-ile
- 1 -5.80792E-01 3.02283E-01
- 2 3.40828E-01 8.04031E-02
- 3 -1.53491E-01 8.43189E-02
- 4 4.63538E-02 4.42798E-02
- 5 -1.22754E-01 6.87427E-03
- 6 5.36731E-03 3.93173E-02
-6 0 *********** CCCS-lys-leu
- 1 -5.18717E-01 3.38804E-01
- 2 4.03546E-01 -6.67436E-02
- 3 9.16556E-02 -2.75418E-02
- 4 -3.87499E-02 8.93877E-02
- 5 4.88300E-02 -5.27869E-02
- 6 -3.02332E-02 -3.82412E-02
-6 0 *********** CCCS-lys-val
- 1 -5.44447E-01 3.13960E-01
- 2 3.27461E-01 1.46123E-02
- 3 -1.08087E-01 3.76512E-02
- 4 1.75716E-02 5.51607E-02
- 5 -8.01396E-02 -8.14887E-03
- 6 -8.78334E-03 1.82321E-02
-6 0 *********** CCCS-lys-trp
- 1 -4.65195E-01 3.09005E-01
- 2 2.25634E-01 5.40043E-02
- 3 -4.22891E-02 -3.71968E-02
- 4 -2.51112E-02 7.62059E-02
- 5 -6.11602E-02 -3.41142E-02
- 6 -2.07623E-02 -6.61822E-02
-6 0 *********** CCCS-lys-tyr
- 1 -4.65511E-01 3.29194E-01
- 2 2.07270E-01 3.25418E-03
- 3 -1.43564E-02 -7.59897E-02
- 4 -3.75895E-02 8.22471E-02
- 5 -4.83579E-02 -4.68575E-02
- 6 -2.70825E-02 -7.62800E-02
-6 0 *********** CCCS-lys-ala
- 1 -6.35930E-01 2.65608E-02
- 2 3.59546E-01 4.19819E-01
- 3 -8.84120E-02 2.55692E-02
- 4 -1.36443E-01 1.67481E-01
- 5 2.61108E-02 -2.38085E-02
- 6 -1.14583E-01 -2.56733E-01
-6 0 *********** CCCS-lys-gly
+4 0 *********** CCCS-arg-thr
+ 1 -7.41292E-01 1.79491E-02
+ 2 -1.14110E-01 -1.12274E-01
+ 3 2.09531E-02 -7.55140E-02
+ 4 -4.83518E-02 7.54308E-03
+4 0 *********** CCCS-arg-ser
+ 1 -1.08178E+00 -7.42395E-01
+ 2 2.36169E-01 1.54880E-01
+ 3 1.50230E-01 -1.86019E-01
+ 4 9.56662E-03 2.35742E-02
+4 0 *********** CCCS-arg-gln
+ 1 -7.63714E-01 -7.13278E-02
+ 2 -2.44959E-04 -1.02773E-01
+ 3 -2.83988E-02 -1.04252E-01
+ 4 -2.19452E-02 1.74852E-02
+4 0 *********** CCCS-arg-asn
+ 1 -8.44769E-01 -5.28407E-01
+ 2 1.94637E-01 -5.37759E-03
+ 3 6.93261E-02 -8.06881E-02
+ 4 4.46814E-02 4.06136E-02
+4 0 *********** CCCS-arg-glu
+ 1 -8.41862E-01 -1.32649E-02
+ 2 -1.56056E-02 -9.31546E-02
+ 3 -4.46320E-02 -1.08568E-01
+ 4 -1.99048E-02 8.70813E-03
+4 0 *********** CCCS-arg-asp
+ 1 -9.40580E-01 -5.94497E-01
+ 2 2.07471E-01 3.22621E-02
+ 3 7.42922E-02 -9.60415E-02
+ 4 5.22099E-02 3.43707E-02
+4 0 *********** CCCS-arg-his
+ 1 -8.12781E-01 -5.04109E-01
+ 2 1.78450E-01 1.32505E-02
+ 3 1.24235E-01 -5.28164E-02
+ 4 5.58702E-02 -9.35862E-03
+4 0 *********** CCCS-arg-arg
+ 1 -5.62345E-01 1.68355E-01
+ 2 -1.40534E-01 3.26282E-02
+ 3 -3.29850E-02 -4.82963E-02
+ 4 -6.41402E-03 3.43577E-02
+4 0 *********** CCCS-arg-lys
+ 1 -4.88191E-01 2.13645E-01
+ 2 -2.11967E-01 1.95535E-02
+ 3 1.16384E-02 -2.24441E-02
+ 4 -8.30089E-03 4.76400E-02
+4 0 *********** CCCS-arg-pro
+ 1 -1.55006E+00 -5.29384E-01
+ 2 4.43655E-01 1.48509E-01
+ 3 -1.04577E-01 -4.50797E-01
+ 4 -4.92987E-02 5.37380E-02
+4 0 *********** CCCS-lys-cys
+ 1 -8.57945E-01 -3.73314E-01
+ 2 1.14933E-01 -2.11371E-02
+ 3 8.36268E-02 -1.02175E-01
+ 4 1.06463E-02 2.13660E-02
+4 0 *********** CCCS-lys-met
+ 1 -5.89273E-01 6.23451E-02
+ 2 -1.04779E-01 -3.04958E-02
+ 3 1.01108E-02 -5.32766E-02
+ 4 -8.64647E-03 4.27045E-02
+4 0 *********** CCCS-lys-phe
+ 1 -6.22741E-01 1.30188E-01
+ 2 -5.64494E-02 5.91916E-02
+ 3 -1.03939E-01 -2.61833E-02
+ 4 5.14258E-02 5.05484E-02
+4 0 *********** CCCS-lys-ile
+ 1 -7.47930E-01 6.24236E-02
+ 2 -1.06004E-01 -6.04978E-02
+ 3 -5.71686E-04 -9.85706E-02
+ 4 -4.01148E-02 3.79531E-02
+4 0 *********** CCCS-lys-leu
+ 1 -5.15368E-01 2.67874E-01
+ 2 -2.39334E-01 3.11397E-02
+ 3 -2.58942E-02 -3.37048E-02
+ 4 -1.85408E-02 9.02257E-02
+4 0 *********** CCCS-lys-val
+ 1 -6.64281E-01 1.08775E-01
+ 2 -1.60067E-01 -3.75534E-02
+ 3 1.05717E-03 -8.08583E-02
+ 4 -3.17826E-02 6.07997E-02
+4 0 *********** CCCS-lys-trp
+ 1 -6.68837E-01 1.40711E-01
+ 2 -5.24290E-02 3.18997E-03
+ 3 -7.20523E-02 -3.78172E-02
+ 4 3.65417E-02 4.20063E-02
+4 0 *********** CCCS-lys-tyr
+ 1 -6.13091E-01 1.25364E-01
+ 2 -4.95788E-02 5.75949E-02
+ 3 -1.00299E-01 -2.58421E-02
+ 4 5.43450E-02 5.10909E-02
+4 0 *********** CCCS-lys-ala
+ 1 -4.77878E-01 1.91412E-02
+ 2 -1.91670E-01 -1.94850E-01
+ 3 4.91807E-02 -2.44385E-02
+ 4 -7.07822E-02 -6.64245E-02
+4 0 *********** CCCS-lys-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-lys-thr
- 1 -7.50639E-01 1.74206E-01
- 2 4.90877E-01 2.46492E-01
- 3 -1.67962E-01 5.84114E-02
- 4 4.15554E-02 1.06409E-01
- 5 -1.81180E-01 1.69280E-02
- 6 4.69751E-03 -8.42133E-02
-6 0 *********** CCCS-lys-ser
- 1 -7.66887E-01 -1.96177E-01
- 2 -1.02778E-01 9.24461E-01
- 3 -2.54621E-01 -5.57384E-02
- 4 -2.08148E-01 1.14874E-01
- 5 -1.09620E-02 -9.32760E-02
- 6 -1.03855E-01 -5.26694E-01
-6 0 *********** CCCS-lys-gln
- 1 -5.45066E-01 1.42537E-01
- 2 1.58834E-01 3.37685E-01
- 3 -1.51041E-01 4.17064E-02
- 4 -4.26816E-02 7.49185E-02
- 5 -1.21478E-01 -4.70664E-03
- 6 -2.75753E-02 -1.28892E-01
-6 0 *********** CCCS-lys-asn
- 1 -5.28592E-01 -1.30237E-01
- 2 -3.39344E-01 5.03292E-01
- 3 -2.42832E-01 -1.45713E-01
- 4 -1.27021E-01 7.00802E-02
- 5 -1.88622E-02 -6.96551E-02
- 6 -6.96779E-02 -3.71631E-01
-6 0 *********** CCCS-lys-glu
- 1 -5.86733E-01 1.98662E-01
- 2 2.55789E-01 3.13409E-01
- 3 -1.38397E-01 8.81366E-02
- 4 -4.08687E-02 6.57991E-02
- 5 -9.08640E-02 1.12822E-02
- 6 -3.58259E-02 -6.27429E-02
-6 0 *********** CCCS-lys-asp
- 1 -6.01818E-01 -2.41511E-01
- 2 -2.47820E-01 5.85543E-01
- 3 -2.34350E-01 -3.32414E-02
- 4 -1.05742E-01 5.49222E-02
- 5 -9.48059E-02 -4.46984E-02
- 6 -4.52813E-02 -3.30641E-01
-6 0 *********** CCCS-lys-his
- 1 -4.95835E-01 2.82517E-02
- 2 -2.29881E-01 4.26648E-01
- 3 -3.56636E-01 -2.62411E-02
- 4 -1.52709E-02 1.83840E-02
- 5 -1.52950E-01 -3.06618E-02
- 6 -2.78739E-03 -1.90989E-01
-6 0 *********** CCCS-lys-arg
- 1 -4.46965E-01 2.77001E-01
- 2 2.51039E-01 3.41170E-02
- 3 9.21583E-04 -3.41144E-02
- 4 -4.34806E-02 9.03882E-02
- 5 -2.72861E-02 -4.46405E-02
- 6 -2.88453E-02 -8.04451E-02
-6 0 *********** CCCS-lys-lys
- 1 -4.77369E-01 2.86128E-01
- 2 3.16700E-01 -1.04528E-02
- 3 -1.50073E-02 -6.34081E-03
- 4 -3.07878E-03 6.75630E-02
- 5 -5.21673E-02 -3.25405E-02
- 6 -8.05653E-03 -2.28501E-02
-6 0 *********** CCCS-lys-pro
- 1 7.81033E-01 3.86633E-01
- 2 -8.85961E-01 -1.97254E-01
- 3 -5.86614E-01 -4.32830E-01
- 4 -3.27302E-01 7.08707E-01
- 5 -4.36193E-02 3.08966E-01
- 6 -3.54830E-01 -3.11488E-01
-6 0 *********** CCCS-pro-cys
- 1 9.85489E-01 2.36991E-01
- 2 -3.54985E-03 2.93726E-03
- 3 -1.54961E-01 -2.06716E-01
- 4 -6.04452E-02 2.32695E-01
- 5 1.66816E-01 -5.35372E-02
- 6 -5.49626E-02 -2.62096E-01
-6 0 *********** CCCS-pro-met
- 1 5.54373E-01 -2.19283E-01
- 2 4.93476E-02 2.99992E-01
- 3 -5.81622E-02 3.90212E-02
- 4 7.84420E-02 8.76785E-02
- 5 1.71796E-02 -6.29924E-02
- 6 -3.01909E-02 -2.29831E-01
-6 0 *********** CCCS-pro-phe
- 1 5.83641E-01 -3.12690E-01
- 2 3.67635E-01 3.25859E-01
- 3 -6.02619E-02 -1.03419E-01
- 4 4.11098E-02 -1.76950E-02
- 5 -7.36235E-02 -5.01435E-02
- 6 -1.32399E-03 -2.42767E-01
-6 0 *********** CCCS-pro-ile
- 1 7.23878E-01 -3.13312E-01
- 2 1.59590E-01 2.90108E-01
- 3 -1.78930E-02 3.44547E-01
- 4 3.41762E-01 8.31147E-02
- 5 -2.02750E-01 -3.63193E-02
- 6 4.53851E-02 -6.84121E-02
-6 0 *********** CCCS-pro-leu
- 1 2.93568E-01 -5.44251E-01
- 2 9.03241E-02 7.06069E-01
- 3 3.11071E-02 1.66763E-01
- 4 1.42547E-01 -6.09245E-02
- 5 -1.50809E-01 3.46120E-02
- 6 7.52883E-02 -1.75628E-01
-6 0 *********** CCCS-pro-val
- 1 6.47938E-01 -3.76160E-01
- 2 1.32510E-01 4.84379E-01
- 3 4.78833E-02 2.61158E-01
- 4 9.24696E-02 2.34331E-01
- 5 4.00620E-02 -1.20910E-01
- 6 -1.12681E-01 -3.55874E-01
-6 0 *********** CCCS-pro-trp
- 1 5.39977E-01 -3.01300E-01
- 2 2.82541E-01 2.08083E-01
- 3 -1.56150E-01 -3.33156E-02
- 4 1.28191E-01 -4.32846E-02
- 5 -1.85930E-01 -8.52603E-03
- 6 6.65920E-02 -1.19828E-01
-6 0 *********** CCCS-pro-tyr
- 1 5.67567E-01 -3.09601E-01
- 2 3.68313E-01 2.91200E-01
- 3 -7.23925E-02 -1.27058E-01
- 4 4.00739E-02 -2.23247E-02
- 5 -6.15331E-02 -6.03706E-02
- 6 2.62971E-03 -2.43875E-01
-6 0 *********** CCCS-pro-ala
- 1 5.71181E-01 -2.05709E-01
- 2 -5.21818E-01 3.59463E-01
- 3 -2.25054E-01 3.44062E-01
- 4 5.92711E-02 3.13742E-01
- 5 -1.21830E-01 -9.66926E-02
- 6 -1.72966E-01 -2.78257E-01
-6 0 *********** CCCS-pro-gly
+4 0 *********** CCCS-lys-thr
+ 1 -7.32265E-01 3.88917E-02
+ 2 -8.93353E-02 -1.02472E-01
+ 3 8.47632E-03 -7.36822E-02
+ 4 -4.89634E-02 1.09405E-02
+4 0 *********** CCCS-lys-ser
+ 1 -1.09042E+00 -7.13201E-01
+ 2 2.37665E-01 1.82376E-01
+ 3 1.42143E-01 -2.00704E-01
+ 4 7.02171E-03 2.05770E-02
+4 0 *********** CCCS-lys-gln
+ 1 -7.55053E-01 -4.83876E-02
+ 2 1.35247E-02 -9.34263E-02
+ 3 -3.62364E-02 -9.91817E-02
+ 4 -2.13951E-02 1.67911E-02
+4 0 *********** CCCS-lys-asn
+ 1 -8.44846E-01 -5.00831E-01
+ 2 1.90252E-01 1.19835E-02
+ 3 6.41052E-02 -8.56566E-02
+ 4 4.98239E-02 3.25985E-02
+4 0 *********** CCCS-lys-glu
+ 1 -8.31436E-01 1.12945E-02
+ 2 3.97508E-03 -8.80877E-02
+ 3 -5.42010E-02 -1.00588E-01
+ 4 -2.13442E-02 8.60120E-03
+4 0 *********** CCCS-lys-asp
+ 1 -9.42319E-01 -5.64401E-01
+ 2 2.07072E-01 5.29345E-02
+ 3 6.84183E-02 -1.05422E-01
+ 4 5.47873E-02 2.86901E-02
+4 0 *********** CCCS-lys-his
+ 1 -8.09040E-01 -4.76061E-01
+ 2 1.72341E-01 2.31401E-02
+ 3 1.15193E-01 -5.76260E-02
+ 4 5.67028E-02 -1.78136E-02
+4 0 *********** CCCS-lys-arg
+ 1 -5.48948E-01 1.85786E-01
+ 2 -1.20092E-01 2.45507E-02
+ 3 -3.73639E-02 -4.06512E-02
+ 4 -3.63217E-03 3.57043E-02
+4 0 *********** CCCS-lys-lys
+ 1 -4.75770E-01 2.26095E-01
+ 2 -1.86851E-01 1.58762E-02
+ 3 5.05309E-03 -1.86031E-02
+ 4 -3.81038E-03 4.80344E-02
+4 0 *********** CCCS-lys-pro
+ 1 -1.58797E+00 -5.01675E-01
+ 2 4.92487E-01 2.05297E-01
+ 3 -1.27315E-01 -4.64023E-01
+ 4 -4.01578E-02 6.91176E-02
+4 0 *********** CCCS-pro-cys
+ 1 -1.17004E+00 -3.98677E-01
+ 2 -1.60362E-01 -1.93996E-01
+ 3 1.73518E-01 -8.37873E-02
+ 4 -5.92099E-02 1.18630E-01
+4 0 *********** CCCS-pro-met
+ 1 -7.48336E-01 6.07604E-02
+ 2 -2.78999E-01 1.90683E-01
+ 3 7.17836E-02 -1.43945E-01
+ 4 1.91651E-02 2.55350E-02
+4 0 *********** CCCS-pro-phe
+ 1 -8.80193E-01 6.47252E-02
+ 2 -4.88850E-02 4.12591E-01
+ 3 -7.20780E-02 -1.11166E-01
+ 4 2.58254E-02 1.63394E-02
+4 0 *********** CCCS-pro-ile
+ 1 -9.79710E-01 3.99701E-02
+ 2 -4.71326E-01 2.74523E-01
+ 3 1.27845E-01 -2.67378E-01
+ 4 2.82929E-02 2.00015E-02
+4 0 *********** CCCS-pro-leu
+ 1 -6.00811E-01 3.27666E-01
+ 2 -4.91996E-01 5.51639E-01
+ 3 3.84590E-03 -1.80629E-01
+ 4 -9.86790E-03 -7.49951E-02
+4 0 *********** CCCS-pro-val
+ 1 -8.68898E-01 7.17527E-02
+ 2 -5.01002E-01 3.63549E-01
+ 3 1.32046E-01 -2.50488E-01
+ 4 2.93732E-02 -1.61536E-02
+4 0 *********** CCCS-pro-trp
+ 1 -8.96501E-01 1.29992E-01
+ 2 -1.11580E-01 2.84068E-01
+ 3 -4.59362E-02 -1.25418E-01
+ 4 4.37184E-02 1.50829E-02
+4 0 *********** CCCS-pro-tyr
+ 1 -8.61402E-01 7.45852E-02
+ 2 -3.14205E-02 3.78266E-01
+ 3 -8.06996E-02 -9.94746E-02
+ 4 4.14958E-02 1.80331E-02
+4 0 *********** CCCS-pro-ala
+ 1 -5.62598E-01 1.11374E-01
+ 2 -7.45549E-01 -1.31464E-01
+ 3 1.61317E-01 -8.42793E-02
+ 4 8.72320E-02 2.91395E-02
+4 0 *********** CCCS-pro-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** CCCS-pro-thr
- 1 6.77401E-01 -1.01188E-01
- 2 -1.81642E-01 4.22454E-01
- 3 -4.19218E-01 3.96677E-01
- 4 3.91292E-01 1.98865E-01
- 5 -2.52456E-01 3.08293E-02
- 6 -4.27044E-03 -6.59051E-02
-6 0 *********** CCCS-pro-ser
- 1 1.53317E+00 5.10759E-01
- 2 -2.70759E-01 -2.48493E-01
- 3 -1.81702E-01 -4.68519E-01
- 4 -2.05150E-01 4.19572E-01
- 5 2.30890E-01 -2.40943E-02
- 6 -1.04744E-01 -3.62058E-01
-6 0 *********** CCCS-pro-gln
- 1 7.22871E-01 -6.27080E-02
- 2 -1.01971E-01 9.23786E-02
- 3 -1.24258E-01 -1.57409E-01
- 4 2.43517E-02 6.37344E-02
- 5 3.84116E-02 -8.32489E-02
- 6 -4.33634E-02 -2.31576E-01
-6 0 *********** CCCS-pro-asn
- 1 7.94779E-01 5.09708E-01
- 2 2.46870E-03 -2.00313E-01
- 3 -2.64321E-01 -3.75280E-01
- 4 -2.29648E-01 1.20667E-01
- 5 2.16590E-01 -5.28920E-02
- 6 -8.91820E-02 -1.62325E-01
-6 0 *********** CCCS-pro-glu
- 1 8.44383E-01 -1.95329E-01
- 2 -9.59194E-02 1.44007E-01
- 3 -5.28421E-02 -5.98437E-02
- 4 5.06929E-02 1.39596E-02
- 5 -1.13456E-02 -3.84390E-02
- 6 1.87859E-03 -1.51952E-01
-6 0 *********** CCCS-pro-asp
- 1 7.47317E-01 8.75282E-01
- 2 -4.56803E-01 -6.99672E-02
- 3 -3.78971E-01 -1.66435E-01
- 4 -2.98850E-01 3.74484E-01
- 5 1.67122E-01 6.92699E-03
- 6 -1.86486E-02 -1.56816E-01
-6 0 *********** CCCS-pro-his
- 1 1.08803E+00 2.83710E-01
- 2 2.30702E-01 -3.33208E-01
- 3 -1.42208E-01 -1.02947E-01
- 4 -1.28065E-01 1.61761E-01
- 5 1.14187E-01 -3.77072E-03
- 6 -6.54468E-03 -1.05903E-02
-6 0 *********** CCCS-pro-arg
- 1 3.76675E-01 -3.47703E-01
- 2 1.35347E-01 3.78398E-01
- 3 -3.97333E-02 -1.13018E-02
- 4 7.84527E-02 5.99127E-02
- 5 -1.27380E-02 -2.33781E-02
- 6 1.68766E-02 -2.51341E-01
-6 0 *********** CCCS-pro-lys
- 1 3.39222E-01 -3.63671E-01
- 2 9.82634E-02 4.51786E-01
- 3 -4.22663E-02 7.95077E-02
- 4 9.36551E-02 4.56777E-02
- 5 -7.88015E-02 -1.11361E-02
- 6 1.11646E-02 -2.12075E-01
-6 0 *********** CCCS-pro-pro
- 1 -2.27321E+01 -3.85657E+01
- 2 1.58666E+01 -2.88802E+01
- 3 1.67971E+01 -8.07390E-01
- 4 9.30424E-01 2.13176E-01
- 5 5.93499E+00 -9.47235E+00
- 6 7.74876E+00 -5.66348E+00
-6 0 *********** SCCS-cys-cys
- 1 -7.24207E-01 -1.97690E-01
- 2 4.25695E-01 1.80088E-01
- 3 -7.62180E-02 1.36323E-02
- 4 3.01988E-02 4.19477E-02
- 5 -6.48082E-02 -6.45251E-04
- 6 -3.37999E-03 -1.16879E-01
-6 0 *********** SCCS-cys-met
- 1 -4.74043E-01 2.34199E-02
- 2 1.69564E-01 -1.20052E-01
- 3 -2.81536E-02 -9.54968E-02
- 4 -3.95379E-02 4.44851E-02
- 5 -5.31490E-02 -4.84258E-02
- 6 -2.78679E-02 -7.84298E-02
-6 0 *********** SCCS-cys-phe
- 1 -4.28325E-01 7.11343E-02
- 2 5.98883E-02 -1.21511E-01
- 3 -4.03328E-02 -2.75259E-01
- 4 -1.37120E-01 7.50094E-02
- 5 -9.18229E-03 -5.88630E-02
- 6 -7.73522E-02 -1.86927E-01
-6 0 *********** SCCS-cys-ile
- 1 -4.83671E-01 -3.86853E-03
- 2 1.88503E-01 -9.66789E-02
- 3 -6.17656E-02 -4.35353E-02
- 4 -6.04741E-02 4.09216E-02
- 5 -2.02603E-02 -4.76066E-02
- 6 -4.95882E-02 -5.95856E-02
-6 0 *********** SCCS-cys-leu
- 1 -4.70839E-01 1.57622E-01
- 2 8.65584E-02 -2.90285E-01
- 3 1.67944E-02 -1.81989E-01
- 4 -3.86066E-02 6.78994E-02
- 5 -1.28352E-01 -7.91449E-02
- 6 -8.17046E-03 -7.97987E-02
-6 0 *********** SCCS-cys-val
- 1 -5.00810E-01 8.03782E-02
- 2 1.61448E-01 -2.02250E-01
- 3 -1.61346E-02 -8.88929E-02
- 4 -1.25880E-01 5.04734E-02
- 5 1.37057E-03 -5.72010E-02
- 6 -7.30767E-02 -4.87715E-02
-6 0 *********** SCCS-cys-trp
- 1 -4.52842E-01 9.34890E-03
- 2 1.53365E-01 -9.14273E-02
- 3 -9.37907E-02 -1.05503E-01
- 4 -1.32488E-02 2.65187E-02
- 5 -9.45935E-02 -3.75617E-02
- 6 -2.25340E-02 -7.13783E-02
-6 0 *********** SCCS-cys-tyr
- 1 -3.84907E-01 7.98579E-02
- 2 2.44854E-02 -1.41959E-01
- 3 -6.73799E-02 -2.31806E-01
- 4 -1.17880E-01 6.50487E-02
- 5 -2.62425E-02 -6.95007E-02
- 6 -8.04802E-02 -1.62863E-01
-6 0 *********** SCCS-cys-ala
- 1 -5.59066E-01 -2.41275E-02
- 2 3.19831E-01 -1.17360E-01
- 3 -4.96253E-02 8.56232E-02
- 4 6.39408E-02 5.22274E-02
- 5 -1.36277E-01 -1.12869E-02
- 6 7.09482E-03 3.07324E-02
-6 0 *********** SCCS-cys-gly
+4 0 *********** CCCS-pro-thr
+ 1 -9.07849E-01 7.76719E-02
+ 2 -4.72132E-01 8.11280E-02
+ 3 1.26137E-01 -1.61329E-01
+ 4 3.84860E-02 2.42118E-02
+4 0 *********** CCCS-pro-ser
+ 1 -1.61551E+00 -8.47812E-01
+ 2 3.57056E-02 -4.29341E-01
+ 3 -3.91253E-03 1.22740E-01
+ 4 -8.20854E-02 3.68427E-03
+4 0 *********** CCCS-pro-gln
+ 1 -9.33947E-01 6.75567E-04
+ 2 -2.41565E-01 -7.64516E-02
+ 3 -1.67072E-02 -6.96706E-02
+ 4 4.83193E-02 5.10288E-02
+4 0 *********** CCCS-pro-asn
+ 1 -1.18314E+00 -4.98674E-01
+ 2 7.15421E-02 -3.86403E-01
+ 3 -9.88056E-03 6.35419E-02
+ 4 -5.85735E-03 1.90402E-02
+4 0 *********** CCCS-pro-glu
+ 1 -1.04480E+00 5.79008E-02
+ 2 -2.91891E-01 3.08634E-02
+ 3 -5.16516E-03 -1.28810E-01
+ 4 5.90039E-02 3.42053E-02
+4 0 *********** CCCS-pro-asp
+ 1 -1.35548E+00 -6.24364E-01
+ 2 1.14171E-02 -3.92476E-01
+ 3 2.95114E-02 1.43079E-01
+ 4 -1.17147E-02 -1.66194E-02
+4 0 *********** CCCS-pro-his
+ 1 -1.20336E+00 -4.62056E-01
+ 2 1.70184E-01 -2.39155E-01
+ 3 6.15741E-02 -8.19429E-02
+ 4 -5.70485E-02 1.15489E-02
+4 0 *********** CCCS-pro-arg
+ 1 -6.89422E-01 2.07042E-01
+ 2 -1.98428E-01 3.20765E-01
+ 3 -2.68026E-02 -1.28322E-01
+ 4 -7.48013E-03 4.31463E-03
+4 0 *********** CCCS-pro-lys
+ 1 -5.65205E-01 2.73646E-01
+ 2 -3.36290E-01 3.45283E-01
+ 3 4.67419E-02 -1.36545E-01
+ 4 6.86319E-03 -1.94038E-02
+4 0 *********** CCCS-pro-pro
+ 1 -3.30913E+00 -7.17640E-01
+ 2 4.70082E-01 -4.72589E-02
+ 3 -3.03019E-01 -1.08208E-01
+ 4 1.72759E-01 1.84493E-01
+4 0 *********** SCCS-cys-cys
+ 1 8.67192E-01 -3.97420E-01
+ 2 -1.42331E-01 1.54790E-01
+ 3 1.17768E-01 -6.88353E-02
+ 4 1.16808E-02 -4.88455E-02
+4 0 *********** SCCS-cys-met
+ 1 4.26597E-01 -4.96269E-01
+ 2 1.68255E-01 2.05715E-01
+ 3 6.45820E-02 -5.78164E-02
+ 4 -3.30813E-02 -2.01771E-02
+4 0 *********** SCCS-cys-phe
+ 1 4.30309E-01 -5.81996E-01
+ 2 2.91210E-01 3.75351E-02
+ 3 -2.51574E-02 -4.52847E-02
+ 4 -4.59956E-02 2.64473E-02
+4 0 *********** SCCS-cys-ile
+ 1 5.92263E-01 -5.56017E-01
+ 2 1.96396E-01 2.73218E-01
+ 3 7.20998E-02 -8.12583E-02
+ 4 -9.05831E-03 -5.08715E-02
+4 0 *********** SCCS-cys-leu
+ 1 2.23589E-01 -5.45461E-01
+ 2 4.10204E-01 2.68121E-01
+ 3 5.34177E-02 -5.72668E-02
+ 4 -4.98470E-02 1.26762E-02
+4 0 *********** SCCS-cys-val
+ 1 4.91308E-01 -5.42737E-01
+ 2 2.59371E-01 3.06256E-01
+ 3 6.44313E-02 -7.06936E-02
+ 4 -3.66479E-02 -3.46126E-02
+4 0 *********** SCCS-cys-trp
+ 1 4.71912E-01 -6.01415E-01
+ 2 2.16418E-01 8.00790E-02
+ 3 -1.30446E-02 -5.24377E-02
+ 4 -4.99798E-02 3.07055E-03
+4 0 *********** SCCS-cys-tyr
+ 1 4.16234E-01 -5.77036E-01
+ 2 2.74265E-01 2.25244E-02
+ 3 -2.83527E-02 -4.49149E-02
+ 4 -4.88884E-02 2.31939E-02
+4 0 *********** SCCS-cys-ala
+ 1 3.34091E-01 -3.42304E-01
+ 2 8.50400E-03 5.26987E-01
+ 3 9.62156E-02 2.68970E-02
+ 4 2.14985E-02 -4.83972E-02
+4 0 *********** SCCS-cys-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-cys-thr
- 1 -5.46356E-01 -8.38215E-03
- 2 3.03493E-01 -8.73490E-02
- 3 -1.13922E-01 -4.59477E-02
- 4 -4.61134E-02 2.05623E-02
- 5 -2.94384E-02 -1.83005E-02
- 6 -3.54389E-02 -2.50395E-02
-6 0 *********** SCCS-cys-ser
- 1 -1.08249E+00 -2.83620E-01
- 2 6.95394E-01 3.27434E-01
- 3 -7.45357E-02 -1.11475E-01
- 4 -1.53819E-02 1.40160E-01
- 5 5.63049E-02 -4.18293E-02
- 6 -6.10263E-02 -3.46170E-01
-6 0 *********** SCCS-cys-gln
- 1 -5.65683E-01 -7.10455E-02
- 2 2.78181E-01 1.96852E-02
- 3 -5.38471E-02 -7.97023E-02
- 4 -1.26169E-02 4.81418E-02
- 5 -3.89308E-02 -3.32238E-02
- 6 -2.65113E-02 -1.18029E-01
-6 0 *********** SCCS-cys-asn
- 1 -5.92254E-01 -4.39328E-01
- 2 2.07485E-01 5.05557E-01
- 3 -2.87719E-01 1.43563E-03
- 4 -4.98893E-03 6.43461E-02
- 5 -1.53681E-01 -7.23762E-03
- 6 1.92644E-03 -2.97587E-01
-6 0 *********** SCCS-cys-glu
- 1 -6.05273E-01 -7.85402E-03
- 2 3.00492E-01 -7.43861E-02
- 3 -3.57721E-02 -7.93173E-02
- 4 -2.53242E-02 4.32863E-02
- 5 -4.30476E-02 -4.32000E-02
- 6 -2.45313E-02 -8.18778E-02
-6 0 *********** SCCS-cys-asp
- 1 -6.26683E-01 -4.16653E-01
- 2 3.27329E-01 4.96692E-01
- 3 -2.45528E-01 1.29877E-02
- 4 -4.66358E-02 2.27608E-01
- 5 -1.05259E-01 -5.78596E-03
- 6 -8.03820E-02 -3.93242E-01
-6 0 *********** SCCS-cys-his
- 1 -5.06525E-01 -4.01016E-01
- 2 1.29621E-01 4.30216E-01
- 3 -2.29501E-01 3.28900E-03
- 4 -5.83972E-02 6.74478E-02
- 5 -9.96947E-02 -2.87512E-02
- 6 -3.50809E-02 -2.79903E-01
-6 0 *********** SCCS-cys-arg
- 1 -4.14680E-01 8.32294E-02
- 2 8.56744E-02 -1.59767E-01
- 3 -8.35930E-02 -1.36921E-01
- 4 -4.67937E-02 4.28600E-02
- 5 -9.73125E-02 -4.90759E-02
- 6 -2.17442E-02 -7.50254E-02
-6 0 *********** SCCS-cys-lys
- 1 -4.27105E-01 8.52206E-02
- 2 1.02759E-01 -2.06069E-01
- 3 -3.22450E-02 -1.25608E-01
- 4 -4.00735E-02 5.98395E-02
- 5 -1.03990E-01 -7.29824E-02
- 6 -1.34882E-02 -8.35192E-02
-6 0 *********** SCCS-cys-pro
- 1 4.94639E-01 8.68176E-01
- 2 -7.16665E-03 1.60535E+00
- 3 -8.74111E-01 9.04209E-01
- 4 1.54482E-01 3.53449E-01
- 5 -1.13140E+00 2.97469E-01
- 6 -9.00044E-02 6.74301E-02
-6 0 *********** SCCS-met-cys
- 1 -4.40648E-01 -8.23157E-01
- 2 3.57550E-01 2.17083E-02
- 3 -1.16876E-01 -3.07260E-02
- 4 7.79965E-02 -3.34766E-03
- 5 -9.44428E-02 -1.35223E-02
- 6 1.72642E-02 -1.79171E-01
-6 0 *********** SCCS-met-met
- 1 -3.84052E-01 -5.00461E-01
- 2 1.00422E-01 -2.82195E-01
- 3 -1.35104E-01 -1.01063E-01
- 4 -6.73487E-02 2.86005E-02
- 5 -7.07540E-02 -5.40435E-02
- 6 -4.53469E-02 -1.06904E-01
-6 0 *********** SCCS-met-phe
- 1 -4.06116E-01 -5.17834E-01
- 2 -8.47552E-02 -2.48583E-01
- 3 -1.22849E-01 -2.60508E-01
- 4 -1.60273E-01 1.07448E-01
- 5 1.25019E-02 -9.99241E-02
- 6 -1.13720E-01 -2.93365E-01
-6 0 *********** SCCS-met-ile
- 1 -3.76689E-01 -5.96643E-01
- 2 1.47021E-01 -2.59806E-01
- 3 -1.98193E-01 -1.24639E-01
- 4 -1.02936E-01 2.18792E-02
- 5 -6.21120E-02 -5.03216E-02
- 6 -7.49733E-02 -1.35329E-01
-6 0 *********** SCCS-met-leu
- 1 -4.15837E-01 -4.06127E-01
- 2 3.15224E-02 -5.31861E-01
- 3 -1.98245E-01 -1.24374E-01
- 4 -2.91813E-02 4.20351E-02
- 5 -2.27827E-01 -6.47354E-02
- 6 3.44053E-02 -4.38596E-02
-6 0 *********** SCCS-met-val
- 1 -4.40391E-01 -4.93969E-01
- 2 8.73701E-02 -3.48664E-01
- 3 -1.20920E-01 -1.98210E-01
- 4 -1.98372E-01 9.33014E-02
- 5 -8.60502E-03 -1.06582E-01
- 6 -9.57452E-02 -2.21304E-01
-6 0 *********** SCCS-met-trp
- 1 -3.88577E-01 -5.54384E-01
- 2 3.92167E-02 -2.02794E-01
- 3 -1.38330E-01 -1.14018E-01
- 4 -4.55223E-02 1.62095E-02
- 5 -1.18694E-01 -4.75900E-02
- 6 -2.66408E-02 -1.40127E-01
-6 0 *********** SCCS-met-tyr
- 1 -4.11894E-01 -5.19276E-01
- 2 -1.03740E-01 -2.04605E-01
- 3 -1.29785E-01 -2.61280E-01
- 4 -1.73822E-01 1.24499E-01
- 5 2.00019E-02 -1.09933E-01
- 6 -1.22511E-01 -3.28760E-01
-6 0 *********** SCCS-met-ala
- 1 -3.44888E-01 -4.08453E-01
- 2 4.89948E-01 -3.68112E-01
- 3 -2.63780E-01 1.74467E-02
- 4 8.99364E-02 -2.11717E-02
- 5 -2.84007E-01 -2.48871E-02
- 6 5.45323E-02 5.73032E-02
-6 0 *********** SCCS-met-gly
+4 0 *********** SCCS-cys-thr
+ 1 5.34364E-01 -5.20718E-01
+ 2 3.54739E-02 3.67105E-01
+ 3 7.05045E-02 -2.83985E-02
+ 4 3.20212E-02 -5.62046E-02
+4 0 *********** SCCS-cys-ser
+ 1 1.08515E+00 -2.62182E-01
+ 2 -3.11425E-01 1.33473E-01
+ 3 9.24029E-02 -1.02550E-01
+ 4 1.03816E-01 -6.31816E-02
+4 0 *********** SCCS-cys-gln
+ 1 5.66258E-01 -5.39383E-01
+ 2 -2.13376E-02 2.06540E-01
+ 3 -3.79359E-02 -7.98189E-02
+ 4 -4.15080E-02 -4.31848E-02
+4 0 *********** SCCS-cys-asn
+ 1 9.22612E-01 -2.63118E-01
+ 2 -2.41432E-01 6.53561E-02
+ 3 2.40540E-02 -3.36319E-02
+ 4 2.68269E-02 9.52648E-03
+4 0 *********** SCCS-cys-glu
+ 1 5.96137E-01 -6.10543E-01
+ 2 3.53487E-02 2.27789E-01
+ 3 -1.67001E-02 -8.81237E-02
+ 4 -4.14545E-02 -3.65214E-02
+4 0 *********** SCCS-cys-asp
+ 1 1.01795E+00 -2.60910E-01
+ 2 -1.97330E-01 1.05405E-01
+ 3 4.50490E-02 -4.55831E-03
+ 4 2.89560E-02 2.39952E-02
+4 0 *********** SCCS-cys-his
+ 1 8.90355E-01 -2.91398E-01
+ 2 -1.50779E-01 3.51671E-03
+ 3 1.32057E-01 -3.87007E-02
+ 4 7.11463E-02 3.32134E-02
+4 0 *********** SCCS-cys-arg
+ 1 3.05165E-01 -5.50396E-01
+ 2 2.65996E-01 1.34162E-01
+ 3 1.63970E-02 -6.55688E-02
+ 4 -1.63990E-02 -6.42449E-03
+4 0 *********** SCCS-cys-lys
+ 1 2.10559E-01 -5.08694E-01
+ 2 2.92920E-01 2.11781E-01
+ 3 7.45051E-02 -4.33034E-02
+ 4 -2.31646E-02 5.82520E-03
+4 0 *********** SCCS-cys-pro
+ 1 1.19886E+00 -1.94173E-01
+ 2 -2.59796E-01 1.46925E-01
+ 3 2.03461E-01 -1.47537E-01
+ 4 1.86013E-01 1.95403E-02
+4 0 *********** SCCS-met-cys
+ 1 6.77842E-01 -1.22147E-01
+ 2 3.01442E-02 -8.28383E-02
+ 3 2.53218E-02 -2.89579E-02
+ 4 2.32855E-02 -1.30591E-02
+4 0 *********** SCCS-met-met
+ 1 3.93839E-01 -2.65359E-01
+ 2 -2.98951E-02 -7.82974E-04
+ 3 -6.71525E-03 2.70051E-03
+ 4 -4.19784E-03 -6.76316E-03
+4 0 *********** SCCS-met-phe
+ 1 3.47890E-01 -3.31177E-01
+ 2 -1.40210E-02 1.34047E-02
+ 3 -6.20698E-03 9.61245E-03
+ 4 -7.78514E-03 2.24073E-03
+4 0 *********** SCCS-met-ile
+ 1 5.15140E-01 -2.68442E-01
+ 2 -3.13116E-02 -3.35772E-02
+ 3 -1.11768E-02 -9.13918E-03
+ 4 6.51943E-03 -1.56479E-02
+4 0 *********** SCCS-met-leu
+ 1 2.97078E-01 -3.52096E-01
+ 2 -4.44542E-02 4.92139E-02
+ 3 1.62294E-03 8.51857E-03
+ 4 -1.90766E-02 -1.67157E-03
+4 0 *********** SCCS-met-val
+ 1 4.44647E-01 -3.10886E-01
+ 2 -5.17011E-02 -3.76384E-03
+ 3 -2.22666E-02 5.59111E-04
+ 4 -1.13944E-02 -1.24191E-02
+4 0 *********** SCCS-met-trp
+ 1 4.26445E-01 -3.01683E-01
+ 2 -1.23552E-02 -1.83657E-02
+ 3 -1.26295E-02 -8.84208E-03
+ 4 -4.38497E-03 -6.94827E-03
+4 0 *********** SCCS-met-tyr
+ 1 3.35211E-01 -3.27458E-01
+ 2 -8.79237E-03 1.12200E-02
+ 3 -5.55911E-03 9.19752E-03
+ 4 -8.69196E-03 2.27149E-03
+4 0 *********** SCCS-met-ala
+ 1 3.47583E-01 -1.40409E-01
+ 2 -7.66753E-02 2.14822E-02
+ 3 -1.83836E-03 1.15904E-02
+ 4 7.81264E-03 -1.16514E-02
+4 0 *********** SCCS-met-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-met-thr
- 1 -3.28921E-01 -5.15095E-01
- 2 3.02493E-01 -2.95297E-01
- 3 -1.96756E-01 -1.85399E-01
- 4 -5.69217E-02 -6.18868E-02
- 5 -8.22300E-02 -6.33454E-02
- 6 -5.41360E-02 -9.55429E-02
-6 0 *********** SCCS-met-ser
- 1 -8.09969E-01 -1.05312E+00
- 2 6.15521E-01 2.76109E-01
- 3 -2.35733E-02 -2.13770E-01
- 4 4.13078E-02 8.23782E-02
- 5 3.80815E-02 -6.09184E-02
- 6 -2.38641E-02 -4.84823E-01
-6 0 *********** SCCS-met-gln
- 1 -4.46380E-01 -6.08000E-01
- 2 2.46235E-01 -1.08523E-01
- 3 -1.06118E-01 -1.18742E-01
- 4 -3.01210E-02 5.15472E-03
- 5 -6.29406E-02 -2.41803E-02
- 6 -3.16821E-02 -1.53858E-01
-6 0 *********** SCCS-met-asn
- 1 -1.64359E-01 -8.16222E-01
- 2 3.04739E-01 3.79406E-01
- 3 -2.19302E-01 -2.04363E-02
- 4 1.28449E-01 2.00877E-02
- 5 -1.63667E-01 -2.19955E-02
- 6 5.76872E-02 -3.07047E-01
-6 0 *********** SCCS-met-glu
- 1 -5.17605E-01 -6.19269E-01
- 2 2.62896E-01 -2.00396E-01
- 3 -1.34743E-01 -1.44076E-01
- 4 -7.10931E-02 -1.47989E-02
- 5 -7.87967E-02 -1.72038E-02
- 6 -3.32032E-02 -1.16833E-01
-6 0 *********** SCCS-met-asp
- 1 -6.66296E-02 -6.86112E-01
- 2 5.20732E-01 3.34009E-01
- 3 -1.07526E-01 -9.95903E-02
- 4 -2.40285E-02 1.73802E-01
- 5 -2.58508E-02 3.07996E-02
- 6 -1.92849E-02 -3.65318E-01
-6 0 *********** SCCS-met-his
- 1 -1.42119E-01 -9.00856E-01
- 2 1.26164E-01 3.57382E-01
- 3 -1.04021E-01 -3.53492E-02
- 4 4.59235E-03 5.78228E-03
- 5 -5.40533E-02 -5.38778E-02
- 6 -7.20234E-03 -3.37805E-01
-6 0 *********** SCCS-met-arg
- 1 -4.22845E-01 -3.95052E-01
- 2 1.20234E-03 -2.85629E-01
- 3 -1.56866E-01 -1.12423E-01
- 4 -7.67059E-02 3.65577E-02
- 5 -8.52288E-02 -6.47195E-02
- 6 -2.38007E-02 -1.08320E-01
-6 0 *********** SCCS-met-lys
- 1 -3.73678E-01 -4.04217E-01
- 2 3.05616E-02 -3.87928E-01
- 3 -1.72906E-01 -9.61810E-02
- 4 -6.25771E-02 4.14123E-02
- 5 -1.44767E-01 -5.24466E-02
- 6 -6.89935E-03 -6.03887E-02
-6 0 *********** SCCS-met-pro
- 1 -7.94019E-01 4.73402E-01
- 2 -4.35125E-01 2.09023E+00
- 3 -5.15019E-01 4.09889E-01
- 4 -1.09590E-01 -3.32620E-01
- 5 -8.07757E-01 4.82847E-01
- 6 1.06730E-01 2.17904E-01
-6 0 *********** SCCS-phe-cys
- 1 -4.77720E-01 -1.19189E+00
- 2 3.11049E-01 -1.32231E-01
- 3 -1.62767E-01 -1.17713E-01
- 4 -9.10289E-02 1.10568E-01
- 5 7.25370E-02 -1.11469E-01
- 6 -1.25959E-01 -3.76241E-01
-6 0 *********** SCCS-phe-met
- 1 -4.22573E-01 -6.83855E-01
- 2 -5.47756E-02 -2.97389E-01
- 3 -1.71183E-01 -7.05160E-02
- 4 -7.23906E-02 6.75718E-02
- 5 -4.80395E-02 -6.30420E-02
- 6 -5.52961E-02 -1.50666E-01
-6 0 *********** SCCS-phe-phe
- 1 -4.74883E-01 -7.56680E-01
- 2 -2.47371E-01 -2.61330E-01
- 3 -1.41954E-01 -7.87211E-02
- 4 7.56003E-03 5.40319E-02
- 5 -1.27301E-01 -7.02696E-02
- 6 -5.45888E-02 -1.77698E-01
-6 0 *********** SCCS-phe-ile
- 1 -4.72150E-01 -8.60317E-01
- 2 -1.16033E-01 -3.55364E-01
- 3 -2.43430E-01 -5.53555E-02
- 4 -1.49856E-01 1.38837E-01
- 5 3.21433E-02 -4.26979E-02
- 6 -7.49414E-02 -1.86628E-01
-6 0 *********** SCCS-phe-leu
- 1 -4.13339E-01 -5.63590E-01
- 2 -3.13046E-01 -5.65163E-01
- 3 -1.49460E-01 -5.38196E-02
- 4 -7.52139E-02 1.23860E-01
- 5 -1.11313E-01 -7.94510E-02
- 6 -1.98189E-02 -8.39389E-02
-6 0 *********** SCCS-phe-val
- 1 -4.84643E-01 -7.05534E-01
- 2 -2.40577E-02 -5.07636E-01
- 3 -3.95941E-01 -5.36785E-03
- 4 -4.30410E-03 5.48310E-02
- 5 -2.01757E-01 9.60730E-03
- 6 3.83940E-02 8.12650E-03
-6 0 *********** SCCS-phe-trp
- 1 -5.23208E-01 -7.69790E-01
- 2 -1.65588E-01 -1.60544E-01
- 3 -1.27467E-01 -9.48473E-02
- 4 -4.74938E-02 4.74844E-02
- 5 -8.51877E-02 -7.00972E-02
- 6 -5.28242E-02 -2.15356E-01
-6 0 *********** SCCS-phe-tyr
- 1 -4.73067E-01 -7.53833E-01
- 2 -2.37343E-01 -2.20817E-01
- 3 -1.40242E-01 -1.20171E-01
- 4 -4.79766E-02 6.35251E-02
- 5 -7.93764E-02 -7.81519E-02
- 6 -6.02793E-02 -2.24916E-01
-6 0 *********** SCCS-phe-ala
- 1 -1.16121E-01 -6.23136E-01
- 2 1.71710E-01 -5.45137E-01
- 3 -2.45494E-01 -4.47752E-02
- 4 -1.14405E-01 4.81874E-02
- 5 -2.21757E-02 -4.14914E-03
- 6 -4.54070E-02 1.41510E-02
-6 0 *********** SCCS-phe-gly
+4 0 *********** SCCS-met-thr
+ 1 5.08255E-01 -2.52922E-01
+ 2 -4.50710E-02 -2.69872E-02
+ 3 -1.48451E-02 -1.40399E-02
+ 4 4.39034E-03 -1.89867E-02
+4 0 *********** SCCS-met-ser
+ 1 8.01001E-01 -4.95313E-02
+ 2 9.72315E-02 -9.47434E-02
+ 3 6.93740E-02 -4.24953E-02
+ 4 5.18705E-02 -1.18763E-02
+4 0 *********** SCCS-met-gln
+ 1 5.01149E-01 -2.69021E-01
+ 2 -2.49395E-02 -4.99726E-02
+ 3 -1.56056E-02 -2.12705E-02
+ 4 -7.22647E-03 -1.64211E-02
+4 0 *********** SCCS-met-asn
+ 1 6.73569E-01 1.52099E-02
+ 2 7.13503E-02 -6.74262E-02
+ 3 3.90477E-02 -1.39945E-02
+ 4 2.52162E-02 3.59290E-03
+4 0 *********** SCCS-met-glu
+ 1 5.25931E-01 -3.25302E-01
+ 2 -3.29368E-02 -5.37539E-02
+ 3 -1.90438E-02 -2.32002E-02
+ 4 -9.20583E-03 -1.93397E-02
+4 0 *********** SCCS-met-asp
+ 1 7.14424E-01 1.99294E-02
+ 2 9.11002E-02 -6.60162E-02
+ 3 4.52199E-02 -1.28745E-02
+ 4 3.06190E-02 5.71878E-03
+4 0 *********** SCCS-met-his
+ 1 6.48672E-01 3.96519E-02
+ 2 9.07352E-02 -5.93949E-02
+ 3 3.52519E-02 1.88478E-03
+ 4 2.44209E-02 1.78793E-02
+4 0 *********** SCCS-met-arg
+ 1 3.07539E-01 -3.33991E-01
+ 2 -2.38728E-02 1.77764E-02
+ 3 -2.32994E-03 6.48369E-03
+ 4 -6.48227E-03 -1.82843E-03
+4 0 *********** SCCS-met-lys
+ 1 2.74243E-01 -3.17318E-01
+ 2 -3.79758E-02 3.83663E-02
+ 3 3.07022E-03 1.29550E-02
+ 4 -1.17798E-02 -9.80492E-04
+4 0 *********** SCCS-met-pro
+ 1 8.53443E-01 6.32717E-04
+ 2 1.54723E-01 -9.89519E-02
+ 3 1.33621E-01 -3.85601E-02
+ 4 1.13225E-01 2.03647E-02
+4 0 *********** SCCS-phe-cys
+ 1 6.17912E-01 4.08053E-02
+ 2 8.03708E-02 -1.78292E-01
+ 3 -4.69639E-02 -4.27914E-02
+ 4 -1.76101E-02 4.81626E-02
+4 0 *********** SCCS-phe-met
+ 1 4.00919E-01 -1.33434E-01
+ 2 -8.47991E-02 -1.11941E-01
+ 3 -6.60895E-02 3.54194E-02
+ 4 -2.32957E-02 -4.88659E-03
+4 0 *********** SCCS-phe-phe
+ 1 3.70355E-01 -2.13805E-01
+ 2 -1.33203E-01 -6.44535E-02
+ 3 -2.38403E-02 5.51917E-02
+ 4 -4.77525E-02 3.66054E-02
+4 0 *********** SCCS-phe-ile
+ 1 4.83527E-01 -1.13031E-01
+ 2 -5.50937E-02 -1.64700E-01
+ 3 -1.21456E-01 4.46557E-03
+ 4 -4.47308E-03 -2.79464E-02
+4 0 *********** SCCS-phe-leu
+ 1 3.30503E-01 -2.51950E-01
+ 2 -1.85358E-01 -7.54903E-02
+ 3 -8.18024E-03 9.43208E-02
+ 4 -4.27669E-02 -1.78173E-02
+4 0 *********** SCCS-phe-val
+ 1 4.61384E-01 -1.89805E-01
+ 2 -1.19066E-01 -1.67802E-01
+ 3 -9.11416E-02 5.00339E-02
+ 4 -2.91337E-02 -4.54035E-02
+4 0 *********** SCCS-phe-trp
+ 1 4.21300E-01 -1.36878E-01
+ 2 -6.85968E-02 -7.57692E-02
+ 3 -7.08461E-02 5.92965E-02
+ 4 -2.27440E-02 -1.34410E-03
+4 0 *********** SCCS-phe-tyr
+ 1 3.56633E-01 -2.11338E-01
+ 2 -1.21404E-01 -4.96290E-02
+ 3 -2.81706E-02 4.66030E-02
+ 4 -3.18445E-02 3.78772E-02
+4 0 *********** SCCS-phe-ala
+ 1 3.36910E-01 -6.87199E-02
+ 2 -8.07815E-02 -1.92038E-01
+ 3 -1.00267E-01 3.43753E-02
+ 4 5.43754E-02 -3.09258E-02
+4 0 *********** SCCS-phe-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-phe-thr
- 1 -3.97080E-01 -6.86184E-01
- 2 1.81891E-01 -5.52630E-01
- 3 -3.83171E-01 -1.08834E-01
- 4 -6.45258E-03 -5.66500E-02
- 5 -2.73262E-01 -1.94285E-02
- 6 1.35721E-02 3.65688E-02
-6 0 *********** SCCS-phe-ser
- 1 -6.23725E-01 -1.58496E+00
- 2 6.98394E-01 -1.07993E-01
- 3 -1.95352E-01 -9.47647E-02
- 4 1.90337E-02 -2.63999E-02
- 5 -1.09746E-01 -9.80081E-02
- 6 3.15061E-02 -3.43566E-01
-6 0 *********** SCCS-phe-gln
- 1 -4.98920E-01 -8.30863E-01
- 2 6.35253E-02 -1.61680E-01
- 3 -8.81663E-02 -1.20723E-01
- 4 -1.26542E-02 1.38600E-02
- 5 -2.27741E-02 -9.09493E-02
- 6 -5.06644E-02 -2.34981E-01
-6 0 *********** SCCS-phe-asn
- 1 4.97500E-02 -1.09296E+00
- 2 2.36387E-01 2.72975E-01
- 3 -2.96556E-02 -1.56050E-01
- 4 -4.47871E-02 3.28199E-02
- 5 -3.03638E-02 -6.34265E-02
- 6 -5.35005E-02 -4.25285E-01
-6 0 *********** SCCS-phe-glu
- 1 -5.96593E-01 -8.89185E-01
- 2 2.08404E-02 -2.69112E-01
- 3 -1.15377E-01 -1.13473E-01
- 4 -4.24806E-02 1.99648E-02
- 5 -2.88386E-02 -8.00633E-02
- 6 -5.70793E-02 -2.07468E-01
-6 0 *********** SCCS-phe-asp
- 1 1.85776E-01 -9.15278E-01
- 2 5.52340E-01 1.33137E-01
- 3 -4.57073E-02 -2.46623E-01
- 4 -2.56981E-02 1.00929E-01
- 5 6.63062E-02 -8.89455E-02
- 6 -7.99884E-02 -4.58913E-01
-6 0 *********** SCCS-phe-his
- 1 -7.96019E-02 -1.31776E+00
- 2 5.05884E-02 1.85026E-01
- 3 -1.38229E-01 -4.13929E-02
- 4 -3.28063E-02 3.43186E-02
- 5 -9.41024E-02 -5.25009E-02
- 6 -5.40753E-02 -3.73950E-01
-6 0 *********** SCCS-phe-arg
- 1 -4.74505E-01 -5.40996E-01
- 2 -1.39061E-01 -2.91173E-01
- 3 -1.99127E-01 -4.48236E-02
- 4 1.33532E-02 3.44437E-02
- 5 -1.42821E-01 -4.41293E-02
- 6 -1.80308E-02 -8.02370E-02
-6 0 *********** SCCS-phe-lys
- 1 -4.21541E-01 -5.20319E-01
- 2 -1.63285E-01 -3.82184E-01
- 3 -1.58106E-01 -9.39399E-02
- 4 -1.08373E-01 1.26981E-01
- 5 -2.23846E-02 -7.85287E-02
- 6 -5.73183E-02 -1.56062E-01
-6 0 *********** SCCS-phe-pro
- 1 -2.15318E+00 -2.86309E-02
- 2 -3.82770E-01 3.15290E+00
- 3 4.87991E-01 3.49936E-01
- 4 -7.52288E-01 -2.73225E-01
- 5 -6.95114E-01 4.22811E-01
- 6 2.04513E-02 -3.22089E-01
-6 0 *********** SCCS-ile-cys
- 1 -3.66362E-01 -4.37426E-01
- 2 5.37390E-01 2.32705E-02
- 3 -1.02074E-01 -9.60693E-02
- 4 5.71536E-02 -1.07946E-02
- 5 -5.55116E-02 -2.29703E-02
- 6 -3.24376E-03 -1.40591E-01
-6 0 *********** SCCS-ile-met
- 1 -3.39501E-01 -2.68760E-01
- 2 1.01068E-01 -2.90853E-01
- 3 -1.24444E-01 -1.24910E-01
- 4 -5.88246E-02 2.94906E-02
- 5 -1.04711E-01 -5.10055E-02
- 6 -2.92503E-02 -7.37541E-02
-6 0 *********** SCCS-ile-phe
- 1 -3.21982E-01 -2.59359E-01
- 2 -1.05171E-01 -3.01575E-01
- 3 -1.76793E-01 -1.60188E-01
- 4 -3.55047E-02 5.60801E-02
- 5 -1.23136E-01 -3.46645E-02
- 6 -2.66364E-02 -9.10756E-02
-6 0 *********** SCCS-ile-ile
- 1 -3.81223E-01 -3.03959E-01
- 2 1.29061E-01 -2.93015E-01
- 3 -1.17933E-01 -8.36166E-02
- 4 -7.92858E-02 2.23016E-02
- 5 -1.33755E-01 -5.44812E-02
- 6 -3.00558E-02 -6.06688E-02
-6 0 *********** SCCS-ile-leu
- 1 -3.71001E-01 -9.55315E-02
- 2 -2.04756E-01 -4.16649E-01
- 3 -6.86485E-02 -2.98134E-01
- 4 -1.73242E-01 1.66972E-01
- 5 -9.39167E-03 -8.75446E-02
- 6 -9.43430E-02 -2.09801E-01
-6 0 *********** SCCS-ile-val
- 1 -3.54833E-01 -2.39039E-01
- 2 4.45292E-02 -4.47911E-01
- 3 -1.30083E-01 -1.30964E-01
- 4 -3.10455E-02 5.29424E-02
- 5 -2.01350E-01 -2.40452E-02
- 6 6.12922E-03 -1.53781E-02
-6 0 *********** SCCS-ile-trp
- 1 -3.65137E-01 -3.14193E-01
- 2 9.27431E-02 -2.27563E-01
- 3 -1.27390E-01 -1.08860E-01
- 4 -5.24822E-02 3.74832E-02
- 5 -9.38747E-02 -4.82880E-02
- 6 -2.91066E-02 -1.00919E-01
-6 0 *********** SCCS-ile-tyr
- 1 -3.29671E-01 -2.61676E-01
- 2 -1.08412E-01 -2.83339E-01
- 3 -1.97386E-01 -1.50580E-01
- 4 2.71883E-03 5.42508E-02
- 5 -1.39960E-01 -2.37462E-02
- 6 -2.27496E-02 -8.50223E-02
-6 0 *********** SCCS-ile-ala
- 1 -4.78099E-01 -2.24743E-01
- 2 2.44743E-01 -2.07951E-01
- 3 2.35548E-02 -2.81703E-01
- 4 -2.51433E-01 1.48554E-01
- 5 1.38615E-01 -1.28752E-01
- 6 -1.44817E-01 -3.15873E-01
-6 0 *********** SCCS-ile-gly
+4 0 *********** SCCS-phe-thr
+ 1 4.82970E-01 -9.10727E-02
+ 2 -5.58281E-02 -1.57682E-01
+ 3 -1.33460E-01 -6.99795E-03
+ 4 2.48573E-02 -7.19938E-02
+4 0 *********** SCCS-phe-ser
+ 1 7.61323E-01 9.17861E-02
+ 2 2.06520E-01 -1.99787E-01
+ 3 4.29281E-02 -8.32855E-02
+ 4 1.72165E-02 4.10619E-02
+4 0 *********** SCCS-phe-gln
+ 1 4.86846E-01 -1.05888E-01
+ 2 -3.94640E-02 -1.43621E-01
+ 3 -1.07811E-01 2.13469E-02
+ 4 -4.22265E-03 -2.88818E-02
+4 0 *********** SCCS-phe-asn
+ 1 6.17192E-01 1.32884E-01
+ 2 2.11050E-01 -1.43871E-01
+ 3 -3.77821E-02 -7.12819E-02
+ 4 2.23335E-02 5.71418E-02
+4 0 *********** SCCS-phe-glu
+ 1 5.12548E-01 -1.55228E-01
+ 2 -7.80945E-02 -1.54708E-01
+ 3 -1.17487E-01 3.69667E-02
+ 4 4.81689E-03 -2.57806E-02
+4 0 *********** SCCS-phe-asp
+ 1 6.54725E-01 1.36981E-01
+ 2 2.27435E-01 -1.56591E-01
+ 3 -1.76645E-02 -8.60832E-02
+ 4 2.41417E-02 4.79527E-02
+4 0 *********** SCCS-phe-his
+ 1 5.71382E-01 1.65067E-01
+ 2 2.21862E-01 -1.03689E-01
+ 3 7.14090E-03 -1.05914E-01
+ 4 1.86059E-02 4.81888E-02
+4 0 *********** SCCS-phe-arg
+ 1 3.46205E-01 -2.19591E-01
+ 2 -1.23250E-01 -6.09198E-02
+ 3 -3.07295E-02 6.26693E-02
+ 4 -2.18389E-02 -3.92536E-04
+4 0 *********** SCCS-phe-lys
+ 1 3.12189E-01 -2.08352E-01
+ 2 -1.38776E-01 -7.42432E-02
+ 3 -2.46965E-02 6.30946E-02
+ 4 -2.00432E-02 -2.35017E-03
+4 0 *********** SCCS-phe-pro
+ 1 5.75671E-01 1.88566E-01
+ 2 1.73271E-01 -2.03893E-01
+ 3 -4.52139E-02 -2.19582E-01
+ 4 1.30494E-01 1.14331E-01
+4 0 *********** SCCS-ile-cys
+ 1 8.12861E-01 -3.96504E-03
+ 2 -4.19983E-02 -1.84176E-01
+ 3 2.24503E-02 -1.66688E-01
+ 4 1.95631E-02 -1.59739E-02
+4 0 *********** SCCS-ile-met
+ 1 5.06126E-01 -1.90924E-01
+ 2 -1.04465E-01 5.08062E-02
+ 3 -4.34139E-02 -8.62438E-03
+ 4 2.80063E-03 -1.68203E-02
+4 0 *********** SCCS-ile-phe
+ 1 4.61933E-01 -2.73111E-01
+ 2 -4.71593E-02 1.06871E-01
+ 3 -4.16029E-02 3.21457E-02
+ 4 -2.32600E-02 -2.22548E-02
+4 0 *********** SCCS-ile-ile
+ 1 6.43631E-01 -1.58904E-01
+ 2 -1.37423E-01 -2.45357E-02
+ 3 -4.92316E-02 -4.74913E-02
+ 4 8.06138E-03 -1.35900E-02
+4 0 *********** SCCS-ile-leu
+ 1 4.08520E-01 -3.13005E-01
+ 2 -1.27566E-01 1.49512E-01
+ 3 -6.34900E-02 3.46685E-02
+ 4 -9.06413E-03 -3.52161E-02
+4 0 *********** SCCS-ile-val
+ 1 5.49852E-01 -2.38227E-01
+ 2 -1.86617E-01 6.55581E-02
+ 3 -8.85027E-02 -2.08951E-03
+ 4 2.05440E-02 -1.84654E-02
+4 0 *********** SCCS-ile-trp
+ 1 5.56619E-01 -2.29250E-01
+ 2 -7.23091E-02 2.04708E-02
+ 3 -5.42306E-02 -1.94723E-02
+ 4 -1.19046E-02 -1.59240E-02
+4 0 *********** SCCS-ile-tyr
+ 1 4.49078E-01 -2.74446E-01
+ 2 -2.55459E-02 9.15112E-02
+ 3 -2.72392E-02 2.83834E-02
+ 4 -1.70035E-02 -1.89771E-02
+4 0 *********** SCCS-ile-ala
+ 1 4.03565E-01 -9.73049E-02
+ 2 -1.65085E-01 5.69215E-02
+ 3 -2.98332E-02 -3.68601E-02
+ 4 5.11142E-02 -3.60853E-03
+4 0 *********** SCCS-ile-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-ile-thr
- 1 -3.19331E-01 -2.78129E-01
- 2 2.64859E-01 -3.68305E-01
- 3 -9.64321E-02 -4.17280E-02
- 4 -1.00414E-01 -6.24471E-02
- 5 -7.11982E-02 -5.01324E-02
- 6 -5.10848E-02 5.66547E-02
-6 0 *********** SCCS-ile-ser
- 1 -4.69377E-01 -4.72659E-01
- 2 8.40766E-01 2.99629E-03
- 3 -1.17410E-01 -1.33685E-01
- 4 1.58318E-01 -4.26942E-03
- 5 -6.33359E-02 -3.32984E-02
- 6 3.23217E-02 -1.78609E-01
-6 0 *********** SCCS-ile-gln
- 1 -4.06047E-01 -3.29706E-01
- 2 3.02080E-01 -1.95983E-01
- 3 -1.17195E-01 -8.51338E-02
- 4 9.16907E-03 -1.65888E-03
- 5 -9.67471E-02 -4.13248E-02
- 6 -6.74363E-03 -6.95093E-02
-6 0 *********** SCCS-ile-asn
- 1 -3.91779E-01 -5.68894E-01
- 2 3.97636E-01 3.66844E-01
- 3 -6.26444E-02 -8.34805E-03
- 4 5.59487E-02 9.99808E-02
- 5 -2.22813E-02 -3.30375E-02
- 6 -1.89595E-02 -3.19876E-01
-6 0 *********** SCCS-ile-glu
- 1 -4.17017E-01 -3.24561E-01
- 2 2.90040E-01 -2.87396E-01
- 3 -1.31230E-01 -1.00111E-01
- 4 -1.75487E-02 -1.67929E-02
- 5 -1.12516E-01 -4.33961E-02
- 6 -1.68652E-02 -3.99147E-02
-6 0 *********** SCCS-ile-asp
- 1 -3.43233E-01 -4.49234E-01
- 2 5.34913E-01 2.02793E-01
- 3 -6.84339E-02 2.38160E-02
- 4 1.32494E-01 3.19377E-02
- 5 -8.10469E-02 1.40293E-02
- 6 4.47311E-02 -1.41734E-01
-6 0 *********** SCCS-ile-his
- 1 -4.82226E-01 -5.88413E-01
- 2 3.76655E-01 2.75091E-01
- 3 -8.24065E-02 -2.68400E-02
- 4 4.22172E-02 4.80822E-02
- 5 -5.39495E-02 -3.96245E-02
- 6 -2.79295E-02 -2.68305E-01
-6 0 *********** SCCS-ile-arg
- 1 -3.29820E-01 -2.07717E-01
- 2 -6.96591E-02 -3.11345E-01
- 3 -1.08863E-01 -1.46964E-01
- 4 -7.83059E-02 8.99063E-02
- 5 -7.90597E-02 -5.03337E-02
- 6 -5.35145E-02 -1.07962E-01
-6 0 *********** SCCS-ile-lys
- 1 -3.26846E-01 -1.68690E-01
- 2 -8.62982E-02 -3.42839E-01
- 3 -1.09530E-01 -1.95703E-01
- 4 -1.01321E-01 8.17160E-02
- 5 -7.61797E-02 -6.57440E-02
- 6 -5.80906E-02 -1.23863E-01
-6 0 *********** SCCS-ile-pro
- 1 -8.95187E-01 -5.72347E-01
- 2 -3.05340E-02 2.28174E+00
- 3 -5.52865E-02 3.85467E-01
- 4 -6.72103E-01 3.19480E-01
- 5 -4.16920E-01 2.00371E-01
- 6 -2.31081E-01 -7.14821E-01
-6 0 *********** SCCS-leu-cys
- 1 -2.49218E-01 -6.85998E-01
- 2 5.61460E-01 -4.98721E-03
- 3 -1.20421E-01 -1.18166E-01
- 4 8.35564E-02 -6.16545E-02
- 5 -1.69494E-01 -4.29556E-02
- 6 4.94242E-03 -1.71439E-01
-6 0 *********** SCCS-leu-met
- 1 -2.90525E-01 -5.02697E-01
- 2 1.10917E-01 -3.42050E-01
- 3 -1.74279E-01 -7.40614E-02
- 4 -4.56289E-02 1.42436E-02
- 5 -9.91967E-02 -3.33844E-02
- 6 -2.45275E-02 -4.78671E-02
-6 0 *********** SCCS-leu-phe
- 1 -3.12424E-01 -5.02028E-01
- 2 -1.38808E-01 -3.33835E-01
- 3 -1.35106E-01 -1.60210E-01
- 4 -1.23605E-01 9.06911E-02
- 5 -5.13431E-02 -8.65858E-02
- 6 -6.15301E-02 -1.87885E-01
-6 0 *********** SCCS-leu-ile
- 1 -2.51806E-01 -6.13216E-01
- 2 1.52660E-01 -3.78317E-01
- 3 -2.73995E-01 -8.73092E-02
- 4 -4.51981E-02 -2.53193E-02
- 5 -1.94259E-01 -2.60557E-02
- 6 -1.81751E-02 -2.82477E-02
-6 0 *********** SCCS-leu-leu
- 1 -3.36827E-01 -3.49138E-01
- 2 -1.33320E-01 -5.69843E-01
- 3 -1.56998E-01 -1.70189E-01
- 4 -1.11519E-01 9.50555E-02
- 5 -1.07886E-01 -6.89421E-02
- 6 -9.39830E-03 -7.95082E-02
-6 0 *********** SCCS-leu-val
- 1 -3.48806E-01 -4.94846E-01
- 2 1.05186E-01 -4.83487E-01
- 3 -1.82596E-01 -1.31634E-01
- 4 -1.55232E-01 8.41925E-02
- 5 -7.07517E-03 -7.70740E-02
- 6 -8.90066E-02 -1.14378E-01
-6 0 *********** SCCS-leu-trp
- 1 -3.28013E-01 -5.59379E-01
- 2 6.60342E-02 -2.55918E-01
- 3 -1.80637E-01 -7.39186E-02
- 4 -1.25598E-02 1.78130E-02
- 5 -1.31863E-01 -3.29401E-02
- 6 -1.20909E-02 -9.40927E-02
-6 0 *********** SCCS-leu-tyr
- 1 -3.29662E-01 -5.10630E-01
- 2 -1.26164E-01 -2.60216E-01
- 3 -1.68906E-01 -1.35382E-01
- 4 -5.79898E-02 6.73397E-02
- 5 -8.35187E-02 -5.55666E-02
- 6 -4.04080E-02 -1.64084E-01
-6 0 *********** SCCS-leu-ala
- 1 -3.49356E-01 -3.04182E-01
- 2 3.47609E-01 -4.74371E-01
- 3 -1.21154E-01 -5.30663E-02
- 4 -9.48709E-02 -6.71932E-03
- 5 -9.85826E-02 -4.98969E-02
- 6 -2.45818E-02 3.29046E-02
-6 0 *********** SCCS-leu-gly
+4 0 *********** SCCS-ile-thr
+ 1 6.20201E-01 -1.51004E-01
+ 2 -1.87224E-01 -2.62016E-02
+ 3 -6.88780E-02 -4.57481E-02
+ 4 2.01786E-02 -1.07393E-02
+4 0 *********** SCCS-ile-ser
+ 1 9.86260E-01 6.17463E-02
+ 2 6.62327E-02 -2.73558E-01
+ 3 1.10960E-01 -2.60774E-01
+ 4 3.83570E-02 -4.73275E-02
+4 0 *********** SCCS-ile-gln
+ 1 6.33544E-01 -1.88461E-01
+ 2 -1.11157E-01 -5.46044E-02
+ 3 -6.63764E-02 -7.88378E-02
+ 4 -2.90177E-04 -3.37399E-02
+4 0 *********** SCCS-ile-asn
+ 1 8.25454E-01 1.18023E-01
+ 2 9.19552E-02 -1.26947E-01
+ 3 1.45967E-01 -1.11375E-01
+ 4 2.12906E-02 -9.23171E-03
+4 0 *********** SCCS-ile-glu
+ 1 6.72081E-01 -2.47902E-01
+ 2 -1.35462E-01 -4.61728E-02
+ 3 -1.02405E-01 -6.77087E-02
+ 4 -6.17406E-03 -2.95507E-02
+4 0 *********** SCCS-ile-asp
+ 1 8.82886E-01 1.31154E-01
+ 2 1.26880E-01 -1.35348E-01
+ 3 1.68125E-01 -9.99270E-02
+ 4 2.84089E-02 -1.18548E-02
+4 0 *********** SCCS-ile-his
+ 1 7.94558E-01 1.75521E-01
+ 2 1.38135E-01 -1.15967E-01
+ 3 1.67239E-01 -3.45828E-03
+ 4 2.51629E-02 1.09876E-02
+4 0 *********** SCCS-ile-arg
+ 1 4.15725E-01 -3.00712E-01
+ 2 -6.50785E-02 9.28036E-02
+ 3 -3.20538E-02 2.66472E-02
+ 4 -8.49279E-03 -1.49651E-02
+4 0 *********** SCCS-ile-lys
+ 1 3.86892E-01 -2.73636E-01
+ 2 -1.12672E-01 1.29364E-01
+ 3 -3.92998E-02 3.02353E-02
+ 4 1.05440E-03 -2.13757E-02
+4 0 *********** SCCS-ile-pro
+ 1 1.10677E+00 1.63062E-01
+ 2 1.50623E-01 -4.22318E-01
+ 3 2.98202E-01 -2.99543E-01
+ 4 1.21923E-01 -2.54283E-02
+4 0 *********** SCCS-leu-cys
+ 1 5.94172E-01 1.73408E-01
+ 2 -4.73314E-02 -4.02620E-01
+ 3 9.12043E-02 2.01775E-02
+ 4 -1.81725E-02 4.15779E-02
+4 0 *********** SCCS-leu-met
+ 1 4.50214E-01 -4.84057E-02
+ 2 -3.11550E-01 -6.43377E-02
+ 3 -1.88595E-02 2.46353E-03
+ 4 3.13201E-02 1.89536E-02
+4 0 *********** SCCS-leu-phe
+ 1 4.47533E-01 -7.27249E-02
+ 2 -3.24192E-01 1.23022E-01
+ 3 -1.38368E-02 -1.16926E-02
+ 4 3.17776E-02 -2.62258E-02
+4 0 *********** SCCS-leu-ile
+ 1 5.38275E-01 -3.28620E-02
+ 2 -3.61398E-01 -1.84453E-01
+ 3 -1.26381E-03 -4.46188E-03
+ 4 3.51930E-02 2.87682E-02
+4 0 *********** SCCS-leu-leu
+ 1 3.93440E-01 -1.90873E-01
+ 2 -5.15508E-01 1.28112E-01
+ 3 -3.48570E-02 -1.12793E-02
+ 4 5.06812E-02 -1.16744E-02
+4 0 *********** SCCS-leu-val
+ 1 4.86868E-01 -7.00880E-02
+ 2 -4.72459E-01 -1.31204E-01
+ 3 -3.24814E-02 -2.39810E-02
+ 4 5.04527E-02 3.87129E-02
+4 0 *********** SCCS-leu-trp
+ 1 4.99228E-01 -6.01644E-02
+ 2 -2.56724E-01 -1.84632E-02
+ 3 3.00625E-03 -6.97844E-03
+ 4 3.48385E-02 4.33609E-04
+4 0 *********** SCCS-leu-tyr
+ 1 4.44213E-01 -7.33654E-02
+ 2 -2.88693E-01 1.26663E-01
+ 3 -1.36961E-02 -8.27957E-03
+ 4 2.22349E-02 -1.54084E-02
+4 0 *********** SCCS-leu-ala
+ 1 3.52407E-01 9.90197E-03
+ 2 -4.25254E-01 -2.87061E-01
+ 3 -9.77948E-03 1.04495E-02
+ 4 1.24345E-02 6.57671E-02
+4 0 *********** SCCS-leu-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-leu-thr
- 1 -1.72571E-01 -5.54925E-01
- 2 3.17232E-01 -3.25933E-01
- 3 -2.07871E-01 -2.53780E-01
- 4 -1.41440E-01 -1.26154E-02
- 5 -5.92041E-02 -7.95712E-02
- 6 -1.01076E-01 -1.74839E-01
-6 0 *********** SCCS-leu-ser
- 1 -4.74879E-01 -8.14550E-01
- 2 7.98263E-01 1.95635E-01
- 3 -6.60844E-03 -1.62053E-01
- 4 1.29202E-01 8.27874E-02
- 5 7.47400E-02 -4.48376E-02
- 6 1.40053E-02 -3.81815E-01
-6 0 *********** SCCS-leu-gln
- 1 -3.25690E-01 -5.69581E-01
- 2 2.63441E-01 -2.11752E-01
- 3 -1.40460E-01 -5.26245E-02
- 4 4.25378E-02 1.66858E-02
- 5 -1.00321E-01 -2.63036E-02
- 6 4.44963E-03 -9.41635E-02
-6 0 *********** SCCS-leu-asn
- 1 -2.26826E-01 -7.13740E-01
- 2 4.76870E-01 3.03841E-01
- 3 -1.07653E-01 9.54672E-03
- 4 1.51007E-01 2.03519E-02
- 5 -1.62452E-01 5.04810E-03
- 6 5.21187E-02 -2.25646E-01
-6 0 *********** SCCS-leu-glu
- 1 -3.52949E-01 -5.96190E-01
- 2 2.60448E-01 -3.30297E-01
- 3 -1.72790E-01 -6.52391E-02
- 4 1.24512E-02 -1.77719E-02
- 5 -1.28543E-01 -3.04144E-02
- 6 -4.06654E-03 -4.01179E-02
-6 0 *********** SCCS-leu-asp
- 1 -1.28529E-01 -5.77499E-01
- 2 6.22101E-01 1.47609E-01
- 3 -1.37239E-01 2.56708E-02
- 4 1.63598E-01 1.63447E-02
- 5 -1.24655E-01 -1.47705E-02
- 6 6.35426E-02 -1.50020E-01
-6 0 *********** SCCS-leu-his
- 1 -2.64819E-01 -7.66118E-01
- 2 3.92361E-01 3.09038E-01
- 3 -1.28562E-01 -6.93224E-02
- 4 5.94849E-02 -7.13782E-03
- 5 -9.25568E-02 -2.07811E-02
- 6 1.15707E-02 -2.84113E-01
-6 0 *********** SCCS-leu-arg
- 1 -3.42665E-01 -4.06661E-01
- 2 -4.60374E-02 -3.28852E-01
- 3 -1.47526E-01 -1.28543E-01
- 4 -9.79422E-02 8.55661E-02
- 5 -5.49528E-02 -5.43999E-02
- 6 -5.00766E-02 -1.28551E-01
-6 0 *********** SCCS-leu-lys
- 1 -3.22036E-01 -3.94770E-01
- 2 6.92088E-03 -4.58561E-01
- 3 -1.71484E-01 -8.83143E-02
- 4 -4.55712E-02 8.21355E-02
- 5 -1.54150E-01 -4.61641E-02
- 6 5.99116E-03 -6.20385E-02
-6 0 *********** SCCS-leu-pro
- 1 -1.69766E+01 -9.28976E-01
- 2 1.53398E+01 2.14294E+00
- 3 -1.53132E+01 8.50123E-01
- 4 1.49694E+01 -5.86703E-02
- 5 -1.64306E+01 6.05533E-01
- 6 7.77414E+00 2.44536E-01
-6 0 *********** SCCS-val-cys
- 1 -5.08127E-01 -1.22833E+00
- 2 1.75422E-01 -2.31780E-01
- 3 -2.42711E-01 1.24791E-02
- 4 1.10213E-01 -4.72575E-02
- 5 -1.93504E-01 -4.47106E-02
- 6 7.72327E-03 -1.33976E-01
-6 0 *********** SCCS-val-met
- 1 -4.67615E-01 -6.81299E-01
- 2 -1.14903E-01 -2.96704E-01
- 3 -1.64393E-01 -4.68767E-02
- 4 -4.51223E-02 5.96671E-02
- 5 -8.21649E-02 -6.74528E-02
- 6 -4.49196E-02 -1.36428E-01
-6 0 *********** SCCS-val-phe
- 1 -5.66763E-01 -7.49695E-01
- 2 -2.74294E-01 -1.15026E-01
- 3 -1.50105E-01 -2.37182E-01
- 4 -1.49918E-01 1.65041E-01
- 5 4.24887E-02 -1.41044E-01
- 6 -1.49910E-01 -4.37427E-01
-6 0 *********** SCCS-val-ile
- 1 -4.72304E-01 -8.97826E-01
- 2 -1.39904E-01 -3.21496E-01
- 3 -2.68467E-01 -9.37305E-03
- 4 -9.77386E-02 1.37961E-01
- 5 2.74672E-02 -6.24458E-02
- 6 -8.73308E-02 -1.95481E-01
-6 0 *********** SCCS-val-leu
- 1 -4.99294E-01 -5.76277E-01
- 2 -2.66861E-01 -4.61833E-01
- 3 -1.98833E-01 -5.36916E-02
- 4 2.32649E-02 1.02889E-01
- 5 -1.94799E-01 -5.97384E-02
- 6 1.20541E-02 -8.75408E-02
-6 0 *********** SCCS-val-val
- 1 -5.72548E-01 -7.22372E-01
- 2 -1.01544E-01 -3.29190E-01
- 3 -2.16137E-01 -1.70961E-01
- 4 -2.57871E-01 2.16216E-01
- 5 1.37429E-01 -8.07120E-02
- 6 -1.41239E-01 -3.08226E-01
-6 0 *********** SCCS-val-trp
- 1 -5.73204E-01 -7.57398E-01
- 2 -1.10157E-01 -1.24961E-01
- 3 -1.30925E-01 -7.42745E-02
- 4 -4.72776E-02 6.88725E-03
- 5 -1.10282E-01 -3.03642E-02
- 6 -3.59409E-02 -1.58460E-01
-6 0 *********** SCCS-val-tyr
- 1 -5.99614E-01 -7.19719E-01
- 2 -2.88389E-01 -4.15766E-02
- 3 -1.43902E-01 -1.91628E-01
- 4 -1.34170E-01 1.98232E-01
- 5 7.76092E-02 -1.30236E-01
- 6 -1.42821E-01 -4.50663E-01
-6 0 *********** SCCS-val-ala
- 1 -4.04349E-01 -5.89275E-01
- 2 3.26142E-01 -5.36841E-01
- 3 -4.29884E-01 1.08914E-02
- 4 1.90257E-01 4.09288E-02
- 5 -3.21138E-01 2.87473E-02
- 6 1.37507E-01 7.66460E-02
-6 0 *********** SCCS-val-gly
+4 0 *********** SCCS-leu-thr
+ 1 5.30410E-01 -3.02183E-02
+ 2 -3.40930E-01 -2.50663E-01
+ 3 -1.72778E-02 -3.12795E-02
+ 4 6.50734E-03 4.50499E-02
+4 0 *********** SCCS-leu-ser
+ 1 6.43329E-01 2.88516E-01
+ 2 1.45392E-01 -5.44840E-01
+ 3 1.89139E-01 4.54212E-02
+ 4 5.20574E-03 6.18441E-03
+4 0 *********** SCCS-leu-gln
+ 1 5.38355E-01 -9.84240E-03
+ 2 -2.31182E-01 -2.17751E-01
+ 3 4.74929E-02 -4.53414E-02
+ 4 2.17601E-03 3.35150E-02
+4 0 *********** SCCS-leu-asn
+ 1 5.90026E-01 2.87928E-01
+ 2 1.94468E-01 -4.17227E-01
+ 3 1.25681E-01 4.82303E-02
+ 4 -6.52887E-05 2.85218E-02
+4 0 *********** SCCS-leu-glu
+ 1 5.67262E-01 -4.93095E-02
+ 2 -3.05894E-01 -1.96980E-01
+ 3 3.23051E-02 -6.29242E-02
+ 4 1.22491E-02 2.40107E-02
+4 0 *********** SCCS-leu-asp
+ 1 6.22202E-01 3.02516E-01
+ 2 2.07573E-01 -4.31691E-01
+ 3 1.27351E-01 4.61920E-02
+ 4 -8.60483E-04 2.43449E-02
+4 0 *********** SCCS-leu-his
+ 1 5.86765E-01 2.88627E-01
+ 2 2.35091E-01 -3.01746E-01
+ 3 3.08047E-02 9.85179E-02
+ 4 1.02471E-02 7.74650E-03
+4 0 *********** SCCS-leu-arg
+ 1 4.15115E-01 -1.37915E-01
+ 2 -3.18066E-01 8.40315E-02
+ 3 -2.25748E-02 1.54698E-02
+ 4 2.14297E-02 -9.37111E-03
+4 0 *********** SCCS-leu-lys
+ 1 3.77420E-01 -1.69429E-01
+ 2 -3.94650E-01 8.02192E-02
+ 3 -4.51308E-02 8.84393E-03
+ 4 2.97845E-02 2.48893E-03
+4 0 *********** SCCS-leu-pro
+ 1 7.16084E-01 2.99786E-01
+ 2 1.86283E-01 -6.03837E-01
+ 3 2.55575E-01 7.04726E-02
+ 4 1.91405E-02 -4.06397E-03
+4 0 *********** SCCS-val-cys
+ 1 7.86466E-01 -4.29816E-03
+ 2 -4.32969E-03 -2.08880E-01
+ 3 8.92767E-02 -7.77737E-02
+ 4 1.70589E-02 2.40084E-03
+4 0 *********** SCCS-val-met
+ 1 4.82523E-01 -1.71997E-01
+ 2 -1.79550E-01 4.18869E-03
+ 3 -4.20704E-02 1.06050E-02
+ 4 5.12664E-03 -9.63187E-03
+4 0 *********** SCCS-val-phe
+ 1 4.51288E-01 -2.28428E-01
+ 2 -1.51994E-01 1.02467E-01
+ 3 -5.40453E-02 -6.33436E-04
+ 4 -1.17698E-02 -6.75950E-03
+4 0 *********** SCCS-val-ile
+ 1 5.99794E-01 -1.49710E-01
+ 2 -2.21716E-01 -1.00818E-01
+ 3 -7.56670E-02 -4.49988E-02
+ 4 2.23437E-02 1.38860E-04
+4 0 *********** SCCS-val-leu
+ 1 4.14638E-01 -2.61707E-01
+ 2 -2.82127E-01 1.46116E-01
+ 3 -5.38285E-02 4.44781E-02
+ 4 9.79193E-03 -6.08394E-02
+4 0 *********** SCCS-val-val
+ 1 5.31517E-01 -2.21076E-01
+ 2 -2.82958E-01 -2.56610E-02
+ 3 -7.96155E-02 2.15670E-03
+ 4 1.47594E-02 -2.10170E-02
+4 0 *********** SCCS-val-trp
+ 1 5.21376E-01 -1.78759E-01
+ 2 -1.31968E-01 1.73530E-04
+ 3 -5.86612E-02 -8.79356E-03
+ 4 -4.52690E-03 -1.10914E-02
+4 0 *********** SCCS-val-tyr
+ 1 4.36795E-01 -2.36531E-01
+ 2 -1.37645E-01 1.01878E-01
+ 3 -5.17500E-02 -1.33638E-03
+ 4 -1.13990E-02 -8.80492E-03
+4 0 *********** SCCS-val-ala
+ 1 4.02626E-01 1.40449E-02
+ 2 -2.57620E-01 -1.04836E-01
+ 3 -1.72425E-02 -4.38215E-03
+ 4 6.62607E-02 1.47455E-02
+4 0 *********** SCCS-val-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-val-thr
- 1 -3.48995E-01 -6.96045E-01
- 2 1.06333E-01 -4.36133E-01
- 3 -2.97050E-01 -1.37189E-01
- 4 -1.49435E-01 -5.41107E-04
- 5 -1.19870E-01 -2.70059E-02
- 6 -6.05371E-02 -6.72354E-02
-6 0 *********** SCCS-val-ser
- 1 -8.11529E-01 -1.78847E+00
- 2 3.14178E-01 -1.76381E-01
- 3 -2.60278E-01 -2.46390E-01
- 4 -4.55604E-02 7.42253E-03
- 5 -1.02370E-01 -8.89302E-02
- 6 -7.15634E-02 -4.52371E-01
-6 0 *********** SCCS-val-gln
- 1 -5.71382E-01 -8.23637E-01
- 2 5.13980E-02 -1.63906E-01
- 3 -1.10240E-01 -6.85517E-02
- 4 -2.23447E-02 -9.12615E-03
- 5 -8.15237E-02 -7.69131E-02
- 6 -5.42256E-02 -1.73653E-01
-6 0 *********** SCCS-val-asn
- 1 -1.69305E-01 -1.12563E+00
- 2 3.32025E-01 8.51981E-02
- 3 -1.46261E-01 -8.61763E-02
- 4 4.97252E-02 9.93696E-02
- 5 -1.97415E-01 -7.82931E-02
- 6 3.50810E-02 -3.88527E-01
-6 0 *********** SCCS-val-glu
- 1 -6.53174E-01 -8.94631E-01
- 2 -3.97347E-03 -2.46543E-01
- 3 -1.46293E-01 -5.22161E-02
- 4 -4.02746E-02 4.35529E-03
- 5 -1.04705E-01 -6.60692E-02
- 6 -4.56520E-02 -1.55539E-01
-6 0 *********** SCCS-val-asp
- 1 3.77343E-02 -1.03201E+00
- 2 5.59251E-01 -1.04204E-01
- 3 -2.48617E-01 -3.11181E-01
- 4 -1.48392E-03 1.20016E-01
- 5 1.53107E-01 -1.30515E-01
- 6 -9.11765E-02 -4.89330E-01
-6 0 *********** SCCS-val-his
- 1 -1.81605E-01 -1.35929E+00
- 2 4.77597E-02 1.95803E-01
- 3 -1.58777E-01 -8.74716E-02
- 4 -3.51418E-02 4.17012E-02
- 5 -5.43388E-02 -6.84646E-02
- 6 -5.66821E-02 -4.16107E-01
-6 0 *********** SCCS-val-arg
- 1 -5.32337E-01 -4.97573E-01
- 2 -1.57505E-01 -2.14989E-01
- 3 -1.68156E-01 -6.54746E-02
- 4 -4.61937E-02 6.33402E-02
- 5 -1.03468E-01 -6.34401E-02
- 6 -4.42908E-02 -1.39737E-01
-6 0 *********** SCCS-val-lys
- 1 -4.59219E-01 -5.37800E-01
- 2 -1.84523E-01 -3.46324E-01
- 3 -1.75077E-01 -4.43680E-02
- 4 -2.93453E-02 9.23726E-02
- 5 -1.16393E-01 -6.40328E-02
- 6 -1.80163E-02 -1.13905E-01
-6 0 *********** SCCS-val-pro
- 1 -2.41642E+00 2.08252E+00
- 2 2.76103E-01 2.43649E+00
- 3 -7.14083E-01 -4.46788E-01
- 4 -7.05393E-01 7.99817E-01
- 5 4.02375E-02 -1.54129E-01
- 6 -4.87454E-01 -1.36105E+00
-6 0 *********** SCCS-trp-cys
- 1 -4.48284E-01 -1.18396E+00
- 2 1.44145E-01 -2.24227E-01
- 3 -1.91893E-01 -9.55712E-02
- 4 -2.53007E-02 3.93433E-02
- 5 -4.14547E-02 -5.83266E-02
- 6 -5.43771E-02 -2.60738E-01
-6 0 *********** SCCS-trp-met
- 1 -4.64991E-01 -6.70876E-01
- 2 -7.03091E-02 -2.49665E-01
- 3 -1.58999E-01 -7.11774E-02
- 4 -8.07247E-02 7.24877E-02
- 5 -4.97798E-02 -7.04688E-02
- 6 -5.98883E-02 -1.75993E-01
-6 0 *********** SCCS-trp-phe
- 1 -5.18748E-01 -7.41114E-01
- 2 -2.20139E-01 -1.87387E-01
- 3 -1.32501E-01 -1.60661E-01
- 4 -7.45539E-02 9.89325E-02
- 5 -3.23087E-02 -7.22612E-02
- 6 -8.61964E-02 -2.74166E-01
-6 0 *********** SCCS-trp-ile
- 1 -5.17656E-01 -8.52654E-01
- 2 -1.06775E-01 -2.26708E-01
- 3 -2.24799E-01 -8.46696E-02
- 4 -1.33455E-01 1.50851E-01
- 5 3.58038E-02 -5.96966E-02
- 6 -8.56653E-02 -2.63603E-01
-6 0 *********** SCCS-trp-leu
- 1 -4.73686E-01 -6.08987E-01
- 2 -2.28889E-01 -4.41430E-01
- 3 -2.37775E-01 -4.53232E-02
- 4 2.39357E-02 7.37284E-02
- 5 -2.10380E-01 -4.42244E-02
- 6 2.31318E-02 -6.58227E-02
-6 0 *********** SCCS-trp-val
- 1 -5.21572E-01 -7.40083E-01
- 2 -1.01166E-01 -2.86204E-01
- 3 -1.99181E-01 -1.62018E-01
- 4 -1.86917E-01 1.99988E-01
- 5 6.75405E-02 -5.62877E-02
- 6 -1.18237E-01 -2.95003E-01
-6 0 *********** SCCS-trp-trp
- 1 -5.54205E-01 -7.54113E-01
- 2 -1.43472E-01 -1.09025E-01
- 3 -1.44082E-01 -6.62824E-02
- 4 -1.89042E-02 3.00530E-02
- 5 -1.20752E-01 -5.50070E-02
- 6 -3.24228E-02 -1.93303E-01
-6 0 *********** SCCS-trp-tyr
- 1 -5.47196E-01 -7.52212E-01
- 2 -2.28131E-01 -1.27066E-01
- 3 -1.42024E-01 -2.21094E-01
- 4 -1.07429E-01 1.29316E-01
- 5 4.17529E-02 -1.18433E-01
- 6 -1.12539E-01 -3.85618E-01
-6 0 *********** SCCS-trp-ala
- 1 -2.18613E-01 -6.45344E-01
- 2 2.30947E-01 -4.63063E-01
- 3 -3.38638E-01 -3.67520E-02
- 4 7.39973E-02 2.36394E-03
- 5 -2.66254E-01 -1.64697E-02
- 6 7.17476E-02 1.94584E-02
-6 0 *********** SCCS-trp-gly
+4 0 *********** SCCS-val-thr
+ 1 5.86762E-01 -1.46511E-01
+ 2 -2.13679E-01 -1.03577E-01
+ 3 -7.94667E-02 -4.83725E-02
+ 4 2.09928E-02 -4.62998E-03
+4 0 *********** SCCS-val-ser
+ 1 1.04735E+00 4.99137E-02
+ 2 2.14269E-01 -3.39805E-01
+ 3 2.44740E-01 -8.40160E-02
+ 4 5.29428E-02 -4.33972E-02
+4 0 *********** SCCS-val-gln
+ 1 6.13296E-01 -1.73183E-01
+ 2 -1.26476E-01 -1.28614E-01
+ 3 -3.71179E-02 -7.86053E-02
+ 4 1.04799E-02 -2.01331E-02
+4 0 *********** SCCS-val-asn
+ 1 8.04143E-01 1.57745E-01
+ 2 1.82443E-01 -2.61981E-01
+ 3 9.86430E-02 -3.13450E-02
+ 4 4.11567E-02 1.32916E-02
+4 0 *********** SCCS-val-glu
+ 1 6.46327E-01 -2.34941E-01
+ 2 -1.66375E-01 -1.21363E-01
+ 3 -6.35693E-02 -8.08871E-02
+ 4 9.52973E-03 -2.25330E-02
+4 0 *********** SCCS-val-asp
+ 1 8.60112E-01 1.77381E-01
+ 2 2.19171E-01 -2.83089E-01
+ 3 1.35769E-01 -5.49904E-02
+ 4 3.53350E-02 1.97050E-03
+4 0 *********** SCCS-val-his
+ 1 7.50465E-01 2.17826E-01
+ 2 2.31690E-01 -2.13623E-01
+ 3 1.08163E-01 4.23888E-03
+ 4 1.00893E-02 4.01857E-02
+4 0 *********** SCCS-val-arg
+ 1 4.10847E-01 -2.63199E-01
+ 2 -1.51817E-01 6.81096E-02
+ 3 -3.92104E-02 2.09606E-02
+ 4 1.06147E-02 -1.12527E-02
+4 0 *********** SCCS-val-lys
+ 1 3.76811E-01 -2.56016E-01
+ 2 -2.25150E-01 1.08778E-01
+ 3 -4.37858E-02 5.46755E-02
+ 4 8.88439E-03 -2.55896E-02
+4 0 *********** SCCS-val-pro
+ 1 1.03436E+00 1.00714E-01
+ 2 1.86406E-01 -4.96539E-01
+ 3 2.62543E-01 -3.07019E-01
+ 4 8.02174E-02 -9.14531E-02
+4 0 *********** SCCS-trp-cys
+ 1 4.85138E-01 -1.82979E-01
+ 2 1.96020E-01 6.48263E-02
+ 3 -2.52414E-02 -8.54147E-02
+ 4 7.93224E-03 1.31628E-02
+4 0 *********** SCCS-trp-met
+ 1 2.48041E-01 -2.84325E-01
+ 2 1.30070E-01 -1.01583E-01
+ 3 -3.33324E-02 -1.77276E-02
+ 4 -3.97627E-03 -6.68479E-03
+4 0 *********** SCCS-trp-phe
+ 1 2.19398E-01 -3.43636E-01
+ 2 7.09310E-02 -1.59341E-01
+ 3 -3.49108E-02 1.35400E-02
+ 4 -1.17105E-02 2.68615E-03
+4 0 *********** SCCS-trp-ile
+ 1 3.39621E-01 -3.07163E-01
+ 2 1.91920E-01 -1.12493E-01
+ 3 -3.90083E-02 -2.87568E-02
+ 4 5.73771E-04 -1.45520E-02
+4 0 *********** SCCS-trp-leu
+ 1 1.92352E-01 -3.39104E-01
+ 2 1.12441E-01 -1.87719E-01
+ 3 -2.48803E-02 5.17637E-03
+ 4 -2.43256E-02 -1.13261E-02
+4 0 *********** SCCS-trp-val
+ 1 3.04400E-01 -3.17984E-01
+ 2 1.79017E-01 -1.32345E-01
+ 3 -3.70638E-02 -1.81856E-02
+ 4 3.47239E-03 -1.33026E-02
+4 0 *********** SCCS-trp-trp
+ 1 2.43296E-01 -3.18081E-01
+ 2 1.06406E-01 -1.38401E-01
+ 3 -3.34627E-02 -1.13739E-03
+ 4 -4.60639E-03 2.78278E-03
+4 0 *********** SCCS-trp-tyr
+ 1 2.07853E-01 -3.39702E-01
+ 2 6.52886E-02 -1.46562E-01
+ 3 -2.61363E-02 1.94548E-02
+ 4 -1.14587E-02 1.22331E-03
+4 0 *********** SCCS-trp-ala
+ 1 2.88980E-01 -1.77235E-01
+ 2 2.16084E-01 -1.60516E-02
+ 3 4.02341E-04 -4.80763E-02
+ 4 1.04394E-02 -4.60249E-02
+4 0 *********** SCCS-trp-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-trp-thr
- 1 -3.73142E-01 -6.85240E-01
- 2 6.95429E-02 -4.04444E-01
- 3 -2.94958E-01 -1.08692E-01
- 4 -6.88820E-02 8.37906E-03
- 5 -1.47169E-01 -1.16512E-02
- 6 -1.99472E-02 -5.45492E-02
-6 0 *********** SCCS-trp-ser
- 1 -5.72191E-01 -1.73897E+00
- 2 3.75892E-01 -2.39716E-01
- 3 -1.60353E-01 -1.43903E-01
- 4 1.14520E-01 -3.34018E-02
- 5 -2.12776E-01 1.55122E-02
- 6 9.41949E-03 -2.49871E-01
-6 0 *********** SCCS-trp-gln
- 1 -5.32836E-01 -8.20032E-01
- 2 2.87967E-02 -1.20752E-01
- 3 -1.28860E-01 -1.06653E-01
- 4 -5.02384E-02 2.43303E-02
- 5 -7.07573E-02 -6.81090E-02
- 6 -5.42439E-02 -2.27826E-01
-6 0 *********** SCCS-trp-asn
- 1 9.80713E-02 -1.09128E+00
- 2 1.76599E-01 1.47477E-01
- 3 -4.67979E-02 -1.39269E-01
- 4 -4.23642E-02 3.16019E-02
- 5 -5.96547E-02 -4.35885E-02
- 6 -4.80702E-02 -3.58565E-01
-6 0 *********** SCCS-trp-glu
- 1 -6.30771E-01 -8.83315E-01
- 2 -2.66606E-02 -2.04321E-01
- 3 -1.53341E-01 -8.88564E-02
- 4 -6.19404E-02 2.49300E-02
- 5 -8.18937E-02 -7.13081E-02
- 6 -6.16335E-02 -2.04751E-01
-6 0 *********** SCCS-trp-asp
- 1 1.99860E-01 -9.37262E-01
- 2 5.05636E-01 4.91373E-02
- 3 -1.96814E-02 -2.81295E-01
- 4 -5.09498E-02 2.48404E-02
- 5 9.16954E-03 -1.10693E-01
- 6 -9.27262E-02 -4.23157E-01
-6 0 *********** SCCS-trp-his
- 1 -4.56231E-02 -1.31960E+00
- 2 -1.11050E-02 1.24647E-01
- 3 -1.16496E-01 -3.67834E-02
- 4 -3.05527E-02 7.21364E-02
- 5 -6.13869E-02 -5.20078E-02
- 6 -6.34768E-02 -3.76992E-01
-6 0 *********** SCCS-trp-arg
- 1 -5.22101E-01 -5.20351E-01
- 2 -1.09536E-01 -2.26795E-01
- 3 -2.02612E-01 -4.92539E-02
- 4 2.01571E-02 3.71938E-02
- 5 -1.56698E-01 -3.42874E-02
- 6 -1.18273E-02 -9.68762E-02
-6 0 *********** SCCS-trp-lys
- 1 -4.28469E-01 -5.26256E-01
- 2 -1.85745E-01 -3.19636E-01
- 3 -1.69527E-01 -5.27355E-02
- 4 -5.07424E-02 7.21603E-02
- 5 -8.74315E-02 -5.31631E-02
- 6 -3.66357E-02 -1.01719E-01
-6 0 *********** SCCS-trp-pro
- 1 -2.73361E+00 2.12664E+00
- 2 3.01098E-01 1.99547E+00
- 3 -1.32265E+00 -3.62459E-01
- 4 -1.18304E-01 -4.05155E-01
- 5 -3.58510E-01 -2.36804E-01
- 6 3.90217E-01 -4.15373E-01
-6 0 *********** SCCS-tyr-cys
- 1 -3.87510E-01 -1.20833E+00
- 2 3.22669E-01 -3.57898E-02
- 3 -2.36645E-01 -1.33782E-01
- 4 -7.13273E-02 -2.07493E-04
- 5 1.15887E-01 -6.74428E-02
- 6 -1.18548E-01 -3.17289E-01
-6 0 *********** SCCS-tyr-met
- 1 -4.11264E-01 -6.88410E-01
- 2 -4.33420E-02 -3.02846E-01
- 3 -1.72364E-01 -6.50718E-02
- 4 -7.02888E-02 5.70206E-02
- 5 -4.67840E-02 -5.79613E-02
- 6 -5.72579E-02 -1.35510E-01
-6 0 *********** SCCS-tyr-phe
- 1 -4.91138E-01 -7.58770E-01
- 2 -1.96839E-01 -2.99334E-01
- 3 -2.40163E-01 -1.82708E-02
- 4 7.61872E-02 1.58644E-02
- 5 -2.20125E-01 -5.01634E-02
- 6 1.88156E-02 -8.41331E-02
-6 0 *********** SCCS-tyr-ile
- 1 -4.48345E-01 -8.47062E-01
- 2 -1.12874E-01 -4.11658E-01
- 3 -2.70935E-01 -7.47193E-04
- 4 -1.07202E-01 1.04382E-01
- 5 -3.13915E-02 -1.35150E-02
- 6 -4.52254E-02 -9.23647E-02
-6 0 *********** SCCS-tyr-leu
- 1 -4.21104E-01 -5.41405E-01
- 2 -2.78550E-01 -5.65247E-01
- 3 -1.46415E-01 -8.72502E-02
- 4 -1.27358E-01 1.43909E-01
- 5 -6.49960E-02 -8.22910E-02
- 6 -3.87224E-02 -1.12511E-01
-6 0 *********** SCCS-tyr-val
- 1 -4.78476E-01 -7.27720E-01
- 2 -6.30069E-03 -5.21135E-01
- 3 -4.16647E-01 -5.69677E-03
- 4 -1.93008E-03 5.29606E-02
- 5 -2.20459E-01 1.79385E-03
- 6 5.22447E-02 4.32833E-03
-6 0 *********** SCCS-tyr-trp
- 1 -5.09422E-01 -7.75589E-01
- 2 -1.67638E-01 -1.78565E-01
- 3 -1.28118E-01 -9.47470E-02
- 4 -5.30020E-02 4.44236E-02
- 5 -7.45042E-02 -7.53422E-02
- 6 -6.45105E-02 -2.13918E-01
-6 0 *********** SCCS-tyr-tyr
- 1 -4.65337E-01 -7.60848E-01
- 2 -2.24418E-01 -2.26474E-01
- 3 -1.48839E-01 -8.45522E-02
- 4 -1.63466E-02 4.55127E-02
- 5 -1.14927E-01 -7.76143E-02
- 6 -5.74827E-02 -1.94198E-01
-6 0 *********** SCCS-tyr-ala
- 1 -2.99193E-01 -6.31838E-01
- 2 3.13387E-01 -3.75316E-01
- 3 -2.08453E-01 -2.48901E-01
- 4 -2.53717E-01 1.93717E-01
- 5 1.93621E-01 -1.13822E-01
- 6 -1.80867E-01 -3.39802E-01
-6 0 *********** SCCS-tyr-gly
+4 0 *********** SCCS-trp-thr
+ 1 3.33794E-01 -2.86700E-01
+ 2 2.17694E-01 -9.80045E-02
+ 3 -2.38907E-02 -2.66965E-02
+ 4 8.30399E-03 -1.35058E-02
+4 0 *********** SCCS-trp-ser
+ 1 6.00894E-01 -1.14686E-01
+ 2 2.16336E-01 1.32206E-01
+ 3 -9.68653E-03 -9.15954E-02
+ 4 9.12456E-03 1.96290E-02
+4 0 *********** SCCS-trp-gln
+ 1 3.15699E-01 -2.87964E-01
+ 2 1.65908E-01 -6.56960E-02
+ 3 -3.91986E-02 9.97324E-04
+ 4 -1.62928E-03 -8.66838E-03
+4 0 *********** SCCS-trp-asn
+ 1 5.22114E-01 -6.16801E-02
+ 2 1.43744E-01 1.28932E-01
+ 3 3.34487E-02 -3.92939E-02
+ 4 7.68923E-03 1.87095E-02
+4 0 *********** SCCS-trp-glu
+ 1 3.28314E-01 -3.32187E-01
+ 2 1.84183E-01 -1.06422E-01
+ 3 -4.84187E-02 2.23351E-03
+ 4 -4.18345E-03 -1.77328E-02
+4 0 *********** SCCS-trp-asp
+ 1 5.60666E-01 -5.93245E-02
+ 2 1.69393E-01 1.37331E-01
+ 3 4.09960E-02 -3.79390E-02
+ 4 1.43053E-02 1.99879E-02
+4 0 *********** SCCS-trp-his
+ 1 4.84972E-01 -5.97378E-02
+ 2 1.22201E-01 1.14444E-01
+ 3 3.44912E-02 -5.65853E-02
+ 4 1.06022E-02 1.47781E-03
+4 0 *********** SCCS-trp-arg
+ 1 1.76449E-01 -3.23649E-01
+ 2 7.61235E-02 -1.50410E-01
+ 3 -3.06091E-02 2.92860E-03
+ 4 -1.56412E-02 -3.18537E-03
+4 0 *********** SCCS-trp-lys
+ 1 1.56107E-01 -2.99490E-01
+ 2 9.54620E-02 -1.43133E-01
+ 3 -1.39722E-02 -2.58350E-03
+ 4 -1.16648E-02 -9.91106E-03
+4 0 *********** SCCS-trp-pro
+ 1 5.68316E-01 -1.01008E-01
+ 2 2.97583E-01 1.87430E-01
+ 3 -1.19631E-02 -6.91847E-02
+ 4 1.36279E-02 3.97384E-03
+4 0 *********** SCCS-tyr-cys
+ 1 5.55259E-01 2.14259E-02
+ 2 1.98180E-01 -1.44708E-01
+ 3 -1.37493E-01 -6.34694E-02
+ 4 3.34960E-02 1.80364E-02
+4 0 *********** SCCS-tyr-met
+ 1 3.66448E-01 -1.23226E-01
+ 2 -2.16214E-02 -1.63415E-01
+ 3 -7.70080E-02 2.82162E-02
+ 4 -2.89652E-02 -3.48982E-03
+4 0 *********** SCCS-tyr-phe
+ 1 3.32943E-01 -1.85915E-01
+ 2 -9.74173E-02 -1.42315E-01
+ 3 -4.09691E-02 1.02017E-01
+ 4 -4.72429E-02 3.46750E-02
+4 0 *********** SCCS-tyr-ile
+ 1 4.47979E-01 -1.18184E-01
+ 2 5.22640E-03 -2.12939E-01
+ 3 -1.25254E-01 1.77613E-02
+ 4 -1.89103E-02 -1.71523E-02
+4 0 *********** SCCS-tyr-leu
+ 1 3.19351E-01 -2.36058E-01
+ 2 -1.48965E-01 -1.87933E-01
+ 3 -4.73722E-02 9.45693E-02
+ 4 -6.97518E-02 -3.99825E-03
+4 0 *********** SCCS-tyr-val
+ 1 4.20060E-01 -1.66880E-01
+ 2 -3.05941E-02 -2.26764E-01
+ 3 -1.12217E-01 4.12918E-02
+ 4 -3.14988E-02 -3.87474E-02
+4 0 *********** SCCS-tyr-trp
+ 1 3.76306E-01 -1.38972E-01
+ 2 -4.73139E-02 -1.34862E-01
+ 3 -6.65524E-02 6.30932E-02
+ 4 -2.29209E-02 1.68061E-02
+4 0 *********** SCCS-tyr-tyr
+ 1 3.23069E-01 -1.81659E-01
+ 2 -9.14465E-02 -1.31407E-01
+ 3 -2.79885E-02 1.00003E-01
+ 4 -4.99827E-02 3.17112E-02
+4 0 *********** SCCS-tyr-ala
+ 1 3.31711E-01 -5.51802E-02
+ 2 4.32172E-02 -2.29156E-01
+ 3 -1.08502E-01 -7.32833E-02
+ 4 1.58578E-02 -6.28907E-02
+4 0 *********** SCCS-tyr-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-tyr-thr
- 1 -3.16814E-01 -6.97451E-01
- 2 1.55133E-01 -5.94716E-01
- 3 -2.72853E-01 -9.13668E-02
- 4 -6.74650E-02 -6.81674E-02
- 5 -1.45340E-01 -6.75570E-03
- 6 -2.25740E-02 6.24114E-02
-6 0 *********** SCCS-tyr-ser
- 1 -4.65735E-01 -1.65446E+00
- 2 6.29907E-01 -3.57058E-02
- 3 -1.99004E-01 -1.10672E-01
- 4 5.91414E-02 -7.68924E-02
- 5 -4.37221E-02 3.22634E-03
- 6 -3.94049E-02 -2.63064E-01
-6 0 *********** SCCS-tyr-gln
- 1 -4.81568E-01 -8.36739E-01
- 2 8.20154E-02 -1.63785E-01
- 3 -8.99512E-02 -1.02623E-01
- 4 -1.53615E-02 3.22598E-02
- 5 -4.60622E-02 -7.35226E-02
- 6 -5.11076E-02 -2.26461E-01
-6 0 *********** SCCS-tyr-asn
- 1 5.78726E-02 -1.09556E+00
- 2 2.29505E-01 2.64977E-01
- 3 -3.09193E-02 -1.59758E-01
- 4 -4.56856E-02 4.84772E-02
- 5 -1.08984E-02 -7.35328E-02
- 6 -6.35265E-02 -4.42554E-01
-6 0 *********** SCCS-tyr-glu
- 1 -5.73907E-01 -9.06378E-01
- 2 4.22463E-02 -2.62790E-01
- 3 -9.87536E-02 -1.02830E-01
- 4 -4.14298E-02 4.39334E-02
- 5 -3.73275E-02 -8.30798E-02
- 6 -6.52865E-02 -2.19827E-01
-6 0 *********** SCCS-tyr-asp
- 1 2.60759E-01 -8.72925E-01
- 2 5.19523E-01 5.69634E-02
- 3 -4.90372E-02 -1.62750E-01
- 4 4.20601E-02 3.52954E-02
- 5 -3.15888E-02 -5.83981E-02
- 6 -2.37225E-02 -3.19141E-01
-6 0 *********** SCCS-tyr-his
- 1 -6.01049E-02 -1.32350E+00
- 2 3.09132E-02 1.60375E-01
- 3 -1.51647E-01 -2.73955E-02
- 4 -2.43134E-02 4.27742E-02
- 5 -9.63423E-02 -5.10342E-02
- 6 -4.70408E-02 -3.60935E-01
-6 0 *********** SCCS-tyr-arg
- 1 -4.50758E-01 -5.53968E-01
- 2 -1.38765E-01 -3.14012E-01
- 3 -1.83397E-01 -5.93655E-02
- 4 -7.39288E-03 4.95774E-02
- 5 -1.21274E-01 -4.60344E-02
- 6 -2.67240E-02 -9.33134E-02
-6 0 *********** SCCS-tyr-lys
- 1 -4.13095E-01 -5.26386E-01
- 2 -1.53166E-01 -3.84123E-01
- 3 -1.63802E-01 -9.98995E-02
- 4 -1.04489E-01 1.25757E-01
- 5 -2.51877E-02 -6.26002E-02
- 6 -5.73001E-02 -1.52514E-01
-6 0 *********** SCCS-tyr-pro
- 1 -2.22229E+00 -1.37740E-01
- 2 -4.87112E-01 3.08271E+00
- 3 3.45549E-01 3.56667E-01
- 4 -8.41963E-01 -1.17460E-01
- 5 -5.71056E-01 5.93003E-01
- 6 1.30769E-01 -2.77334E-01
-6 0 *********** SCCS-ala-cys
- 1 -8.78004E-01 5.01767E-02
- 2 2.69999E-01 2.21404E-01
- 3 -1.07276E-01 -1.92933E-02
- 4 -7.20909E-02 7.56565E-02
- 5 -2.68208E-02 -2.07365E-02
- 6 -5.85231E-02 -1.47370E-01
-6 0 *********** SCCS-ala-met
- 1 -5.35076E-01 3.07454E-01
- 2 7.63702E-02 -1.54725E-02
- 3 -3.61258E-02 -1.09351E-01
- 4 -5.43513E-02 8.28805E-02
- 5 -4.77047E-02 -4.50729E-02
- 6 -4.00031E-02 -9.37844E-02
-6 0 *********** SCCS-ala-phe
- 1 -4.22387E-01 3.96474E-01
- 2 2.72607E-02 -9.27268E-02
- 3 -1.16746E-01 -1.38573E-01
- 4 -1.98630E-02 4.29344E-02
- 5 -9.92753E-02 -4.00815E-02
- 6 -2.44434E-02 -3.91092E-02
-6 0 *********** SCCS-ala-ile
- 1 -6.08164E-01 3.76219E-01
- 2 1.74606E-02 -7.01888E-02
- 3 4.21442E-03 -9.67046E-02
- 4 -9.16231E-02 1.20748E-01
- 5 -2.44847E-02 -6.78150E-02
- 6 -4.86552E-02 -1.03992E-01
-6 0 *********** SCCS-ala-leu
- 1 -4.32857E-01 4.54080E-01
- 2 2.22152E-02 -1.21616E-01
- 3 -4.29410E-02 -2.08721E-01
- 4 -5.58708E-02 8.85364E-02
- 5 -5.47986E-02 -6.79193E-02
- 6 -5.44840E-02 -1.10560E-01
-6 0 *********** SCCS-ala-val
- 1 -5.46652E-01 3.94687E-01
- 2 1.06558E-01 -1.02644E-01
- 3 -3.68364E-02 -5.06559E-02
- 4 -3.30635E-02 7.43897E-02
- 5 -1.31426E-01 -6.20887E-02
- 6 9.28900E-03 -2.88931E-02
-6 0 *********** SCCS-ala-trp
- 1 -5.12889E-01 3.54971E-01
- 2 2.48557E-02 5.68926E-03
- 3 -9.38995E-02 -1.25738E-01
- 4 -4.19572E-02 6.46048E-02
- 5 -6.07452E-02 -3.84727E-02
- 6 -3.95298E-02 -8.31586E-02
-6 0 *********** SCCS-ala-tyr
- 1 -4.04256E-01 3.91007E-01
- 2 1.03781E-02 -8.08145E-02
- 3 -1.39132E-01 -1.27036E-01
- 4 -1.29804E-03 4.31630E-02
- 5 -1.16617E-01 -3.22136E-02
- 6 -9.75651E-03 -2.83841E-02
-6 0 *********** SCCS-ala-ala
- 1 -6.12231E-01 1.94524E-01
- 2 1.94660E-01 3.30749E-02
- 3 5.97129E-02 -9.01564E-02
- 4 -8.13668E-02 8.68830E-02
- 5 -1.74542E-03 -2.80352E-02
- 6 -2.09383E-02 -1.06421E-01
-6 0 *********** SCCS-ala-gly
+4 0 *********** SCCS-tyr-thr
+ 1 4.43129E-01 -9.98765E-02
+ 2 2.04282E-02 -2.00306E-01
+ 3 -1.05974E-01 1.38295E-02
+ 4 -3.15679E-02 -3.11278E-02
+4 0 *********** SCCS-tyr-ser
+ 1 6.66665E-01 9.58879E-02
+ 2 3.34355E-01 -9.54379E-02
+ 3 -6.17057E-02 -1.52488E-01
+ 4 7.72154E-02 8.43553E-02
+4 0 *********** SCCS-tyr-gln
+ 1 4.37842E-01 -9.39496E-02
+ 2 4.04782E-02 -1.67628E-01
+ 3 -8.25634E-02 4.71052E-02
+ 4 -3.65037E-02 -1.97291E-02
+4 0 *********** SCCS-tyr-asn
+ 1 5.40093E-01 1.60657E-01
+ 2 2.63253E-01 -4.26824E-02
+ 3 2.73246E-02 -1.10022E-01
+ 4 -2.02731E-03 1.83667E-02
+4 0 *********** SCCS-tyr-glu
+ 1 4.65578E-01 -1.46079E-01
+ 2 7.61706E-03 -1.97810E-01
+ 3 -8.75500E-02 7.24762E-02
+ 4 -3.60083E-02 -1.46126E-02
+4 0 *********** SCCS-tyr-asp
+ 1 5.67738E-01 1.62877E-01
+ 2 2.87863E-01 -4.37540E-02
+ 3 3.52221E-02 -1.23523E-01
+ 4 2.01681E-02 2.44886E-02
+4 0 *********** SCCS-tyr-his
+ 1 4.92109E-01 1.70168E-01
+ 2 2.45441E-01 -1.63849E-02
+ 3 4.64559E-02 -1.29182E-01
+ 4 3.45022E-03 3.48007E-02
+4 0 *********** SCCS-tyr-arg
+ 1 3.14126E-01 -1.95475E-01
+ 2 -9.23748E-02 -1.38555E-01
+ 3 -4.03817E-02 6.17459E-02
+ 4 -3.32932E-02 9.17303E-03
+4 0 *********** SCCS-tyr-lys
+ 1 2.93079E-01 -1.90224E-01
+ 2 -1.01976E-01 -1.53648E-01
+ 3 -2.88171E-02 5.03449E-02
+ 4 -3.86407E-02 -5.83875E-03
+4 0 *********** SCCS-tyr-pro
+ 1 4.64556E-01 1.05697E-01
+ 2 3.36517E-01 -1.50630E-01
+ 3 -1.30342E-01 -1.88491E-01
+ 4 1.93320E-01 1.93493E-02
+4 0 *********** SCCS-ala-cys
+ 1 5.17504E-01 -1.15621E-01
+ 2 -2.78017E-01 -2.46450E-01
+ 3 1.43228E-01 -1.13635E-01
+ 4 1.81971E-02 -2.19186E-02
+4 0 *********** SCCS-ala-met
+ 1 3.06790E-01 -2.72879E-01
+ 2 -2.12822E-01 1.36660E-01
+ 3 -1.64592E-02 -3.59792E-02
+ 4 1.19042E-02 -4.00863E-02
+4 0 *********** SCCS-ala-phe
+ 1 2.93504E-01 -2.78677E-01
+ 2 -1.14338E-01 2.49323E-01
+ 3 -9.15688E-02 -4.35241E-02
+ 4 -2.99342E-02 -2.97687E-02
+4 0 *********** SCCS-ala-ile
+ 1 3.81000E-01 -3.38357E-01
+ 2 -2.69790E-01 1.13978E-01
+ 3 2.20053E-02 -1.06324E-01
+ 4 1.26719E-02 -2.72123E-02
+4 0 *********** SCCS-ala-leu
+ 1 1.87817E-01 -3.83373E-01
+ 2 -2.22169E-01 3.72273E-01
+ 3 -8.10128E-02 -3.27082E-02
+ 4 -6.54640E-04 -6.42731E-02
+4 0 *********** SCCS-ala-val
+ 1 3.29822E-01 -3.04273E-01
+ 2 -3.06624E-01 1.83651E-01
+ 3 -4.32460E-02 -7.25547E-02
+ 4 1.49068E-02 -4.24229E-02
+4 0 *********** SCCS-ala-trp
+ 1 3.24766E-01 -3.31163E-01
+ 2 -1.12692E-01 1.42964E-01
+ 3 -4.08045E-02 -7.47186E-02
+ 4 -2.22856E-02 -3.33097E-02
+4 0 *********** SCCS-ala-tyr
+ 1 2.94138E-01 -2.67378E-01
+ 2 -1.02416E-01 2.54456E-01
+ 3 -7.49459E-02 -2.60298E-02
+ 4 -2.32349E-02 -2.79041E-02
+4 0 *********** SCCS-ala-ala
+ 1 2.78430E-01 -2.18986E-01
+ 2 -4.25143E-01 6.83946E-02
+ 3 8.41961E-02 -3.15499E-02
+ 4 9.37586E-02 5.84512E-03
+4 0 *********** SCCS-ala-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-ala-thr
- 1 -6.80244E-01 2.82399E-01
- 2 1.46140E-01 -1.24080E-01
- 3 -4.28436E-02 1.04690E-02
- 4 -3.79855E-02 4.22225E-02
- 5 -6.83102E-02 -3.97209E-02
- 6 -1.17089E-02 3.21642E-02
-6 0 *********** SCCS-ala-ser
- 1 -1.25828E+00 1.98709E-02
- 2 5.75643E-01 2.72897E-01
- 3 -2.06187E-01 1.42949E-02
- 4 9.61208E-03 6.90565E-02
- 5 -1.24158E-01 2.54657E-02
- 6 -1.76551E-02 -1.00876E-01
-6 0 *********** SCCS-ala-gln
- 1 -6.67556E-01 2.35138E-01
- 2 1.53103E-01 5.32959E-02
- 3 -4.69499E-02 -8.98371E-02
- 4 -3.23213E-02 8.59389E-02
- 5 -5.31865E-02 -3.29743E-02
- 6 -3.24962E-02 -1.10470E-01
-6 0 *********** SCCS-ala-asn
- 1 -8.82213E-01 -1.96353E-01
- 2 1.61854E-01 4.02598E-01
- 3 -1.74884E-01 4.24055E-02
- 4 -3.24830E-02 9.41099E-02
- 5 -7.58262E-02 -3.80648E-02
- 6 -5.64397E-02 -2.40526E-01
-6 0 *********** SCCS-ala-glu
- 1 -6.94975E-01 3.25872E-01
- 2 1.54176E-01 -2.10567E-02
- 3 -1.44469E-02 -9.91634E-02
- 4 -2.64213E-02 9.63849E-02
- 5 -5.95332E-02 -3.34288E-02
- 6 -3.12275E-02 -8.37471E-02
-6 0 *********** SCCS-ala-asp
- 1 -9.42341E-01 -1.72029E-01
- 2 2.35718E-01 3.36372E-01
- 3 -1.53346E-01 9.23925E-02
- 4 1.21705E-02 4.39880E-02
- 5 -1.46440E-01 3.00360E-02
- 6 8.63453E-03 -1.02406E-01
-6 0 *********** SCCS-ala-his
- 1 -8.49054E-01 -1.04507E-01
- 2 1.56506E-01 3.05873E-01
- 3 -1.70738E-01 4.72288E-02
- 4 -9.09632E-02 1.19454E-01
- 5 -4.07039E-02 -3.00495E-02
- 6 -7.80062E-02 -2.11413E-01
-6 0 *********** SCCS-ala-arg
- 1 -3.93547E-01 3.43901E-01
- 2 3.30017E-02 -6.15635E-02
- 3 -8.65490E-02 -1.22140E-01
- 4 -1.24218E-02 5.69747E-02
- 5 -9.40418E-02 -3.31139E-02
- 6 -2.36903E-02 -4.90555E-02
-6 0 *********** SCCS-ala-lys
- 1 -4.43823E-01 3.59670E-01
- 2 1.59415E-02 -4.10491E-02
- 3 -3.10706E-02 -1.44413E-01
- 4 -4.48412E-02 9.07903E-02
- 5 -3.18838E-02 -4.91322E-02
- 6 -4.14286E-02 -1.02421E-01
-6 0 *********** SCCS-ala-pro
- 1 5.92441E-01 4.23394E-01
- 2 -4.48057E-02 1.16083E+00
- 3 -1.49893E-01 -5.59499E-02
- 4 -6.45567E-02 4.79780E-01
- 5 4.50455E-01 -1.92333E-01
- 6 -1.65095E-01 -8.22323E-01
-6 0 *********** SCCS-gly-cys
+4 0 *********** SCCS-ala-thr
+ 1 3.77641E-01 -3.13359E-01
+ 2 -2.80922E-01 8.72298E-02
+ 3 1.50802E-02 -9.86901E-02
+ 4 2.88410E-02 -1.46565E-02
+4 0 *********** SCCS-ala-ser
+ 1 5.72896E-01 3.51691E-02
+ 2 -2.61807E-01 -5.26417E-01
+ 3 2.19606E-01 -1.44148E-01
+ 4 1.22317E-02 -1.52747E-02
+4 0 *********** SCCS-ala-gln
+ 1 4.05550E-01 -2.85079E-01
+ 2 -2.55923E-01 7.39632E-03
+ 3 -2.48059E-02 -1.37493E-01
+ 4 9.74316E-03 -2.67603E-02
+4 0 *********** SCCS-ala-asn
+ 1 6.23989E-01 -4.68698E-02
+ 2 -6.72975E-02 -4.10474E-01
+ 3 1.87023E-01 -2.95986E-02
+ 4 1.45295E-02 -1.66240E-02
+4 0 *********** SCCS-ala-glu
+ 1 3.99331E-01 -3.34843E-01
+ 2 -2.83988E-01 6.59348E-02
+ 3 -4.72190E-02 -1.51632E-01
+ 4 -3.86735E-03 -2.22313E-02
+4 0 *********** SCCS-ala-asp
+ 1 6.61667E-01 -5.40240E-02
+ 2 -7.71390E-02 -4.21717E-01
+ 3 1.95768E-01 -2.74466E-02
+ 4 1.34416E-02 3.71095E-03
+4 0 *********** SCCS-ala-his
+ 1 6.48420E-01 -4.93751E-02
+ 2 2.18602E-02 -3.27254E-01
+ 3 2.02531E-01 9.70109E-02
+ 4 4.05286E-03 2.16230E-02
+4 0 *********** SCCS-ala-arg
+ 1 2.38360E-01 -3.17928E-01
+ 2 -1.17734E-01 2.35691E-01
+ 3 -3.31488E-02 -2.26556E-02
+ 4 -9.22722E-03 -1.22751E-02
+4 0 *********** SCCS-ala-lys
+ 1 1.90188E-01 -3.46793E-01
+ 2 -1.72410E-01 2.76499E-01
+ 3 -3.79097E-02 1.47776E-02
+ 4 3.59765E-03 -3.93860E-02
+4 0 *********** SCCS-ala-pro
+ 1 7.05480E-01 -1.44827E-01
+ 2 -1.13182E-01 -2.87785E-01
+ 3 4.06266E-01 -2.54091E-01
+ 4 4.58362E-02 -2.52399E-02
+4 0 *********** SCCS-gly-cys
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-met
+4 0 *********** SCCS-gly-met
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-phe
+4 0 *********** SCCS-gly-phe
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-ile
+4 0 *********** SCCS-gly-ile
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-leu
+4 0 *********** SCCS-gly-leu
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-val
+4 0 *********** SCCS-gly-val
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-trp
+4 0 *********** SCCS-gly-trp
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-tyr
+4 0 *********** SCCS-gly-tyr
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-ala
+4 0 *********** SCCS-gly-ala
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-gly
+4 0 *********** SCCS-gly-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-thr
+4 0 *********** SCCS-gly-thr
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-ser
+4 0 *********** SCCS-gly-ser
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-gln
+4 0 *********** SCCS-gly-gln
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-asn
+4 0 *********** SCCS-gly-asn
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-glu
+4 0 *********** SCCS-gly-glu
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-asp
+4 0 *********** SCCS-gly-asp
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-his
+4 0 *********** SCCS-gly-his
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-arg
+4 0 *********** SCCS-gly-arg
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-lys
+4 0 *********** SCCS-gly-lys
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gly-pro
+4 0 *********** SCCS-gly-pro
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-thr-cys
- 1 -4.78252E-01 -1.21282E+00
- 2 2.30200E-01 -1.93371E-01
- 3 -2.62189E-01 -1.34267E-02
- 4 1.20677E-01 -5.43489E-02
- 5 -2.28955E-01 -2.49593E-02
- 6 3.45747E-02 -1.30880E-01
-6 0 *********** SCCS-thr-met
- 1 -4.76883E-01 -6.89293E-01
- 2 -1.13823E-01 -2.94833E-01
- 3 -1.70193E-01 -1.86699E-02
- 4 -1.10863E-02 4.45008E-02
- 5 -1.15430E-01 -6.80059E-02
- 6 -3.24995E-02 -1.17920E-01
-6 0 *********** SCCS-thr-phe
- 1 -5.50351E-01 -7.12325E-01
- 2 -3.23486E-01 -1.53650E-01
- 3 -1.34118E-01 -8.39328E-02
- 4 -7.59681E-02 9.41809E-02
- 5 -3.47416E-02 -9.43178E-02
- 6 -7.94893E-02 -2.51501E-01
-6 0 *********** SCCS-thr-ile
- 1 -4.74101E-01 -9.61700E-01
- 2 -1.96021E-01 -3.37099E-01
- 3 -3.04114E-01 1.15258E-01
- 4 5.99404E-02 4.48290E-02
- 5 -1.65781E-01 -4.79378E-02
- 6 2.44909E-03 -5.78368E-02
-6 0 *********** SCCS-thr-leu
- 1 -5.18402E-01 -4.57179E-01
- 2 -3.35443E-01 -4.02755E-01
- 3 -1.64278E-01 -1.10675E-01
- 4 -3.93933E-02 9.99274E-02
- 5 -1.12048E-01 -8.64722E-02
- 6 -2.20778E-02 -1.39755E-01
-6 0 *********** SCCS-thr-val
- 1 -5.36201E-01 -6.61594E-01
- 2 -1.90235E-01 -4.54193E-01
- 3 -1.73250E-01 -3.63807E-02
- 4 -1.54668E-01 1.71872E-01
- 5 5.10418E-02 -1.16297E-01
- 6 -9.69115E-02 -1.95628E-01
-6 0 *********** SCCS-thr-trp
- 1 -6.10855E-01 -7.62383E-01
- 2 -8.03668E-02 -1.22626E-01
- 3 -1.52481E-01 -6.08235E-02
- 4 -2.03662E-02 1.60383E-02
- 5 -1.19499E-01 -3.98874E-02
- 6 -3.06429E-02 -1.67410E-01
-6 0 *********** SCCS-thr-tyr
- 1 -5.82783E-01 -7.01074E-01
- 2 -2.87141E-01 -7.06469E-02
- 3 -1.60396E-01 -5.44901E-02
- 4 2.09835E-02 3.01896E-02
- 5 -1.25293E-01 -4.31272E-02
- 6 -4.37682E-02 -1.81502E-01
-6 0 *********** SCCS-thr-ala
- 1 -4.57130E-01 -4.24338E-01
- 2 1.40275E-01 -5.64149E-01
- 3 -2.64578E-01 -3.40173E-02
- 4 6.40720E-02 7.40211E-02
- 5 -2.67262E-01 -1.30189E-02
- 6 7.00275E-02 3.47947E-02
-6 0 *********** SCCS-thr-gly
+4 0 *********** SCCS-thr-cys
+ 1 6.94146E-01 -1.10554E-01
+ 2 -3.15401E-01 -2.43730E-01
+ 3 8.32213E-02 -7.15149E-02
+ 4 5.66906E-02 8.41925E-03
+4 0 *********** SCCS-thr-met
+ 1 4.32580E-01 -2.39169E-01
+ 2 -2.56341E-01 1.56166E-01
+ 3 -5.16709E-03 4.76564E-02
+ 4 1.03130E-02 -4.42845E-02
+4 0 *********** SCCS-thr-phe
+ 1 4.15597E-01 -2.72196E-01
+ 2 -1.51395E-01 2.99282E-01
+ 3 -4.50011E-02 3.19434E-02
+ 4 -3.07748E-02 -1.79729E-02
+4 0 *********** SCCS-thr-ile
+ 1 5.39174E-01 -2.24077E-01
+ 2 -3.27413E-01 7.71185E-02
+ 3 -4.86396E-02 2.77815E-02
+ 4 4.52735E-02 -5.11917E-02
+4 0 *********** SCCS-thr-leu
+ 1 3.27056E-01 -3.30255E-01
+ 2 -2.49986E-01 4.43994E-01
+ 3 -6.32695E-03 5.11674E-02
+ 4 -6.20378E-02 -8.73174E-02
+4 0 *********** SCCS-thr-val
+ 1 4.58099E-01 -3.02824E-01
+ 2 -4.19837E-01 2.14224E-01
+ 3 -3.97065E-02 2.92216E-02
+ 4 -7.84974E-03 -8.54191E-02
+4 0 *********** SCCS-thr-trp
+ 1 4.78223E-01 -2.54797E-01
+ 2 -1.58174E-01 1.26678E-01
+ 3 -1.92522E-02 2.16408E-02
+ 4 -8.29943E-03 -3.27046E-02
+4 0 *********** SCCS-thr-tyr
+ 1 4.16175E-01 -2.63677E-01
+ 2 -1.04597E-01 2.78809E-01
+ 3 -4.67057E-02 2.51712E-02
+ 4 -2.98319E-02 -1.77672E-02
+4 0 *********** SCCS-thr-ala
+ 1 3.50298E-01 -1.15334E-01
+ 2 -5.12625E-01 1.63761E-01
+ 3 1.85377E-02 4.73053E-02
+ 4 1.02115E-01 -8.55357E-02
+4 0 *********** SCCS-thr-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-thr-thr
- 1 -4.00198E-01 -8.37045E-01
- 2 1.31558E-01 -3.11476E-01
- 3 -2.82928E-01 -3.09156E-01
- 4 -2.91050E-01 2.16151E-01
- 5 1.62207E-01 -1.29139E-01
- 6 -1.99401E-01 -4.43480E-01
-6 0 *********** SCCS-thr-ser
- 1 -6.91653E-01 -1.77025E+00
- 2 3.19225E-01 -1.53412E-01
- 3 -2.40168E-01 -2.27141E-01
- 4 -3.10878E-03 -4.34126E-03
- 5 -1.16980E-01 -1.02597E-01
- 6 -6.51546E-02 -4.38794E-01
-6 0 *********** SCCS-thr-gln
- 1 -5.78616E-01 -8.24726E-01
- 2 7.23174E-02 -1.74898E-01
- 3 -1.25154E-01 -6.13718E-02
- 4 4.23225E-03 -4.72411E-03
- 5 -1.15575E-01 -5.90561E-02
- 6 -3.22209E-02 -1.59844E-01
-6 0 *********** SCCS-thr-asn
- 1 -2.97795E-01 -1.12293E+00
- 2 3.80284E-01 -2.41235E-03
- 3 -1.60209E-01 -8.45606E-02
- 4 1.20696E-01 -5.27442E-02
- 5 -1.94928E-01 -4.42491E-02
- 6 1.81182E-02 -2.21766E-01
-6 0 *********** SCCS-thr-glu
- 1 -6.60150E-01 -8.99749E-01
- 2 1.54939E-02 -2.39422E-01
- 3 -1.50985E-01 -4.71386E-02
- 4 -8.99812E-03 -1.89234E-02
- 5 -1.30256E-01 -6.21209E-02
- 6 -3.54086E-02 -1.41274E-01
-6 0 *********** SCCS-thr-asp
- 1 -8.28763E-02 -9.70862E-01
- 2 5.16883E-01 -3.22882E-01
- 3 -2.81189E-01 -8.89955E-02
- 4 1.40981E-01 -5.01782E-02
- 5 -2.33595E-01 -2.02784E-02
- 6 5.54853E-02 -8.22412E-02
-6 0 *********** SCCS-thr-his
- 1 -3.98116E-01 -1.34384E+00
- 2 1.69249E-01 6.75837E-02
- 3 -1.88083E-01 -5.60535E-02
- 4 4.69898E-02 -2.90069E-03
- 5 -7.39476E-02 1.33782E-02
- 6 -7.93948E-02 -2.65030E-01
-6 0 *********** SCCS-thr-arg
- 1 -5.42741E-01 -5.01279E-01
- 2 -1.88557E-01 -2.04413E-01
- 3 -1.30541E-01 -1.04576E-01
- 4 -8.71559E-02 1.17049E-01
- 5 -3.46579E-02 -8.81523E-02
- 6 -7.37831E-02 -2.24380E-01
-6 0 *********** SCCS-thr-lys
- 1 -4.78204E-01 -5.06985E-01
- 2 -2.06269E-01 -3.50811E-01
- 3 -1.55467E-01 -5.96862E-02
- 4 7.58353E-03 1.00290E-01
- 5 -1.32738E-01 -4.69953E-02
- 6 -2.22697E-02 -1.07470E-01
-6 0 *********** SCCS-thr-pro
- 1 -1.67495E+00 1.99389E+00
- 2 4.18464E-01 2.38030E+00
- 3 -1.02443E+00 3.98025E-01
- 4 -2.77855E-01 5.99878E-01
- 5 -8.59721E-01 3.47303E-01
- 6 -3.80802E-01 -3.84736E-01
-6 0 *********** SCCS-ser-cys
- 1 -6.75936E-01 -2.51372E-01
- 2 2.83749E-01 2.22765E-02
- 3 -8.37611E-02 -2.98347E-02
- 4 -1.25832E-02 2.82799E-02
- 5 -4.89796E-02 -1.31941E-02
- 6 -2.04676E-02 -9.34153E-02
-6 0 *********** SCCS-ser-met
- 1 -4.79277E-01 -5.85533E-02
- 2 4.67438E-02 -9.61475E-02
- 3 -7.78201E-02 -1.10824E-01
- 4 -3.68149E-02 4.88099E-02
- 5 -8.43379E-02 -4.71735E-02
- 6 -3.11575E-02 -1.05951E-01
-6 0 *********** SCCS-ser-phe
- 1 -4.40817E-01 -1.93201E-03
- 2 -3.75256E-02 -4.70413E-02
- 3 -1.11120E-01 -2.00006E-01
- 4 -1.03561E-01 8.27181E-02
- 5 -3.10534E-02 -5.29796E-02
- 6 -7.45012E-02 -1.88387E-01
-6 0 *********** SCCS-ser-ile
- 1 -4.89129E-01 -9.71660E-02
- 2 6.96478E-02 -9.84504E-02
- 3 -9.78677E-02 -6.23724E-02
- 4 -4.38765E-02 4.39530E-02
- 5 -7.58677E-02 -4.90286E-02
- 6 -3.04404E-02 -8.35285E-02
-6 0 *********** SCCS-ser-leu
- 1 -4.61498E-01 5.70563E-02
- 2 -5.70577E-02 -1.52749E-01
- 3 -8.29277E-02 -1.86562E-01
- 4 -1.35198E-03 6.69431E-02
- 5 -1.25108E-01 -2.25713E-02
- 6 -3.30351E-02 -9.94868E-02
-6 0 *********** SCCS-ser-val
- 1 -4.91643E-01 -5.75777E-03
- 2 1.56976E-02 -1.20510E-01
- 3 -6.39172E-02 -1.37088E-01
- 4 -8.35079E-02 7.43083E-02
- 5 -2.99272E-02 -3.25470E-02
- 6 -7.48698E-02 -1.03754E-01
-6 0 *********** SCCS-ser-trp
- 1 -4.90971E-01 -7.66287E-02
- 2 7.58249E-02 -6.22292E-02
- 3 -1.49855E-01 -9.47067E-02
- 4 1.49302E-02 2.48190E-02
- 5 -1.45208E-01 -2.49698E-02
- 6 -4.35175E-04 -8.53366E-02
-6 0 *********** SCCS-ser-tyr
- 1 -4.17677E-01 2.35700E-03
- 2 -4.83259E-02 -4.16898E-02
- 3 -1.25891E-01 -1.79935E-01
- 4 -7.78872E-02 9.52749E-02
- 5 -3.47220E-02 -5.12502E-02
- 6 -7.29019E-02 -1.81669E-01
-6 0 *********** SCCS-ser-ala
- 1 -5.17095E-01 -7.94432E-02
- 2 1.72920E-01 -1.53668E-01
- 3 -9.76482E-02 4.32460E-02
- 4 9.89786E-02 3.44415E-02
- 5 -1.85130E-01 -4.41722E-02
- 6 5.61277E-02 -1.20588E-02
-6 0 *********** SCCS-ser-gly
+4 0 *********** SCCS-thr-thr
+ 1 5.32639E-01 -2.51788E-01
+ 2 -3.65678E-01 2.80268E-02
+ 3 -8.20267E-02 3.41941E-02
+ 4 3.20060E-02 -3.66002E-02
+4 0 *********** SCCS-thr-ser
+ 1 8.29226E-01 -4.47256E-02
+ 2 -3.07794E-01 -5.43561E-01
+ 3 1.52434E-01 -1.70668E-01
+ 4 4.02455E-02 2.94916E-02
+4 0 *********** SCCS-thr-gln
+ 1 5.44618E-01 -2.61200E-01
+ 2 -2.91685E-01 -8.52894E-04
+ 3 -6.22562E-02 -3.13102E-02
+ 4 7.05645E-03 -3.96955E-02
+4 0 *********** SCCS-thr-asn
+ 1 7.29074E-01 1.96296E-02
+ 2 -1.83089E-01 -4.48830E-01
+ 3 8.45099E-02 -7.55621E-02
+ 4 1.42241E-02 2.85328E-02
+4 0 *********** SCCS-thr-glu
+ 1 5.55177E-01 -3.20515E-01
+ 2 -3.35056E-01 6.64964E-02
+ 3 -8.15214E-02 -1.60734E-02
+ 4 -5.10384E-03 -6.58212E-02
+4 0 *********** SCCS-thr-asp
+ 1 7.77903E-01 1.48359E-02
+ 2 -1.81561E-01 -4.55763E-01
+ 3 8.06929E-02 -8.81991E-02
+ 4 2.74675E-02 2.53221E-02
+4 0 *********** SCCS-thr-his
+ 1 7.18127E-01 5.33399E-02
+ 2 -5.18661E-02 -3.85563E-01
+ 3 1.00852E-01 -1.09336E-03
+ 4 9.59055E-03 3.86896E-02
+4 0 *********** SCCS-thr-arg
+ 1 3.55433E-01 -3.15600E-01
+ 2 -1.53066E-01 2.59433E-01
+ 3 1.89246E-03 4.45031E-02
+ 4 -2.07639E-02 -2.58293E-02
+4 0 *********** SCCS-thr-lys
+ 1 3.15369E-01 -3.08440E-01
+ 2 -2.15935E-01 3.06506E-01
+ 3 9.15967E-03 7.76526E-02
+ 4 -2.41978E-02 -4.64169E-02
+4 0 *********** SCCS-thr-pro
+ 1 8.64041E-01 -3.46195E-02
+ 2 -2.43266E-01 -5.75809E-01
+ 3 9.44992E-02 -3.26994E-01
+ 4 4.31977E-02 -2.28477E-02
+4 0 *********** SCCS-ser-cys
+ 1 1.12657E+00 -4.05912E-01
+ 2 -2.04372E-01 2.21214E-01
+ 3 1.94762E-01 -2.38945E-02
+ 4 2.72424E-02 -1.36295E-01
+4 0 *********** SCCS-ser-met
+ 1 5.52897E-01 -5.23767E-01
+ 2 1.93424E-01 3.78624E-01
+ 3 1.58880E-01 -8.44168E-02
+ 4 -2.30319E-02 -3.90520E-02
+4 0 *********** SCCS-ser-phe
+ 1 6.07247E-01 -6.37768E-01
+ 2 4.84383E-01 1.21296E-01
+ 3 -5.03608E-04 -1.46678E-01
+ 4 -7.88804E-02 -4.13110E-03
+4 0 *********** SCCS-ser-ile
+ 1 8.28835E-01 -6.04995E-01
+ 2 3.10932E-01 5.50024E-01
+ 3 2.93309E-01 -1.09850E-01
+ 4 1.53895E-02 -2.36185E-02
+4 0 *********** SCCS-ser-leu
+ 1 2.18535E-01 -6.37048E-01
+ 2 6.23176E-01 5.76774E-01
+ 3 1.30993E-01 -1.16495E-01
+ 4 -1.08630E-02 6.41354E-02
+4 0 *********** SCCS-ser-val
+ 1 6.94161E-01 -5.64087E-01
+ 2 3.62179E-01 6.66479E-01
+ 3 2.67300E-01 -1.35004E-01
+ 4 -1.23872E-03 2.69694E-02
+4 0 *********** SCCS-ser-trp
+ 1 6.83990E-01 -6.22528E-01
+ 2 2.18412E-01 2.10656E-01
+ 3 4.96465E-02 -1.90013E-01
+ 4 -5.13491E-02 -1.09238E-02
+4 0 *********** SCCS-ser-tyr
+ 1 5.94121E-01 -6.45033E-01
+ 2 4.43614E-01 6.71824E-02
+ 3 -5.00495E-03 -1.30727E-01
+ 4 -7.13470E-02 -2.88808E-03
+4 0 *********** SCCS-ser-ala
+ 1 2.91750E-01 -4.88415E-01
+ 2 -9.19135E-02 8.74485E-01
+ 3 2.11077E-01 3.74125E-02
+ 4 -4.78129E-02 -3.48121E-02
+4 0 *********** SCCS-ser-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-ser-thr
- 1 -4.78359E-01 -1.05343E-01
- 2 1.25776E-01 -1.06119E-01
- 3 -1.18951E-01 -8.34825E-02
- 4 -5.75417E-02 6.94834E-02
- 5 -7.02717E-02 -6.29224E-02
- 6 -3.55264E-02 -1.23105E-01
-6 0 *********** SCCS-ser-ser
- 1 -9.33073E-01 -3.08202E-01
- 2 4.33602E-01 1.17228E-01
- 3 -3.07553E-02 -1.72160E-01
- 4 -1.47558E-01 1.50928E-01
- 5 1.90943E-01 -9.29047E-02
- 6 -1.44184E-01 -3.58001E-01
-6 0 *********** SCCS-ser-gln
- 1 -5.59586E-01 -1.28952E-01
- 2 1.44841E-01 -5.37194E-02
- 3 -7.17698E-02 -8.96105E-02
- 4 -4.40377E-02 4.77416E-02
- 5 -4.85355E-02 -4.67083E-02
- 6 -3.69193E-02 -1.24130E-01
-6 0 *********** SCCS-ser-asn
- 1 -6.51055E-01 -4.39756E-01
- 2 2.48476E-01 1.53902E-01
- 3 -1.80528E-01 -1.23069E-02
- 4 -4.77216E-02 9.02530E-02
- 5 -6.22917E-02 2.54240E-03
- 6 -3.74477E-02 -1.92629E-01
-6 0 *********** SCCS-ser-glu
- 1 -5.91225E-01 -8.29610E-02
- 2 1.36775E-01 -1.06866E-01
- 3 -5.84922E-02 -8.64410E-02
- 4 -5.33579E-02 5.12381E-02
- 5 -5.25020E-02 -5.63398E-02
- 6 -3.31115E-02 -1.06697E-01
-6 0 *********** SCCS-ser-asp
- 1 -5.91005E-01 -3.74842E-01
- 2 2.42275E-01 9.30429E-02
- 3 -1.71360E-01 3.33390E-02
- 4 8.66703E-04 7.33567E-02
- 5 -3.62694E-02 -2.52558E-02
- 6 -6.07643E-02 -1.46528E-01
-6 0 *********** SCCS-ser-his
- 1 -5.31584E-01 -4.23968E-01
- 2 1.78112E-01 2.18263E-01
- 3 -1.91242E-01 -4.86434E-02
- 4 -5.74705E-02 9.23880E-02
- 5 -6.57485E-02 -6.23534E-02
- 6 -8.41895E-03 -2.86348E-01
-6 0 *********** SCCS-ser-arg
- 1 -4.25794E-01 7.53531E-03
- 2 -1.30989E-02 -8.86256E-02
- 3 -1.18246E-01 -1.16565E-01
- 4 -5.29254E-02 7.23512E-02
- 5 -8.41741E-02 -4.71509E-02
- 6 -2.76868E-02 -1.18162E-01
-6 0 *********** SCCS-ser-lys
- 1 -4.33240E-01 -6.29186E-03
- 2 -1.43180E-02 -1.22178E-01
- 3 -9.51192E-02 -1.23200E-01
- 4 -2.80523E-02 5.77444E-02
- 5 -1.14024E-01 -4.81200E-02
- 6 -1.53999E-02 -1.03247E-01
-6 0 *********** SCCS-ser-pro
- 1 3.70161E-01 5.65740E-01
- 2 1.05712E-01 1.04689E+00
- 3 -1.78745E-02 6.36354E-01
- 4 -2.03219E-01 4.43976E-01
- 5 -6.52191E-01 4.55377E-01
- 6 -3.06751E-01 1.59676E-01
-6 0 *********** SCCS-gln-cys
- 1 -3.78657E-01 -1.03174E+00
- 2 2.99986E-01 -6.08579E-02
- 3 -1.74084E-01 -1.86924E-02
- 4 1.23712E-01 -2.59351E-02
- 5 -1.53103E-01 -3.48945E-02
- 6 2.49076E-02 -1.74405E-01
-6 0 *********** SCCS-gln-met
- 1 -3.97262E-01 -6.36989E-01
- 2 9.77800E-03 -3.10533E-01
- 3 -1.80090E-01 -5.82939E-02
- 4 -4.26313E-02 3.74287E-02
- 5 -8.73326E-02 -4.34022E-02
- 6 -3.23650E-02 -9.90856E-02
-6 0 *********** SCCS-gln-phe
- 1 -4.47849E-01 -6.47983E-01
- 2 -2.06546E-01 -2.38765E-01
- 3 -1.45039E-01 -1.45211E-01
- 4 -1.32275E-01 9.73647E-02
- 5 -7.25739E-03 -8.60319E-02
- 6 -1.00530E-01 -2.43895E-01
-6 0 *********** SCCS-gln-ile
- 1 -3.59745E-01 -8.06123E-01
- 2 -8.35108E-03 -3.54256E-01
- 3 -2.93051E-01 1.63909E-03
- 4 -4.44899E-02 -5.23598E-04
- 5 -1.13093E-01 -1.87610E-02
- 6 -3.02316E-02 -2.87519E-02
-6 0 *********** SCCS-gln-leu
- 1 -4.69746E-01 -4.39820E-01
- 2 -1.67933E-01 -5.12800E-01
- 3 -1.73229E-01 -1.31450E-01
- 4 -3.43452E-02 8.76257E-02
- 5 -1.36679E-01 -4.84730E-02
- 6 4.40327E-03 -7.22009E-02
-6 0 *********** SCCS-gln-val
- 1 -5.15814E-01 -6.16676E-01
- 2 3.32873E-02 -4.13802E-01
- 3 -1.89944E-01 -1.70376E-01
- 4 -2.52293E-01 1.69662E-01
- 5 9.08513E-02 -2.66504E-02
- 6 -8.76044E-02 -1.89805E-01
-6 0 *********** SCCS-gln-trp
- 1 -4.83279E-01 -7.00803E-01
- 2 -1.36902E-02 -1.85220E-01
- 3 -1.67112E-01 -7.37444E-02
- 4 -9.19416E-03 2.43077E-02
- 5 -1.51276E-01 -4.24719E-02
- 6 -3.14920E-03 -1.48435E-01
-6 0 *********** SCCS-gln-tyr
- 1 -4.54834E-01 -6.35611E-01
- 2 -2.27888E-01 -1.90841E-01
- 3 -1.49858E-01 -1.01266E-01
- 4 -6.86815E-02 8.49749E-02
- 5 -5.92009E-02 -6.88625E-02
- 6 -6.06456E-02 -2.09833E-01
-6 0 *********** SCCS-gln-ala
- 1 -4.24436E-01 -4.20815E-01
- 2 3.31291E-01 -5.05157E-01
- 3 -2.44482E-01 -3.42572E-02
- 4 7.75718E-02 -1.00779E-02
- 5 -2.09211E-01 -2.94344E-02
- 6 7.16461E-02 5.52702E-02
-6 0 *********** SCCS-gln-gly
+4 0 *********** SCCS-ser-thr
+ 1 5.97190E-01 -6.25224E-01
+ 2 -1.05158E-01 6.42155E-01
+ 3 2.04056E-01 -1.68946E-02
+ 4 3.56706E-02 -1.42799E-02
+4 0 *********** SCCS-ser-ser
+ 1 1.52873E+00 -3.54863E-01
+ 2 -5.14291E-01 1.50261E-01
+ 3 7.43751E-02 -8.86048E-04
+ 4 1.34172E-01 -8.00352E-02
+4 0 *********** SCCS-ser-gln
+ 1 6.96482E-01 -6.02667E-01
+ 2 -8.72616E-02 2.77530E-01
+ 3 4.07313E-02 -1.34747E-01
+ 4 -4.71931E-02 -9.46027E-02
+4 0 *********** SCCS-ser-asn
+ 1 1.11561E+00 -4.15743E-01
+ 2 -4.64873E-01 3.47477E-02
+ 3 3.25972E-02 -4.08680E-02
+ 4 1.91945E-02 -9.03816E-02
+4 0 *********** SCCS-ser-glu
+ 1 7.64680E-01 -6.78554E-01
+ 2 3.96633E-03 3.30346E-01
+ 3 8.40013E-02 -1.30851E-01
+ 4 -4.91193E-02 -7.39387E-02
+4 0 *********** SCCS-ser-asp
+ 1 1.28950E+00 -4.72641E-01
+ 2 -4.47849E-01 8.30029E-02
+ 3 2.25887E-02 3.44555E-02
+ 4 1.69517E-02 -7.94096E-02
+4 0 *********** SCCS-ser-his
+ 1 1.13239E+00 -4.48872E-01
+ 2 -2.52264E-01 2.14956E-02
+ 3 2.19007E-01 4.35203E-02
+ 4 7.47493E-02 -1.98832E-02
+4 0 *********** SCCS-ser-arg
+ 1 3.96490E-01 -5.99399E-01
+ 2 3.73001E-01 3.41080E-01
+ 3 1.05579E-01 -1.31530E-01
+ 4 -1.00618E-02 -1.83315E-03
+4 0 *********** SCCS-ser-lys
+ 1 2.66381E-01 -5.72008E-01
+ 2 3.93176E-01 4.27667E-01
+ 3 1.60034E-01 -5.56215E-02
+ 4 -9.38006E-03 2.60630E-02
+4 0 *********** SCCS-ser-pro
+ 1 1.75239E+00 7.86060E-02
+ 2 -7.34679E-01 6.12669E-02
+ 3 2.08017E-01 -5.04840E-02
+ 4 2.47507E-01 -1.67663E-02
+4 0 *********** SCCS-gln-cys
+ 1 5.79299E-01 -3.92261E-01
+ 2 4.78812E-02 1.59890E-01
+ 3 -4.19228E-04 9.15860E-03
+ 4 2.19637E-02 -9.74747E-03
+4 0 *********** SCCS-gln-met
+ 1 2.60284E-01 -4.42096E-01
+ 2 1.67225E-01 3.36405E-02
+ 3 3.09445E-03 -2.56183E-02
+ 4 -1.06754E-02 -1.63804E-03
+4 0 *********** SCCS-gln-phe
+ 1 1.87631E-01 -4.95490E-01
+ 2 1.83229E-01 -8.94963E-02
+ 3 -1.27097E-02 -2.03116E-02
+ 4 7.76995E-03 2.45116E-02
+4 0 *********** SCCS-gln-ile
+ 1 3.92171E-01 -4.79698E-01
+ 2 1.78783E-01 6.83637E-02
+ 3 6.47875E-03 -2.62212E-02
+ 4 2.31055E-03 -1.54887E-02
+4 0 *********** SCCS-gln-leu
+ 1 1.14007E-01 -4.60150E-01
+ 2 2.53930E-01 -4.84242E-02
+ 3 2.46070E-02 -3.40276E-02
+ 4 -3.00650E-02 1.14012E-02
+4 0 *********** SCCS-gln-val
+ 1 2.92983E-01 -4.80541E-01
+ 2 2.40605E-01 8.05510E-02
+ 3 2.49547E-02 -2.96703E-02
+ 4 -3.41654E-02 -2.04849E-02
+4 0 *********** SCCS-gln-trp
+ 1 2.75555E-01 -4.97123E-01
+ 2 1.26874E-01 -5.73869E-03
+ 3 -1.05645E-02 -1.30748E-02
+ 4 -2.01834E-03 1.13898E-03
+4 0 *********** SCCS-gln-tyr
+ 1 1.74347E-01 -4.97323E-01
+ 2 1.50749E-01 -9.23285E-02
+ 3 -1.36964E-02 -1.53743E-02
+ 4 5.29976E-03 1.10334E-02
+4 0 *********** SCCS-gln-ala
+ 1 2.34424E-01 -3.04211E-01
+ 2 2.31434E-01 1.61410E-01
+ 3 2.96583E-02 1.55498E-02
+ 4 -1.84200E-02 -4.01721E-02
+4 0 *********** SCCS-gln-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-gln-thr
- 1 -3.03209E-01 -6.98179E-01
- 2 2.44917E-01 -3.04184E-01
- 3 -2.39339E-01 -2.87544E-01
- 4 -2.05542E-01 6.12287E-02
- 5 -6.70010E-03 -8.58810E-02
- 6 -1.29112E-01 -2.79558E-01
-6 0 *********** SCCS-gln-ser
- 1 -7.07382E-01 -1.36578E+00
- 2 4.93845E-01 1.99758E-01
- 3 -4.10441E-02 -2.36320E-01
- 4 1.19249E-02 6.98319E-02
- 5 3.41754E-02 -5.64061E-02
- 6 -2.46900E-02 -5.06199E-01
-6 0 *********** SCCS-gln-gln
- 1 -4.70075E-01 -7.61202E-01
- 2 1.59596E-01 -1.63292E-01
- 3 -1.32824E-01 -7.51517E-02
- 4 5.97928E-03 1.20702E-03
- 5 -1.02351E-01 -3.95062E-02
- 6 -1.44607E-02 -1.48045E-01
-6 0 *********** SCCS-gln-asn
- 1 -2.23034E-01 -1.00535E+00
- 2 3.68944E-01 1.29083E-01
- 3 -1.54627E-01 -4.01162E-03
- 4 1.77949E-01 -2.68915E-02
- 5 -1.97537E-01 -1.60013E-03
- 6 5.02450E-02 -1.99642E-01
-6 0 *********** SCCS-gln-glu
- 1 -5.43431E-01 -8.05564E-01
- 2 1.45278E-01 -2.51063E-01
- 3 -1.63713E-01 -7.71359E-02
- 4 -2.09429E-02 -7.85377E-03
- 5 -1.04595E-01 -3.89351E-02
- 6 -2.64487E-02 -1.15315E-01
-6 0 *********** SCCS-gln-asp
- 1 7.07679E-03 -8.17827E-01
- 2 4.97616E-01 -4.63663E-02
- 3 -1.74624E-01 2.28487E-02
- 4 1.08495E-01 -8.19002E-03
- 5 -1.27738E-01 1.20698E-03
- 6 2.23359E-02 -9.95721E-02
-6 0 *********** SCCS-gln-his
- 1 -2.52482E-01 -1.14883E+00
- 2 2.24564E-01 1.98816E-01
- 3 -1.85558E-01 2.05834E-04
- 4 4.91996E-02 8.60683E-03
- 5 -1.49607E-01 -2.46427E-02
- 6 -7.93116E-03 -2.87346E-01
-6 0 *********** SCCS-gln-arg
- 1 -4.72072E-01 -4.77430E-01
- 2 -8.78127E-02 -2.68670E-01
- 3 -1.55619E-01 -1.13500E-01
- 4 -8.92743E-02 8.81233E-02
- 5 -5.08411E-02 -5.91076E-02
- 6 -5.26929E-02 -1.59327E-01
-6 0 *********** SCCS-gln-lys
- 1 -4.20651E-01 -4.86376E-01
- 2 -5.74136E-02 -4.11034E-01
- 3 -1.81302E-01 -5.72312E-02
- 4 -4.94468E-02 7.51362E-02
- 5 -1.45406E-01 -6.40972E-02
- 6 9.89860E-03 -7.93734E-02
-6 0 *********** SCCS-gln-pro
- 1 -2.33433E+01 6.16546E-01
- 2 2.19328E+01 2.31249E+00
- 3 -2.26728E+01 5.13543E-01
- 4 2.19107E+01 -2.60800E-01
- 5 -2.31940E+01 5.68846E-01
- 6 1.12249E+01 2.13542E-01
-6 0 *********** SCCS-asn-cys
- 1 -3.81221E-01 -1.24183E+00
- 2 1.77744E-01 -2.24530E-01
- 3 -2.19645E-01 1.91884E-03
- 4 5.68149E-02 5.55250E-03
- 5 -9.88176E-02 -2.94638E-02
- 6 -5.76986E-03 -1.61760E-01
-6 0 *********** SCCS-asn-met
- 1 -4.14485E-01 -7.03590E-01
- 2 -5.65333E-02 -3.34035E-01
- 3 -1.65019E-01 -5.54883E-02
- 4 -6.62833E-02 6.43652E-02
- 5 -4.65185E-02 -7.25391E-02
- 6 -5.59685E-02 -1.37172E-01
-6 0 *********** SCCS-asn-phe
- 1 -4.88728E-01 -7.90689E-01
- 2 -2.41462E-01 -2.18277E-01
- 3 -1.27789E-01 -2.35880E-01
- 4 -1.13521E-01 1.33365E-01
- 5 5.46675E-02 -1.38110E-01
- 6 -1.27259E-01 -3.86126E-01
-6 0 *********** SCCS-asn-ile
- 1 -4.06873E-01 -9.20526E-01
- 2 -6.55001E-02 -3.69403E-01
- 3 -3.07097E-01 -7.27184E-02
- 4 -1.56268E-01 1.47582E-01
- 5 2.94983E-02 -1.14863E-02
- 6 -6.64692E-02 -1.83426E-01
-6 0 *********** SCCS-asn-leu
- 1 -4.56668E-01 -6.23593E-01
- 2 -1.82973E-01 -5.60058E-01
- 3 -2.55619E-01 -5.19992E-02
- 4 2.44867E-02 1.02573E-01
- 5 -2.37314E-01 -6.01161E-02
- 6 5.79650E-02 -6.83231E-02
-6 0 *********** SCCS-asn-val
- 1 -4.96020E-01 -7.68406E-01
- 2 -5.31078E-02 -3.96118E-01
- 3 -2.18497E-01 -2.30010E-01
- 4 -2.80039E-01 2.46263E-01
- 5 1.03583E-01 -9.09713E-02
- 6 -1.06927E-01 -3.52591E-01
-6 0 *********** SCCS-asn-trp
- 1 -4.99099E-01 -8.07351E-01
- 2 -1.29660E-01 -1.55795E-01
- 3 -1.28933E-01 -5.85417E-02
- 4 -7.80390E-03 1.45275E-02
- 5 -1.31421E-01 -6.70676E-02
- 6 -3.22116E-02 -1.78027E-01
-6 0 *********** SCCS-asn-tyr
- 1 -5.05318E-01 -7.81759E-01
- 2 -2.49523E-01 -1.56773E-01
- 3 -1.39998E-01 -2.35873E-01
- 4 -1.42535E-01 1.63922E-01
- 5 4.76773E-02 -1.39603E-01
- 6 -1.47019E-01 -4.21563E-01
-6 0 *********** SCCS-asn-ala
- 1 -2.65872E-01 -6.13325E-01
- 2 3.86720E-01 -5.51795E-01
- 3 -3.89547E-01 3.96087E-03
- 4 5.67089E-02 1.02255E-02
- 5 -3.22979E-01 -2.48239E-02
- 6 9.74780E-02 5.91367E-02
-6 0 *********** SCCS-asn-gly
+4 0 *********** SCCS-gln-thr
+ 1 3.72524E-01 -4.51041E-01
+ 2 1.52057E-01 1.40094E-01
+ 3 3.02990E-02 -1.91968E-02
+ 4 -3.59983E-03 -2.59568E-02
+4 0 *********** SCCS-gln-ser
+ 1 7.06676E-01 -3.49953E-01
+ 2 2.15481E-02 2.18139E-01
+ 3 -7.06996E-03 3.61775E-02
+ 4 3.88715E-02 -1.19804E-02
+4 0 *********** SCCS-gln-gln
+ 1 3.45167E-01 -4.83364E-01
+ 2 1.09744E-01 8.74874E-02
+ 3 -1.41305E-02 1.23287E-02
+ 4 -2.35528E-02 4.53373E-04
+4 0 *********** SCCS-gln-asn
+ 1 6.05408E-01 -3.11408E-01
+ 2 -1.21350E-02 1.78216E-01
+ 3 -3.39004E-02 2.93603E-02
+ 4 1.65826E-02 2.08530E-02
+4 0 *********** SCCS-gln-glu
+ 1 3.57855E-01 -5.33509E-01
+ 2 1.46387E-01 6.89503E-02
+ 3 3.22538E-03 4.56514E-03
+ 4 -2.05340E-02 -7.87216E-03
+4 0 *********** SCCS-gln-asp
+ 1 6.42044E-01 -3.21931E-01
+ 2 1.24171E-02 1.71516E-01
+ 3 -2.30269E-02 3.44125E-02
+ 4 3.71335E-02 2.06943E-02
+4 0 *********** SCCS-gln-his
+ 1 5.81423E-01 -3.02122E-01
+ 2 -1.66860E-02 1.20394E-01
+ 3 -2.64290E-02 -1.31693E-02
+ 4 4.12599E-02 3.48810E-02
+4 0 *********** SCCS-gln-arg
+ 1 1.32993E-01 -4.67945E-01
+ 2 1.75658E-01 -4.29680E-02
+ 3 -4.65605E-03 -3.18778E-02
+ 4 -1.33197E-02 4.57256E-03
+4 0 *********** SCCS-gln-lys
+ 1 1.12536E-01 -4.26087E-01
+ 2 2.09075E-01 -1.43530E-02
+ 3 8.78889E-03 -2.92447E-02
+ 4 -2.20890E-02 3.54246E-03
+4 0 *********** SCCS-gln-pro
+ 1 7.34775E-01 -2.94956E-01
+ 2 -8.33276E-03 2.05041E-01
+ 3 8.67681E-03 1.83067E-02
+ 4 9.83198E-02 6.77699E-03
+4 0 *********** SCCS-asn-cys
+ 1 5.04335E-01 -7.39264E-01
+ 2 1.65204E-01 3.02986E-01
+ 3 -5.78337E-02 -3.47671E-02
+ 4 -2.37965E-02 1.77826E-02
+4 0 *********** SCCS-asn-met
+ 1 1.77178E-01 -6.13369E-01
+ 2 3.39709E-01 6.61443E-02
+ 3 -2.62225E-02 -8.08027E-02
+ 4 -1.42941E-02 2.09088E-02
+4 0 *********** SCCS-asn-phe
+ 1 2.14472E-01 -6.53363E-01
+ 2 3.62519E-01 -1.10511E-01
+ 3 -7.57402E-02 3.28164E-03
+ 4 -1.23714E-02 5.52818E-02
+4 0 *********** SCCS-asn-ile
+ 1 3.25121E-01 -7.10652E-01
+ 2 3.76442E-01 1.57116E-01
+ 3 1.16290E-02 -9.84483E-02
+ 4 -8.25687E-03 -3.35860E-04
+4 0 *********** SCCS-asn-leu
+ 1 1.29184E-01 -5.84371E-01
+ 2 5.58686E-01 -7.39847E-02
+ 3 -5.71794E-02 -1.53406E-02
+ 4 9.76635E-03 6.80307E-03
+4 0 *********** SCCS-asn-val
+ 1 2.15116E-01 -6.63449E-01
+ 2 4.94741E-01 1.82214E-01
+ 3 2.16339E-02 -1.10162E-01
+ 4 -1.48604E-02 6.05498E-03
+4 0 *********** SCCS-asn-trp
+ 1 2.23583E-01 -7.19405E-01
+ 2 2.14051E-01 -5.47469E-02
+ 3 -5.78897E-02 -9.80034E-03
+ 4 5.28692E-03 3.83168E-02
+4 0 *********** SCCS-asn-tyr
+ 1 1.74799E-01 -6.51312E-01
+ 2 3.33445E-01 -1.55248E-01
+ 3 -4.96369E-02 -1.86586E-02
+ 4 1.13473E-04 6.49258E-02
+4 0 *********** SCCS-asn-ala
+ 1 3.93563E-01 -3.61207E-01
+ 2 4.16689E-01 3.56767E-01
+ 3 -4.80322E-02 -1.47193E-01
+ 4 -1.46148E-02 -8.93927E-03
+4 0 *********** SCCS-asn-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-asn-thr
- 1 -3.05529E-01 -7.17547E-01
- 2 1.89052E-01 -4.54335E-01
- 3 -2.86506E-01 -1.86811E-01
- 4 -1.13599E-01 -5.41133E-02
- 5 -1.19741E-01 -4.42205E-02
- 6 -5.43206E-02 -6.50022E-02
-6 0 *********** SCCS-asn-ser
- 1 -6.89183E-01 -1.79737E+00
- 2 3.94757E-01 -1.47323E-01
- 3 -2.22155E-01 -2.68679E-01
- 4 -2.72310E-02 2.43246E-02
- 5 -6.40004E-02 -8.64620E-02
- 6 -6.13375E-02 -4.74422E-01
-6 0 *********** SCCS-asn-gln
- 1 -4.93659E-01 -8.60870E-01
- 2 7.12198E-02 -1.54778E-01
- 3 -1.24473E-01 -6.06627E-02
- 4 -1.46071E-03 2.23055E-02
- 5 -6.06458E-02 -7.47387E-02
- 6 -4.79627E-02 -2.01273E-01
-6 0 *********** SCCS-asn-asn
- 1 -5.08546E-02 -1.10601E+00
- 2 3.62859E-01 2.06370E-01
- 3 -2.19120E-01 -1.40081E-01
- 4 9.68600E-02 3.05455E-04
- 5 -1.13958E-01 -5.14073E-02
- 6 2.73311E-02 -3.72200E-01
-6 0 *********** SCCS-asn-glu
- 1 -5.82316E-01 -9.26292E-01
- 2 2.82638E-02 -2.66133E-01
- 3 -1.48082E-01 -5.10984E-02
- 4 -3.95615E-02 4.71363E-03
- 5 -7.65485E-02 -8.38700E-02
- 6 -6.27427E-02 -1.73783E-01
-6 0 *********** SCCS-asn-asp
- 1 1.58497E-01 -9.20923E-01
- 2 6.98850E-01 1.19949E-01
- 3 -1.32246E-01 -2.58848E-01
- 4 -1.45539E-02 1.08537E-01
- 5 1.21489E-03 -1.11350E-01
- 6 -4.98969E-02 -4.92381E-01
-6 0 *********** SCCS-asn-his
- 1 -4.70519E-02 -1.35731E+00
- 2 4.06081E-02 1.86889E-01
- 3 -1.67461E-01 -3.27274E-02
- 4 -7.99144E-03 3.11632E-02
- 5 -8.77365E-02 -6.67197E-02
- 6 -5.82699E-02 -3.84061E-01
-6 0 *********** SCCS-asn-arg
- 1 -4.82403E-01 -5.45529E-01
- 2 -1.17244E-01 -2.86891E-01
- 3 -1.67906E-01 -6.23761E-02
- 4 -4.48542E-02 5.31104E-02
- 5 -9.64431E-02 -6.25849E-02
- 6 -2.86109E-02 -1.11286E-01
-6 0 *********** SCCS-asn-lys
- 1 -4.03420E-01 -5.61829E-01
- 2 -1.35882E-01 -4.14959E-01
- 3 -1.94967E-01 -4.56707E-02
- 4 -4.83526E-02 8.49845E-02
- 5 -1.19811E-01 -5.39978E-02
- 6 -7.36229E-03 -8.95423E-02
-6 0 *********** SCCS-asn-pro
- 1 -3.67224E+00 4.68734E-02
- 2 1.77071E-01 3.46357E+00
- 3 3.13984E-01 -2.85396E-01
- 4 -8.86506E-01 -5.57566E-01
- 5 -1.14756E+00 9.67820E-01
- 6 5.91455E-01 -7.81408E-02
-6 0 *********** SCCS-glu-cys
- 1 -4.83925E-01 -6.51298E-01
- 2 4.28198E-01 6.62544E-02
- 3 -1.08338E-01 -9.99842E-03
- 4 1.38581E-01 1.40218E-02
- 5 -8.30239E-02 -3.01554E-02
- 6 2.99992E-02 -1.72604E-01
-6 0 *********** SCCS-glu-met
- 1 -3.93119E-01 -3.98059E-01
- 2 9.69646E-02 -2.72972E-01
- 3 -1.37647E-01 -9.00019E-02
- 4 -4.46393E-02 1.15511E-02
- 5 -1.00741E-01 -3.89598E-02
- 6 -2.45381E-02 -6.15883E-02
-6 0 *********** SCCS-glu-phe
- 1 -3.95727E-01 -3.74910E-01
- 2 -1.01446E-01 -2.38418E-01
- 3 -1.30590E-01 -1.93845E-01
- 4 -1.19484E-01 7.51964E-02
- 5 -5.30626E-02 -5.84511E-02
- 6 -8.15070E-02 -1.80758E-01
-6 0 *********** SCCS-glu-ile
- 1 -3.76411E-01 -4.69599E-01
- 2 1.27676E-01 -2.87101E-01
- 3 -1.87287E-01 -5.72492E-02
- 4 -5.37534E-02 -2.61303E-02
- 5 -1.47236E-01 -2.76259E-02
- 6 -2.62566E-02 -1.26201E-02
-6 0 *********** SCCS-glu-leu
- 1 -4.24362E-01 -2.20791E-01
- 2 -9.48430E-02 -4.67883E-01
- 3 -1.29599E-01 -1.87328E-01
- 4 -7.47320E-02 7.40743E-02
- 5 -1.55034E-01 -5.66349E-02
- 6 -2.11177E-02 -6.92212E-02
-6 0 *********** SCCS-glu-val
- 1 -4.62405E-01 -3.55735E-01
- 2 7.06503E-02 -3.87041E-01
- 3 -1.14871E-01 -1.22447E-01
- 4 -1.53633E-01 9.45069E-02
- 5 -6.44192E-03 -9.52620E-02
- 6 -8.99715E-02 -1.38035E-01
-6 0 *********** SCCS-glu-trp
- 1 -4.24069E-01 -4.42051E-01
- 2 8.70206E-02 -2.06026E-01
- 3 -1.61927E-01 -1.04064E-01
- 4 -3.16868E-02 1.19989E-02
- 5 -1.22331E-01 -3.34510E-02
- 6 -2.03725E-02 -9.52521E-02
-6 0 *********** SCCS-glu-tyr
- 1 -4.12882E-01 -3.75196E-01
- 2 -9.64704E-02 -1.81167E-01
- 3 -1.47505E-01 -1.66643E-01
- 4 -7.52565E-02 6.90457E-02
- 5 -7.95121E-02 -5.76465E-02
- 6 -4.72807E-02 -1.87221E-01
-6 0 *********** SCCS-glu-ala
- 1 -4.50264E-01 -2.41613E-01
- 2 2.92979E-01 -4.03720E-01
- 3 -1.07326E-01 -2.86858E-02
- 4 1.07420E-02 9.28010E-03
- 5 -1.62466E-01 -6.07238E-02
- 6 3.08043E-02 1.59837E-02
-6 0 *********** SCCS-glu-gly
+4 0 *********** SCCS-asn-thr
+ 1 3.01041E-01 -6.87682E-01
+ 2 3.44749E-01 1.81216E-01
+ 3 4.16396E-02 -8.47487E-02
+ 4 -4.45363E-02 -4.98194E-03
+4 0 *********** SCCS-asn-ser
+ 1 7.09361E-01 -7.69862E-01
+ 2 8.21010E-04 4.13794E-01
+ 3 -1.25945E-01 6.26593E-02
+ 4 -1.76184E-02 -1.81647E-02
+4 0 *********** SCCS-asn-gln
+ 1 2.43864E-01 -7.20861E-01
+ 2 1.91086E-01 1.52343E-01
+ 3 -2.69797E-02 6.76108E-03
+ 4 -4.41378E-02 4.58135E-02
+4 0 *********** SCCS-asn-asn
+ 1 7.30592E-01 -5.65273E-01
+ 2 -2.75405E-01 2.93682E-01
+ 3 -2.05638E-02 -9.66590E-03
+ 4 9.89644E-03 8.66577E-02
+4 0 *********** SCCS-asn-glu
+ 1 2.14632E-01 -7.88719E-01
+ 2 2.97187E-01 1.15949E-01
+ 3 -2.46968E-02 -1.43120E-03
+ 4 -1.08428E-02 2.79630E-02
+4 0 *********** SCCS-asn-asp
+ 1 8.22186E-01 -5.80883E-01
+ 2 -2.44168E-01 3.22652E-01
+ 3 -1.32451E-02 2.30903E-02
+ 4 1.41592E-02 7.94026E-02
+4 0 *********** SCCS-asn-his
+ 1 7.19791E-01 -5.65635E-01
+ 2 -2.64163E-01 1.25458E-01
+ 3 1.91594E-02 -1.18050E-01
+ 4 3.78487E-02 5.24126E-02
+4 0 *********** SCCS-asn-arg
+ 1 6.43093E-02 -6.13105E-01
+ 2 3.08886E-01 -7.30893E-02
+ 3 -6.80516E-02 -4.40328E-02
+ 4 -5.48462E-03 1.77752E-02
+4 0 *********** SCCS-asn-lys
+ 1 3.21498E-02 -5.46633E-01
+ 2 4.33619E-01 -3.83997E-02
+ 3 -2.22108E-02 -8.69999E-02
+ 4 -1.23561E-03 5.22853E-03
+4 0 *********** SCCS-asn-pro
+ 1 7.96828E-01 -6.84591E-01
+ 2 -5.26010E-02 4.56772E-01
+ 3 -1.28984E-01 -2.92455E-04
+ 4 1.10783E-01 -1.48442E-02
+4 0 *********** SCCS-glu-cys
+ 1 6.53687E-01 -4.34079E-01
+ 2 1.22866E-01 1.34640E-01
+ 3 -2.24722E-02 -4.32294E-02
+ 4 1.06070E-02 -7.61586E-03
+4 0 *********** SCCS-glu-met
+ 1 2.86066E-01 -4.82459E-01
+ 2 2.06963E-01 -3.97914E-03
+ 3 -2.44571E-02 -3.93101E-02
+ 4 -1.04628E-02 -4.58590E-03
+4 0 *********** SCCS-glu-phe
+ 1 2.15763E-01 -5.46055E-01
+ 2 1.95022E-01 -1.48417E-01
+ 3 -3.36618E-02 -1.10796E-02
+ 4 -4.21384E-04 2.54868E-02
+4 0 *********** SCCS-glu-ile
+ 1 4.41373E-01 -5.32014E-01
+ 2 2.34752E-01 2.82503E-02
+ 3 -2.51430E-02 -6.01055E-02
+ 4 7.50058E-03 -1.34671E-02
+4 0 *********** SCCS-glu-leu
+ 1 1.37141E-01 -4.97969E-01
+ 2 2.90161E-01 -1.08859E-01
+ 3 5.04866E-04 -1.64053E-02
+ 4 -2.79236E-02 -8.20153E-03
+4 0 *********** SCCS-glu-val
+ 1 3.34791E-01 -5.20620E-01
+ 2 3.01756E-01 2.81141E-02
+ 3 -8.05096E-03 -4.20069E-02
+ 4 -1.80520E-02 -3.07707E-02
+4 0 *********** SCCS-glu-trp
+ 1 3.03533E-01 -5.52919E-01
+ 2 1.40792E-01 -4.61200E-02
+ 3 -4.27719E-02 -1.67625E-02
+ 4 -2.07383E-03 9.02039E-03
+4 0 *********** SCCS-glu-tyr
+ 1 1.99606E-01 -5.47577E-01
+ 2 1.61049E-01 -1.51422E-01
+ 3 -3.22340E-02 -1.13962E-02
+ 4 -1.61419E-03 1.55745E-02
+4 0 *********** SCCS-glu-ala
+ 1 2.60662E-01 -3.28473E-01
+ 2 3.02258E-01 1.58958E-01
+ 3 5.30925E-03 -2.35769E-02
+ 4 1.05477E-02 -3.63619E-02
+4 0 *********** SCCS-glu-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-glu-thr
- 1 -3.46300E-01 -4.54820E-01
- 2 2.79076E-01 -2.35428E-01
- 3 -1.60513E-01 -2.12761E-01
- 4 -1.66896E-01 2.87269E-02
- 5 3.02522E-02 -8.25169E-02
- 6 -1.34128E-01 -1.92987E-01
-6 0 *********** SCCS-glu-ser
- 1 -8.09848E-01 -8.35414E-01
- 2 6.96541E-01 3.10409E-01
- 3 1.97702E-02 -2.23115E-01
- 4 5.38167E-02 9.85310E-02
- 5 9.26524E-02 -6.68563E-02
- 6 -2.36952E-02 -4.82460E-01
-6 0 *********** SCCS-glu-gln
- 1 -4.64697E-01 -4.83320E-01
- 2 2.66658E-01 -1.49366E-01
- 3 -1.15317E-01 -1.02810E-01
- 4 -3.67854E-04 1.04164E-02
- 5 -8.83899E-02 -3.72327E-02
- 6 -1.16800E-02 -1.25933E-01
-6 0 *********** SCCS-glu-asn
- 1 -4.02183E-01 -7.44981E-01
- 2 3.80473E-01 2.59710E-01
- 3 -1.32614E-01 3.60203E-02
- 4 1.31910E-01 3.14564E-02
- 5 -1.67914E-01 3.70731E-03
- 6 4.12805E-02 -2.09748E-01
-6 0 *********** SCCS-glu-glu
- 1 -5.09946E-01 -4.76098E-01
- 2 2.75008E-01 -2.48104E-01
- 3 -1.34941E-01 -1.19108E-01
- 4 -2.49491E-02 -1.14406E-02
- 5 -1.04198E-01 -4.35712E-02
- 6 -2.61808E-02 -8.55270E-02
-6 0 *********** SCCS-glu-asp
- 1 -2.84960E-01 -6.02513E-01
- 2 4.48531E-01 1.03066E-01
- 3 -1.40949E-01 8.08122E-02
- 4 1.25542E-01 1.57985E-02
- 5 -1.16764E-01 -7.08610E-03
- 6 4.35504E-02 -1.12851E-01
-6 0 *********** SCCS-glu-his
- 1 -4.07188E-01 -7.83162E-01
- 2 3.00161E-01 3.13014E-01
- 3 -1.63240E-01 -7.26344E-03
- 4 5.67369E-02 -6.28908E-04
- 5 -9.20148E-02 -3.56579E-02
- 6 1.68771E-02 -2.72410E-01
-6 0 *********** SCCS-glu-arg
- 1 -4.18216E-01 -2.97057E-01
- 2 -3.33698E-02 -2.66117E-01
- 3 -1.38048E-01 -1.40957E-01
- 4 -8.99499E-02 7.72389E-02
- 5 -6.26684E-02 -5.93368E-02
- 6 -5.42176E-02 -1.31592E-01
-6 0 *********** SCCS-glu-lys
- 1 -3.93136E-01 -2.92323E-01
- 2 -3.26113E-04 -3.79367E-01
- 3 -1.39488E-01 -1.16637E-01
- 4 -4.45234E-02 6.53483E-02
- 5 -1.58335E-01 -5.34744E-02
- 6 -4.87018E-03 -7.21846E-02
-6 0 *********** SCCS-glu-pro
- 1 -3.22728E+01 2.76828E-01
- 2 3.15410E+01 2.14163E+00
- 3 -3.21600E+01 7.20103E-01
- 4 3.15072E+01 -8.47577E-02
- 5 -3.27421E+01 5.34799E-01
- 6 1.58796E+01 1.98602E-01
-6 0 *********** SCCS-asp-cys
- 1 -3.52954E-01 -1.21645E+00
- 2 2.21333E-01 -1.93029E-01
- 3 -2.18015E-01 -7.31833E-02
- 4 -1.87280E-03 8.21963E-02
- 5 6.10175E-03 -7.28159E-02
- 6 -6.41219E-02 -2.90572E-01
-6 0 *********** SCCS-asp-met
- 1 -3.95745E-01 -7.03791E-01
- 2 -1.42978E-02 -3.31229E-01
- 3 -1.75391E-01 -6.01463E-02
- 4 -7.96403E-02 7.63324E-02
- 5 -4.23240E-02 -5.55756E-02
- 6 -6.04913E-02 -1.36538E-01
-6 0 *********** SCCS-asp-phe
- 1 -4.56026E-01 -7.92210E-01
- 2 -2.09706E-01 -2.49879E-01
- 3 -1.12844E-01 -2.25917E-01
- 4 -1.07112E-01 1.42175E-01
- 5 3.79239E-02 -1.22999E-01
- 6 -1.20597E-01 -3.59660E-01
-6 0 *********** SCCS-asp-ile
- 1 -3.95318E-01 -9.10024E-01
- 2 -2.67416E-02 -3.48730E-01
- 3 -3.02038E-01 -9.96869E-02
- 4 -1.58748E-01 1.41879E-01
- 5 2.93623E-02 -2.62496E-02
- 6 -7.20971E-02 -2.04820E-01
-6 0 *********** SCCS-asp-leu
- 1 -4.22149E-01 -6.34803E-01
- 2 -1.45220E-01 -5.77916E-01
- 3 -2.51513E-01 -6.08448E-02
- 4 1.08794E-02 8.73552E-02
- 5 -2.17136E-01 -3.99329E-02
- 6 4.45664E-02 -4.44983E-02
-6 0 *********** SCCS-asp-val
- 1 -4.67524E-01 -7.80561E-01
- 2 -1.03988E-02 -3.66211E-01
- 3 -2.37349E-01 -2.60624E-01
- 4 -2.38084E-01 1.91404E-01
- 5 1.16954E-01 -6.17612E-02
- 6 -1.28134E-01 -3.18337E-01
-6 0 *********** SCCS-asp-trp
- 1 -4.63547E-01 -8.07769E-01
- 2 -1.23520E-01 -1.64406E-01
- 3 -1.27800E-01 -5.46336E-02
- 4 -1.23681E-02 1.79990E-02
- 5 -1.19191E-01 -6.49684E-02
- 6 -3.83501E-02 -1.72175E-01
-6 0 *********** SCCS-asp-tyr
- 1 -4.76082E-01 -7.86935E-01
- 2 -2.30890E-01 -1.81926E-01
- 3 -1.49339E-01 -2.35846E-01
- 4 -1.49388E-01 1.57514E-01
- 5 4.67536E-02 -1.46085E-01
- 6 -1.46854E-01 -4.18679E-01
-6 0 *********** SCCS-asp-ala
- 1 -2.32058E-01 -6.32426E-01
- 2 4.50134E-01 -5.03699E-01
- 3 -4.30041E-01 -2.09810E-02
- 4 1.12163E-01 -4.00665E-02
- 5 -3.13276E-01 3.18392E-02
- 6 6.21935E-02 1.02867E-01
-6 0 *********** SCCS-asp-gly
+4 0 *********** SCCS-glu-thr
+ 1 4.14591E-01 -4.92306E-01
+ 2 2.06813E-01 1.14666E-01
+ 3 1.04520E-02 -4.84441E-02
+ 4 1.55668E-03 -2.39491E-02
+4 0 *********** SCCS-glu-ser
+ 1 8.20411E-01 -3.74788E-01
+ 2 1.41651E-01 2.12538E-01
+ 3 -6.21859E-03 -1.79885E-02
+ 4 3.80900E-02 -4.92337E-03
+4 0 *********** SCCS-glu-gln
+ 1 3.76192E-01 -5.30580E-01
+ 2 1.42354E-01 5.64657E-02
+ 3 -5.15342E-02 -1.01811E-04
+ 4 -2.54485E-02 8.47337E-03
+4 0 *********** SCCS-glu-asn
+ 1 6.68741E-01 -3.25679E-01
+ 2 5.95386E-02 2.08143E-01
+ 3 -3.75853E-02 -3.46718E-02
+ 4 8.52328E-03 3.37193E-02
+4 0 *********** SCCS-glu-glu
+ 1 3.97863E-01 -5.90618E-01
+ 2 1.81295E-01 2.15547E-02
+ 3 -3.83104E-02 -5.40193E-03
+ 4 -1.75773E-02 -1.93044E-03
+4 0 *********** SCCS-glu-asp
+ 1 7.26648E-01 -3.38866E-01
+ 2 9.14696E-02 2.01477E-01
+ 3 -2.62763E-03 -2.50737E-02
+ 4 1.37337E-02 3.33863E-02
+4 0 *********** SCCS-glu-his
+ 1 6.45652E-01 -3.22105E-01
+ 2 2.88133E-02 1.41654E-01
+ 3 1.41278E-02 -7.41916E-02
+ 4 1.84667E-02 3.66436E-02
+4 0 *********** SCCS-glu-arg
+ 1 1.47048E-01 -5.09324E-01
+ 2 1.93342E-01 -8.72346E-02
+ 3 -2.65704E-02 -3.06199E-02
+ 4 -1.38107E-02 1.72608E-03
+4 0 *********** SCCS-glu-lys
+ 1 1.27552E-01 -4.60023E-01
+ 2 2.41286E-01 -5.68118E-02
+ 3 -1.10430E-02 -2.82039E-02
+ 4 -1.80561E-02 -1.09528E-02
+4 0 *********** SCCS-glu-pro
+ 1 8.38284E-01 -3.23945E-01
+ 2 1.06881E-01 1.92895E-01
+ 3 5.24047E-02 -7.01651E-02
+ 4 1.19062E-01 1.62763E-02
+4 0 *********** SCCS-asp-cys
+ 1 4.83105E-01 -8.50263E-01
+ 2 -4.11716E-02 3.00082E-01
+ 3 3.82279E-02 -1.71003E-01
+ 4 -8.20459E-02 -5.36035E-02
+4 0 *********** SCCS-asp-met
+ 1 1.40426E-01 -6.26797E-01
+ 2 2.56246E-01 1.79435E-01
+ 3 -2.10572E-02 -1.16520E-01
+ 4 -4.84116E-02 3.00437E-02
+4 0 *********** SCCS-asp-phe
+ 1 1.56568E-01 -6.37251E-01
+ 2 3.27439E-01 1.39893E-02
+ 3 -1.14869E-01 -8.95667E-03
+ 4 -2.77096E-02 6.44187E-02
+4 0 *********** SCCS-asp-ile
+ 1 2.15592E-01 -7.70118E-01
+ 2 2.70457E-01 2.89710E-01
+ 3 3.17738E-03 -1.85282E-01
+ 4 -6.27790E-02 2.14411E-02
+4 0 *********** SCCS-asp-leu
+ 1 -2.93893E-02 -5.75986E-01
+ 2 5.44014E-01 1.32738E-01
+ 3 -1.10651E-01 -3.60087E-02
+ 4 2.26130E-02 4.31327E-02
+4 0 *********** SCCS-asp-val
+ 1 1.07323E-01 -7.01274E-01
+ 2 3.61795E-01 3.45811E-01
+ 3 -1.24262E-02 -1.76175E-01
+ 4 -7.10526E-02 3.98444E-02
+4 0 *********** SCCS-asp-trp
+ 1 1.86159E-01 -7.22919E-01
+ 2 1.85783E-01 4.21482E-02
+ 3 -9.32844E-02 -5.54396E-02
+ 4 -2.55758E-02 6.06168E-02
+4 0 *********** SCCS-asp-tyr
+ 1 1.39018E-01 -6.33202E-01
+ 2 3.11716E-01 -1.63136E-02
+ 3 -9.24718E-02 -1.39666E-02
+ 4 -3.23903E-02 7.58724E-02
+4 0 *********** SCCS-asp-ala
+ 1 2.56086E-01 -3.90897E-01
+ 2 2.57773E-01 4.97315E-01
+ 3 5.59778E-03 -1.74054E-01
+ 4 -5.38422E-02 1.42699E-02
+4 0 *********** SCCS-asp-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-asp-thr
- 1 -2.96801E-01 -7.11565E-01
- 2 2.07561E-01 -4.28272E-01
- 3 -2.75265E-01 -1.96542E-01
- 4 -1.02218E-01 -5.41524E-02
- 5 -1.21109E-01 -5.19017E-02
- 6 -5.22935E-02 -8.32035E-02
-6 0 *********** SCCS-asp-ser
- 1 -5.19174E-01 -1.72903E+00
- 2 5.48601E-01 -9.01117E-02
- 3 -1.07748E-01 -2.61897E-01
- 4 3.06619E-02 6.93575E-02
- 5 -1.37603E-03 -5.34243E-02
- 6 -5.73852E-02 -4.81042E-01
-6 0 *********** SCCS-asp-gln
- 1 -4.61379E-01 -8.58253E-01
- 2 8.17725E-02 -1.51520E-01
- 3 -1.30568E-01 -6.45556E-02
- 4 -8.74168E-03 2.88781E-02
- 5 -4.98967E-02 -7.09336E-02
- 6 -5.40534E-02 -2.01335E-01
-6 0 *********** SCCS-asp-asn
- 1 -2.24117E-03 -1.07526E+00
- 2 3.79431E-01 2.34388E-01
- 3 -2.13192E-01 -1.07573E-01
- 4 9.44475E-02 2.95296E-02
- 5 -1.65426E-01 -3.27545E-02
- 6 2.88829E-02 -3.62430E-01
-6 0 *********** SCCS-asp-glu
- 1 -5.43235E-01 -9.33408E-01
- 2 3.77760E-02 -2.55719E-01
- 3 -1.63582E-01 -5.75832E-02
- 4 -3.43118E-02 1.69303E-02
- 5 -6.61767E-02 -7.15137E-02
- 6 -6.05608E-02 -1.77847E-01
-6 0 *********** SCCS-asp-asp
- 1 2.17163E-01 -8.90870E-01
- 2 6.60009E-01 1.29795E-01
- 3 -8.30166E-02 -2.40335E-01
- 4 -5.40702E-02 7.35194E-02
- 5 1.07373E-02 -7.22221E-02
- 6 -4.37594E-02 -4.23589E-01
-6 0 *********** SCCS-asp-his
- 1 6.09761E-02 -1.31169E+00
- 2 -2.13485E-02 1.72700E-01
- 3 -1.18879E-01 -4.46483E-02
- 4 -4.93479E-02 5.14306E-02
- 5 -8.30584E-02 -7.18622E-02
- 6 -4.02941E-02 -3.93830E-01
-6 0 *********** SCCS-asp-arg
- 1 -4.63187E-01 -5.50821E-01
- 2 -7.41568E-02 -2.97612E-01
- 3 -2.11668E-01 -6.72155E-02
- 4 8.58760E-03 3.28651E-02
- 5 -1.31738E-01 -3.72341E-02
- 6 -9.44403E-03 -8.43181E-02
-6 0 *********** SCCS-asp-lys
- 1 -3.83336E-01 -5.61383E-01
- 2 -1.11841E-01 -4.25025E-01
- 3 -1.90188E-01 -4.98107E-02
- 4 -5.88165E-02 8.49811E-02
- 5 -1.07852E-01 -5.58818E-02
- 6 -9.66201E-03 -8.16972E-02
-6 0 *********** SCCS-asp-pro
- 1 -2.83195E+00 1.42514E-01
- 2 1.40687E-01 2.73096E+00
- 3 1.93788E-01 8.37874E-02
- 4 -6.30711E-01 -3.69117E-01
- 5 -1.16730E+00 8.66219E-01
- 6 4.46134E-01 1.07090E-01
-6 0 *********** SCCS-his-cys
- 1 -3.20786E-01 -1.12470E+00
- 2 3.59659E-01 9.54694E-02
- 3 -1.82801E-01 -2.11047E-01
- 4 -6.08196E-02 1.23057E-01
- 5 4.55057E-02 -8.97291E-02
- 6 -9.88602E-02 -4.81590E-01
-6 0 *********** SCCS-his-met
- 1 -3.83211E-01 -6.53762E-01
- 2 7.59601E-03 -3.10874E-01
- 3 -1.75426E-01 -7.12684E-02
- 4 -7.20627E-02 5.19460E-02
- 5 -5.70430E-02 -4.96980E-02
- 6 -5.16797E-02 -1.16673E-01
-6 0 *********** SCCS-his-phe
- 1 -4.42526E-01 -7.17041E-01
- 2 -1.43055E-01 -3.29144E-01
- 3 -2.48077E-01 -4.17076E-02
- 4 5.84178E-02 2.13563E-02
- 5 -2.11381E-01 -3.95820E-02
- 6 1.66644E-02 -8.90761E-02
-6 0 *********** SCCS-his-ile
- 1 -4.28888E-01 -7.81529E-01
- 2 -1.92582E-02 -3.88087E-01
- 3 -2.51867E-01 -6.02494E-02
- 4 -1.27270E-01 8.07236E-02
- 5 -2.97712E-02 -3.07792E-02
- 6 -6.16994E-02 -1.12957E-01
-6 0 *********** SCCS-his-leu
- 1 -4.03019E-01 -5.18938E-01
- 2 -2.07036E-01 -5.87930E-01
- 3 -1.58196E-01 -1.17402E-01
- 4 -1.49763E-01 1.54545E-01
- 5 -4.75673E-02 -8.21038E-02
- 6 -4.47958E-02 -1.30153E-01
-6 0 *********** SCCS-his-val
- 1 -4.35109E-01 -6.79112E-01
- 2 4.42526E-02 -4.97888E-01
- 3 -3.90576E-01 -4.11183E-02
- 4 -2.32712E-02 1.34246E-02
- 5 -1.92111E-01 1.68854E-02
- 6 1.54815E-02 3.53664E-02
-6 0 *********** SCCS-his-trp
- 1 -4.76160E-01 -7.26406E-01
- 2 -1.15604E-01 -1.94527E-01
- 3 -1.30985E-01 -1.21573E-01
- 4 -6.81380E-02 5.68696E-02
- 5 -6.52561E-02 -7.30112E-02
- 6 -6.49105E-02 -2.14156E-01
-6 0 *********** SCCS-his-tyr
- 1 -4.19319E-01 -7.25369E-01
- 2 -1.81033E-01 -2.54103E-01
- 3 -1.61864E-01 -8.54866E-02
- 4 -1.79162E-02 4.53691E-02
- 5 -1.07122E-01 -9.38599E-02
- 6 -5.47608E-02 -1.89819E-01
-6 0 *********** SCCS-his-ala
- 1 -2.94434E-01 -5.57306E-01
- 2 3.87727E-01 -3.20713E-01
- 3 -1.46438E-01 -2.59533E-01
- 4 -2.50631E-01 9.81309E-02
- 5 1.24331E-01 -7.80872E-02
- 6 -1.58315E-01 -2.48968E-01
-6 0 *********** SCCS-his-gly
+4 0 *********** SCCS-asp-thr
+ 1 2.03327E-01 -7.52847E-01
+ 2 2.11769E-01 3.13518E-01
+ 3 4.13921E-02 -1.45323E-01
+ 4 -7.74979E-02 -1.39205E-02
+4 0 *********** SCCS-asp-ser
+ 1 7.12075E-01 -9.85017E-01
+ 2 -3.08707E-01 2.23254E-01
+ 3 1.47396E-02 -5.12763E-02
+ 4 1.54081E-02 -1.22346E-01
+4 0 *********** SCCS-asp-gln
+ 1 2.21200E-01 -7.68690E-01
+ 2 7.23771E-02 2.11751E-01
+ 3 -5.61602E-02 -5.74124E-02
+ 4 -8.91043E-02 3.00415E-02
+4 0 *********** SCCS-asp-asn
+ 1 6.98852E-01 -7.09029E-01
+ 2 -4.32059E-01 1.42390E-01
+ 3 -3.93393E-03 -5.02545E-02
+ 4 -5.04558E-02 -6.01278E-04
+4 0 *********** SCCS-asp-glu
+ 1 1.65649E-01 -8.47903E-01
+ 2 1.61248E-01 2.23107E-01
+ 3 -6.72565E-02 -6.83504E-02
+ 4 -7.00816E-02 4.97329E-02
+4 0 *********** SCCS-asp-asp
+ 1 7.63495E-01 -7.65348E-01
+ 2 -4.52690E-01 1.51719E-01
+ 3 1.68828E-02 -3.35116E-02
+ 4 -2.09857E-02 -2.80251E-02
+4 0 *********** SCCS-asp-his
+ 1 7.10676E-01 -6.82044E-01
+ 2 -3.51444E-01 1.93903E-02
+ 3 8.86603E-02 -1.24592E-01
+ 4 3.95921E-04 -1.62392E-02
+4 0 *********** SCCS-asp-arg
+ 1 2.65954E-02 -6.09657E-01
+ 2 3.01188E-01 6.08210E-02
+ 3 -7.38203E-02 -6.21253E-02
+ 4 -1.07636E-02 3.65483E-02
+4 0 *********** SCCS-asp-lys
+ 1 -3.73791E-02 -5.56543E-01
+ 2 4.02407E-01 1.23485E-01
+ 3 -2.51472E-02 -9.55247E-02
+ 4 -2.21670E-02 3.51783E-02
+4 0 *********** SCCS-asp-pro
+ 1 9.73967E-01 -1.11933E+00
+ 2 -3.14059E-01 2.47529E-01
+ 3 9.04799E-02 -1.17972E-01
+ 4 1.73933E-01 -1.08927E-01
+4 0 *********** SCCS-his-cys
+ 1 7.27451E-01 -6.17263E-01
+ 2 2.24001E-01 1.86860E-01
+ 3 -1.29393E-01 -4.74275E-02
+ 4 -4.47830E-03 2.39322E-02
+4 0 *********** SCCS-his-met
+ 1 2.94987E-01 -5.94858E-01
+ 2 3.46150E-01 -1.93141E-02
+ 3 -5.02700E-02 -5.86869E-02
+ 4 -1.14174E-02 -3.22966E-03
+4 0 *********** SCCS-his-phe
+ 1 2.56331E-01 -6.65620E-01
+ 2 3.20692E-01 -2.39858E-01
+ 3 -2.38650E-02 -6.01628E-02
+ 4 -2.90476E-03 4.87464E-02
+4 0 *********** SCCS-his-ile
+ 1 5.14914E-01 -6.54449E-01
+ 2 3.89567E-01 6.45248E-02
+ 3 -1.23832E-02 -9.75621E-02
+ 4 1.81857E-02 -2.40620E-02
+4 0 *********** SCCS-his-leu
+ 1 2.11255E-01 -6.01120E-01
+ 2 4.80494E-01 -1.65429E-01
+ 3 -3.59946E-02 -3.36199E-02
+ 4 -2.83814E-02 -2.57269E-02
+4 0 *********** SCCS-his-val
+ 1 3.45382E-01 -6.25744E-01
+ 2 5.10689E-01 6.28737E-02
+ 3 5.24011E-02 -5.08175E-02
+ 4 5.49148E-04 -7.00880E-02
+4 0 *********** SCCS-his-trp
+ 1 3.30128E-01 -6.99195E-01
+ 2 1.86006E-01 -9.33053E-02
+ 3 -8.47779E-02 2.85921E-03
+ 4 5.21840E-03 2.78977E-02
+4 0 *********** SCCS-his-tyr
+ 1 2.05324E-01 -6.55546E-01
+ 2 2.52059E-01 -2.50816E-01
+ 3 -4.66802E-02 -7.38547E-02
+ 4 -1.96874E-02 4.25820E-02
+4 0 *********** SCCS-his-ala
+ 1 3.78082E-01 -3.77172E-01
+ 2 4.30375E-01 2.55483E-01
+ 3 -3.69011E-02 -1.48321E-01
+ 4 3.08071E-03 -8.23733E-02
+4 0 *********** SCCS-his-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-his-thr
- 1 -3.18023E-01 -6.46140E-01
- 2 2.15357E-01 -5.46092E-01
- 3 -2.44200E-01 -1.09070E-01
- 4 -5.82679E-02 -1.04531E-01
- 5 -1.47183E-01 -4.02594E-02
- 6 -3.59212E-02 5.03705E-02
-6 0 *********** SCCS-his-ser
- 1 -4.04880E-01 -1.38273E+00
- 2 7.34967E-01 1.34541E-01
- 3 -1.40744E-01 -1.93286E-01
- 4 1.24271E-01 9.80781E-03
- 5 -8.34007E-02 -4.13262E-02
- 6 1.77648E-02 -4.05378E-01
-6 0 *********** SCCS-his-gln
- 1 -4.45795E-01 -7.91044E-01
- 2 1.25418E-01 -1.62270E-01
- 3 -8.61751E-02 -1.11377E-01
- 4 -1.47294E-02 4.27514E-02
- 5 -3.36547E-02 -6.12181E-02
- 6 -4.48218E-02 -2.20835E-01
-6 0 *********** SCCS-his-asn
- 1 5.34751E-02 -1.01359E+00
- 2 2.47598E-01 3.35341E-01
- 3 -1.91970E-02 -1.53944E-01
- 4 -3.54560E-02 8.50663E-02
- 5 3.08194E-02 -8.67889E-02
- 6 -6.82872E-02 -4.83537E-01
-6 0 *********** SCCS-his-glu
- 1 -5.35647E-01 -8.40455E-01
- 2 9.98811E-02 -2.62456E-01
- 3 -9.73287E-02 -1.25479E-01
- 4 -4.75192E-02 4.78952E-02
- 5 -3.81493E-02 -7.95862E-02
- 6 -6.21515E-02 -2.22484E-01
-6 0 *********** SCCS-his-asp
- 1 2.43610E-01 -7.99649E-01
- 2 5.08447E-01 1.58675E-01
- 3 -3.06751E-02 -1.29208E-01
- 4 3.78434E-02 6.97393E-02
- 5 4.84425E-03 -4.82050E-02
- 6 -2.16436E-02 -3.35345E-01
-6 0 *********** SCCS-his-his
- 1 -4.34064E-02 -1.15544E+00
- 2 1.16687E-01 2.18573E-01
- 3 -1.27751E-01 -8.29804E-02
- 4 -5.00485E-02 4.90286E-02
- 5 -7.58662E-02 -5.67584E-02
- 6 -5.92106E-02 -3.92278E-01
-6 0 *********** SCCS-his-arg
- 1 -4.28318E-01 -5.31935E-01
- 2 -9.11069E-02 -3.28713E-01
- 3 -1.91363E-01 -8.27810E-02
- 4 -2.18027E-02 6.44928E-02
- 5 -1.06718E-01 -5.26145E-02
- 6 -2.92614E-02 -1.13546E-01
-6 0 *********** SCCS-his-lys
- 1 -3.93069E-01 -5.09627E-01
- 2 -9.66449E-02 -3.96785E-01
- 3 -1.68484E-01 -1.19507E-01
- 4 -1.25212E-01 1.27382E-01
- 5 -2.32443E-02 -6.21496E-02
- 6 -5.51726E-02 -1.52834E-01
-6 0 *********** SCCS-his-pro
- 1 -1.33039E+00 -2.46431E-01
- 2 -7.20840E-01 2.73699E+00
- 3 2.42245E-01 6.28979E-01
- 4 -7.07569E-01 -1.03412E-02
- 5 -4.95009E-01 4.39986E-01
- 6 -1.68755E-03 -2.71971E-01
-6 0 *********** SCCS-arg-cys
- 1 -4.78527E-01 -8.25180E-01
- 2 4.22481E-01 5.42955E-02
- 3 -1.03641E-01 -5.55069E-02
- 4 -8.31879E-03 8.39725E-02
- 5 -1.12290E-02 -7.60975E-02
- 6 -5.47516E-02 -3.05759E-01
-6 0 *********** SCCS-arg-met
- 1 -3.85901E-01 -5.07367E-01
- 2 1.03269E-01 -2.68768E-01
- 3 -1.28126E-01 -1.11675E-01
- 4 -9.11320E-02 3.63696E-02
- 5 -5.43876E-02 -6.16474E-02
- 6 -5.28023E-02 -1.28482E-01
-6 0 *********** SCCS-arg-phe
- 1 -3.55897E-01 -5.40089E-01
- 2 -5.29262E-02 -3.23248E-01
- 3 -1.18871E-01 -1.77781E-01
- 4 -6.98542E-02 6.70838E-02
- 5 -1.05183E-01 -4.89220E-02
- 6 -6.07785E-02 -1.61799E-01
-6 0 *********** SCCS-arg-ile
- 1 -4.15161E-01 -6.01122E-01
- 2 1.17784E-01 -2.47540E-01
- 3 -1.59388E-01 -1.48810E-01
- 4 -1.48882E-01 4.36632E-02
- 5 -2.06171E-02 -5.92051E-02
- 6 -8.93784E-02 -1.74431E-01
-6 0 *********** SCCS-arg-leu
- 1 -3.58649E-01 -4.24699E-01
- 2 -3.08975E-02 -5.75090E-01
- 3 -1.68173E-01 -1.35823E-01
- 4 -6.88970E-02 5.58886E-02
- 5 -1.94943E-01 -7.01329E-02
- 6 1.03734E-02 -4.58757E-02
-6 0 *********** SCCS-arg-val
- 1 -3.92529E-01 -5.21310E-01
- 2 1.25695E-01 -3.75399E-01
- 3 -1.95371E-01 -1.64184E-01
- 4 -1.60094E-01 2.12237E-02
- 5 -6.43223E-02 -3.82304E-02
- 6 -6.85504E-02 -9.32681E-02
-6 0 *********** SCCS-arg-trp
- 1 -4.22532E-01 -5.58050E-01
- 2 1.56771E-02 -1.73637E-01
- 3 -1.08171E-01 -1.45769E-01
- 4 -7.01390E-02 2.76323E-02
- 5 -8.42156E-02 -6.02564E-02
- 6 -5.15502E-02 -1.75953E-01
-6 0 *********** SCCS-arg-tyr
- 1 -3.62805E-01 -5.49303E-01
- 2 -7.33357E-02 -2.77756E-01
- 3 -1.16191E-01 -2.08924E-01
- 4 -1.01933E-01 7.72644E-02
- 5 -4.87609E-02 -7.22764E-02
- 6 -7.31738E-02 -2.16710E-01
-6 0 *********** SCCS-arg-ala
- 1 -1.73746E-01 -4.69360E-01
- 2 3.98472E-01 -3.53253E-01
- 3 -2.30868E-01 -3.65130E-02
- 4 6.98958E-02 -5.24757E-02
- 5 -2.09480E-01 -1.26925E-02
- 6 3.13435E-02 3.98860E-02
-6 0 *********** SCCS-arg-gly
+4 0 *********** SCCS-his-thr
+ 1 4.59510E-01 -6.14091E-01
+ 2 3.88660E-01 1.39503E-01
+ 3 -1.34841E-03 -6.82452E-02
+ 4 9.93568E-03 -3.76383E-02
+4 0 *********** SCCS-his-ser
+ 1 9.85580E-01 -5.45681E-01
+ 2 2.59144E-01 3.51969E-01
+ 3 -1.14864E-01 1.59596E-02
+ 4 2.50892E-02 2.75788E-02
+4 0 *********** SCCS-his-gln
+ 1 3.80313E-01 -6.76119E-01
+ 2 2.07198E-01 7.93258E-02
+ 3 -9.89995E-02 4.14622E-02
+ 4 -3.20785E-02 3.47803E-02
+4 0 *********** SCCS-his-asn
+ 1 7.73626E-01 -5.06495E-01
+ 2 5.64873E-02 3.00441E-01
+ 3 -1.26639E-01 -2.65754E-02
+ 4 -2.40404E-02 3.74091E-02
+4 0 *********** SCCS-his-glu
+ 1 4.12108E-01 -7.48491E-01
+ 2 2.82602E-01 2.33478E-02
+ 3 -8.39211E-02 3.42983E-02
+ 4 -4.87447E-03 1.51172E-02
+4 0 *********** SCCS-his-asp
+ 1 8.79814E-01 -5.19494E-01
+ 2 9.46259E-02 2.93607E-01
+ 3 -6.31803E-02 -1.92788E-02
+ 4 6.62348E-03 4.73476E-02
+4 0 *********** SCCS-his-his
+ 1 7.89513E-01 -4.79056E-01
+ 2 -5.00126E-02 1.48417E-01
+ 3 5.22344E-03 -1.41744E-01
+ 4 2.22199E-02 3.77415E-02
+4 0 *********** SCCS-his-arg
+ 1 1.23988E-01 -6.17788E-01
+ 2 2.74559E-01 -1.55957E-01
+ 3 -5.46513E-02 -4.57139E-02
+ 4 -1.21850E-02 5.37295E-03
+4 0 *********** SCCS-his-lys
+ 1 1.36874E-01 -5.49372E-01
+ 2 3.98429E-01 -9.82276E-02
+ 3 -2.89139E-02 -6.02261E-02
+ 4 -1.21036E-02 -2.68769E-02
+4 0 *********** SCCS-his-pro
+ 1 1.11445E+00 -2.83047E-01
+ 2 9.70944E-02 5.11328E-01
+ 3 -1.58876E-01 -9.94195E-02
+ 4 5.62044E-02 1.22755E-02
+4 0 *********** SCCS-arg-cys
+ 1 4.83043E-01 8.05269E-02
+ 2 6.62858E-02 -8.76990E-02
+ 3 6.52651E-03 -6.39895E-02
+ 4 4.58964E-02 -2.81111E-02
+4 0 *********** SCCS-arg-met
+ 1 3.53757E-01 -7.83721E-02
+ 2 -5.05327E-02 -3.53860E-02
+ 3 -2.23256E-02 -8.98578E-03
+ 4 -7.23374E-03 -1.07788E-02
+4 0 *********** SCCS-arg-phe
+ 1 3.49698E-01 -1.42041E-01
+ 2 -5.78637E-02 1.33073E-02
+ 3 -3.96744E-02 1.13751E-02
+ 4 -2.68967E-02 -6.88529E-03
+4 0 *********** SCCS-arg-ile
+ 1 4.26213E-01 -4.48649E-02
+ 2 -4.21672E-02 -6.42310E-02
+ 3 -2.25076E-02 -2.02787E-02
+ 4 5.51533E-03 -2.68091E-02
+4 0 *********** SCCS-arg-leu
+ 1 3.31689E-01 -1.79217E-01
+ 2 -1.02750E-01 1.43590E-02
+ 3 -4.89729E-02 -1.11282E-02
+ 4 -5.22584E-02 -6.73114E-03
+4 0 *********** SCCS-arg-val
+ 1 4.01014E-01 -9.47134E-02
+ 2 -7.88450E-02 -5.46381E-02
+ 3 -3.42643E-02 -1.56198E-02
+ 4 -8.53573E-03 -3.14686E-02
+4 0 *********** SCCS-arg-trp
+ 1 3.77877E-01 -8.81707E-02
+ 2 -3.52631E-02 -4.05910E-02
+ 3 -2.28127E-02 3.00764E-03
+ 4 -6.61293E-03 -4.39263E-03
+4 0 *********** SCCS-arg-tyr
+ 1 3.39202E-01 -1.48287E-01
+ 2 -5.09901E-02 1.29384E-02
+ 3 -3.12958E-02 1.89707E-02
+ 4 -2.79499E-02 4.51563E-03
+4 0 *********** SCCS-arg-ala
+ 1 3.27350E-01 -4.65648E-04
+ 2 -9.34329E-02 -7.20440E-02
+ 3 1.54437E-02 -5.41022E-02
+ 4 1.50233E-02 -4.27157E-02
+4 0 *********** SCCS-arg-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-arg-thr
- 1 -4.14100E-01 -4.92274E-01
- 2 3.13638E-01 -3.28985E-01
- 3 -2.39086E-01 -1.23907E-01
- 4 2.46989E-02 -7.08241E-02
- 5 -1.99334E-01 -4.48631E-02
- 6 -1.00821E-02 -2.77504E-02
-6 0 *********** SCCS-arg-ser
- 1 -7.69408E-01 -9.77691E-01
- 2 7.93419E-01 1.49429E-01
- 3 -7.55144E-02 -5.96041E-02
- 4 2.22590E-01 2.55269E-02
- 5 -1.14764E-01 -6.36299E-03
- 6 8.87912E-02 -2.62962E-01
-6 0 *********** SCCS-arg-gln
- 1 -4.46927E-01 -6.24486E-01
- 2 1.88163E-01 -8.95421E-02
- 3 -8.32368E-02 -1.23452E-01
- 4 -3.93165E-02 2.59693E-02
- 5 -3.58699E-02 -5.34086E-02
- 6 -5.02357E-02 -2.06729E-01
-6 0 *********** SCCS-arg-asn
- 1 2.82695E-02 -8.03608E-01
- 2 1.76719E-01 4.29340E-01
- 3 -1.72577E-03 -5.88066E-02
- 4 -4.69838E-02 7.85628E-02
- 5 -1.63873E-02 -2.49263E-02
- 6 -3.61952E-02 -3.83672E-01
-6 0 *********** SCCS-arg-glu
- 1 -5.46074E-01 -6.29612E-01
- 2 1.93568E-01 -1.81833E-01
- 3 -1.01698E-01 -1.37293E-01
- 4 -6.51850E-02 2.43652E-02
- 5 -4.34599E-02 -6.05207E-02
- 6 -6.04025E-02 -1.94963E-01
-6 0 *********** SCCS-arg-asp
- 1 6.92154E-02 -6.63720E-01
- 2 4.37121E-01 4.25647E-01
- 3 -3.98101E-02 -9.77416E-02
- 4 -3.41844E-02 1.60158E-01
- 5 4.96039E-02 -3.71941E-02
- 6 -6.88111E-02 -4.39348E-01
-6 0 *********** SCCS-arg-his
- 1 -5.83580E-02 -8.76410E-01
- 2 1.39428E-01 3.87431E-01
- 3 -6.17208E-02 -4.91109E-02
- 4 -4.49201E-02 7.18106E-02
- 5 -4.05458E-02 -4.64040E-02
- 6 -5.18419E-02 -3.91509E-01
-6 0 *********** SCCS-arg-arg
- 1 -4.13589E-01 -4.17611E-01
- 2 2.12279E-02 -3.02658E-01
- 3 -1.93544E-01 -9.53490E-02
- 4 -1.25278E-02 3.24797E-02
- 5 -1.42395E-01 -3.01640E-02
- 6 -1.03181E-02 -6.73874E-02
-6 0 *********** SCCS-arg-lys
- 1 -3.51275E-01 -4.07501E-01
- 2 -1.38057E-03 -3.95271E-01
- 3 -1.46120E-01 -1.23021E-01
- 4 -9.47377E-02 6.15999E-02
- 5 -8.53676E-02 -5.32753E-02
- 6 -3.99144E-02 -8.39244E-02
-6 0 *********** SCCS-arg-pro
- 1 -5.25473E-01 1.05106E-01
- 2 -8.61041E-01 2.07328E+00
- 3 2.54418E-01 6.31488E-01
- 4 -3.59968E-01 -2.50930E-02
- 5 -6.11025E-01 2.56967E-01
- 6 -1.82642E-01 -1.32984E-01
-6 0 *********** SCCS-lys-cys
- 1 -4.83730E-01 -4.72326E-01
- 2 4.82467E-01 1.00430E-01
- 3 -7.93765E-02 -3.14817E-02
- 4 8.68180E-02 2.25662E-02
- 5 -6.03377E-02 -8.08710E-03
- 6 2.01900E-02 -1.58301E-01
-6 0 *********** SCCS-lys-met
- 1 -3.21718E-01 -2.81874E-01
- 2 1.71956E-01 -2.77428E-01
- 3 -1.12977E-01 -1.20451E-01
- 4 -6.59346E-02 1.91033E-02
- 5 -7.83753E-02 -5.22561E-02
- 6 -4.49423E-02 -7.66441E-02
-6 0 *********** SCCS-lys-phe
- 1 -2.83261E-01 -2.82225E-01
- 2 -4.67123E-02 -3.05368E-01
- 3 -1.24081E-01 -2.25716E-01
- 4 -1.34173E-01 9.75968E-02
- 5 -2.80280E-02 -6.88668E-02
- 6 -7.80157E-02 -1.83762E-01
-6 0 *********** SCCS-lys-ile
- 1 -2.84233E-01 -3.38287E-01
- 2 2.20427E-01 -2.64004E-01
- 3 -1.58959E-01 -1.44948E-01
- 4 -8.97810E-02 -2.09634E-02
- 5 -1.09463E-01 -5.26377E-02
- 6 -5.57165E-02 -7.68775E-02
-6 0 *********** SCCS-lys-leu
- 1 -2.73724E-01 -2.52138E-01
- 2 6.12377E-02 -5.58331E-01
- 3 -1.98930E-01 -1.72644E-01
- 4 -5.48866E-02 4.79222E-02
- 5 -1.99182E-01 -4.91883E-02
- 6 1.69523E-02 -1.37420E-02
-6 0 *********** SCCS-lys-val
- 1 -2.98627E-01 -2.75707E-01
- 2 1.14463E-01 -3.54748E-01
- 3 -1.16298E-01 -1.77887E-01
- 4 -1.24187E-01 -3.75858E-03
- 5 -6.11690E-02 -5.86659E-02
- 6 -8.37663E-02 -6.61661E-02
-6 0 *********** SCCS-lys-trp
- 1 -2.80578E-01 -3.21996E-01
- 2 1.02842E-01 -2.42915E-01
- 3 -1.59496E-01 -1.27884E-01
- 4 -4.35302E-02 3.72282E-02
- 5 -1.03763E-01 -3.99550E-02
- 6 -2.59685E-02 -9.79900E-02
-6 0 *********** SCCS-lys-tyr
- 1 -2.92728E-01 -2.88922E-01
- 2 -6.36405E-02 -2.53431E-01
- 3 -1.34377E-01 -2.37863E-01
- 4 -1.57029E-01 1.12814E-01
- 5 1.64142E-03 -8.43164E-02
- 6 -9.87544E-02 -2.32009E-01
-6 0 *********** SCCS-lys-ala
- 1 -2.69633E-01 -2.61400E-01
- 2 5.09753E-01 -2.71125E-01
- 3 -1.92565E-01 -3.68604E-02
- 4 3.87022E-02 -7.55745E-02
- 5 -2.01687E-01 -1.62476E-02
- 6 -2.79292E-03 6.32375E-02
-6 0 *********** SCCS-lys-gly
+4 0 *********** SCCS-arg-thr
+ 1 4.16188E-01 -3.96263E-02
+ 2 -3.05151E-02 -8.98761E-02
+ 3 -2.15470E-02 -1.76025E-02
+ 4 1.75198E-03 -2.62010E-02
+4 0 *********** SCCS-arg-ser
+ 1 5.40146E-01 1.60164E-01
+ 2 8.56227E-02 -9.98365E-02
+ 3 7.71265E-02 -9.15047E-02
+ 4 8.31182E-02 -6.66454E-03
+4 0 *********** SCCS-arg-gln
+ 1 4.17829E-01 -5.23332E-02
+ 2 -2.02148E-02 -7.96567E-02
+ 3 -1.86421E-02 -2.05454E-02
+ 4 -1.04838E-02 -2.17097E-02
+4 0 *********** SCCS-arg-asn
+ 1 4.80883E-01 2.07288E-01
+ 2 7.02761E-02 -8.66131E-02
+ 3 9.76470E-02 1.62622E-02
+ 4 1.65610E-02 4.60411E-02
+4 0 *********** SCCS-arg-glu
+ 1 4.40522E-01 -8.51300E-02
+ 2 -2.89210E-02 -8.43066E-02
+ 3 -3.20608E-02 -2.20732E-02
+ 4 -1.69003E-02 -2.84614E-02
+4 0 *********** SCCS-arg-asp
+ 1 5.04984E-01 2.16997E-01
+ 2 7.50359E-02 -7.60829E-02
+ 3 8.80974E-02 1.85290E-02
+ 4 2.88681E-02 5.98583E-02
+4 0 *********** SCCS-arg-his
+ 1 4.58552E-01 2.17691E-01
+ 2 7.71597E-02 -6.47595E-02
+ 3 7.36474E-02 3.91082E-02
+ 4 2.24069E-02 6.55631E-02
+4 0 *********** SCCS-arg-arg
+ 1 3.17884E-01 -1.55971E-01
+ 2 -6.93383E-02 -8.30403E-03
+ 3 -2.72502E-02 7.38191E-03
+ 4 -1.98515E-02 -8.58105E-03
+4 0 *********** SCCS-arg-lys
+ 1 2.94370E-01 -1.55508E-01
+ 2 -8.09118E-02 4.41482E-03
+ 3 -2.38380E-02 -4.36194E-04
+ 4 -2.67591E-02 -3.07623E-03
+4 0 *********** SCCS-arg-pro
+ 1 4.93755E-01 1.94671E-01
+ 2 1.71186E-01 -8.91925E-02
+ 3 6.69637E-02 -5.68402E-02
+ 4 9.32563E-02 2.49224E-02
+4 0 *********** SCCS-lys-cys
+ 1 5.93637E-01 1.04087E-01
+ 2 8.60939E-03 -2.48690E-01
+ 3 1.00929E-01 -3.66544E-02
+ 4 8.48823E-03 1.28443E-02
+4 0 *********** SCCS-lys-met
+ 1 4.19430E-01 -9.45382E-02
+ 2 -1.73812E-01 -5.18851E-02
+ 3 -1.23521E-02 -1.82211E-02
+ 4 1.71650E-02 7.00269E-03
+4 0 *********** SCCS-lys-phe
+ 1 4.05854E-01 -1.52236E-01
+ 2 -1.83981E-01 5.43363E-02
+ 3 -4.01237E-02 -2.99043E-02
+ 4 1.69326E-02 -1.75676E-02
+4 0 *********** SCCS-lys-ile
+ 1 5.11302E-01 -6.84253E-02
+ 2 -1.73310E-01 -1.33269E-01
+ 3 -7.38912E-03 -3.75648E-02
+ 4 1.06053E-02 1.21083E-02
+4 0 *********** SCCS-lys-leu
+ 1 3.68681E-01 -2.04273E-01
+ 2 -2.82440E-01 6.06387E-02
+ 3 -3.11424E-02 -2.11212E-02
+ 4 2.68833E-02 -6.60880E-03
+4 0 *********** SCCS-lys-val
+ 1 4.66384E-01 -1.32438E-01
+ 2 -2.51764E-01 -1.04951E-01
+ 3 -2.44270E-02 -4.50107E-02
+ 4 1.81820E-02 1.12568E-02
+4 0 *********** SCCS-lys-trp
+ 1 4.62284E-01 -1.11394E-01
+ 2 -1.27965E-01 -4.37476E-02
+ 3 -7.59629E-03 -2.61331E-02
+ 4 1.23499E-02 -8.34634E-03
+4 0 *********** SCCS-lys-tyr
+ 1 3.95190E-01 -1.53017E-01
+ 2 -1.61562E-01 6.64359E-02
+ 3 -4.03208E-02 -1.81493E-02
+ 4 1.39083E-02 -2.17163E-02
+4 0 *********** SCCS-lys-ala
+ 1 3.43197E-01 -5.33229E-03
+ 2 -2.45017E-01 -1.66817E-01
+ 3 1.80786E-02 1.62145E-02
+ 4 4.71477E-03 2.23686E-02
+4 0 *********** SCCS-lys-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-lys-thr
- 1 -2.90839E-01 -3.01780E-01
- 2 3.45888E-01 -2.72815E-01
- 3 -1.48629E-01 -1.99909E-01
- 4 -5.40208E-02 -5.49530E-02
- 5 -5.82159E-02 -9.93540E-02
- 6 -7.43989E-02 -1.05143E-01
-6 0 *********** SCCS-lys-ser
- 1 -8.25776E-01 -6.31593E-01
- 2 7.59627E-01 3.28957E-01
- 3 1.34157E-02 -2.09988E-01
- 4 4.36743E-02 1.02087E-01
- 5 8.17905E-02 -5.29487E-02
- 6 -2.39574E-02 -4.40762E-01
-6 0 *********** SCCS-lys-gln
- 1 -3.97538E-01 -3.51018E-01
- 2 3.38904E-01 -1.03188E-01
- 3 -9.98548E-02 -1.56287E-01
- 4 -4.66975E-02 2.61153E-02
- 5 -5.22992E-02 -1.01705E-02
- 6 -2.19686E-02 -1.31711E-01
-6 0 *********** SCCS-lys-asn
- 1 -2.92011E-01 -5.25603E-01
- 2 3.72446E-01 5.03649E-01
- 3 -1.88429E-01 -1.53145E-04
- 4 1.36891E-01 4.65355E-02
- 5 -1.33742E-01 -2.27972E-02
- 6 5.46336E-02 -3.02007E-01
-6 0 *********** SCCS-lys-glu
- 1 -4.29054E-01 -3.40848E-01
- 2 3.48874E-01 -2.09007E-01
- 3 -1.05801E-01 -1.80737E-01
- 4 -8.45434E-02 -1.27748E-02
- 5 -7.32634E-02 -2.29241E-02
- 6 -3.55994E-02 -9.07953E-02
-6 0 *********** SCCS-lys-asp
- 1 -2.27344E-01 -4.64711E-01
- 2 5.13038E-01 4.77924E-01
- 3 -4.04331E-02 -3.41223E-02
- 4 2.02068E-02 1.48085E-01
- 5 -1.19024E-02 1.14992E-03
- 6 -3.16690E-02 -3.54021E-01
-6 0 *********** SCCS-lys-his
- 1 -1.49143E-01 -5.24051E-01
- 2 1.98111E-01 4.53266E-01
- 3 -6.12044E-03 -1.14818E-02
- 4 1.01466E-03 5.76531E-02
- 5 -6.28890E-02 -3.65390E-02
- 6 -7.92853E-04 -3.18004E-01
-6 0 *********** SCCS-lys-arg
- 1 -3.03629E-01 -2.39692E-01
- 2 3.28980E-02 -2.90445E-01
- 3 -1.55706E-01 -1.52935E-01
- 4 -7.87916E-02 5.97098E-02
- 5 -7.05710E-02 -4.58845E-02
- 6 -4.80665E-02 -1.00015E-01
-6 0 *********** SCCS-lys-lys
- 1 -2.76500E-01 -2.42205E-01
- 2 7.30995E-02 -3.94309E-01
- 3 -1.70862E-01 -1.29827E-01
- 4 -7.24734E-02 4.28095E-02
- 5 -1.40274E-01 -4.73730E-02
- 6 -8.73447E-03 -4.24827E-02
-6 0 *********** SCCS-lys-pro
- 1 -9.29153E-01 3.28531E-01
- 2 1.20842E-01 1.74666E+00
- 3 -8.94476E-01 8.50019E-01
- 4 1.67985E-01 -4.61776E-01
- 5 -9.36941E-01 5.76112E-01
- 6 7.33976E-02 6.86464E-01
-6 0 *********** SCCS-pro-cys
- 1 -2.08039E-01 1.21242E+00
- 2 3.06994E-01 3.15833E-01
- 3 -9.60282E-02 -1.92386E-01
- 4 9.37223E-02 -3.03487E-02
- 5 4.63536E-02 -8.69181E-03
- 6 -2.21354E-02 1.06480E-02
-6 0 *********** SCCS-pro-met
- 1 1.04833E-01 8.25195E-01
- 2 -9.99227E-03 -4.62378E-04
- 3 -2.05661E-01 -2.57740E-01
- 4 -5.12431E-02 -4.52014E-02
- 5 -6.30400E-02 -7.27189E-02
- 6 -4.02912E-02 -2.62175E-02
-6 0 *********** SCCS-pro-phe
- 1 2.70293E-01 8.60724E-01
- 2 -1.37245E-01 5.36761E-02
- 3 -3.07777E-01 -1.89721E-01
- 4 -2.65210E-01 9.64549E-02
- 5 4.43643E-03 -1.08713E-01
- 6 -7.34776E-02 -1.31703E-01
-6 0 *********** SCCS-pro-ile
- 1 1.51217E-01 1.23188E+00
- 2 -3.47201E-01 5.30481E-02
- 3 -5.51084E-02 -5.07213E-01
- 4 1.80912E-01 -1.90149E-02
- 5 -3.42601E-02 6.89399E-02
- 6 -9.44818E-02 3.88992E-04
-6 0 *********** SCCS-pro-leu
- 1 3.12566E-01 8.81921E-01
- 2 -2.27749E-01 -1.52529E-01
- 3 -2.91043E-01 -5.41004E-01
- 4 -2.36405E-01 -3.33577E-02
- 5 -1.72140E-03 -9.79728E-02
- 6 -1.68694E-01 -1.34085E-01
-6 0 *********** SCCS-pro-val
- 1 1.37825E-01 1.13336E+00
- 2 -3.47931E-01 -1.59843E-01
- 3 -1.04634E-01 -5.16725E-01
- 4 2.59215E-01 9.79920E-03
- 5 -7.77016E-02 1.17339E-01
- 6 -8.13110E-02 6.41544E-02
-6 0 *********** SCCS-pro-trp
- 1 2.32812E-01 8.59238E-01
- 2 2.21764E-02 1.44317E-01
- 3 -2.76160E-01 -3.77822E-02
- 4 -1.32777E-01 4.76202E-02
- 5 -1.36190E-01 -4.92000E-02
- 6 -3.39862E-02 -5.74115E-04
-6 0 *********** SCCS-pro-tyr
- 1 3.42959E-01 8.37795E-01
- 2 -2.14038E-01 3.38815E-02
- 3 -3.01139E-01 -9.50215E-02
- 4 -1.91347E-01 4.68228E-02
- 5 -7.92888E-02 -8.98107E-02
- 6 -3.26324E-02 -2.88043E-02
-6 0 *********** SCCS-pro-ala
- 1 -5.17804E-01 8.80172E-01
- 2 -5.90859E-02 9.58266E-02
- 3 9.58777E-02 -6.83075E-01
- 4 -3.74253E-02 1.34935E-01
- 5 1.31650E-01 -5.64951E-02
- 6 -1.94414E-01 -3.63011E-01
-6 0 *********** SCCS-pro-gly
+4 0 *********** SCCS-lys-thr
+ 1 5.08714E-01 -7.02501E-02
+ 2 -1.65888E-01 -1.67768E-01
+ 3 -8.46236E-03 -4.49925E-02
+ 4 5.11848E-03 1.53504E-02
+4 0 *********** SCCS-lys-ser
+ 1 6.66779E-01 1.85446E-01
+ 2 1.05165E-01 -3.11994E-01
+ 3 1.85471E-01 -3.31472E-02
+ 4 2.66693E-02 8.10383E-03
+4 0 *********** SCCS-lys-gln
+ 1 5.14197E-01 -7.03192E-02
+ 2 -1.20402E-01 -1.49961E-01
+ 3 1.55007E-02 -6.07030E-02
+ 4 1.40581E-02 8.34558E-04
+4 0 *********** SCCS-lys-asn
+ 1 5.96174E-01 2.14942E-01
+ 2 1.61615E-01 -2.48920E-01
+ 3 9.87628E-02 5.68328E-02
+ 4 4.13750E-02 -1.46832E-02
+4 0 *********** SCCS-lys-glu
+ 1 5.42539E-01 -1.13554E-01
+ 2 -1.62501E-01 -1.45900E-01
+ 3 -2.64756E-03 -7.16020E-02
+ 4 1.43699E-02 -1.54648E-03
+4 0 *********** SCCS-lys-asp
+ 1 6.29323E-01 2.29069E-01
+ 2 1.65640E-01 -2.47336E-01
+ 3 1.15160E-01 4.80810E-02
+ 4 3.50094E-02 -6.00468E-03
+4 0 *********** SCCS-lys-his
+ 1 5.64122E-01 2.42482E-01
+ 2 1.81004E-01 -1.78154E-01
+ 3 5.88946E-02 7.53375E-02
+ 4 2.06019E-02 3.69907E-04
+4 0 *********** SCCS-lys-arg
+ 1 3.75256E-01 -1.84567E-01
+ 2 -1.80690E-01 3.21784E-02
+ 3 -2.70698E-02 -2.71976E-03
+ 4 1.32207E-02 -1.26064E-02
+4 0 *********** SCCS-lys-lys
+ 1 3.42418E-01 -1.84838E-01
+ 2 -2.23634E-01 3.89768E-02
+ 3 -3.39660E-02 4.62144E-03
+ 4 1.60552E-02 -8.28990E-04
+4 0 *********** SCCS-lys-pro
+ 1 7.37156E-01 2.16273E-01
+ 2 2.48115E-01 -3.27222E-01
+ 3 2.35046E-01 1.41540E-02
+ 4 6.93851E-02 7.56463E-03
+4 0 *********** SCCS-pro-cys
+ 1 1.13780E-02 -1.23190E+00
+ 2 4.30319E-01 -1.21847E-02
+ 3 -1.90232E-01 -7.70950E-02
+ 4 4.58235E-02 1.06327E-01
+4 0 *********** SCCS-pro-met
+ 1 -1.84507E-01 -7.35658E-01
+ 2 2.87352E-01 -2.79193E-01
+ 3 -1.81757E-01 8.84524E-03
+ 4 3.74601E-02 3.79035E-03
+4 0 *********** SCCS-pro-phe
+ 1 -1.14972E-01 -8.53847E-01
+ 2 5.74763E-02 -4.44151E-01
+ 3 -9.15213E-02 1.21792E-01
+ 4 2.42959E-02 2.01774E-03
+4 0 *********** SCCS-pro-ile
+ 1 -1.03687E-01 -9.86016E-01
+ 2 3.98442E-01 -3.27663E-01
+ 3 -2.79029E-01 -7.41475E-02
+ 4 4.12773E-02 2.16419E-02
+4 0 *********** SCCS-pro-leu
+ 1 -2.05953E-01 -6.91923E-01
+ 2 2.85752E-01 -6.85504E-01
+ 3 -1.60724E-01 1.19944E-01
+ 4 -6.45520E-02 -6.42387E-02
+4 0 *********** SCCS-pro-val
+ 1 -1.85155E-01 -8.48909E-01
+ 2 5.64419E-01 -3.99767E-01
+ 3 -3.07340E-01 -7.26555E-02
+ 4 6.37718E-02 -5.04584E-02
+4 0 *********** SCCS-pro-trp
+ 1 -1.72140E-01 -9.14169E-01
+ 2 1.95891E-02 -2.67473E-01
+ 3 -1.08564E-01 1.07980E-01
+ 4 7.27866E-02 1.27050E-02
+4 0 *********** SCCS-pro-tyr
+ 1 -1.28581E-01 -8.31327E-01
+ 2 4.68794E-02 -4.34261E-01
+ 3 -7.98146E-02 1.17122E-01
+ 4 2.02865E-02 1.46850E-02
+4 0 *********** SCCS-pro-ala
+ 1 2.45019E-01 -6.34920E-01
+ 2 6.31995E-01 -2.51828E-01
+ 3 -2.36710E-01 -9.32386E-02
+ 4 6.83390E-02 -2.85267E-02
+4 0 *********** SCCS-pro-gly
1 0.00000E+00 0.00000E+00
2 0.00000E+00 0.00000E+00
3 0.00000E+00 0.00000E+00
4 0.00000E+00 0.00000E+00
- 5 0.00000E+00 0.00000E+00
- 6 0.00000E+00 0.00000E+00
-6 0 *********** SCCS-pro-thr
- 1 -2.90835E-01 1.03511E+00
- 2 9.07091E-02 -2.83168E-01
- 3 -2.87597E-02 -2.42029E-01
- 4 2.48563E-01 4.41896E-02
- 5 -1.77640E-01 -4.81394E-02
- 6 3.81724E-02 7.39471E-02
-6 0 *********** SCCS-pro-ser
- 1 -3.15844E-01 1.68188E+00
- 2 8.27872E-01 3.80557E-01
- 3 -7.21911E-02 -1.19022E-01
- 4 2.94318E-01 9.27714E-02
- 5 3.84365E-02 -2.09315E-02
- 6 7.72261E-02 9.45871E-03
-6 0 *********** SCCS-pro-gln
- 1 -2.75595E-02 8.83986E-01
- 2 2.36514E-01 1.47014E-01
- 3 -2.71493E-01 -3.81209E-02
- 4 -4.63320E-02 -3.35956E-02
- 5 -5.64537E-02 -5.20119E-02
- 6 -1.31085E-02 5.80492E-02
-6 0 *********** SCCS-pro-asn
- 1 -7.64678E-01 8.48582E-01
- 2 1.44172E-01 5.12018E-01
- 3 -1.79457E-01 1.75001E-01
- 4 -1.42279E-01 1.95035E-01
- 5 -1.67567E-02 -1.32361E-02
- 6 -1.22373E-01 -8.76012E-02
-6 0 *********** SCCS-pro-glu
- 1 1.47617E-01 9.96891E-01
- 2 1.90086E-01 7.19053E-02
- 3 -2.38637E-01 -1.17586E-01
- 4 -5.55263E-02 -5.42835E-02
- 5 -8.04241E-02 -8.03232E-02
- 6 -1.07862E-02 4.99726E-02
-6 0 *********** SCCS-pro-asp
- 1 -1.29479E+00 6.36999E-01
- 2 3.87774E-01 3.58834E-01
- 3 -5.17997E-03 -1.49297E-03
- 4 3.93598E-02 1.48663E-01
- 5 2.01961E-02 -7.51423E-02
- 6 -3.79656E-03 -1.84407E-01
-6 0 *********** SCCS-pro-his
- 1 -3.34426E-01 1.19670E+00
- 2 -1.56739E-01 6.71080E-01
- 3 -2.46508E-01 2.22064E-01
- 4 -7.34581E-02 4.85451E-02
- 5 -9.69955E-02 -6.11139E-02
- 6 -2.03358E-02 -1.00268E-03
-6 0 *********** SCCS-pro-arg
- 1 1.96339E-01 6.67428E-01
- 2 -5.06552E-02 -3.32739E-02
- 3 -2.64246E-01 -1.90599E-01
- 4 -3.57824E-02 -3.40898E-02
- 5 -8.82477E-02 -6.04958E-02
- 6 -1.05153E-02 -5.70527E-03
-6 0 *********** SCCS-pro-lys
- 1 2.17931E-01 7.40442E-01
- 2 -1.60154E-01 -9.55101E-02
- 3 -2.22489E-01 -3.79800E-01
- 4 -1.18440E-01 -4.33765E-02
- 5 -4.07279E-02 -5.14164E-02
- 6 -9.95895E-02 -5.20337E-02
-6 0 *********** SCCS-pro-pro
- 1 5.03922E+01 -1.54518E+01
- 2 -2.23454E+01 1.61095E+01
- 3 -1.41391E+00 -1.79688E+00
- 4 8.36846E+00 -1.29971E+01
- 5 -2.80579E+00 1.36547E+01
- 6 -7.40840E-01 1.14019E+01
+4 0 *********** SCCS-pro-thr
+ 1 -1.19482E-01 -9.21813E-01
+ 2 3.95093E-01 -2.48604E-01
+ 3 -2.12446E-01 -1.08968E-01
+ 4 3.51352E-02 4.08504E-02
+4 0 *********** SCCS-pro-ser
+ 1 9.66746E-02 -1.87464E+00
+ 2 3.34680E-01 3.71959E-01
+ 3 -1.74631E-02 -1.24877E-01
+ 4 -7.73451E-02 9.44713E-02
+4 0 *********** SCCS-pro-gln
+ 1 -1.92023E-01 -9.29464E-01
+ 2 2.35227E-01 -6.67535E-02
+ 3 -5.85362E-02 4.72724E-03
+ 4 9.18944E-02 4.08748E-02
+4 0 *********** SCCS-pro-asn
+ 1 3.87595E-01 -1.23464E+00
+ 2 2.12310E-02 4.88199E-01
+ 3 7.85162E-02 -6.75623E-02
+ 4 -3.44742E-03 4.76528E-02
+4 0 *********** SCCS-pro-glu
+ 1 -2.83068E-01 -1.01776E+00
+ 2 2.88416E-01 -2.00060E-01
+ 3 -1.28540E-01 4.60875E-03
+ 4 1.04337E-01 1.33568E-02
+4 0 *********** SCCS-pro-asp
+ 1 5.38418E-01 -1.43528E+00
+ 2 1.54838E-02 4.69489E-01
+ 3 1.64083E-01 -7.46719E-02
+ 4 -4.17517E-03 1.51138E-02
+4 0 *********** SCCS-pro-his
+ 1 4.45082E-01 -1.23950E+00
+ 2 -1.94661E-01 2.57807E-01
+ 3 -1.00110E-01 -6.75693E-02
+ 4 -7.17474E-02 5.71482E-02
+4 0 *********** SCCS-pro-arg
+ 1 -2.70182E-01 -6.77603E-01
+ 2 1.11620E-01 -3.38473E-01
+ 3 -1.12996E-01 9.27559E-02
+ 4 1.13361E-02 -5.10264E-03
+4 0 *********** SCCS-pro-lys
+ 1 -3.12404E-01 -5.56698E-01
+ 2 2.96887E-01 -4.31599E-01
+ 3 -1.84841E-01 2.85067E-02
+ 4 1.47292E-02 -1.92123E-02
+4 0 *********** SCCS-pro-pro
+ 1 4.75981E-01 -3.04401E+00
+ 2 1.03330E-01 2.29809E-01
+ 3 -2.61299E-01 -3.79309E-01
+ 4 -2.52541E-01 6.54833E-01
--- /dev/null
+5 *** Parameters derived by pdb statistical analysis by Shelly Rackovsky ***
+4 4 4 4 4 4 4 4 3 1 3 3 3 2 3 2 3 3 3 5 4 4 1 4
+6 0 *********** SCCC-Gly-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCC-Gly-Asp
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCC-Gly-Ala
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCC-Gly-Cys
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCC-Gly-Pro
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCC-Asp-Gly
+ 1 -2.33674E-01 -5.31358E-01
+ 2 -4.88897E-01 -6.34765E-01
+ 3 -2.68667E-01 5.10088E-02
+ 4 -2.48344E-01 -2.04530E-01
+ 5 7.81149E-02 -9.89275E-04
+ 6 -5.25209E-02 -8.74971E-02
+6 0 *********** SCCC-Asp-Asp
+ 1 -3.67689E-03 -5.55082E-03
+ 2 -4.88763E-01 -4.13346E-01
+ 3 6.74458E-02 -8.94516E-02
+ 4 -1.48843E-01 3.05053E-02
+ 5 -2.32411E-03 6.93140E-02
+ 6 -3.65344E-02 1.18049E-01
+6 0 *********** SCCC-Asp-Ala
+ 1 -1.22253E-01 4.26719E-02
+ 2 -3.75906E-01 -4.76591E-01
+ 3 1.54140E-01 -1.50381E-01
+ 4 -2.79743E-02 3.45637E-02
+ 5 3.70630E-02 -1.80596E-02
+ 6 1.16381E-02 1.31634E-02
+6 0 *********** SCCC-Asp-Cys
+ 1 -3.85111E-01 3.52424E-01
+ 2 -4.08034E-01 -3.49952E-01
+ 3 6.35540E-03 -1.12671E-01
+ 4 -1.02048E-01 7.07537E-02
+ 5 -8.28533E-02 -6.45643E-02
+ 6 7.03106E-02 1.65406E-02
+6 0 *********** SCCC-Asp-Pro
+ 1 -1.50829E+00 -5.79772E-01
+ 2 1.03224E-01 -9.28513E-01
+ 3 -2.17808E-01 1.96654E-01
+ 4 -9.97970E-03 -1.86116E-01
+ 5 9.68333E-02 -3.40002E-04
+ 6 6.76090E-02 -1.60409E-02
+6 0 *********** SCCC-Ala-Gly
+ 1 1.08671E-01 -1.61916E-01
+ 2 -6.75374E-01 -4.41016E-01
+ 3 7.72515E-02 2.21794E-02
+ 4 -1.33440E-01 -3.52702E-02
+ 5 4.07103E-02 -8.30674E-03
+ 6 -3.38734E-02 -2.91658E-02
+6 0 *********** SCCC-Ala-Asp
+ 1 3.30143E-01 -2.37859E-01
+ 2 -5.58337E-01 -5.48182E-01
+ 3 1.59867E-01 -3.10240E-02
+ 4 -4.71581E-02 9.18808E-02
+ 5 7.58630E-03 1.36081E-02
+ 6 -5.18337E-02 1.67623E-02
+6 0 *********** SCCC-Ala-Ala
+ 1 3.01325E-02 -2.05463E-01
+ 2 -4.29621E-01 -4.94204E-01
+ 3 1.48297E-01 -2.46345E-02
+ 4 -6.66014E-02 7.33216E-02
+ 5 -4.61338E-03 9.99319E-03
+ 6 -1.72753E-02 -1.22783E-02
+6 0 *********** SCCC-Ala-Cys
+ 1 -1.89551E-01 -5.29036E-02
+ 2 -4.70536E-01 -5.46659E-01
+ 3 1.24188E-01 -4.54771E-02
+ 4 -9.01686E-02 7.87782E-02
+ 5 4.38317E-02 -1.50550E-02
+ 6 -1.40100E-02 4.48399E-03
+6 0 *********** SCCC-Ala-Pro
+ 1 -1.05516E+00 -8.27122E-01
+ 2 4.04216E-01 -6.30736E-01
+ 3 -5.65139E-02 1.31356E-01
+ 4 8.86212E-02 -1.93137E-02
+ 5 8.30847E-02 7.84107E-02
+ 6 1.09275E-03 -6.69432E-02
+6 0 *********** SCCC-Cys-Gly
+ 1 2.81717E-02 -9.16432E-02
+ 2 -5.80065E-01 -5.41676E-01
+ 3 8.35896E-02 2.32087E-02
+ 4 -2.52554E-02 -1.99537E-02
+ 5 -2.13136E-02 1.36707E-02
+ 6 5.82876E-02 -3.17349E-02
+6 0 *********** SCCC-Cys-Asp
+ 1 -1.56463E-01 -2.26207E-01
+ 2 -5.27000E-01 -6.19820E-01
+ 3 1.91887E-01 6.70580E-03
+ 4 -3.98226E-02 5.89435E-02
+ 5 -3.16575E-02 -1.15483E-02
+ 6 -2.96986E-02 -2.19490E-02
+6 0 *********** SCCC-Cys-Ala
+ 1 -3.36091E-01 -1.76255E-01
+ 2 -4.69818E-01 -5.33704E-01
+ 3 8.61098E-02 7.14942E-02
+ 4 -8.83260E-02 9.91528E-02
+ 5 3.34156E-02 8.38345E-03
+ 6 5.24593E-03 -3.06572E-02
+6 0 *********** SCCC-Cys-Cys
+ 1 -1.22127E-01 -1.71478E-01
+ 2 -6.74690E-01 -6.10165E-01
+ 3 1.73527E-01 -4.21592E-03
+ 4 -3.70829E-02 9.30684E-02
+ 5 -1.00968E-02 -6.23981E-02
+ 6 -8.89396E-03 -3.14081E-02
+6 0 *********** SCCC-Cys-Pro
+ 1 -1.17342E+00 -7.27036E-01
+ 2 6.83690E-01 -1.00092E+00
+ 3 -4.76000E-02 3.72246E-01
+ 4 -2.26563E-02 -1.70297E-01
+ 5 -2.22742E-02 1.16548E-01
+ 6 7.14525E-03 -4.24250E-02
+6 0 *********** SCCC-Pro-Gly
+ 1 4.02585E-01 -3.94531E-01
+ 2 -3.03503E-01 1.01518E+00
+ 3 -4.38168E-01 -3.04473E-01
+ 4 1.31142E-01 -9.95205E-02
+ 5 -3.80295E-02 8.15597E-02
+ 6 1.26077E-01 -2.53458E-02
+6 0 *********** SCCC-Pro-Asp
+ 1 2.49283E-03 -5.49089E-01
+ 2 -7.83933E-01 9.23601E-01
+ 3 -3.39174E-01 -3.82848E-01
+ 4 1.00026E-01 -1.82055E-01
+ 5 -1.75659E-01 -5.49745E-02
+ 6 8.55600E-02 -1.16096E-01
+6 0 *********** SCCC-Pro-Ala
+ 1 -4.15518E-01 -2.91572E-01
+ 2 -6.52264E-01 7.09750E-01
+ 3 -1.64167E-01 -4.41575E-01
+ 4 1.18955E-01 -3.95590E-02
+ 5 -7.92580E-02 -5.98595E-02
+ 6 9.27982E-02 -2.38264E-02
+6 0 *********** SCCC-Pro-Cys
+ 1 -3.26560E-01 4.41125E-02
+ 2 -6.99614E-01 7.59093E-01
+ 3 -2.81678E-01 -3.28174E-01
+ 4 1.31668E-01 -1.75615E-01
+ 5 7.10756E-03 5.43733E-02
+ 6 4.46549E-02 -1.44439E-02
+6 0 *********** SCCC-Pro-Pro
+ 1 -1.28703E+00 3.46321E-01
+ 2 -1.01267E+00 -8.23419E-01
+ 3 -1.57933E-01 -4.68436E-01
+ 4 8.11040E-02 2.82701E-01
+ 5 -9.53347E-02 -1.21811E-01
+ 6 2.61441E-01 9.39812E-02
+6 0 *********** CCCS-Gly-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** CCCS-Gly-Asp
+ 1 -6.31253E-02 2.38427E-01
+ 2 -1.11407E-01 5.53671E-01
+ 3 7.24875E-02 2.23541E-01
+ 4 6.83969E-03 4.24431E-02
+ 5 1.24417E-02 6.08425E-02
+ 6 6.11012E-02 7.83368E-02
+6 0 *********** CCCS-Gly-Ala
+ 1 -4.37385E-01 1.91403E-01
+ 2 -3.23631E-01 4.02741E-01
+ 3 5.64025E-02 4.08058E-03
+ 4 -5.74258E-02 -7.02841E-02
+ 5 -4.70532E-02 -5.70242E-02
+ 6 -9.28053E-03 4.39361E-02
+6 0 *********** CCCS-Gly-Cys
+ 1 -4.13393E-01 1.65041E-01
+ 2 -1.88107E-01 5.62683E-01
+ 3 5.60016E-02 7.38731E-02
+ 4 -5.95757E-03 -4.64401E-02
+ 5 1.01336E-02 5.56109E-02
+ 6 -2.35731E-03 -3.15908E-02
+6 0 *********** CCCS-Gly-Pro
+ 1 1.76496E+00 1.61351E-02
+ 2 -4.47793E-02 8.85324E-02
+ 3 5.63354E-01 2.17411E-01
+ 4 2.19564E-01 8.87204E-02
+ 5 -5.19152E-02 3.72129E-02
+ 6 -5.31883E-02 1.01306E-01
+6 0 *********** CCCS-Asp-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** CCCS-Asp-Asp
+ 1 -2.19269E-01 8.49318E-02
+ 2 3.49016E-01 1.09227E-01
+ 3 -1.97832E-02 7.72399E-02
+ 4 5.58331E-02 -3.06730E-02
+ 5 1.18306E-01 -2.23422E-02
+ 6 -4.37173E-03 4.71024E-02
+6 0 *********** CCCS-Asp-Ala
+ 1 -4.41640E-01 -5.72041E-03
+ 2 2.73360E-01 1.76355E-01
+ 3 -1.81199E-02 -4.96490E-03
+ 4 -5.22381E-02 2.83445E-02
+ 5 4.75320E-02 3.90300E-02
+ 6 -1.17571E-02 -2.22279E-02
+6 0 *********** CCCS-Asp-Cys
+ 1 -1.04268E+00 -6.40980E-02
+ 2 4.07555E-01 -8.57275E-02
+ 3 -9.99096E-02 -5.20481E-02
+ 4 6.49643E-03 -2.47447E-02
+ 5 -4.98284E-02 -8.55654E-03
+ 6 9.24429E-02 -3.30342E-02
+6 0 *********** CCCS-Asp-Pro
+ 1 5.12065E-01 -1.44224E+00
+ 2 1.29415E+00 5.67146E-01
+ 3 -7.38956E-02 -3.66674E-01
+ 4 -1.18527E-01 4.00056E-01
+ 5 1.03674E-01 1.46075E-01
+ 6 9.06869E-02 -1.14085E-01
+6 0 *********** CCCS-Ala-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** CCCS-Ala-Asp
+ 1 -1.18903E-01 1.83145E-01
+ 2 5.83533E-01 1.08640E-01
+ 3 -6.66729E-02 1.76102E-01
+ 4 4.89076E-02 5.31612E-02
+ 5 5.39967E-02 9.45165E-02
+ 6 8.03064E-02 -4.08910E-03
+6 0 *********** CCCS-Ala-Ala
+ 1 -2.92868E-01 -8.19322E-02
+ 2 4.63252E-01 1.35090E-01
+ 3 -9.30834E-02 -6.42975E-02
+ 4 6.48082E-02 5.29183E-02
+ 5 -1.88075E-02 -1.92230E-02
+ 6 -1.51650E-03 2.44986E-02
+6 0 *********** CCCS-Ala-Cys
+ 1 -5.81015E-01 -1.68223E-01
+ 2 6.20247E-01 -2.12253E-01
+ 3 -1.35184E-01 -6.88396E-02
+ 4 6.16762E-02 -2.05756E-02
+ 5 -3.94035E-02 -1.52101E-02
+ 6 2.08621E-02 3.07917E-03
+6 0 *********** CCCS-Ala-Pro
+ 1 9.10026E-01 -1.25074E+00
+ 2 1.42419E+00 1.07825E+00
+ 3 2.96946E-01 -4.44096E-01
+ 4 1.60238E-01 3.80481E-01
+ 5 3.09317E-02 1.68846E-01
+ 6 -1.77411E-01 -1.00691E-01
+6 0 *********** CCCS-Cys-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** CCCS-Cys-Asp
+ 1 -5.26562E-01 -3.09456E-01
+ 2 5.49368E-01 -1.44823E-01
+ 3 -7.22982E-02 9.84671E-02
+ 4 6.66287E-02 -9.44212E-03
+ 5 1.68578E-03 6.74414E-02
+ 6 3.89759E-02 1.95437E-02
+6 0 *********** CCCS-Cys-Ala
+ 1 -6.56521E-01 -4.61287E-01
+ 2 4.26599E-01 -4.27295E-02
+ 3 -5.80619E-02 -6.82714E-02
+ 4 7.55769E-02 -3.73619E-02
+ 5 -1.25281E-02 -9.43991E-03
+ 6 -2.08379E-02 -1.07485E-02
+6 0 *********** CCCS-Cys-Cys
+ 1 -5.58656E-01 -6.37550E-02
+ 2 6.60644E-01 -4.81978E-01
+ 3 -1.23335E-01 -1.07436E-01
+ 4 9.65717E-02 -4.24652E-02
+ 5 -2.48253E-02 -5.11826E-02
+ 6 6.85820E-05 1.76573E-02
+6 0 *********** CCCS-Cys-Pro
+ 1 4.90723E-01 -1.35625E+00
+ 2 1.67813E+00 1.18718E+00
+ 3 5.22746E-02 -5.00301E-01
+ 4 1.68735E-01 3.93464E-01
+ 5 4.28409E-02 8.91823E-02
+ 6 -1.62951E-02 -2.16810E-02
+6 0 *********** CCCS-Pro-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** CCCS-Pro-Asp
+ 1 -6.52828E-03 3.66128E-01
+ 2 8.72926E-01 2.83756E-01
+ 3 -6.39242E-02 4.15019E-01
+ 4 5.22042E-02 1.13759E-01
+ 5 3.15281E-02 1.19297E-01
+ 6 2.29414E-01 1.65320E-02
+6 0 *********** CCCS-Pro-Ala
+ 1 -1.92755E-01 -2.59299E-01
+ 2 6.27259E-01 3.23210E-01
+ 3 5.09623E-03 -5.98610E-02
+ 4 2.63549E-01 5.54537E-02
+ 5 1.07979E-02 1.42709E-02
+ 6 3.58365E-02 -1.09028E-02
+6 0 *********** CCCS-Pro-Cys
+ 1 -4.65856E-01 -2.86718E-01
+ 2 8.65762E-01 -1.35677E-01
+ 3 -1.54115E-01 -3.55263E-02
+ 4 8.94026E-02 1.99514E-02
+ 5 -4.23955E-02 6.54068E-02
+ 6 1.37749E-01 3.27344E-04
+6 0 *********** CCCS-Pro-Pro
+ 1 1.04077E+00 -4.87596E-01
+ 2 7.01383E-01 2.48642E+00
+ 3 1.47959E-01 -3.84847E-01
+ 4 1.09403E-02 -6.08211E-02
+ 5 -4.12137E-02 8.77603E-02
+ 6 5.29644E-02 1.44612E-02
+6 0 *********** SCCS-Gly-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Gly-Asp
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Gly-Ala
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Gly-Cys
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Gly-Pro
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Asp-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Asp-Asp
+ 1 -1.29367E-01 5.31310E-02
+ 2 2.52177E-01 -4.38233E-01
+ 3 2.89042E-02 -2.12699E-03
+ 4 -5.58810E-02 -1.26169E-01
+ 5 -1.35209E-02 -9.71544E-04
+ 6 -5.55150E-02 1.66374E-02
+6 0 *********** SCCS-Asp-Ala
+ 1 -6.19935E-02 1.46335E-02
+ 2 2.40900E-01 -1.77547E-01
+ 3 2.51822E-02 -5.24041E-02
+ 4 -1.68369E-03 -1.26395E-01
+ 5 -5.14003E-02 -3.09970E-02
+ 6 3.06234E-03 -8.67938E-03
+6 0 *********** SCCS-Asp-Cys
+ 1 4.64551E-01 -1.71287E-01
+ 2 -2.64537E-03 -4.16687E-01
+ 3 -4.88145E-02 -9.31462E-02
+ 4 -5.30998E-02 -6.70922E-02
+ 5 8.75378E-03 1.48263E-02
+ 6 2.66145E-02 -3.62959E-02
+6 0 *********** SCCS-Asp-Pro
+ 1 4.95445E-01 1.54011E+00
+ 2 1.12587E+00 5.33051E-01
+ 3 1.16352E-01 3.06477E-01
+ 4 -1.69937E-01 -8.91254E-02
+ 5 2.99610E-02 -1.99747E-01
+ 6 3.14083E-01 -9.27615E-02
+6 0 *********** SCCS-Ala-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Ala-Asp
+ 1 -3.03491E-01 -3.20195E-03
+ 2 1.87577E-01 -5.35195E-01
+ 3 -9.22075E-02 -2.45286E-02
+ 4 -5.52959E-02 -7.94812E-02
+ 5 2.30392E-02 -6.72315E-02
+ 6 1.13747E-02 1.06330E-02
+6 0 *********** SCCS-Ala-Ala
+ 1 -1.13071E-01 1.14720E-01
+ 2 1.77018E-01 -3.52529E-01
+ 3 2.53076E-02 -3.20530E-02
+ 4 -5.13892E-02 -8.88139E-02
+ 5 3.40895E-03 -1.14563E-02
+ 6 -3.36404E-02 -4.87838E-03
+6 0 *********** SCCS-Ala-Cys
+ 1 1.87671E-01 8.41887E-02
+ 2 -2.58899E-02 -5.91412E-01
+ 3 -6.02484E-02 -6.83110E-02
+ 4 -6.01972E-02 -7.62475E-02
+ 5 1.66086E-02 1.13310E-02
+ 6 -1.52069E-02 2.08523E-02
+6 0 *********** SCCS-Ala-Pro
+ 1 2.97957E-01 1.43349E+00
+ 2 8.50101E-01 6.28525E-01
+ 3 1.37592E-01 3.21604E-01
+ 4 -1.65330E-01 3.97088E-02
+ 5 -5.87512E-02 1.95385E-01
+ 6 4.59752E-02 5.96600E-02
+6 0 *********** SCCS-Cys-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Cys-Asp
+ 1 1.54696E-01 2.74801E-01
+ 2 1.75668E-01 -6.02466E-01
+ 3 -3.71949E-02 2.85682E-02
+ 4 -2.23575E-02 -7.93697E-02
+ 5 3.18670E-02 -3.26104E-02
+ 6 3.42890E-03 9.99826E-03
+6 0 *********** SCCS-Cys-Ala
+ 1 3.12256E-01 2.89927E-01
+ 2 1.38469E-01 -4.21609E-01
+ 3 4.30847E-02 8.17844E-03
+ 4 -6.30056E-02 -7.43044E-02
+ 5 -2.42299E-02 -1.05221E-02
+ 6 -2.32065E-02 1.07005E-02
+6 0 *********** SCCS-Cys-Cys
+ 1 5.42115E-02 1.91060E-01
+ 2 -1.45695E-01 -7.74412E-01
+ 3 -2.74454E-02 -6.31361E-03
+ 4 -6.08427E-02 -5.15224E-02
+ 5 -2.37106E-02 3.55272E-02
+ 6 2.34366E-04 1.57237E-02
+6 0 *********** SCCS-Cys-Pro
+ 1 5.25532E-01 1.45831E+00
+ 2 1.23695E+00 9.22229E-01
+ 3 2.26554E-01 3.11519E-01
+ 4 8.04527E-03 1.20234E-01
+ 5 1.10145E-01 -3.76652E-02
+ 6 1.20059E-01 3.98373E-02
+6 0 *********** SCCS-Pro-Gly
+ 1 0.00000E+00 0.00000E+00
+ 2 0.00000E+00 0.00000E+00
+ 3 0.00000E+00 0.00000E+00
+ 4 0.00000E+00 0.00000E+00
+ 5 0.00000E+00 0.00000E+00
+ 6 0.00000E+00 0.00000E+00
+6 0 *********** SCCS-Pro-Asp
+ 1 -4.75566E-01 4.02839E-01
+ 2 -9.91621E-01 -5.27652E-01
+ 3 1.01043E-01 1.27747E-01
+ 4 2.21600E-01 9.83514E-02
+ 5 9.14873E-02 2.88332E-01
+ 6 -8.89657E-02 6.69934E-02
+6 0 *********** SCCS-Pro-Ala
+ 1 9.73371E-02 2.90189E-01
+ 2 -5.61755E-01 -4.03787E-01
+ 3 -1.18288E-01 -1.57214E-01
+ 4 1.33916E-01 1.47170E-01
+ 5 9.77810E-02 6.01187E-02
+ 6 -5.20456E-02 -7.13409E-02
+6 0 *********** SCCS-Pro-Cys
+ 1 2.37390E-01 5.34492E-02
+ 2 -7.98945E-01 -9.34123E-02
+ 3 -2.65067E-02 1.77660E-01
+ 4 9.11318E-02 8.22393E-02
+ 5 5.66528E-02 3.50986E-02
+ 6 -3.68829E-02 1.55213E-02
+6 0 *********** SCCS-Pro-Pro
+ 1 1.33315E+00 3.64948E-01
+ 2 9.40733E-01 -1.29363E+00
+ 3 -8.51267E-01 -3.39368E-01
+ 4 2.81813E-01 -1.68113E-01
+ 5 2.73587E-01 1.92177E-01
+ 6 3.48452E-02 -4.05145E-01
--- /dev/null
+CYS 3 1.237
+ 1.231369021557632E+00 2.113103139518216E+00 -1.476681317527360E+00
+ 1.359878926615624E+00 -3.499432056994118E+00 5.851204123972364E+00
+ 3.459723100501249E+00 1.294798610288682E+00 5.200500561157463E+00
+ 3.392033819970949E-01
+ 1.359527534079732E-01 2.488992224191690E+00 -1.450121802398932E+00
+ 4.725424960615999E+00 -4.418975268235962E+00 6.400484083733093E+00
+ -6.687748468647851E-01 -9.084157935657023E-01 1.046849325214548E+00
+ 7.829019235133238E-01
+ 7.415643590879490E-01 2.792768443976991E+00 -2.326205186615562E+00
+ 3.858922654647919E+00 2.090295355195358E+00 9.478999336121685E+00
+ -6.768263592724760E-01 5.478998925892089E-01 2.772884507615886E+00
+MET 3 2.142
+ 9.722127791633153E-02 2.498757650488667E+00 -1.863073704235900E+00
+ 1.028667973951980E+01 -1.744751696265225E-01 5.698529122809084E+00
+ 1.779878495634811E-01 1.302283396983590E+00 1.645070985258705E+00
+ -1.191702757775135E+00
+ 9.700887295306095E-01 2.538480849432296E+00 -1.687447400950541E+00
+ 2.914503970707226E+00 2.213301785498612E+00 4.010429280441711E+00
+ 2.771061835565503E-01 6.480629170944440E-01 1.679848361209695E+00
+ -1.628221773759656E+00
+ 4.484623269013633E-01 2.864001564043303E+00 7.913014582211814E-02
+ 3.486241945413903E+00 -1.221211083950580E+00 7.313788902870085E+00
+ -1.858364963267348E-01 1.286231122554250E-02 6.005873637331760E-01
+PHE 3 2.299
+ 1.792749228715690E-01 2.445321260587006E+00 -2.205383105485196E-01
+ 2.840049609374177E+00 -1.946074226932073E+00 7.434212815352109E+00
+ -1.325930890710515E+00 -2.222394548566823E+00 4.322358981301695E+00
+ -5.765617699207611E-01
+ 1.413760435690095E+00 1.915812548005232E+00 -1.549456042065778E+00
+ 1.871929323345368E+00 -1.798891416070481E+00 5.582439929847176E+00
+ 3.407720474278349E+00 1.386029650812961E+00 6.458424508347823E+00
+ -5.632243342901979E-01
+ 3.872060168185270E-01 2.551483419092877E+00 -2.909509224769854E+00
+ 2.777352210943400E+00 -1.559466166364287E+00 5.701287306910894E+00
+ 1.333394634883710E+00 1.343599581596888E+00 2.013294785721223E+00
+ILE 2 1.776
+ -8.993392849314651E-01 2.460735301794427E+00 -1.466352275710623E+00
+ 1.335507880308818E+00 3.877163081255017E-01 7.342141116717881E+00
+ 7.646810523407427E-01 4.326452654630720E-01 4.966284208737452E+00
+ -1.666694944219961E+00
+ 6.014239241365417E-01 2.880135719336223E+00 -2.070215098352316E+00
+ 4.161941123865015E+00 1.577137223745539E+00 1.012195032332899E+01
+ -1.627090702085070E-01 6.622334464456527E-01 1.262489404602994E+00
+LEU 2 1.939
+ 3.031139617881610E-01 2.638741044956045E+00 -5.106419445898494E-01
+ 4.831704554331401E+00 -3.697848673560471E+00 7.968578956159185E+00
+ -2.207860346857545E+00 -2.849178555593270E+00 3.258554653312988E+00
+ -6.946793699134425E-01
+ 2.142135800771929E-01 2.646823111812505E+00 -2.164247197286523E+00
+ 2.202765871995703E+00 -3.364828805115636E+00 5.101613190841591E+00
+ 4.613109756437048E-01 1.286816666077665E+00 1.503199199335317E+00
+VAL 3 1.410
+ 7.026604253503660E-01 2.523187735648662E+00 -1.561674989218780E+00
+ 1.683788105084965E+00 -3.290038249451969E+00 4.095279542685026E+00
+ 5.930133788835822E-01 6.799979143850547E-01 3.199690346005689E+00
+ 3.738180412805506E+00
+ 6.527373716823524E-02 2.487070654943019E+00 -1.280466510275925E+00
+ 1.546886613223673E+01 2.797972581686856E-01 1.576935600395508E+01
+ 2.214189328363042E-01 4.509398531501813E+00 1.127082394603407E+01
+ 1.148964981925863E+00
+ 5.111601528759810E-01 2.940400701888451E+00 -1.261593886733134E+00
+ 5.552778496952875E+00 -1.896738804484332E+00 1.304912692852219E+01
+ -3.376435655060783E-02 -5.880574756732890E-02 1.710540585086872E+00
+TRP 3 2.605
+ 3.671385351642817E-01 2.649906086725728E+00 -3.156606077931241E+00
+ 2.690908807161844E+00 -1.026463093825944E+00 5.060483795501765E+00
+ 8.253185580791326E-01 4.742781302323599E-01 1.333408847594917E+00
+ -4.813331350209762E-01
+ 8.486877673687784E-01 1.810301460940188E+00 -1.493282213570890E+00
+ 1.781266347191273E+00 -7.059746291420510E+00 4.646455292590170E+00
+ 7.948414660676448E-02 1.895728288968257E+00 2.603989448457775E+00
+ 8.209173910579813E-02
+ 2.717200429601971E-01 2.400990183711977E+00 -1.577652664504292E-01
+ 2.437028663976406E+00 -8.163339602649062E-01 4.586850127312752E+00
+ -1.081177212503867E-01 -1.493161294053607E+00 2.502481016266474E+00
+TYR 3 2.484
+ 4.028666745713829E-01 2.519003276438601E+00 -2.961640954840339E+00
+ 2.810344165608079E+00 -1.511517003072798E+00 5.824409353060568E+00
+ 1.466134423268518E+00 1.192683001754308E+00 2.100881004969442E+00
+ 4.671201937281126E-01
+ 1.270875009009630E-01 2.394447070478641E+00 -1.827684477015144E-01
+ 2.331550682785130E+00 -1.132358905395797E+00 7.193177319124498E+00
+ -1.022699111580738E+00 -2.721112738727777E+00 4.563594836270955E+00
+ -4.500643586478538E-01
+ 1.225837549981350E+00 1.875587240640277E+00 -1.551335672790210E+00
+ 1.943167657599241E+00 -1.940785649959641E+00 5.993343592431522E+00
+ 3.664991318878045E+00 1.542184195088237E+00 4.927234334893407E+00
+ALA 2 0.743
+ 7.419719809464693E-01 2.573069816683764E+00 -1.445022321790584E+00
+ 2.664034429086210E+00 -9.544541018281457E-01 4.931050451872054E+00
+ -2.252940531751257E-01 1.983979286852417E-01 3.424484598993639E+00
+ 3.302656131123964E+00
+ 6.859966237758021E-02 2.260980778629371E+00 -1.331483284360863E+00
+ 1.364738115017513E+01 -8.146260155599712E-01 1.496299563312356E+01
+ 4.636173064527849E-01 6.629814458423924E+00 1.388312051255217E+01
+GLY 0 0.000
+THR 3 1.393
+ 5.396062211948021E-01 2.896860177830998E+00 -1.216721192952898E+00
+ 4.969075609331727E+00 -2.794491848631561E+00 9.596330753868708E+00
+ -1.409200406451479E-01 1.514851393892751E-02 1.824412748816235E+00
+ 4.594808606971496E-01
+ 4.681166950347075E-01 2.368583199343734E+00 -1.621935088489747E+00
+ 2.081815334126496E+00 -4.883219939543496E+00 4.187512631560888E+00
+ -2.005988215261086E+00 -9.795008722668578E-01 3.729136436139124E+00
+ 2.881914774441310E+00
+ 5.705085647645143E-02 2.477787901184960E+00 -1.294293372963355E+00
+ 1.686093057525384E+01 9.551099284588697E-01 1.603877631675030E+01
+ 6.010996622329809E-01 1.864352621160113E+00 1.251483195843141E+01
+SER 2 1.150
+ -5.497069590255966E-01 1.933816215853224E+00 -1.272066735241571E+00
+ 1.673075066955311E+00 -6.048541008624543E+00 5.568869961886437E+00
+ 4.323468454867889E+00 5.728305342360822E+00 5.505848742322177E+00
+ -1.891146969473795E+00
+ 3.545637604391543E-01 2.516361001755047E+00 -1.405614220460048E+00
+ 2.602024141419324E+00 -3.306262412749110E+00 3.793823815282222E+00
+ -2.711053897830787E-01 -1.110920333229469E-01 1.394289514741237E+00
+GLN 2 2.240
+ 1.027151529129258E-01 2.402194719228994E+00 -1.840526154465306E+00
+ 1.035278504075063E+01 -3.042996004529227E-01 4.694929450977331E+00
+ 2.927121487211625E-01 6.550907667964759E-01 1.724533079288311E+00
+ -1.494517970520823E+00
+ 6.608878200615514E-01 2.641160540899916E+00 -1.786928303175113E+00
+ 2.272091312109362E+00 1.161744050050166E+00 4.382225001869918E+00
+ 1.149209568761504E-01 7.460217105526566E-02 7.426041660239801E-01
+ASN 3 1.684
+ 1.112324703760510E-01 2.528719444818902E+00 -2.379382053772226E+00
+ 3.003367245616277E+00 -3.077709164923569E+00 4.985751975374973E+00
+ 1.071072219163129E+00 1.147015025964058E+00 1.773370257994376E+00
+ -3.534179914231330E-01
+ 4.190831955801756E-01 2.663213595201207E+00 -4.139116465625171E-01
+ 2.538613102403088E+00 -1.602088849778903E+00 6.399612979739945E+00
+ -9.548410606537884E-01 -6.166941633843815E-01 2.325009293208644E+00
+ 1.069207572802126E-01
+ 9.476766747812758E-01 1.986688873032181E+00 -1.477414498295757E+00
+ 1.351726099094456E+00 -1.905998737540555E+00 7.220080605345742E+00
+ 1.203769942930408E+00 8.057677136706265E-01 7.255204499253058E+00
+GLU 2 2.254
+ 6.166174397478329E-01 2.693699329729441E+00 -1.815037701752951E+00
+ 2.362949343214702E+00 6.607299337431395E-02 4.810699687696198E+00
+ -1.797853312829220E-02 1.201102153157729E-01 8.106206358901631E-01
+ 1.007096375122964E+00
+ 9.129006848374797E-02 2.317041280936629E+00 -1.558857025943406E+00
+ 1.011107292999823E+01 -5.328741393611267E-01 3.878173399207487E+00
+ 4.044654587833792E-02 -9.448056425066667E-02 1.885476706933426E+00
+ASP 3 1.709
+ 5.400605786370840E-01 2.657722884515353E+00 -3.385273047058785E-01
+ 2.898083944088662E+00 -1.328273653208097E+00 7.223737735100110E+00
+ -4.157376380045905E-01 -1.072329011263512E+00 3.233263570904083E+00
+ -3.989809665255895E-02
+ -3.109978485378748E-02 2.463994287298199E+00 -2.105677103768799E+00
+ 4.311372565687824E+00 -4.970595023288378E+00 4.950710638274173E+00
+ 1.139208265734643E+00 1.630793464419479E+00 1.639513705335163E+00
+ -3.771887580443609E-01
+ 6.105555660819125E-01 1.970311083953980E+00 -1.441339194531222E+00
+ 1.551018782708743E+00 -2.827531798850897E+00 5.723235709915189E+00
+ -1.078460330524896E+00 7.700956574760588E-01 6.344660213195646E+00
+HIS 3 2.113
+ 1.079338349140086E+00 1.849201182174331E+00 -1.512850967805422E+00
+ 1.712591981224657E+00 -3.158900916348374E+00 5.920842405006604E+00
+ 3.622057782204497E+00 1.817638218496146E+00 5.150761208239930E+00
+ 5.074858225126165E-01
+ 2.573617350357087E-01 2.500706138792129E+00 -2.684315843812017E+00
+ 2.621189104761450E+00 -2.862497001612499E+00 5.338578885081990E+00
+ 1.135581147707634E+00 9.508053123569241E-01 2.080139050567627E+00
+ 3.984094872658914E-01
+ 3.049738507877272E-01 2.487729725733018E+00 -2.164821284296528E-01
+ 2.450893788481603E+00 -1.800558830434274E+00 5.712326383935853E+00
+ -1.294194499599506E+00 -1.225776080654669E+00 3.563351646368943E+00
+ARG 1 3.020
+ 2.658505077963930E-01 2.479884890012459E+00 -2.008958667908643E+00
+ 1.747155103050119E+00 -8.926596092802748E-01 3.301752445174772E+00
+ 1.014462199059906E-01 2.456980356367927E-01 7.408904959852515E-01
+LYS 2 2.541
+ 7.923379070478030E-02 2.425873196105961E+00 -1.733532248623140E+00
+ 1.337559472175678E+01 9.888245505076281E-01 7.031156014718327E+00
+ 3.370494365618861E-01 6.128970418682688E-01 1.383582262184565E+00
+ -1.612492318547635E+00
+ 5.991027320671027E-01 2.605935955764981E+00 -1.747726166038849E+00
+ 2.158191195473436E+00 -8.729452021612440E-01 3.406203674600574E+00
+ 1.472643934438318E-01 1.972139148579855E-01 8.378149787932554E-01
+PRO 2 1.345
+ 5.949257202797159E-01 2.115043062984257E+00 -2.243046587283823E+00
+ 7.864992205907319E+00 -1.166688113704284E+01 1.582629740652047E+01
+ -1.062192417755259E+01 6.919539462773781E+00 5.075035563649993E+00
+ -1.059712366514320E+00
+ 6.598832522023589E-02 1.743404116417184E+00 -1.990010091107989E+00
+ 9.339178673430029E+00 1.583092863327845E-01 9.472694795331311E+00
+ -1.358141183315971E+00 1.090025619396050E+00 4.267614299031873E+00
+SME 3 2.142
+ 9.722127791633153E-02 2.498757650488667E+00 -1.863073704235900E+00
+ 1.028667973951980E+01 -1.744751696265225E-01 5.698529122809084E+00
+ 1.779878495634811E-01 1.302283396983590E+00 1.645070985258705E+00
+ -1.191702757775135E+00
+ 9.700887295306095E-01 2.538480849432296E+00 -1.687447400950541E+00
+ 2.914503970707226E+00 2.213301785498612E+00 4.010429280441711E+00
+ 2.771061835565503E-01 6.480629170944440E-01 1.679848361209695E+00
+ -1.628221773759656E+00
+ 4.484623269013633E-01 2.864001564043303E+00 7.913014582211814E-02
+ 3.486241945413903E+00 -1.221211083950580E+00 7.313788902870085E+00
+ -1.858364963267348E-01 1.286231122554250E-02 6.005873637331760E-01
+DBZ 3 3.799
+ 1.792749228715690E-01 2.445321260587006E+00 -2.205383105485196E-01
+ 2.840049609374177E+00 -1.946074226932073E+00 7.434212815352109E+00
+ -1.325930890710515E+00 -2.222394548566823E+00 4.322358981301695E+00
+ -5.765617699207611E-01
+ 1.413760435690095E+00 1.915812548005232E+00 -1.549456042065778E+00
+ 1.871929323345368E+00 -1.798891416070481E+00 5.582439929847176E+00
+ 3.407720474278349E+00 1.386029650812961E+00 6.458424508347823E+00
+ -5.632243342901979E-01
+ 3.872060168185270E-01 2.551483419092877E+00 -2.909509224769854E+00
+ 2.777352210943400E+00 -1.559466166364287E+00 5.701287306910894E+00
+ 1.333394634883710E+00 1.343599581596888E+00 2.013294785721223E+00
+AIB 2 0.743
+ 7.419719809464693E-01 3.003069816683764E+00 -1.445022321790584E-02
+ 2.664034429086210E+00 -9.544541018281457E-01 4.931050451872054E+00
+ -2.252940531751257E-01 1.983979286852417E-01 3.424484598993639E+00
+ 0.000656131123964E+00
+ 7.419719809464693E-01 3.003069816683764E+00 1.445022321790584E-02
+ 2.664034429086210E+00 -9.544541018281457E-01 4.931050451872054E+00
+ -2.252940531751257E-01 1.983979286852417E-01 3.424484598993639E+00
+ABU 2 1.210
+ -5.497069590255966E-01 1.933816215853224E+00 -1.272066735241571E+00
+ 1.673075066955311E+00 -6.048541008624543E+00 5.568869961886437E+00
+ 4.323468454867889E+00 5.728305342360822E+00 5.505848742322177E+00
+ -1.891146969473795E+00
+ 3.545637604391543E-01 2.516361001755047E+00 -1.405614220460048E+00
+ 2.602024141419324E+00 -3.306262412749110E+00 3.793823815282222E+00
+ -2.711053897830787E-01 -1.110920333229469E-01 1.394289514741237E+00
5.2638423822 5.4961954124 4.2928124162 4.3582250540
4.2667755921 3.6813845958 3.5405429647 3.7026985912
4.7177596156 3.3811992227 3.7936085458 4.5157490585
+
6.6296746680 6.6717260508 6.8168876945 6.8378960152
6.3512039986 6.1425192423 5.5200206406 5.4858936024
4.9382573262 4.2795129166 4.0534857018 4.2086428525
3.5388086279 3.4209730327 2.7995744193 4.8164268553
- 3.8790755071 3.5878262177 4.6457432555 6.6424306340
- 6.9715947250 6.9241225787 6.5291325353 6.1394821460
- 5.4415971840 5.2914044780 4.7881880526 4.1302408718
- 3.9405275117 3.9022731880 3.6078928145 3.0809713206
- 3.0182595342 4.7935507272 3.8711928134 3.6826168780
- 4.4872661030 7.3271707934 7.2970176793 7.0494948235
- 6.2565687662 5.8133715113 5.8845382769 5.3463553241
- 4.7146928716 4.4864793359 4.3092352779 3.6928361281
- 4.0100566871 3.6584608489 4.5901676001 4.4681844010
- 4.6334334282 4.9023945082 7.0106342493 6.8341607204
- 6.2047876082 5.5802122247 5.6716968726 5.2011344932
- 4.1966522349 4.2383931955 3.8954073453 3.5679086118
- 3.1136348127 2.7622561241 4.5092053374 4.0238412606
- 3.9799853578 4.8087180377 6.5353606708 5.8844482033
- 5.1100976261 5.5515360893 4.9587559238 4.2030790774
- 4.0351600709 3.6506289806 3.4640416936 3.1611022087
- 2.7976192835 4.0422832763 3.4415952740 3.8620694983
- 4.5934246009 5.2828811325 4.8298466315 4.7575327777
- 4.7249779042 3.5656384285 3.5613366567 3.9273045564
- 3.7664779118 3.5861699761 3.5523191627 4.6508672463
- 4.2424308260 4.0987727783 4.5079669929 4.2222645754
- 4.1627149417 3.9786372270 3.1623319201 2.9379696734
- 3.1365985188 2.8025851476 2.6576343487 2.8733395837
- 3.8785891655 3.4443068252 3.4405132673 4.0915305763
+ 3.8790755071 3.5878262177 4.6457432555
+
+ 6.6424306340 6.9715947250 6.9241225787 6.5291325353
+ 6.1394821460 5.4415971840 5.2914044780 4.7881880526
+ 4.1302408718 3.9405275117 3.9022731880 3.6078928145
+ 3.0809713206 3.0182595342 4.7935507272 3.8711928134
+ 3.6826168780 4.4872661030
+
+ 7.3271707934 7.2970176793 7.0494948235 6.2565687662
+ 5.8133715113 5.8845382769 5.3463553241 4.7146928716
+ 4.4864793359 4.3092352779 3.6928361281 4.0100566871
+ 3.6584608489 4.5901676001 4.4681844010 4.6334334282
+ 4.9023945082
+ 7.0106342493 6.8341607204 6.2047876082 5.5802122247
+ 5.6716968726 5.2011344932 4.1966522349 4.2383931955
+ 3.8954073453 3.5679086118 3.1136348127 2.7622561241
+ 4.5092053374 4.0238412606 3.9799853578 4.8087180377
+
+ 6.5353606708 5.8844482033 5.1100976261 5.5515360893
+ 4.9587559238 4.2030790774 4.0351600709 3.6506289806
+ 3.4640416936 3.1611022087 2.7976192835 4.0422832763
+ 3.4415952740 3.8620694983 4.5934246009
+
+ 5.2828811325 4.8298466315 4.7575327777 4.7249779042
+ 3.5656384285 3.5613366567 3.9273045564 3.7664779118
+ 3.5861699761 3.5523191627 4.6508672463 4.2424308260
+ 4.0987727783 4.5079669929
+
+ 4.2222645754 4.1627149417 3.9786372270 3.1623319201
+ 2.9379696734 3.1365985188 2.8025851476 2.6576343487
+ 2.8733395837 3.8785891655 3.4443068252 3.4405132673
+ 4.0915305763
+
4.3860654351 3.6520014167 3.0264937881 2.5680579493
2.5001857370 2.1393094782 1.4707077389 1.7373181916
3.1045342752 2.0152329038 1.8196209136 3.6395852546
+
2.5016557935 2.7879606493 2.1424756816 1.0741544747
1.3236438850 -.2712356678 .7613312181 2.8627348285
- 1.5002127649 -.2392577636 3.5381128985 2.2903847447
- 2.2466771550 1.5053607856 1.4031797188 .9676209687
- 1.3075541842 2.8595118604 1.9833053538 -.0085773647
- 2.9557553666 1.2800038243 .7689806100 .9119606366
- -.0744371793 .3669965427 2.4288563200 1.4975482174
- -.2134101897 2.9415021479 -.6792428859 .4532383239
- -.7590387660 -.3617034846 1.6803275058 .6775209988
- -.5354837468 2.6208591363 .4136122500 -.1637152873
- .2212564728 2.1287126020 .3896388275 -.2354089650
- 2.3255326077 -3.5193531074 -2.0157307929 1.8355926160
- 2.7489174124 2.0098391558 1.7975718667 -1.3532688232
- 2.5504275249 2.8202873790 1.6253609671 1.8625091247
+ 1.5002127649 -.2392577636 3.5381128985
+
+ 2.2903847447 2.2466771550 1.5053607856 1.4031797188
+ .9676209687 1.3075541842 2.8595118604 1.9833053538
+ -.0085773647 2.9557553666
+
+ 1.2800038243 .7689806100 .9119606366 -.0744371793
+ .3669965427 2.4288563200 1.4975482174 -.2134101897
+ 2.9415021479
+ -.6792428859 .4532383239 -.7590387660 -.3617034846
+ 1.6803275058 .6775209988 -.5354837468 2.6208591363
+
+ .4136122500 -.1637152873 .2212564728 2.1287126020
+ .3896388275 -.2354089650 2.3255326077
+
+ -3.5193531074 -2.0157307929 1.8355926160 2.7489174124
+ 2.0098391558 1.7975718667
+
+ -1.3532688232 2.5504275249 2.8202873790 1.6253609671
+ 1.8625091247
+
3.7292778697 2.2944436481 -.0303565255 3.1115776177
- -.0827362961 -1.6043113182 2.4439837435 -4.3897783280
- 2.3664634533 4.1927969260 2.6748060017 2.7338810145
- 2.9664647229 2.8819636737 3.0210738150 2.8414286152
- 2.4773438660 2.4611943788 2.4653201213 2.4925087371
- 2.5734767751 2.4564026744 2.4847825281 2.4889289233
- 2.5089517645 2.5083338383 2.4220622723 2.2714609770
- 2.4520703089 2.7026129788 4.9272154761 5.1054284230
- 4.2073516165 4.8513972837 2.7848875293 3.5829861634
- 7.8660217576 7.4299209847 1.9625939832 .7987769569
- 4.0580899681 1.8889021032 3.1987197026 3.2673274538
- 2.6848131904 2.0043027404 6.2446341910 8.1959452095
- 13.4748295858 2.6632376837 .8699023011 1.0540660014
- .9385909298 1.0263274101 1.0835277045 1.0543183886
- .7888686996 .8989305833 1.0039962875 1.2427518128
- .8932801724 .9173928990 1.6157695657 1.4315860373
- 2.0498317879 1.4199615546 .9933677971 1.4319625600
- 27.4951763288 .7788025286 .0103697556 .0611385674
- .0448303346 .0392831782 .0854166338 .0398896619
- .0249496569 .0232410908 .0861379100 -.0754794185
- -.0266146021 -.0163429099 .0572167103 -.0468608825
- .0151048455 .0084963678 .0278930397 .0076922911
- .1033536738 -.0098256036
+
+ -.0827362961 -1.6043113182 2.4439837435
+
+ -4.3897783280 2.3664634533
+
+ 4.1927969260
+
+ 2.6748060017 2.7338810145 2.9664647229 2.8819636737
+ 3.0210738150 2.8414286152 2.4773438660 2.4611943788
+ 2.4653201213 2.4925087371 2.5734767751 2.4564026744
+ 2.4847825281 2.4889289233 2.5089517645 2.5083338383
+ 2.4220622723 2.2714609770 2.4520703089 2.7026129788
+
+ 4.9272154761 5.1054284230 4.2073516165 4.8513972837
+ 2.7848875293 3.5829861634 7.8660217576 7.4299209847
+ 1.9625939832 .7987769569 4.0580899681 1.8889021032
+ 3.1987197026 3.2673274538 2.6848131904 2.0043027404
+ 6.2446341910 8.1959452095 13.4748295858 2.6632376837
+
+ .8699023011 1.0540660014 .9385909298 1.0263274101
+ 1.0835277045 1.0543183886 .7888686996 .8989305833
+ 1.0039962875 1.2427518128 .8932801724 .9173928990
+ 1.6157695657 1.4315860373 2.0498317879 1.4199615546
+ .9933677971 1.4319625600 27.4951763288 .7788025286
+
+ .0103697556 .0611385674 .0448303346 .0392831782
+ .0854166338 .0398896619 .0249496569 .0232410908
+ .0861379100 -.0754794185 -.0266146021 -.0163429099
+ .0572167103 -.0468608825 .0151048455 .0084963678
+ .0278930397 .0076922911 .1033536738 -.0098256036
--- /dev/null
+4 6
+ 5.6053537261 6.2200032154 6.2159898496 6.4386968963
+ 6.2098101231 5.9596374798 5.4310222662 4.8790085257
+ 5.2638423822 5.4961954124 4.2928124162 4.3582250540
+ 4.2667755921 3.6813845958 3.5405429647 3.7026985912
+ 4.7177596156 3.3811992227 3.7936085458 4.5157490585
+ 6.2200032154 6.2159898496 5.2638423822 5.2638423822
+
+ 6.6296746680 6.6717260508 6.8168876945 6.8378960152
+ 6.3512039986 6.1425192423 5.5200206406 5.4858936024
+ 4.9382573262 4.2795129166 4.0534857018 4.2086428525
+ 3.5388086279 3.4209730327 2.7995744193 4.8164268553
+ 3.8790755071 3.5878262177 4.6457432555 6.6296746680
+ 6.6717260508 5.4858936024 5.4858936024
+
+ 6.6424306340 6.9715947250 6.9241225787 6.5291325353
+ 6.1394821460 5.4415971840 5.2914044780 4.7881880526
+ 4.1302408718 3.9405275117 3.9022731880 3.6078928145
+ 3.0809713206 3.0182595342 4.7935507272 3.8711928134
+ 3.6826168780 4.4872661030 6.6717260508 6.6424306340
+ 5.2914044780 5.2914044780
+
+ 7.3271707934 7.2970176793 7.0494948235 6.2565687662
+ 5.8133715113 5.8845382769 5.3463553241 4.7146928716
+ 4.4864793359 4.3092352779 3.6928361281 4.0100566871
+ 3.6584608489 4.5901676001 4.4681844010 4.6334334282
+ 4.9023945082 6.8168876945 6.9715947250 5.8845382769
+ 5.8845382769
+
+ 7.0106342493 6.8341607204 6.2047876082 5.5802122247
+ 5.6716968726 5.2011344932 4.1966522349 4.2383931955
+ 3.8954073453 3.5679086118 3.1136348127 2.7622561241
+ 4.5092053374 4.0238412606 3.9799853578 4.8087180377
+ 6.8378960152 6.9241225787 5.6716968726 5.6716968726
+
+ 6.5353606708 5.8844482033 5.1100976261 5.5515360893
+ 4.9587559238 4.2030790774 4.0351600709 3.6506289806
+ 3.4640416936 3.1611022087 2.7976192835 4.0422832763
+ 3.4415952740 3.8620694983 4.5934246009 6.3512039986
+ 6.5291325353 5.5515360893 5.5515360893
+
+ 5.2828811325 4.8298466315 4.7575327777 4.7249779042
+ 3.5656384285 3.5613366567 3.9273045564 3.7664779118
+ 3.5861699761 3.5523191627 4.6508672463 4.2424308260
+ 4.0987727783 4.5079669929 6.1425192423 6.1394821460
+ 4.7575327777 4.7575327777
+
+ 4.2222645754 4.1627149417 3.9786372270 3.1623319201
+ 2.9379696734 3.1365985188 2.8025851476 2.6576343487
+ 2.8733395837 3.8785891655 3.4443068252 3.4405132673
+ 4.0915305763 5.5200206406 5.4415971840 4.1627149417
+ 4.1627149417
+
+ 4.3860654351 3.6520014167 3.0264937881 2.5680579493
+ 2.5001857370 2.1393094782 1.4707077389 1.7373181916
+ 3.1045342752 2.0152329038 1.8196209136 3.6395852546
+ 5.4858936024 5.2914044780 4.3860654351 4.3860654351
+
+ 2.5016557935 2.7879606493 2.1424756816 1.0741544747
+ 1.3236438850 -.2712356678 .7613312181 2.8627348285
+ 1.5002127649 -.2392577636 3.5381128985 4.9382573262
+ 4.7881880526 3.6520014167 3.6520014167
+
+ 2.2903847447 2.2466771550 1.5053607856 1.4031797188
+ .9676209687 1.3075541842 2.8595118604 1.9833053538
+ -.0085773647 2.9557553666 4.2795129166 4.1302408718
+ 3.0264937881 3.0264937881
+
+ 1.2800038243 .7689806100 .9119606366 -.0744371793
+ .3669965427 2.4288563200 1.4975482174 -.2134101897
+ 2.9415021479 4.0534857018 3.9405275117 2.5680579493
+ 2.5680579493
+
+ -.6792428859 .4532383239 -.7590387660 -.3617034846
+ 1.6803275058 .6775209988 -.5354837468 2.6208591363
+ 4.2086428525 3.9022731880 2.5001857370 2.5001857370
+
+ .4136122500 -.1637152873 .2212564728 2.1287126020
+ .3896388275 -.2354089650 2.3255326077 3.5388086279
+ 3.6078928145 2.1393094782 2.1393094782
+
+ -3.5193531074 -2.0157307929 1.8355926160 2.7489174124
+ 2.0098391558 1.7975718667 3.4209730327 3.0809713206
+ 1.4707077389 1.4707077389
+
+ -1.3532688232 2.5504275249 2.8202873790 1.6253609671
+ 1.8625091247 2.7995744193 3.0182595342 1.7373181916
+ 1.7373181916
+
+ 3.7292778697 2.2944436481 -.0303565255 3.1115776177
+ 4.8164268553 4.7935507272 3.1045342752 3.1045342752
+
+ -.0827362961 -1.6043113182 2.4439837435 3.8790755071
+ 3.8711928134 2.0152329038 2.0152329038
+
+ -4.3897783280 2.3664634533 3.5878262177 3.6826168780
+ 1.8196209136 1.8196209136
+
+ 4.1927969260 4.6457432555 4.4872661030 3.6395852546
+ 3.6395852546
+
+ 6.6296746680 6.6717260508 5.4858936024 5.4858936024
+
+ 6.6424306340 5.2914044780 5.2914044780
+
+ 4.3860654351 4.3860654351
+
+ 4.3860654351
+
+ 2.6748060017 2.7338810145 2.9664647229 2.8819636737
+ 3.0210738150 2.8414286152 2.4773438660 2.4611943788
+ 2.4653201213 2.4925087371 2.5734767751 2.4564026744
+ 2.4847825281 2.4889289233 2.5089517645 2.5083338383
+ 2.4220622723 2.2714609770 2.4520703089 2.7026129788
+ 2.7338810145 2.9664647229 2.4653201213 2.4653201213
+
+ 4.9272154761 5.1054284230 4.2073516165 4.8513972837
+ 2.7848875293 3.5829861634 7.8660217576 7.4299209847
+ 1.9625939832 .7987769569 4.0580899681 1.8889021032
+ 3.1987197026 3.2673274538 2.6848131904 2.0043027404
+ 6.2446341910 8.1959452095 13.4748295858 2.6632376837
+ 5.1054284230 4.2073516165 1.9625939832 1.9625939832
+
+ .8699023011 1.0540660014 .9385909298 1.0263274101
+ 1.0835277045 1.0543183886 .7888686996 .8989305833
+ 1.0039962875 1.2427518128 .8932801724 .9173928990
+ 1.6157695657 1.4315860373 2.0498317879 1.4199615546
+ .9933677971 1.4319625600 27.4951763288 .7788025286
+ 1.0540660014 .9385909298 1.0039962875 1.0039962875
+
+ .0103697556 .0611385674 .0448303346 .0392831782
+ .0854166338 .0398896619 .0249496569 .0232410908
+ .0861379100 -.0754794185 -.0266146021 -.0163429099
+ .0572167103 -.0468608825 .0151048455 .0084963678
+ .0278930397 .0076922911 .1033536738 -.0098256036
+ .0611385674 .0448303346 .0861379100 .0861379100
--- /dev/null
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 CYS
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 MET
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 PHE
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 ILE
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 LEU
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 VAL
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 TRP
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 TYR
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 ALA
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 GLY
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 THR
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 SER
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 GLN
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 ASN
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 GLU
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 ASP
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 HIS
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 ARG
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 LYS
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 PRO
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 SME
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 DBZ
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 AIB
+ -1.5000000000 4.0000000000 -1.5000000000 4.0000000000 ABU
--- /dev/null
+ 2.06465 -0.06831 0.01355 -0.00812 -0.09758 #Cys
+ 29.21370 -34.44846 13.72337 -1.74054
+ 3.09856 1.95857 0.03306
+ 1.63064 0.07168 -0.04257
+ 1.99178 -0.06482 -0.03880 -0.11590 -0.16841 #Met
+ 1019.06154 -1501.20365 733.35985 -118.79055
+ 2.18609 1.57215 0.21806
+ 1.59688 0.05049 -1.05253
+ 2.03448 -0.03722 -0.02796 -0.07020 -0.15794 #Phe
+ 106.86695 -106.89456 27.09324 -0.22643
+ 26.65625 -0.37887 0.32246
+ 1.63105 0.07107 1.25760
+ 2.02718 -0.01708 -0.00960 -0.05401 -0.06189 #Ile
+ -615.59829 969.96424 -507.35634 88.26905
+ 46.70433 0.83300 0.11943
+ 1.62975 0.07455 -0.04858
+ 1.95310 -0.05566 -0.06591 -0.07030 -0.09413 #Leu
+ 1652.27901 -2470.82365 1227.14429 -202.39631
+ 2.36688 1.74318 0.10797
+ 1.60809 0.05629 -1.08576
+ 2.03284 -0.01545 -0.02060 -0.07657 -0.08562 #Val
+ 4761.57404 -6901.80322 3328.45293 -534.03362
+ 33.52089 0.29937 0.20598
+ 1.62521 0.07389 -1.05243
+ 2.06851 -0.03319 0.01965 -0.02164 -0.09654 #Trp
+ 1638.97503 -2411.55013 1180.03365 -191.98736
+ 4.46092 1.98145 0.01623
+ 1.62608 0.06970 1.08159
+ 2.08602 -0.04157 0.01038 -0.03532 -0.13794 #Tyr
+ -107.69022 266.55612 -181.08076 37.35743
+ 4.24066 1.95577 0.01622
+ 1.63390 0.07678 1.19713
+ 1.97815 -0.06321 -0.06208 -0.11214 -0.14326 #Ala
+ 766.38404 -1127.22990 549.33368 -88.68934
+ 4.17259 1.25710 0.26371
+ 1.59573 0.05208 -1.07378
+ 2.13434 -0.05195 0.02396 0.01347 -0.17139 #Gly
+ -753.46517 1044.36067 -481.75066 74.03551
+ 4.05617 1.95337 0.05127
+ 1.64921 0.07842 0.95510
+ 2.10098 -0.02296 -0.01603 -0.03525 -0.07186 #Thr
+ 6549.16222 -9185.31294 4288.04011 -666.27514
+ 72.03562 -1.65111 0.31257
+ 1.64724 0.08296 1.13068
+ 2.09671 -0.01870 -0.02299 -0.04238 -0.06419 #Ser
+ -8004.16591 11403.06948 -5414.06076 856.73824
+ 83.62142 -2.22395 0.33449
+ 1.62636 0.07882 1.08974
+ 1.95803 -0.05083 -0.04893 -0.09656 -0.15217 #Gln
+ 814.31120 -1198.45388 584.79505 -94.59531
+ 3.23590 1.19270 0.31671
+ 1.59853 0.05034 1.11522
+ 1.97198 -0.06385 0.05392 -0.04646 -0.08177 #Asn
+ 291.96891 -449.97314 231.74382 -39.71451
+ 3.55134 1.89287 0.02937
+ 1.63346 0.08123 0.02128
+ 2.03333 -0.01495 -0.00560 -0.06888 -0.10661 #Glu
+ 125.45691 -84.06896 -8.37432 9.53694
+ 38.23766 0.87783 0.12314
+ 1.61268 0.06986 1.09398
+ 2.01204 -0.02209 -0.01758 -0.04489 -0.06184 #Asp
+ 12378.82287 -18291.64504 9002.42074 -1475.68394
+ 21.29358 0.47419 0.23987
+ 1.62195 0.07479 -1.12367
+ 2.03710 -0.04510 0.01242 -0.02475 -0.16309 #His
+ -45.83876 73.82429 -38.51477 6.68058
+ 4.89521 1.88416 0.01213
+ 1.63141 0.08680 0.02961
+ 2.05079 -0.04421 0.01084 -0.01323 -0.15358 #Arg
+ -544.97661 800.57178 -391.37329 63.77070
+ 4.55612 1.91434 0.02113
+ 1.62247 0.07063 0.83511
+ 2.00849 -0.03763 -0.02354 -0.06875 -0.13654 #Lys
+ 1123.12058 -1614.34746 770.07474 -121.86663
+ 83.25740 -7.17128 0.71018
+ 1.61550 0.07052 1.11514
+ 2.03763 0.00079 -0.00355 -0.00406 -0.00869 #Pro
+ -200705.91646 306523.02136 -155888.42030 26402.00623
+ 4.25848 2.02803 0.00189
+ 1.61462 0.07555 -1.06659
+ 1.99178 -0.06482 -0.03880 -0.11590 -0.16841 #MSe
+ 1019.06154 -1501.20365 733.35985 -118.79055
+ 2.18609 1.57215 0.21806
+ 1.59688 0.05049 -1.05253
+ 2.03448 -0.03722 -0.02796 -0.07020 -0.15794 #DBZ
+ 106.86695 -106.89456 27.09324 -0.22643
+ 26.65625 -0.37887 0.32246
+ 1.63105 0.07107 1.25760
+ 2.13434 -0.05195 0.02396 0.01347 -0.17139 #AIB
+ -753.46517 1044.36067 -481.75066 74.03551
+ 4.05617 1.95337 0.05127
+ 1.64921 0.07842 0.95510
+ 1.97815 -0.06321 -0.06208 -0.11214 -0.14326 #ABU
+ 766.38404 -1127.22990 549.33368 -88.68934
+ 4.17259 1.25710 0.26371
+ 1.59573 0.05208 -1.07378
+
--- /dev/null
+3 *** Parameters derived by integrating MP2/6-31G** local energy surfaces ***
+1 1 1 1 1 1 1 1 1 0 1 1 1 1 1 1 1 1 1 2
+ 0 0 ** Gly-D-Pro-reg
+ 0 0 ** Gly-D-Ala-reg
+ 6 0 ************ G-G
+ 1 4.03053E-03 0.0
+ 2 -4.90330E-03 0.0
+ 3 2.70952E-01 0.0
+ 4 -7.20927E-02 0.0
+ 5 -3.66258E-03 0.0
+ 6 -6.34294E-03 0.0
+ 6 0 ************ G-A
+ 1 1.27465E-02 -1.01763E-01
+ 2 -8.41985E-03 1.18716E-02
+ 3 2.50582E-01 3.30235E-02
+ 4 -1.02631E-01 1.46337E-01
+ 5 6.63161E-03 8.86275E-03
+ 6 -6.81049E-03 8.71641E-03
+10 0 ************ G-P
+ 1 -1.14953E+00 1.29720E+00
+ 2 -1.08859E-03 -1.20321E-02
+ 3 4.04229E-01 2.92750E-01
+ 4 -2.41994E-01 5.38295E-02
+ 5 4.31804E-02 -6.56306E-02
+ 6 4.29080E-02 1.38685E-01
+ 7 -6.31286E-02 -2.65338E-02
+ 8 1.46743E-02 -3.26658E-03
+ 9 -1.33460E-02 3.01470E-02
+ 0 -1.11258E-02 -3.15723E-02
+ 0 0 ****** Ala-D-Pro
+ 0 0 ****** Ala-D-Ala
+ 6 0 ************ A-G
+ 1 5.14830E-03 9.48478E-02
+ 2 -8.85552E-02 1.20661E-01
+ 3 2.65903E-01 -8.99192E-02
+ 4 -6.16552E-02 -6.07952E-02
+ 5 2.19209E-02 -3.09487E-02
+ 6 -1.58136E-02 -1.74252E-02
+ 6 0 ************ A-A
+ 1 1.05084E+00 -1.83406E-03
+ 2 2.56198E-01 3.75825E-02
+ 3 2.97224E-01 -6.65886E-03
+ 4 -9.30144E-02 2.78499E-02
+ 5 2.69127E-02 -2.79813E-03
+ 6 -5.69348E-03 -5.76679E-03
+10 0 ************ A-P
+ 1 1.97348E+00 3.61809E+00
+ 2 3.25172E-01 6.93324E-01
+ 3 7.44811E-01 2.28853E-01
+ 4 -1.11515E-02 4.21766E-01
+ 5 -1.09160E-01 4.09945E-02
+ 6 1.08618E-01 6.71048E-03
+ 7 1.21785E-02 9.37813E-02
+ 8 -2.77282E-02 2.84981E-02
+ 9 2.15879E-02 1.85528E-02
+ 0 -8.56980E-03 3.92482E-02
+ 0 0 ** Pro-D-Por
+ 0 0 ** Pro-D-Ala
+10 0 ************ P-G
+ 1 2.12359E-02 4.05506E-02
+ 2 -1.19424E-01 2.91087E-01
+ 3 3.81770E-01 -1.11839E-01
+ 4 -9.75339E-02 -7.60089E-02
+ 5 -5.00214E-02 3.42037E-02
+ 6 8.12296E-02 3.98713E-02
+ 7 -1.21613E-02 -4.57682E-02
+ 8 6.95870E-03 2.28245E-02
+ 9 2.02598E-02 -2.00100E-02
+ 0 -1.48685E-02 -1.09627E-02
+10 0 ************ P-A
+ 1 1.40539E+00 -7.42879E-01
+ 2 9.21075E-02 -1.17205E-01
+ 3 4.49479E-01 3.82888E-02
+ 4 8.11975E-02 -3.35594E-02
+ 5 -9.88964E-03 -4.63759E-02
+ 6 8.58396E-02 4.22362E-02
+ 7 2.73049E-02 -5.43392E-02
+ 8 -4.18620E-03 -1.04889E-02
+ 9 1.06804E-02 -7.89066E-03
+ 0 -5.01879E-03 -1.20569E-02
+10 0 ************ P-P
+ 1 4.23219E+00 1.42318E+00
+ 2 1.24967E+00 -2.32575E-01
+ 3 5.38690E-01 -4.25507E-01
+ 4 4.01096E-01 -6.42186E-01
+ 5 2.52852E-01 -2.32257E-01
+ 6 -3.06406E-02 -2.48617E-01
+ 7 -1.68086E-02 -1.55069E-01
+ 8 -9.68421E-02 -1.80718E-01
+ 9 -2.73541E-02 -1.36915E-01
+ 0 -6.08829E-02 -6.71426E-02
+ 0 0 ** Gly-D-Pro-reg
+ 0 0 ** Gly-D-Ala-reg
+ 6 0 ************ G-G
+ 1 4.03053E-03 0.0
+ 2 -4.90330E-03 0.0
+ 3 2.70952E-01 0.0
+ 4 -7.20927E-02 0.0
+ 5 -3.66258E-03 0.0
+ 6 -6.34294E-03 0.0
+ 6 0 ************ G-A
+ 1 1.27465E-02 -1.01763E-01
+ 2 -8.41985E-03 1.18716E-02
+ 3 2.50582E-01 3.30235E-02
+ 4 -1.02631E-01 1.46337E-01
+ 5 6.63161E-03 8.86275E-03
+ 6 -6.81049E-03 8.71641E-03
+10 0 ************ G-P
+ 1 -1.14953E+00 1.29720E+00
+ 2 -1.08859E-03 -1.20321E-02
+ 3 4.04229E-01 2.92750E-01
+ 4 -2.41994E-01 5.38295E-02
+ 5 4.31804E-02 -6.56306E-02
+ 6 4.29080E-02 1.38685E-01
+ 7 -6.31286E-02 -2.65338E-02
+ 8 1.46743E-02 -3.26658E-03
+ 9 -1.33460E-02 3.01470E-02
+ 0 -1.11258E-02 -3.15723E-02
+ 0 0 ****** Ala-D-Pro
+ 0 0 ****** Ala-D-Ala
+ 6 0 ************ A-G
+ 1 5.14830E-03 9.48478E-02
+ 2 -8.85552E-02 1.20661E-01
+ 3 2.65903E-01 -8.99192E-02
+ 4 -6.16552E-02 -6.07952E-02
+ 5 2.19209E-02 -3.09487E-02
+ 6 -1.58136E-02 -1.74252E-02
+ 6 0 ************ A-A
+ 1 1.05084E+00 -1.83406E-03
+ 2 2.56198E-01 3.75825E-02
+ 3 2.97224E-01 -6.65886E-03
+ 4 -9.30144E-02 2.78499E-02
+ 5 2.69127E-02 -2.79813E-03
+ 6 -5.69348E-03 -5.76679E-03
+10 0 ************ A-P
+ 1 1.97348E+00 3.61809E+00
+ 2 3.25172E-01 6.93324E-01
+ 3 7.44811E-01 2.28853E-01
+ 4 -1.11515E-02 4.21766E-01
+ 5 -1.09160E-01 4.09945E-02
+ 6 1.08618E-01 6.71048E-03
+ 7 1.21785E-02 9.37813E-02
+ 8 -2.77282E-02 2.84981E-02
+ 9 2.15879E-02 1.85528E-02
+ 0 -8.56980E-03 3.92482E-02
+ 0 0 ** Pro-D-Por
+ 0 0 ** Pro-D-Ala
+10 0 ************ P-G
+ 1 2.12359E-02 4.05506E-02
+ 2 -1.19424E-01 2.91087E-01
+ 3 3.81770E-01 -1.11839E-01
+ 4 -9.75339E-02 -7.60089E-02
+ 5 -5.00214E-02 3.42037E-02
+ 6 8.12296E-02 3.98713E-02
+ 7 -1.21613E-02 -4.57682E-02
+ 8 6.95870E-03 2.28245E-02
+ 9 2.02598E-02 -2.00100E-02
+ 0 -1.48685E-02 -1.09627E-02
+10 0 ************ P-A
+ 1 1.40539E+00 -7.42879E-01
+ 2 9.21075E-02 -1.17205E-01
+ 3 4.49479E-01 3.82888E-02
+ 4 8.11975E-02 -3.35594E-02
+ 5 -9.88964E-03 -4.63759E-02
+ 6 8.58396E-02 4.22362E-02
+ 7 2.73049E-02 -5.43392E-02
+ 8 -4.18620E-03 -1.04889E-02
+ 9 1.06804E-02 -7.89066E-03
+ 0 -5.01879E-03 -1.20569E-02
+10 0 ************ P-P
+ 1 4.23219E+00 1.42318E+00
+ 2 1.24967E+00 -2.32575E-01
+ 3 5.38690E-01 -4.25507E-01
+ 4 4.01096E-01 -6.42186E-01
+ 5 2.52852E-01 -2.32257E-01
+ 6 -3.06406E-02 -2.48617E-01
+ 7 -1.68086E-02 -1.55069E-01
+ 8 -9.68421E-02 -1.80718E-01
+ 9 -2.73541E-02 -1.36915E-01
+ 0 -6.08829E-02 -6.71426E-02
--- /dev/null
+Gpp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Gpa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GpG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GpA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GpP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Gap
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Gaa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GaG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GaA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GaP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GGp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GGa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GGG_abinitio.fitout
+6 6
+-4.46036E-03
+-5.52737E-05
+-2.18852E-02
+4.33960E-03
+1.85025E-03
+4.95855E-04
+-3.24597E-18
+-2.02014E-17
+4.26966E-17
+1.49283E-17
+2.82040E-17
+1.43925E-16
+-7.18411E-03
+7.92072E-03
+-2.17806E-02
+1.67057E-03
+3.84725E-03
+-7.17231E-05
+-7.20379E-18
+-4.20384E-17
+3.03891E-17
+-2.44087E-18
+9.05009E-17
+1.14122E-19
+-7.23813E-03
+3.28293E-03
+-1.39801E-17
+-1.89800E-17
+-1.30490E-03
+1.38772E-02
+-7.10794E-18
+3.31613E-17
+1.99808E-04
+-2.17604E-03
+3.79714E-18
+5.99313E-17
+1.26587E-02
+-2.05259E-02
+1.93061E-17
+2.66731E-17
+-3.66073E-04
+3.55213E-03
+-1.11906E-17
+-3.51248E-18
+-4.59544E-03
+-9.54163E-03
+-1.52654E-17
+3.48214E-18
+4.86862E-03
+-9.46975E-05
+-1.03323E-17
+-5.01265E-17
+-5.04727E-03
+2.44410E-03
+5.33373E-17
+-1.92922E-17
+2.77079E-03
+2.66047E-02
+2.43917E-17
+-3.41779E-17
+3.19743E-03
+-5.00879E-03
+-1.09699E-17
+3.58392E-17
+4.68052E-03
+6.60091E-04
+3.91014E-17
+3.76848E-17
+-3.19326E-04
+2.01276E-04
+-2.20174E-17
+4.87189E-17
+-2.79146E-02
+-6.79853E-02
+1.69022E-17
+-5.18855E-17
+2.15742E-02
+-4.87803E-02
+2.70102E-17
+-5.03522E-18
+1.86440E-04
+-1.17222E-04
+4.25151E-18
+-1.13210E-17
+GGA_abinitio.fitout
+6 6
+-8.46686E-03
+2.62291E-03
+-3.30608E-02
+7.96177E-03
+7.15867E-03
+3.66237E-03
+-7.72008E-04
+-2.02845E-04
+1.62280E-03
+8.54876E-04
+-8.49190E-05
+-5.78018E-04
+-8.84141E-03
+1.13979E-02
+-2.03566E-02
+3.55919E-03
+-3.02160E-04
+-1.26198E-03
+3.52817E-02
+8.28932E-03
+4.25960E-03
+-6.41946E-03
+3.60893E-04
+3.94028E-04
+-1.35465E-02
+4.17716E-03
+8.28258E-02
+1.61355E-02
+8.31401E-03
+1.44081E-02
+1.30831E-02
+-1.86039E-04
+4.43630E-04
+-2.39715E-03
+-3.58254E-03
+-6.00048E-03
+9.14174E-03
+-8.39490E-03
+-6.77698E-04
+1.68410E-03
+-1.67024E-03
+-2.02726E-03
+5.39827E-04
+-8.64739E-04
+-7.91196E-03
+-1.68047E-02
+6.92503E-02
+-8.67821E-02
+3.44170E-03
+8.48263E-04
+3.84754E-03
+2.18871E-03
+-4.09461E-03
+-4.34824E-04
+9.37754E-04
+-2.35904E-03
+1.07912E-02
+3.20561E-02
+-9.95653E-04
+-1.99915E-02
+9.98327E-03
+-8.10801E-03
+-7.96601E-02
+-5.92419E-02
+-4.49290E-03
+1.00540E-03
+-1.71946E-03
+1.14316E-03
+7.92241E-05
+6.05998E-04
+3.78783E-04
+2.15709E-03
+-1.93128E-02
+-5.56518E-02
+-1.58545E-03
+8.20476E-03
+1.36469E-02
+-5.13838E-02
+2.85169E-03
+3.67851E-02
+1.00136E-03
+-2.29434E-03
+-4.83317E-03
+-3.92162E-03
+GGP_abinitio.fitout
+6 6
+6.50508E-02
+-5.89761E-03
+-8.27980E-02
+3.10265E-02
+-3.38962E-03
+6.73743E-04
+-4.16459E-04
+1.00721E-04
+-4.62636E-05
+-3.49098E-03
+-9.41654E-05
+2.71000E-04
+-2.72775E-02
+-8.83340E-04
+-4.37583E-03
+8.50974E-04
+-2.05161E-03
+-2.06744E-03
+3.15235E-02
+-2.21357E-03
+-3.64561E-03
+5.73169E-05
+2.49261E-03
+-7.51165E-03
+-5.84943E-02
+3.97047E-02
+6.60434E-02
+4.52294E-02
+3.58092E-03
+4.17625E-03
+3.31956E-02
+-2.90994E-02
+-4.75490E-04
+-3.86681E-03
+9.36791E-04
+-4.89921E-03
+1.88598E-02
+-4.42295E-03
+1.27901E-02
+2.50468E-03
+-1.10166E-03
+-6.43327E-04
+-7.04067E-03
+6.64965E-04
+1.12632E-02
+1.15798E-01
+-6.89545E-03
+1.25577E-01
+-1.23962E-02
+-6.95734E-03
+3.95449E-03
+-1.02346E-03
+-3.67717E-03
+-3.65381E-03
+-2.61415E-03
+3.03406E-03
+-3.43625E-03
+1.68217E-02
+1.47508E-02
+-1.73684E-01
+-1.75592E-02
+-2.20142E-02
+2.19531E-02
+-1.87179E-02
+-3.30625E-04
+-2.47359E-03
+-7.45116E-04
+-5.56124E-03
+2.54898E-03
+6.05867E-03
+-6.14297E-04
+1.24640E-03
+-1.17324E-02
+-1.19361E-02
+-1.28656E-02
+8.59711E-03
+-5.18731E-03
+7.58531E-03
+-5.10999E-02
+-4.52666E-02
+3.56032E-03
+3.85053E-03
+-3.65556E-03
+4.00514E-03
+GAp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GAa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GAG_abinitio.fitout
+6 6
+-6.97988E-03
+2.11326E-04
+-3.29929E-02
+2.08293E-03
+-4.84598E-04
+2.83986E-03
+9.70254E-04
+-7.61772E-04
+8.32483E-03
+-1.25922E-02
+-3.45241E-04
+-1.52497E-03
+-5.32058E-03
+5.03716E-03
+-2.67407E-02
+-2.11211E-05
+-1.71645E-03
+1.11761E-03
+-2.54093E-03
+-1.64341E-02
+-4.08188E-03
+1.68737E-03
+3.46628E-03
+1.20169E-03
+-1.55672E-03
+-3.27573E-04
+1.18295E-03
+-2.74125E-03
+6.89273E-03
+5.44083E-03
+-1.06816E-02
+8.72845E-03
+-1.39272E-03
+-7.16988E-04
+-5.68857E-04
+4.75969E-04
+-7.24911E-03
+-1.12901E-02
+-1.80540E-02
+4.99824E-05
+8.68770E-04
+-6.51696E-05
+-2.98370E-03
+2.10040E-03
+-2.04330E-04
+-7.57116E-03
+2.10429E-02
+-7.44830E-03
+-9.90521E-04
+1.59562E-03
+2.77189E-03
+-4.99094E-03
+-3.89075E-03
+-2.77476E-03
+-3.39128E-04
+-1.78779E-03
+-1.03301E-02
+3.30321E-02
+-4.51590E-02
+4.76619E-02
+-8.44719E-03
+4.88342E-03
+-1.77256E-03
+-4.07904E-03
+1.13761E-03
+2.28837E-03
+-1.92714E-03
+1.78535E-03
+-4.62403E-05
+6.19471E-04
+-1.29644E-03
+1.96271E-03
+-4.78698E-02
+-8.10150E-02
+-1.16577E-02
+2.11953E-02
+1.00520E-02
+-2.99724E-02
+-4.03191E-03
+2.14660E-03
+1.38202E-04
+-5.32398E-04
+-1.11994E-04
+-1.14554E-03
+GAA_abinitio.fitout
+6 6
+-2.48643E-02
+4.81526E-03
+-4.51777E-02
+2.76581E-02
+-3.04518E-04
+4.36235E-03
+2.17373E-02
+-2.41799E-03
+5.37657E-03
+-2.98047E-02
+-2.52519E-03
+-5.47296E-03
+-1.58140E-02
+-6.16724E-03
+-2.25130E-02
+3.11349E-03
+-3.17153E-03
+-1.31443E-03
+1.86030E-02
+-6.75956E-03
+-7.49626E-03
+-4.44882E-03
+-1.60960E-03
+9.74007E-04
+-1.32605E-02
+-1.96368E-02
+4.43606E-02
+-1.22538E-02
+1.29574E-02
+9.39390E-04
+1.40595E-02
+-4.89717E-04
+-1.80880E-03
+2.35373E-03
+4.11257E-03
+-2.89455E-03
+5.20837E-03
+-7.82527E-03
+-8.10209E-03
+2.09822E-03
+-5.59362E-04
+6.21779E-04
+1.19200E-03
+3.27965E-03
+6.34701E-02
+-9.55843E-02
+7.89666E-02
+-8.69198E-02
+3.85345E-03
+-1.60660E-03
+6.48502E-03
+-2.57321E-04
+-2.77198E-03
+-2.22505E-03
+8.32341E-04
+4.61294E-04
+4.76449E-02
+7.77390E-03
+-4.89485E-02
+9.50176E-04
+-5.87483E-03
+4.95926E-02
+-1.88864E-02
+-2.20620E-02
+3.61988E-03
+3.72923E-04
+-9.01274E-04
+2.99111E-03
+3.87878E-04
+1.49061E-03
+-7.52049E-04
+2.88234E-03
+-2.78368E-02
+-5.76616E-02
+-4.44516E-02
+3.52391E-02
+1.62484E-02
+-1.33273E-02
+-2.03980E-02
+5.05344E-03
+-3.74544E-03
+1.78525E-03
+-2.40457E-03
+-3.94525E-03
+GAP_abinitio.fitout
+6 6
+2.16431E-02
+1.01017E-02
+1.08876E-01
+7.34409E-02
+-1.09853E-02
+9.79247E-04
+4.98205E-02
+-6.29565E-03
+-1.37799E-01
+-4.10759E-02
+-2.46017E-03
+4.80559E-04
+1.58473E-03
+1.75081E-02
+-1.54409E-03
+2.42574E-03
+4.26959E-03
+-1.02854E-03
+1.03385E-02
+-1.57001E-02
+2.02765E-03
+1.87894E-04
+2.12208E-04
+3.96201E-03
+-2.27239E-02
+7.46691E-03
+4.17848E-02
+2.41565E-02
+7.74483E-03
+1.63369E-03
+3.93859E-02
+-2.02702E-02
+-2.30982E-03
+-1.11121E-03
+3.03768E-03
+-1.78059E-03
+-1.92422E-03
+1.47293E-03
+1.85671E-02
+-7.15950E-03
+1.11092E-03
+4.77112E-03
+-3.82005E-03
+6.27417E-04
+1.72187E-01
+8.48193E-02
+5.13335E-02
+2.56405E-02
+-1.86126E-02
+-5.59752E-03
+1.12581E-02
+-9.64361E-04
+6.46262E-04
+-2.31221E-03
+-2.40846E-03
+1.63797E-03
+4.54519E-02
+-5.91857E-02
+-1.00474E-02
+-1.40591E-01
+1.81836E-02
+-2.04773E-02
+6.49684E-02
+3.16978E-02
+-9.31686E-03
+7.77812E-03
+3.71733E-03
+-8.83382E-03
+1.26015E-03
+7.59054E-04
+4.31544E-04
+-8.23154E-04
+1.76513E-02
+-3.27815E-03
+-1.17345E-01
+5.62252E-02
+-1.81312E-02
+4.04796E-02
+-5.55516E-02
+-1.14203E-02
+9.65567E-04
+1.29682E-03
+-5.17527E-03
+1.59823E-03
+GPp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GPa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GPG_abinitio.fitout
+6 6
+-7.59230E-03
+-1.94552E-04
+-5.12944E-03
+3.20316E-03
+8.28212E-04
+-6.12307E-03
+-4.85436E-03
+-3.86687E-03
+5.36871E-03
+-3.81511E-03
+1.48924E-03
+-4.03381E-03
+-1.52037E-03
+5.72898E-03
+-2.07652E-02
+6.52919E-03
+-1.05532E-03
+-1.52037E-03
+-4.69660E-03
+-6.37003E-03
+6.17507E-03
+8.39488E-03
+-1.76904E-03
+8.05108E-03
+-7.98866E-04
+3.32411E-03
+5.85637E-03
+-2.98884E-03
+-1.20298E-02
+-3.13323E-02
+-1.89038E-02
+-1.18356E-02
+-3.02395E-03
+2.43800E-03
+1.38867E-03
+3.67447E-04
+-2.66576E-02
+5.35667E-02
+3.22822E-02
+-4.20099E-02
+-2.76279E-03
+2.73121E-03
+-2.92878E-03
+-3.97641E-03
+5.10833E-03
+-2.13602E-03
+1.80687E-03
+-2.80887E-03
+1.75818E-02
+4.47119E-03
+1.94978E-03
+3.01372E-02
+2.73577E-03
+2.07557E-04
+1.02968E-02
+1.06706E-02
+-1.07292E-02
+-4.42466E-03
+1.03471E-02
+3.26791E-02
+-3.88377E-03
+1.21678E-03
+-7.07759E-04
+1.76439E-03
+-9.08375E-03
+1.74263E-03
+2.04763E-03
+-1.17705E-02
+2.75141E-03
+-6.02603E-03
+-3.58871E-03
+-2.79755E-03
+2.32403E-02
+-5.25103E-02
+1.58724E-02
+-4.78943E-02
+-6.49652E-04
+-1.30365E-02
+-1.24654E-02
+-1.82200E-02
+-1.17657E-04
+-1.48990E-03
+-1.15237E-03
+-1.71433E-04
+GPA_abinitio.fitout
+6 6
+1.76833E-02
+9.87411E-04
+-1.16391E-02
+1.75059E-02
+-6.24857E-03
+-5.22125E-03
+5.86116E-03
+-2.32421E-03
+-1.58225E-02
+7.43433E-03
+4.93394E-03
+-1.89631E-02
+-3.25799E-02
+-2.32415E-02
+-3.10454E-02
+-8.91640E-03
+-7.65479E-03
+-1.27982E-03
+-9.57172E-03
+8.77571E-03
+6.27899E-03
+9.87208E-03
+1.16529E-02
+8.66130E-03
+1.92294E-02
+7.29907E-02
+5.17669E-02
+-2.27035E-02
+6.60383E-03
+2.08489E-02
+-4.78442E-03
+-1.14125E-02
+-4.55136E-03
+7.67130E-03
+1.21326E-02
+1.30754E-02
+-2.73899E-02
+6.76535E-02
+3.83851E-02
+-5.38365E-02
+5.65271E-03
+-5.37810E-04
+6.97088E-03
+7.72153E-03
+2.74100E-02
+-4.70346E-02
+-2.35609E-02
+-5.97889E-02
+3.49906E-02
+3.87800E-02
+2.36671E-02
+3.21217E-02
+3.57922E-03
+3.74125E-03
+1.26977E-02
+1.32543E-02
+-1.83147E-02
+-2.62166E-02
+-5.76715E-03
+-1.83617E-02
+-6.49200E-03
+4.85116E-02
+2.89452E-02
+1.35099E-02
+8.75516E-03
+2.02179E-02
+4.64394E-03
+7.27739E-03
+4.54111E-03
+-3.11138E-03
+2.01092E-03
+2.90504E-03
+2.15560E-02
+-7.36577E-02
+1.91254E-02
+-5.61390E-02
+8.99074E-03
+1.35028E-02
+4.72925E-04
+-3.22296E-03
+-9.02731E-03
+-1.73413E-02
+-9.12097E-03
+1.71334E-02
+GPP_abinitio.fitout
+6 6
+3.55782E-01
+-2.50590E-02
+-2.02781E-02
+1.88976E-01
+-6.17588E-02
+-2.91385E-02
+2.05426E-01
+-5.87770E-03
+-3.30234E-01
+7.61622E-02
+5.16617E-02
+-1.35195E-01
+-3.32316E-03
+4.73134E-03
+9.83600E-03
+1.38053E-02
+2.51654E-03
+6.42227E-03
+-1.41234E-02
+1.49387E-02
+-1.78714E-04
+-5.87439E-03
+1.08191E-03
+-1.97401E-04
+1.05038E-01
+2.91828E-01
+3.05333E-01
+-1.00742E-01
+-1.01012E-02
+-1.49328E-02
+3.57843E-02
+-4.10710E-02
+-2.83700E-02
+-2.30223E-03
+-2.43599E-03
+2.05701E-02
+-1.78170E-02
+-4.82013E-03
+6.73937E-03
+-3.38595E-03
+3.28851E-03
+-8.08060E-03
+-7.65673E-03
+5.09805E-03
+1.57284E-01
+-2.00083E-01
+-2.14765E-01
+-1.45042E-01
+3.67444E-02
+1.99603E-02
+2.72203E-02
+3.10215E-02
+-2.08581E-03
+-1.66514E-03
+-4.79677E-03
+-3.68899E-03
+1.95962E-02
+-5.81681E-03
+-5.65331E-02
+5.75209E-02
+6.98914E-02
+1.28428E-01
+1.38299E-01
+-6.32083E-02
+-1.13264E-02
+-1.45981E-02
+-6.42446E-03
+-1.94911E-02
+-8.84309E-03
+-2.46011E-03
+-2.28773E-03
+-5.77668E-03
+3.89634E-03
+9.03634E-03
+9.92089E-03
+-6.47315E-03
+4.81635E-02
+-5.01397E-02
+3.40332E-02
+-2.73013E-02
+-6.50338E-02
+9.57053E-04
+3.41943E-03
+5.80621E-02
+App
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Apa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ApG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ApA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ApP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Aap
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Aaa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AaG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AaA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AaP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AGp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AGa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AGG_abinitio.fitout
+6 6
+-7.39715E-03
+3.65556E-03
+-1.91078E-02
+2.38136E-03
+-5.37961E-03
+3.61998E-03
+-2.18464E-02
+-4.41896E-03
+5.08921E-03
+3.21624E-03
+5.89060E-03
+1.19802E-03
+-2.19281E-02
+1.49645E-02
+-3.56136E-02
+9.88455E-03
+1.22315E-02
+-3.00099E-03
+2.21176E-03
+3.15110E-03
+-6.61995E-03
+-3.20593E-03
+1.54183E-03
+-8.59009E-04
+-5.99348E-03
+4.65389E-05
+-5.95310E-02
+1.06111E-02
+1.57623E-02
+1.59041E-02
+1.00177E-04
+1.29357E-01
+4.43290E-03
+2.08145E-02
+-4.15715E-03
+1.26761E-03
+1.04441E-02
+-2.89679E-02
+6.04392E-02
+-1.59174E-01
+-5.14944E-02
+1.87340E-02
+3.85570E-02
+-3.73199E-02
+7.51987E-04
+-4.77918E-03
+4.26491E-03
+4.13725E-03
+9.71818E-03
+9.73285E-04
+3.70014E-02
+-2.94368E-04
+-4.04141E-03
+3.29676E-03
+4.40040E-02
+-7.37677E-03
+-2.53272E-03
+1.62907E-02
+1.14612E-03
+-1.48734E-02
+-3.33955E-03
+-2.38826E-03
+-8.32102E-03
+1.27157E-03
+4.85104E-03
+4.73026E-04
+2.63678E-02
+-1.07751E-02
+-2.39741E-03
+-1.84784E-02
+5.03233E-03
+1.06810E-02
+-2.90718E-02
+-5.45636E-02
+4.72574E-03
+3.35612E-02
+1.56482E-02
+-2.86180E-02
+7.62139E-03
+-1.87081E-02
+-1.26071E-03
+2.55160E-03
+3.08408E-03
+6.64625E-04
+AGA_abinitio.fitout
+6 6
+-2.10939E-02
+6.03383E-02
+-5.52248E-02
+1.30827E-02
+-1.40094E-02
+1.47428E-02
+-4.01256E-02
+-2.37278E-02
+-2.87652E-02
+3.68246E-02
+2.93335E-02
+4.16440E-04
+1.17436E-02
+1.16773E-01
+-5.62224E-02
+2.90645E-02
+9.23893E-03
+9.04317E-04
+8.25772E-02
+-8.68232E-03
+5.76473E-02
+-5.38481E-02
+4.24119E-03
+-2.74517E-03
+-7.20633E-01
+-1.75249E-01
+2.57130E-03
+1.87130E-02
+-3.59686E-02
+6.77989E-02
+2.08938E-02
+1.32158E-01
+-1.08429E-02
+7.44245E-02
+-1.44520E-03
+1.01815E-01
+-3.94152E-02
+-3.71396E-02
+5.52084E-02
+-1.15046E-01
+1.03393E-01
+3.15823E-02
+4.11136E-03
+2.05022E-02
+3.50590E-02
+-3.83513E-02
+2.49373E-02
+-8.93949E-02
+1.20974E-02
+-4.74375E-03
+1.72335E-02
+1.47956E-02
+-7.11183E-03
+-1.84173E-03
+2.06808E-02
+-7.58410E-03
+1.52949E-02
+-5.81264E-03
+-5.96499E-04
+-2.82883E-02
+-1.02857E-02
+2.25503E-02
+-2.57388E-02
+-2.87509E-02
+-8.97673E-03
+-8.26320E-03
+-5.34274E-03
+-1.16850E-02
+2.07672E-02
+-3.82975E-03
+-1.01681E-02
+6.05167E-03
+-5.72931E-02
+-4.97570E-02
+1.03005E-03
+4.70162E-02
+-1.06617E-03
+-2.36271E-02
+1.88343E-03
+-3.47428E-03
+1.31956E-03
+-2.15396E-02
+9.27436E-03
+-7.35804E-03
+AGP_abinitio.fitout
+6 6
+1.31640E-01
+2.58075E-01
+-8.58162E-02
+1.38005E-02
+-1.71596E-03
+5.98072E-03
+3.33712E-01
+2.93859E-02
+-3.00524E-02
+7.07210E-03
+7.75509E-03
+-8.65250E-03
+-8.74605E-02
+4.48412E-03
+-4.66310E-02
+3.06797E-02
+-2.19807E-02
+-1.58779E-02
+1.05553E-01
+6.43617E-02
+-4.08730E-02
+-2.03012E-03
+3.47495E-02
+-7.22030E-02
+-7.17920E-01
+-5.04379E-01
+-5.06488E-01
+5.31765E-01
+-1.50917E-01
+4.25707E-01
+5.91572E-02
+7.35844E-03
+-6.86600E-02
+8.34443E-03
+2.77907E-02
+2.06332E-02
+-1.13316E-01
+-6.99060E-02
+2.08245E-01
+-8.67383E-02
+-2.09219E-02
+2.28999E-02
+1.01289E-01
+-7.87242E-02
+-9.80531E-04
+1.26618E-01
+-4.27857E-02
+1.02030E-01
+-5.09267E-02
+-7.30891E-03
+-1.41543E-01
+-1.16047E-02
+6.00033E-02
+-7.06215E-02
+1.06774E-01
+4.95735E-02
+6.20532E-03
+-1.58945E-02
+1.13562E-02
+-1.70360E-01
+-2.32910E-02
+-6.32569E-03
+1.29374E-02
+-2.33028E-02
+7.41635E-02
+6.90855E-02
+3.93931E-02
+-4.32746E-02
+6.13297E-02
+3.73997E-02
+-4.94826E-03
+-3.71951E-03
+-2.28195E-03
+-6.09570E-03
+-8.25585E-03
+2.80583E-02
+5.84276E-03
+-3.18833E-02
+-3.95278E-02
+-3.23312E-02
+5.37754E-03
+3.70124E-03
+-5.30540E-05
+2.20955E-02
+AAp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AAa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AAG_abinitio.fitout
+6 6
+-1.70504E-02
+-1.25725E-02
+-2.16572E-02
+9.17676E-03
+-7.82222E-03
+4.46235E-04
+-2.89066E-02
+-3.18047E-03
+1.97174E-03
+8.13914E-05
+2.44927E-03
+-7.40994E-04
+-1.96244E-02
+4.33134E-02
+-3.37035E-02
+7.64787E-03
+-2.13924E-02
+9.52598E-03
+-3.70523E-02
+-7.40036E-02
+2.40140E-02
+-5.10030E-03
+1.59236E-02
+7.43181E-03
+-1.31910E-02
+-7.98080E-03
+-3.09633E-02
+-7.51476E-03
+1.27383E-01
+-5.50401E-02
+5.28821E-03
+1.30486E-01
+7.11103E-03
+3.19300E-03
+-6.44252E-03
+-1.02063E-02
+6.87598E-02
+-8.99360E-02
+-6.87923E-02
+-1.23161E-01
+2.60656E-03
+-1.74383E-02
+3.18957E-02
+1.71278E-02
+6.27281E-03
+-3.34598E-03
+9.42044E-03
+-7.47981E-03
+-8.29916E-03
+2.89364E-02
+8.84389E-03
+-1.37194E-03
+3.56810E-02
+9.28219E-03
+3.85979E-02
+-2.62633E-02
+-1.93497E-02
+2.38321E-02
+-2.48270E-02
+4.03903E-02
+-3.67611E-04
+-4.36283E-03
+-9.47872E-03
+3.38944E-04
+3.18600E-03
+-4.88922E-03
+5.87363E-03
+-1.14359E-03
+-1.15826E-03
+-3.43521E-03
+7.57689E-03
+3.94852E-03
+-3.77955E-02
+-5.78792E-02
+1.21638E-02
+2.92502E-02
+1.65337E-02
+-2.18462E-02
+-9.40339E-03
+5.38053E-03
+3.03565E-03
+-1.07824E-04
+4.67967E-03
+-2.39506E-03
+AAA_abinitio.fitout
+6 6
+-2.05481E-01
+-8.26191E-02
+-6.95965E-02
+2.35665E-02
+-2.42723E-02
+1.32714E-03
+-8.89860E-02
+3.10180E-02
+-1.78645E-02
+-1.17453E-02
+6.66812E-03
+2.24833E-03
+-2.12827E-01
+-8.67822E-02
+-6.42470E-02
+2.51073E-02
+-1.87957E-02
+-2.67943E-03
+2.43460E-02
+-6.09457E-02
+3.04366E-02
+1.66922E-04
+-4.91981E-04
+4.11041E-03
+-5.57253E-01
+3.53999E-02
+-3.54366E-02
+-2.08256E-01
+-1.00701E-01
+5.79432E-03
+8.35129E-02
+7.78467E-02
+-1.23620E-01
+5.25424E-02
+-7.34795E-02
+3.79700E-02
+3.56303E-02
+-1.04002E-01
+1.77074E-02
+-6.40671E-02
+1.61121E-02
+5.81681E-02
+2.14007E-02
+6.03380E-02
+3.14908E-02
+-8.44041E-02
+-1.35241E-02
+-5.63823E-02
+-1.98125E-02
+-1.07643E-02
+3.85091E-02
+2.61695E-03
+2.67479E-02
+2.91781E-02
+3.32585E-02
+3.74364E-03
+3.95839E-02
+3.44728E-02
+-3.61017E-02
+2.51821E-02
+-1.16023E-02
+9.06885E-03
+-3.49017E-02
+-2.81423E-02
+-7.23186E-03
+-2.86460E-02
+1.58622E-02
+-1.63989E-03
+-1.90603E-02
+-6.01905E-03
+1.24698E-02
+2.47730E-03
+-3.53859E-02
+-1.77117E-02
+-2.28246E-02
+4.82700E-02
+1.54564E-02
+-5.67317E-03
+-7.01419E-03
+4.19916E-03
+7.22849E-03
+-3.30823E-02
+-8.92923E-03
+-1.67293E-02
+AAP_abinitio.fitout
+6 6
+-2.60341E-01
+-1.76464E-01
+-2.58402E-02
+5.08365E-02
+9.37785E-03
+1.34683E-02
+9.21716E-02
+4.11687E-02
+-8.52362E-02
+-1.16991E-02
+-2.83520E-02
+-2.85315E-02
+-1.15678E-01
+1.39526E-01
+1.43150E-03
+-1.24315E-02
+3.67833E-02
+-1.29502E-02
+-1.49832E-01
+-1.70965E-01
+-5.62158E-03
+-2.47031E-02
+-2.08181E-02
+1.00187E-02
+-5.09741E-01
+-3.04707E-01
+-1.77654E-01
+6.17878E-02
+-3.70183E-01
+3.16793E-01
+2.12524E-02
+2.52440E-02
+-6.09105E-02
+-8.32189E-02
+-3.45513E-02
+9.52014E-03
+-1.82716E-01
+1.57791E-02
+5.23627E-02
+-4.44659E-03
+-6.04463E-02
+7.35341E-02
+6.70677E-02
+-5.01091E-02
+1.58910E-01
+7.43892E-02
+-4.84020E-03
+2.64253E-02
+-1.74718E-01
+2.79791E-02
+-1.48718E-01
+-1.55775E-02
+2.66950E-02
+-1.89974E-02
+9.19990E-02
+-1.34598E-02
+2.58915E-02
+-8.32852E-02
+-1.21375E-02
+-1.35189E-01
+-2.34513E-03
+2.60660E-02
+2.74800E-02
+2.42119E-02
+-1.05766E-02
+1.07458E-01
+-9.49010E-02
+4.41061E-02
+2.37077E-04
+1.65542E-02
+5.17467E-03
+-2.63125E-02
+4.40376E-03
+-5.38761E-03
+-9.77473E-02
+6.71620E-02
+2.48552E-03
+-2.73268E-03
+-6.93468E-02
+-2.85697E-02
+-4.28702E-04
+1.93884E-02
+3.32264E-03
+6.53017E-03
+APp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+APa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+APG_abinitio.fitout
+6 6
+2.11374E-02
+2.96387E-02
+7.90197E-03
+2.06850E-02
+2.34088E-02
+6.25406E-03
+-6.08740E-03
+-1.55375E-03
+-5.36785E-03
+-3.11711E-02
+-9.42745E-03
+-9.88549E-03
+-2.33313E-03
+1.05580E-02
+-6.05641E-02
+2.53598E-02
+-3.71104E-03
+-5.01697E-03
+-2.89535E-02
+-2.77652E-02
+3.61965E-02
+2.00866E-02
+-3.16730E-03
+1.42707E-02
+-2.45496E-03
+-6.39974E-03
+-5.31496E-03
+1.49525E-02
+-5.33448E-02
+-6.12883E-02
+1.64008E-02
+5.17439E-02
+-1.32435E-02
+8.86931E-04
+-1.93406E-02
+1.29406E-02
+3.93005E-02
+-4.91735E-02
+8.90276E-02
+-1.29607E-01
+-4.02511E-02
+2.03071E-03
+-3.23640E-03
+1.57962E-02
+2.20466E-03
+4.80277E-03
+-7.51544E-03
+1.37773E-02
+2.79080E-02
+6.38630E-02
+-3.29278E-02
+6.21700E-03
+2.75330E-02
+-6.78977E-02
+7.03002E-02
+-2.20345E-02
+-1.90882E-02
+1.59821E-03
+1.08734E-02
+6.23326E-02
+-1.95481E-02
+6.49369E-03
+1.63273E-03
+1.99442E-02
+1.58751E-03
+-2.23369E-02
+2.25455E-02
+-1.50345E-02
+2.31505E-02
+2.36684E-02
+-2.15136E-02
+-2.13738E-02
+4.16797E-02
+-1.06406E-01
+4.31283E-02
+-5.98608E-02
+-2.21497E-02
+-4.07299E-02
+-4.56594E-04
+-1.37761E-03
+-1.48161E-02
+3.23533E-03
+-1.19902E-02
+1.20310E-02
+APA_abinitio.fitout
+6 6
+8.58406E-02
+7.11000E-02
+-2.46047E-03
+6.50547E-02
+6.13304E-02
+4.29823E-03
+-6.05849E-02
+-2.44367E-03
+-3.77551E-02
+-7.23133E-02
+-3.86123E-03
+-1.07154E-02
+-1.03709E-01
+-7.05574E-02
+-9.49350E-02
+-1.53363E-02
+-1.18499E-02
+-7.61708E-03
+-2.91869E-02
+4.65680E-02
+3.62772E-02
+3.39042E-02
+3.16662E-02
+1.47463E-02
+1.52687E-01
+3.95754E-02
+-1.32083E-02
+-1.89615E-01
+-1.83152E-02
+-3.72732E-03
+-1.41424E-02
+-4.35396E-02
+3.71739E-02
+2.14553E-02
+6.33433E-02
+1.58020E-02
+4.23314E-02
+-7.04643E-02
+1.00041E-01
+-1.66457E-01
+1.68853E-02
+-4.71492E-02
+4.53786E-02
+1.36936E-02
+1.65425E-02
+-1.09111E-01
+-4.96983E-02
+-7.14614E-02
+7.25503E-02
+1.07859E-01
+-6.38044E-02
+-5.08115E-02
+2.52785E-02
+-7.96546E-02
+8.77169E-02
+-1.86505E-02
+-4.12172E-02
+-4.92979E-02
+2.69538E-02
+-2.66457E-02
+6.73594E-02
+8.20067E-02
+1.23491E-02
+-7.82045E-02
+5.59781E-03
+1.69580E-02
+-3.36624E-03
+-2.40832E-02
+5.55433E-02
+1.45973E-02
+-1.31928E-02
+-1.57636E-02
+3.78321E-02
+-1.46667E-01
+5.68449E-02
+-5.81680E-02
+1.44393E-02
+9.01460E-03
+-2.10025E-02
+-1.45872E-02
+4.07156E-03
+3.95902E-02
+4.00640E-02
+4.22339E-02
+APP_abinitio.fitout
+6 6
+7.67218E-01
+2.33457E-01
+-1.46363E-01
+2.05224E-01
+1.06638E-01
+-6.77313E-02
+-6.30041E-01
+-3.81159E-01
+-5.15514E-01
+-2.88904E-01
+-2.90076E-02
+-2.70035E-02
+3.70005E-03
+1.95656E-02
+1.25674E-02
+3.59916E-02
+1.37024E-02
+1.01801E-02
+-3.80359E-02
+5.47337E-02
+1.01848E-02
+-2.57535E-02
+2.66764E-03
+-4.98453E-04
+7.52962E-01
+2.85588E-02
+-2.30346E-03
+-7.23259E-01
+8.10079E-02
+-1.05684E-01
+3.68628E-02
+-1.91424E-03
+2.12266E-01
+-6.32729E-02
+-1.02146E-01
+-2.18836E-01
+-6.31142E-03
+-2.91560E-02
+5.34587E-02
+-7.50095E-03
+7.50583E-02
+-8.13426E-02
+-2.32451E-02
+1.11562E-02
+1.13419E-01
+-3.85175E-01
+-4.29197E-01
+-1.16652E-01
+7.97811E-02
+9.57693E-02
+-8.52841E-02
+-2.21538E-02
+-2.39487E-03
+-8.70199E-03
+1.31160E-02
+-1.57490E-02
+4.10501E-03
+1.15439E-02
+-1.21521E-01
+1.06008E-01
+2.17808E-01
+-4.09860E-02
+-4.67063E-02
+-2.20038E-01
+-1.73742E-02
+-5.15139E-02
+1.45133E-02
+1.43836E-02
+1.12055E-02
+4.37722E-02
+-6.08277E-02
+-2.48175E-02
+1.34523E-02
+-5.61869E-03
+2.54898E-02
+-1.15690E-02
+8.28139E-02
+-9.28803E-02
+-7.82454E-02
+8.53303E-02
+-8.14192E-03
+4.37089E-02
+4.66433E-02
+-7.54954E-03
+Ppp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Ppa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PpG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PpA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PpP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Pap
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Paa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PaG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PaA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PaP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PGp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PGa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PGG_abinitio.fitout
+6 6
+-1.17152E-02
+8.08314E-04
+-1.84929E-02
+7.36520E-03
+6.78035E-04
+1.47704E-03
+-1.70250E-02
+-1.55551E-03
+2.76943E-03
+1.08343E-02
+4.12013E-03
+-3.24136E-03
+-3.01008E-02
+2.32977E-02
+-5.15750E-02
+2.27035E-02
+6.65240E-03
+-2.18380E-03
+5.05778E-04
+1.64632E-03
+-3.06580E-03
+-1.65941E-03
+1.19256E-03
+1.70662E-04
+-3.20902E-02
+1.66855E-03
+-5.58858E-02
+3.53936E-03
+3.31006E-02
+7.91879E-02
+4.61083E-02
+1.38623E-01
+3.86473E-03
+1.37982E-02
+-9.42935E-03
+-2.21267E-02
+3.39327E-02
+-1.03076E-01
+5.55447E-02
+-1.74210E-01
+-5.80200E-02
+4.68277E-02
+1.06477E-01
+-8.69627E-02
+6.78160E-03
+-3.06871E-03
+-7.58285E-04
+-2.00872E-04
+2.83759E-02
+-1.86440E-04
+4.72643E-02
+-3.65989E-03
+-3.13701E-02
+9.28177E-03
+7.65182E-02
+-1.78706E-02
+-8.74290E-03
+7.16994E-03
+3.33572E-03
+-3.65890E-03
+-7.11420E-03
+2.06385E-03
+-8.99078E-03
+2.57823E-03
+1.33229E-02
+-6.60596E-03
+2.05639E-02
+-1.16590E-02
+-7.63912E-03
+-1.97280E-02
+1.62325E-02
+3.47846E-02
+-4.83151E-02
+-6.75034E-02
+3.99377E-03
+9.70541E-03
+5.68454E-03
+-7.85137E-03
+3.89044E-03
+2.39758E-03
+-2.02212E-03
+4.78289E-03
+6.07226E-03
+-9.28848E-03
+PGA_abinitio.fitout
+6 6
+-4.21674E-02
+-1.10869E-02
+-1.91467E-01
+3.91775E-02
+1.94958E-02
+-3.54878E-02
+-3.77851E-02
+1.27993E-02
+6.84937E-03
+5.87173E-02
+-2.19318E-02
+-1.22346E-02
+3.61826E-02
+1.58457E-01
+-8.77671E-02
+5.07088E-02
+1.99345E-02
+-5.69296E-03
+1.80979E-01
+-1.48099E-02
+4.34955E-02
+-1.06913E-01
+-4.23758E-03
+-1.12771E-02
+-9.14668E-01
+-1.27576E-01
+4.31803E-01
+8.48152E-02
+-9.29375E-02
+8.11535E-02
+7.75147E-02
+-1.54831E-02
+1.80980E-02
+3.56840E-01
+1.06163E-03
+1.84371E-01
+-3.63221E-02
+-1.54518E-01
+8.01580E-02
+-1.37715E-01
+3.75783E-02
+6.25028E-02
+-9.71596E-02
+-7.76123E-02
+-7.34366E-03
+-2.53251E-02
+-8.84402E-02
+-1.33588E-01
+2.93982E-02
+-2.04265E-02
+3.61310E-02
+2.56799E-02
+-7.53693E-02
+3.97849E-03
+9.38605E-03
+-1.03295E-02
+1.08952E-02
+-1.28963E-02
+-9.99238E-03
+-1.83259E-02
+-5.49337E-02
+-3.29320E-02
+1.76373E-02
+1.68899E-02
+-1.38793E-02
+-6.36390E-03
+1.10934E-02
+-2.37010E-02
+7.99957E-03
+-8.11723E-03
+-1.10377E-02
+1.49324E-02
+-5.20932E-02
+-5.07061E-02
+9.24310E-03
+3.59607E-02
+8.39780E-03
+2.03269E-02
+3.52271E-02
+2.07302E-02
+2.99236E-02
+1.25733E-02
+2.46004E-02
+2.57522E-02
+PGP_abinitio.fitout
+6 6
+2.03597E-01
+8.31483E-02
+-1.71381E-01
+8.54226E-02
+4.25626E-02
+-5.85819E-02
+2.22794E-01
+-2.02475E-01
+3.25632E-02
+7.33475E-02
+-7.06541E-02
+4.51681E-03
+-1.67080E-01
+2.09618E-02
+-3.46297E-02
+8.43392E-02
+-5.34880E-02
+-6.10693E-02
+2.21688E-01
+2.10843E-01
+-3.28216E-02
+-2.72329E-02
+9.86024E-02
+-1.76610E-01
+-1.60565E+00
+-4.44138E-01
+-2.78194E-01
+1.38773E+00
+-3.28544E-01
+5.61299E-01
+2.68172E-01
+-2.49111E-01
+-3.04849E-02
+3.24789E-01
+-7.02413E-02
+-5.66952E-02
+-1.99543E-02
+-1.54812E-01
+3.44999E-01
+-8.80924E-02
+2.92163E-01
+-1.06140E-01
+1.13480E-01
+-6.77349E-02
+-1.00651E-02
+7.06482E-04
+-1.16447E-02
+-9.76706E-03
+-1.99690E-01
+-4.61642E-05
+-1.88271E-01
+2.39097E-02
+8.30479E-02
+-3.04097E-03
+-5.22889E-02
+-3.72105E-02
+1.89411E-02
+5.14450E-03
+1.73122E-04
+2.81198E-02
+-5.64760E-02
+-2.87088E-02
+1.98950E-02
+-1.16766E-02
+1.01974E-01
+6.66616E-02
+-1.87044E-03
+-1.15424E-01
+4.27475E-02
+1.81373E-02
+-1.20504E-01
+-1.84873E-02
+-1.08167E-01
+1.51483E-02
+-3.84445E-02
+-1.61519E-02
+8.86730E-03
+1.79342E-02
+-6.56259E-02
+-7.10179E-03
+2.27041E-02
+-1.46227E-02
+4.06429E-02
+6.08438E-03
+PAp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PAa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PAG_abinitio.fitout
+6 6
+-1.86727E-02
+-4.32929E-03
+-2.85958E-02
+1.50859E-03
+-3.07202E-03
+-1.39642E-03
+-3.69846E-02
+1.04882E-03
+-8.93575E-03
+6.91102E-03
+8.76224E-03
+-9.37333E-03
+-2.83489E-02
+9.17861E-02
+-4.06504E-02
+3.05162E-03
+-2.76511E-02
+1.12820E-02
+-6.41226E-02
+-1.64995E-01
+1.11209E-01
+2.21353E-03
+2.39645E-02
+2.01533E-02
+-2.47345E-02
+-2.50684E-03
+-3.41213E-02
+-7.94485E-03
+1.05852E-01
+8.78292E-02
+-5.17054E-02
+1.69855E-01
+1.04445E-02
+9.78832E-04
+-2.29385E-02
+-1.47634E-02
+1.18421E-01
+-1.88867E-01
+-6.21589E-02
+-1.26185E-01
+-5.33812E-02
+5.50859E-02
+7.14998E-02
+-8.04550E-02
+-2.26018E-03
+4.68748E-03
+-2.27517E-03
+-1.43078E-02
+-1.17454E-03
+1.23677E-02
+3.28704E-02
+-1.18357E-03
+6.66522E-02
+1.62106E-02
+4.96241E-02
+2.33720E-02
+-3.02511E-02
+9.67404E-03
+2.23762E-02
+-7.04732E-03
+-4.78693E-03
+-4.81439E-03
+-1.62583E-02
+-5.39745E-03
+1.03614E-02
+-1.48080E-03
+2.00905E-03
+-1.32309E-03
+2.19363E-02
+-1.24035E-02
+2.52544E-02
+5.18711E-02
+-2.76865E-02
+-5.74752E-02
+2.65025E-02
+3.94510E-02
+2.18987E-02
+-2.19298E-02
+7.84386E-04
+1.00090E-02
+-1.75104E-05
+-7.15526E-04
+4.07597E-05
+-8.03326E-03
+PAA_abinitio.fitout
+6 6
+-1.48004E-01
+3.55924E-02
+-1.63137E-01
+-8.28753E-02
+-1.06713E-02
+-6.45243E-03
+-3.21653E-02
+6.01919E-02
+-5.05636E-02
+5.67676E-02
+7.86295E-02
+-2.22937E-02
+-5.37140E-01
+-1.70759E-01
+-9.59335E-02
+6.43856E-02
+-8.81145E-03
+-1.00916E-02
+-4.40811E-02
+-3.73393E-02
+1.03283E-01
+-3.42948E-03
+-2.17269E-03
+9.17541E-03
+-9.27782E-01
+-1.11939E-02
+3.02174E-01
+-1.36657E-02
+-7.86916E-02
+6.96968E-03
+1.56723E-01
+2.32634E-02
+-1.70987E-01
+3.76170E-01
+9.99686E-02
+2.18486E-01
+1.06825E-01
+-2.06877E-01
+-2.97818E-03
+-4.52041E-02
+3.13196E-02
+7.85678E-02
+-1.01412E-02
+-3.73421E-02
+1.72860E-02
+1.22020E-01
+2.19112E-02
+-1.30464E-01
+-1.06877E-02
+-3.86686E-02
+3.99139E-02
+5.35222E-04
+1.14431E-02
+6.04451E-02
+3.05464E-02
+1.50339E-02
+6.80800E-02
+3.31187E-03
+-6.31445E-02
+-1.72000E-02
+-7.22567E-02
+2.69832E-02
+-2.09692E-02
+-6.82591E-02
+-1.64572E-02
+-1.33289E-02
+1.19150E-02
+-1.13424E-02
+-1.07905E-02
+-1.69497E-02
+4.81347E-02
+3.76561E-02
+-5.18859E-02
+-3.22088E-02
+-1.06826E-02
+3.06852E-02
+3.58685E-04
+1.38110E-02
+-8.67692E-03
+2.35927E-02
+-1.07325E-02
+-3.63660E-03
+1.88840E-02
+2.41626E-02
+PAP_abinitio.fitout
+6 6
+-6.62363E-01
+7.32861E-02
+1.94710E-01
+9.73458E-02
+-6.28769E-03
+-4.85752E-02
+3.97715E-01
+5.49366E-01
+2.30814E-02
+-8.22262E-02
+-8.64146E-02
+-2.43265E-02
+-4.11363E-01
+3.39575E-01
+1.05049E-02
+-6.65599E-02
+1.35397E-01
+-4.58790E-02
+-5.10344E-01
+-4.70674E-01
+1.31064E-02
+-1.19879E-01
+-1.29575E-02
+1.81257E-02
+-1.09088E+00
+-4.71902E-01
+2.36092E-02
+5.38778E-01
+-6.85489E-01
+4.92470E-01
+4.01670E-01
+-2.32399E-01
+-7.00634E-02
+2.83989E-01
+-1.32175E-01
+1.66960E-02
+-2.21384E-01
+-5.96587E-02
+2.72734E-01
+-4.13095E-02
+2.44356E-01
+6.36661E-02
+1.48425E-01
+-6.93542E-02
+-3.99401E-02
+5.24989E-02
+7.15320E-02
+-1.61202E-01
+-3.72458E-01
+1.25361E-02
+-4.14212E-02
+2.01276E-02
+1.48321E-01
+4.87296E-02
+3.08984E-02
+-7.43849E-02
+2.22397E-02
+-6.30931E-02
+-2.58342E-02
+-1.17253E-01
+1.16469E-03
+-4.30153E-02
+1.00187E-01
+-3.68603E-02
+-2.84632E-02
+1.25879E-01
+-7.91799E-02
+-5.81097E-02
+1.66423E-02
+6.62823E-02
+-2.10941E-02
+-4.56423E-02
+-4.47566E-02
+-2.91895E-02
+-9.58987E-02
+5.13975E-03
+-2.11538E-02
+-6.48730E-03
+-5.39683E-02
+1.34026E-02
+5.00738E-02
+4.52056E-04
+3.10756E-02
+1.90776E-02
+PPp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PPa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PPG_abinitio.fitout
+6 6
+5.16416E-02
+8.62095E-02
+-4.51303E-02
+-1.00017E-02
+5.57916E-02
+-2.82344E-03
+1.31516E-02
+-4.56497E-02
+-2.65691E-02
+-5.08100E-02
+5.49723E-03
+-2.54623E-02
+-1.16607E-02
+8.71292E-03
+-1.04028E-01
+4.88786E-02
+4.79630E-03
+-2.09226E-02
+-6.61022E-02
+-5.72385E-02
+8.20553E-02
+2.70668E-02
+-5.44738E-03
+1.03208E-02
+-1.03496E-02
+-2.79784E-04
+-4.19006E-02
+4.74221E-02
+-5.69082E-02
+-4.47927E-02
+8.07646E-03
+1.26023E-01
+-2.52358E-02
+1.21320E-02
+-3.71100E-02
+4.15186E-02
+5.02204E-02
+-1.58502E-01
+1.32449E-01
+-1.77700E-01
+-3.00666E-02
+-1.30149E-02
+1.33461E-02
+9.21573E-02
+-2.56421E-02
+2.27861E-02
+-1.73030E-02
+3.10550E-02
+3.71478E-02
+9.60699E-02
+-4.83687E-02
+-2.61395E-02
+4.01929E-02
+-1.28377E-01
+9.48191E-02
+-8.40461E-02
+-8.84160E-03
+-1.60301E-02
+1.77380E-02
+8.24025E-02
+-2.67488E-02
+2.84035E-02
+2.91455E-03
+1.70812E-02
+1.54656E-02
+-2.40176E-02
+2.76831E-02
+-5.27066E-03
+2.65944E-02
+4.76662E-02
+-4.29954E-02
+-4.04722E-02
+3.02425E-02
+-8.97502E-02
+5.58394E-02
+-5.79944E-02
+-1.14607E-02
+-5.29796E-02
+2.89066E-02
+7.05200E-02
+-3.06923E-02
+1.81037E-02
+-7.19964E-03
+1.24096E-02
+PPA_abinitio.fitout
+6 6
+1.32899E-01
+1.38710E-01
+-3.14724E-02
+1.18637E-03
+7.58328E-02
+-1.42436E-02
+-6.58168E-02
+-8.66061E-02
+-6.79304E-02
+-1.19298E-01
+-1.61300E-02
+-4.37837E-02
+-1.78927E-01
+-1.06051E-01
+-1.70089E-01
+-8.92743E-03
+-1.36536E-02
+-3.11752E-02
+-6.57058E-02
+8.25739E-02
+8.75466E-02
+4.94767E-02
+3.98260E-02
+7.59713E-03
+7.87024E-02
+-1.31469E-01
+-1.19822E-01
+-1.88926E-01
+-5.37974E-02
+-5.92828E-02
+3.66331E-02
+-7.89996E-02
+3.94025E-02
+-1.22489E-01
+-1.04510E-01
+-8.92355E-02
+3.76168E-02
+-2.21729E-01
+1.45467E-01
+-2.07780E-01
+-2.21517E-02
+-6.26420E-02
+5.66877E-02
+-8.08278E-03
+2.41190E-02
+-1.27733E-01
+-1.22023E-01
+-1.08070E-01
+6.95849E-02
+1.10424E-01
+-8.50267E-02
+-1.19373E-01
+3.44974E-02
+-1.88762E-01
+1.16889E-01
+-8.09305E-02
+-2.55243E-02
+-4.70948E-02
+3.42463E-02
+-6.88564E-03
+8.19412E-02
+-5.04839E-02
+-1.18235E-01
+-1.96336E-01
+1.05609E-02
+1.98306E-02
+-3.37354E-03
+-3.73736E-02
+4.17335E-02
+4.33113E-02
+-5.87118E-02
+-6.90520E-02
+2.89217E-02
+-1.39956E-01
+8.07782E-02
+-5.61360E-02
+-1.10854E-02
+-2.35454E-02
+-2.55672E-02
+-1.54173E-02
+5.08292E-02
+2.02335E-03
+-6.94101E-02
+-7.15398E-02
+PPP_abinitio.fitout
+6 6
+9.55141E-01
+2.82825E-01
+-1.25053E-01
+-7.72476E-02
+-1.53768E-02
+-1.23068E-01
+-1.07860E+00
+-8.60254E-01
+-5.96195E-01
+-5.73846E-01
+-1.56914E-01
+-2.25099E-01
+3.39553E-02
+5.27174E-02
+-4.70984E-04
+6.95022E-02
+3.54170E-02
+-6.13267E-04
+-7.18476E-02
+1.27301E-01
+3.65459E-02
+-6.67390E-02
+-1.04061E-02
+-1.72909E-02
+9.06180E-01
+-3.16174E-01
+-4.36987E-01
+-8.48768E-01
+1.45459E-01
+-1.03920E-01
+6.02209E-02
+-2.74110E-02
+3.85731E-01
+-4.98738E-01
+-6.17808E-01
+-3.88753E-01
+1.82417E-02
+-5.85814E-02
+8.79629E-02
+-1.17158E-02
+9.11518E-02
+-5.60357E-02
+-8.69024E-02
+7.33401E-02
+1.80120E-01
+-4.92279E-01
+-5.69457E-01
+-2.06515E-01
+7.60602E-02
+1.37305E-01
+-1.78078E-01
+-3.68494E-02
+3.13809E-02
+-4.97757E-02
+6.29741E-02
+-1.27850E-02
+3.55620E-03
+6.26058E-03
+-1.59718E-01
+1.40642E-01
+2.54613E-01
+-4.16776E-01
+-4.60517E-01
+-2.65052E-01
+4.02722E-03
+-3.47336E-02
+1.38117E-02
+4.25497E-02
+-4.07847E-03
+8.37183E-02
+-1.45515E-01
+-4.97774E-02
+2.16109E-02
+-4.19394E-02
+5.29746E-02
+-7.24450E-03
+1.28857E-03
+5.46137E-03
+-2.15724E-01
+2.27414E-01
+9.50069E-02
+-1.60267E-01
+-1.77017E-01
+-1.06693E-01
+Gpp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Gpa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GpG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GpA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GpP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Gap
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Gaa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GaG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GaA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GaP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GGp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GGa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GGG_abinitio.fitout
+6 6
+-4.46036E-03
+-5.52737E-05
+-2.18852E-02
+4.33960E-03
+1.85025E-03
+4.95855E-04
+-3.24597E-18
+-2.02014E-17
+4.26966E-17
+1.49283E-17
+2.82040E-17
+1.43925E-16
+-7.18411E-03
+7.92072E-03
+-2.17806E-02
+1.67057E-03
+3.84725E-03
+-7.17231E-05
+-7.20379E-18
+-4.20384E-17
+3.03891E-17
+-2.44087E-18
+9.05009E-17
+1.14122E-19
+-7.23813E-03
+3.28293E-03
+-1.39801E-17
+-1.89800E-17
+-1.30490E-03
+1.38772E-02
+-7.10794E-18
+3.31613E-17
+1.99808E-04
+-2.17604E-03
+3.79714E-18
+5.99313E-17
+1.26587E-02
+-2.05259E-02
+1.93061E-17
+2.66731E-17
+-3.66073E-04
+3.55213E-03
+-1.11906E-17
+-3.51248E-18
+-4.59544E-03
+-9.54163E-03
+-1.52654E-17
+3.48214E-18
+4.86862E-03
+-9.46975E-05
+-1.03323E-17
+-5.01265E-17
+-5.04727E-03
+2.44410E-03
+5.33373E-17
+-1.92922E-17
+2.77079E-03
+2.66047E-02
+2.43917E-17
+-3.41779E-17
+3.19743E-03
+-5.00879E-03
+-1.09699E-17
+3.58392E-17
+4.68052E-03
+6.60091E-04
+3.91014E-17
+3.76848E-17
+-3.19326E-04
+2.01276E-04
+-2.20174E-17
+4.87189E-17
+-2.79146E-02
+-6.79853E-02
+1.69022E-17
+-5.18855E-17
+2.15742E-02
+-4.87803E-02
+2.70102E-17
+-5.03522E-18
+1.86440E-04
+-1.17222E-04
+4.25151E-18
+-1.13210E-17
+GGA_abinitio.fitout
+6 6
+-8.46686E-03
+2.62291E-03
+-3.30608E-02
+7.96177E-03
+7.15867E-03
+3.66237E-03
+-7.72008E-04
+-2.02845E-04
+1.62280E-03
+8.54876E-04
+-8.49190E-05
+-5.78018E-04
+-8.84141E-03
+1.13979E-02
+-2.03566E-02
+3.55919E-03
+-3.02160E-04
+-1.26198E-03
+3.52817E-02
+8.28932E-03
+4.25960E-03
+-6.41946E-03
+3.60893E-04
+3.94028E-04
+-1.35465E-02
+4.17716E-03
+8.28258E-02
+1.61355E-02
+8.31401E-03
+1.44081E-02
+1.30831E-02
+-1.86039E-04
+4.43630E-04
+-2.39715E-03
+-3.58254E-03
+-6.00048E-03
+9.14174E-03
+-8.39490E-03
+-6.77698E-04
+1.68410E-03
+-1.67024E-03
+-2.02726E-03
+5.39827E-04
+-8.64739E-04
+-7.91196E-03
+-1.68047E-02
+6.92503E-02
+-8.67821E-02
+3.44170E-03
+8.48263E-04
+3.84754E-03
+2.18871E-03
+-4.09461E-03
+-4.34824E-04
+9.37754E-04
+-2.35904E-03
+1.07912E-02
+3.20561E-02
+-9.95653E-04
+-1.99915E-02
+9.98327E-03
+-8.10801E-03
+-7.96601E-02
+-5.92419E-02
+-4.49290E-03
+1.00540E-03
+-1.71946E-03
+1.14316E-03
+7.92241E-05
+6.05998E-04
+3.78783E-04
+2.15709E-03
+-1.93128E-02
+-5.56518E-02
+-1.58545E-03
+8.20476E-03
+1.36469E-02
+-5.13838E-02
+2.85169E-03
+3.67851E-02
+1.00136E-03
+-2.29434E-03
+-4.83317E-03
+-3.92162E-03
+GGP_abinitio.fitout
+6 6
+6.50508E-02
+-5.89761E-03
+-8.27980E-02
+3.10265E-02
+-3.38962E-03
+6.73743E-04
+-4.16459E-04
+1.00721E-04
+-4.62636E-05
+-3.49098E-03
+-9.41654E-05
+2.71000E-04
+-2.72775E-02
+-8.83340E-04
+-4.37583E-03
+8.50974E-04
+-2.05161E-03
+-2.06744E-03
+3.15235E-02
+-2.21357E-03
+-3.64561E-03
+5.73169E-05
+2.49261E-03
+-7.51165E-03
+-5.84943E-02
+3.97047E-02
+6.60434E-02
+4.52294E-02
+3.58092E-03
+4.17625E-03
+3.31956E-02
+-2.90994E-02
+-4.75490E-04
+-3.86681E-03
+9.36791E-04
+-4.89921E-03
+1.88598E-02
+-4.42295E-03
+1.27901E-02
+2.50468E-03
+-1.10166E-03
+-6.43327E-04
+-7.04067E-03
+6.64965E-04
+1.12632E-02
+1.15798E-01
+-6.89545E-03
+1.25577E-01
+-1.23962E-02
+-6.95734E-03
+3.95449E-03
+-1.02346E-03
+-3.67717E-03
+-3.65381E-03
+-2.61415E-03
+3.03406E-03
+-3.43625E-03
+1.68217E-02
+1.47508E-02
+-1.73684E-01
+-1.75592E-02
+-2.20142E-02
+2.19531E-02
+-1.87179E-02
+-3.30625E-04
+-2.47359E-03
+-7.45116E-04
+-5.56124E-03
+2.54898E-03
+6.05867E-03
+-6.14297E-04
+1.24640E-03
+-1.17324E-02
+-1.19361E-02
+-1.28656E-02
+8.59711E-03
+-5.18731E-03
+7.58531E-03
+-5.10999E-02
+-4.52666E-02
+3.56032E-03
+3.85053E-03
+-3.65556E-03
+4.00514E-03
+GAp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GAa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GAG_abinitio.fitout
+6 6
+-6.97988E-03
+2.11326E-04
+-3.29929E-02
+2.08293E-03
+-4.84598E-04
+2.83986E-03
+9.70254E-04
+-7.61772E-04
+8.32483E-03
+-1.25922E-02
+-3.45241E-04
+-1.52497E-03
+-5.32058E-03
+5.03716E-03
+-2.67407E-02
+-2.11211E-05
+-1.71645E-03
+1.11761E-03
+-2.54093E-03
+-1.64341E-02
+-4.08188E-03
+1.68737E-03
+3.46628E-03
+1.20169E-03
+-1.55672E-03
+-3.27573E-04
+1.18295E-03
+-2.74125E-03
+6.89273E-03
+5.44083E-03
+-1.06816E-02
+8.72845E-03
+-1.39272E-03
+-7.16988E-04
+-5.68857E-04
+4.75969E-04
+-7.24911E-03
+-1.12901E-02
+-1.80540E-02
+4.99824E-05
+8.68770E-04
+-6.51696E-05
+-2.98370E-03
+2.10040E-03
+-2.04330E-04
+-7.57116E-03
+2.10429E-02
+-7.44830E-03
+-9.90521E-04
+1.59562E-03
+2.77189E-03
+-4.99094E-03
+-3.89075E-03
+-2.77476E-03
+-3.39128E-04
+-1.78779E-03
+-1.03301E-02
+3.30321E-02
+-4.51590E-02
+4.76619E-02
+-8.44719E-03
+4.88342E-03
+-1.77256E-03
+-4.07904E-03
+1.13761E-03
+2.28837E-03
+-1.92714E-03
+1.78535E-03
+-4.62403E-05
+6.19471E-04
+-1.29644E-03
+1.96271E-03
+-4.78698E-02
+-8.10150E-02
+-1.16577E-02
+2.11953E-02
+1.00520E-02
+-2.99724E-02
+-4.03191E-03
+2.14660E-03
+1.38202E-04
+-5.32398E-04
+-1.11994E-04
+-1.14554E-03
+GAA_abinitio.fitout
+6 6
+-2.48643E-02
+4.81526E-03
+-4.51777E-02
+2.76581E-02
+-3.04518E-04
+4.36235E-03
+2.17373E-02
+-2.41799E-03
+5.37657E-03
+-2.98047E-02
+-2.52519E-03
+-5.47296E-03
+-1.58140E-02
+-6.16724E-03
+-2.25130E-02
+3.11349E-03
+-3.17153E-03
+-1.31443E-03
+1.86030E-02
+-6.75956E-03
+-7.49626E-03
+-4.44882E-03
+-1.60960E-03
+9.74007E-04
+-1.32605E-02
+-1.96368E-02
+4.43606E-02
+-1.22538E-02
+1.29574E-02
+9.39390E-04
+1.40595E-02
+-4.89717E-04
+-1.80880E-03
+2.35373E-03
+4.11257E-03
+-2.89455E-03
+5.20837E-03
+-7.82527E-03
+-8.10209E-03
+2.09822E-03
+-5.59362E-04
+6.21779E-04
+1.19200E-03
+3.27965E-03
+6.34701E-02
+-9.55843E-02
+7.89666E-02
+-8.69198E-02
+3.85345E-03
+-1.60660E-03
+6.48502E-03
+-2.57321E-04
+-2.77198E-03
+-2.22505E-03
+8.32341E-04
+4.61294E-04
+4.76449E-02
+7.77390E-03
+-4.89485E-02
+9.50176E-04
+-5.87483E-03
+4.95926E-02
+-1.88864E-02
+-2.20620E-02
+3.61988E-03
+3.72923E-04
+-9.01274E-04
+2.99111E-03
+3.87878E-04
+1.49061E-03
+-7.52049E-04
+2.88234E-03
+-2.78368E-02
+-5.76616E-02
+-4.44516E-02
+3.52391E-02
+1.62484E-02
+-1.33273E-02
+-2.03980E-02
+5.05344E-03
+-3.74544E-03
+1.78525E-03
+-2.40457E-03
+-3.94525E-03
+GAP_abinitio.fitout
+6 6
+2.16431E-02
+1.01017E-02
+1.08876E-01
+7.34409E-02
+-1.09853E-02
+9.79247E-04
+4.98205E-02
+-6.29565E-03
+-1.37799E-01
+-4.10759E-02
+-2.46017E-03
+4.80559E-04
+1.58473E-03
+1.75081E-02
+-1.54409E-03
+2.42574E-03
+4.26959E-03
+-1.02854E-03
+1.03385E-02
+-1.57001E-02
+2.02765E-03
+1.87894E-04
+2.12208E-04
+3.96201E-03
+-2.27239E-02
+7.46691E-03
+4.17848E-02
+2.41565E-02
+7.74483E-03
+1.63369E-03
+3.93859E-02
+-2.02702E-02
+-2.30982E-03
+-1.11121E-03
+3.03768E-03
+-1.78059E-03
+-1.92422E-03
+1.47293E-03
+1.85671E-02
+-7.15950E-03
+1.11092E-03
+4.77112E-03
+-3.82005E-03
+6.27417E-04
+1.72187E-01
+8.48193E-02
+5.13335E-02
+2.56405E-02
+-1.86126E-02
+-5.59752E-03
+1.12581E-02
+-9.64361E-04
+6.46262E-04
+-2.31221E-03
+-2.40846E-03
+1.63797E-03
+4.54519E-02
+-5.91857E-02
+-1.00474E-02
+-1.40591E-01
+1.81836E-02
+-2.04773E-02
+6.49684E-02
+3.16978E-02
+-9.31686E-03
+7.77812E-03
+3.71733E-03
+-8.83382E-03
+1.26015E-03
+7.59054E-04
+4.31544E-04
+-8.23154E-04
+1.76513E-02
+-3.27815E-03
+-1.17345E-01
+5.62252E-02
+-1.81312E-02
+4.04796E-02
+-5.55516E-02
+-1.14203E-02
+9.65567E-04
+1.29682E-03
+-5.17527E-03
+1.59823E-03
+GPp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GPa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+GPG_abinitio.fitout
+6 6
+-7.59230E-03
+-1.94552E-04
+-5.12944E-03
+3.20316E-03
+8.28212E-04
+-6.12307E-03
+-4.85436E-03
+-3.86687E-03
+5.36871E-03
+-3.81511E-03
+1.48924E-03
+-4.03381E-03
+-1.52037E-03
+5.72898E-03
+-2.07652E-02
+6.52919E-03
+-1.05532E-03
+-1.52037E-03
+-4.69660E-03
+-6.37003E-03
+6.17507E-03
+8.39488E-03
+-1.76904E-03
+8.05108E-03
+-7.98866E-04
+3.32411E-03
+5.85637E-03
+-2.98884E-03
+-1.20298E-02
+-3.13323E-02
+-1.89038E-02
+-1.18356E-02
+-3.02395E-03
+2.43800E-03
+1.38867E-03
+3.67447E-04
+-2.66576E-02
+5.35667E-02
+3.22822E-02
+-4.20099E-02
+-2.76279E-03
+2.73121E-03
+-2.92878E-03
+-3.97641E-03
+5.10833E-03
+-2.13602E-03
+1.80687E-03
+-2.80887E-03
+1.75818E-02
+4.47119E-03
+1.94978E-03
+3.01372E-02
+2.73577E-03
+2.07557E-04
+1.02968E-02
+1.06706E-02
+-1.07292E-02
+-4.42466E-03
+1.03471E-02
+3.26791E-02
+-3.88377E-03
+1.21678E-03
+-7.07759E-04
+1.76439E-03
+-9.08375E-03
+1.74263E-03
+2.04763E-03
+-1.17705E-02
+2.75141E-03
+-6.02603E-03
+-3.58871E-03
+-2.79755E-03
+2.32403E-02
+-5.25103E-02
+1.58724E-02
+-4.78943E-02
+-6.49652E-04
+-1.30365E-02
+-1.24654E-02
+-1.82200E-02
+-1.17657E-04
+-1.48990E-03
+-1.15237E-03
+-1.71433E-04
+GPA_abinitio.fitout
+6 6
+1.76833E-02
+9.87411E-04
+-1.16391E-02
+1.75059E-02
+-6.24857E-03
+-5.22125E-03
+5.86116E-03
+-2.32421E-03
+-1.58225E-02
+7.43433E-03
+4.93394E-03
+-1.89631E-02
+-3.25799E-02
+-2.32415E-02
+-3.10454E-02
+-8.91640E-03
+-7.65479E-03
+-1.27982E-03
+-9.57172E-03
+8.77571E-03
+6.27899E-03
+9.87208E-03
+1.16529E-02
+8.66130E-03
+1.92294E-02
+7.29907E-02
+5.17669E-02
+-2.27035E-02
+6.60383E-03
+2.08489E-02
+-4.78442E-03
+-1.14125E-02
+-4.55136E-03
+7.67130E-03
+1.21326E-02
+1.30754E-02
+-2.73899E-02
+6.76535E-02
+3.83851E-02
+-5.38365E-02
+5.65271E-03
+-5.37810E-04
+6.97088E-03
+7.72153E-03
+2.74100E-02
+-4.70346E-02
+-2.35609E-02
+-5.97889E-02
+3.49906E-02
+3.87800E-02
+2.36671E-02
+3.21217E-02
+3.57922E-03
+3.74125E-03
+1.26977E-02
+1.32543E-02
+-1.83147E-02
+-2.62166E-02
+-5.76715E-03
+-1.83617E-02
+-6.49200E-03
+4.85116E-02
+2.89452E-02
+1.35099E-02
+8.75516E-03
+2.02179E-02
+4.64394E-03
+7.27739E-03
+4.54111E-03
+-3.11138E-03
+2.01092E-03
+2.90504E-03
+2.15560E-02
+-7.36577E-02
+1.91254E-02
+-5.61390E-02
+8.99074E-03
+1.35028E-02
+4.72925E-04
+-3.22296E-03
+-9.02731E-03
+-1.73413E-02
+-9.12097E-03
+1.71334E-02
+GPP_abinitio.fitout
+6 6
+3.55782E-01
+-2.50590E-02
+-2.02781E-02
+1.88976E-01
+-6.17588E-02
+-2.91385E-02
+2.05426E-01
+-5.87770E-03
+-3.30234E-01
+7.61622E-02
+5.16617E-02
+-1.35195E-01
+-3.32316E-03
+4.73134E-03
+9.83600E-03
+1.38053E-02
+2.51654E-03
+6.42227E-03
+-1.41234E-02
+1.49387E-02
+-1.78714E-04
+-5.87439E-03
+1.08191E-03
+-1.97401E-04
+1.05038E-01
+2.91828E-01
+3.05333E-01
+-1.00742E-01
+-1.01012E-02
+-1.49328E-02
+3.57843E-02
+-4.10710E-02
+-2.83700E-02
+-2.30223E-03
+-2.43599E-03
+2.05701E-02
+-1.78170E-02
+-4.82013E-03
+6.73937E-03
+-3.38595E-03
+3.28851E-03
+-8.08060E-03
+-7.65673E-03
+5.09805E-03
+1.57284E-01
+-2.00083E-01
+-2.14765E-01
+-1.45042E-01
+3.67444E-02
+1.99603E-02
+2.72203E-02
+3.10215E-02
+-2.08581E-03
+-1.66514E-03
+-4.79677E-03
+-3.68899E-03
+1.95962E-02
+-5.81681E-03
+-5.65331E-02
+5.75209E-02
+6.98914E-02
+1.28428E-01
+1.38299E-01
+-6.32083E-02
+-1.13264E-02
+-1.45981E-02
+-6.42446E-03
+-1.94911E-02
+-8.84309E-03
+-2.46011E-03
+-2.28773E-03
+-5.77668E-03
+3.89634E-03
+9.03634E-03
+9.92089E-03
+-6.47315E-03
+4.81635E-02
+-5.01397E-02
+3.40332E-02
+-2.73013E-02
+-6.50338E-02
+9.57053E-04
+3.41943E-03
+5.80621E-02
+App
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Apa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ApG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ApA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ApP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Aap
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Aaa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AaG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AaA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AaP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AGp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AGa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AGG_abinitio.fitout
+6 6
+-7.39715E-03
+3.65556E-03
+-1.91078E-02
+2.38136E-03
+-5.37961E-03
+3.61998E-03
+-2.18464E-02
+-4.41896E-03
+5.08921E-03
+3.21624E-03
+5.89060E-03
+1.19802E-03
+-2.19281E-02
+1.49645E-02
+-3.56136E-02
+9.88455E-03
+1.22315E-02
+-3.00099E-03
+2.21176E-03
+3.15110E-03
+-6.61995E-03
+-3.20593E-03
+1.54183E-03
+-8.59009E-04
+-5.99348E-03
+4.65389E-05
+-5.95310E-02
+1.06111E-02
+1.57623E-02
+1.59041E-02
+1.00177E-04
+1.29357E-01
+4.43290E-03
+2.08145E-02
+-4.15715E-03
+1.26761E-03
+1.04441E-02
+-2.89679E-02
+6.04392E-02
+-1.59174E-01
+-5.14944E-02
+1.87340E-02
+3.85570E-02
+-3.73199E-02
+7.51987E-04
+-4.77918E-03
+4.26491E-03
+4.13725E-03
+9.71818E-03
+9.73285E-04
+3.70014E-02
+-2.94368E-04
+-4.04141E-03
+3.29676E-03
+4.40040E-02
+-7.37677E-03
+-2.53272E-03
+1.62907E-02
+1.14612E-03
+-1.48734E-02
+-3.33955E-03
+-2.38826E-03
+-8.32102E-03
+1.27157E-03
+4.85104E-03
+4.73026E-04
+2.63678E-02
+-1.07751E-02
+-2.39741E-03
+-1.84784E-02
+5.03233E-03
+1.06810E-02
+-2.90718E-02
+-5.45636E-02
+4.72574E-03
+3.35612E-02
+1.56482E-02
+-2.86180E-02
+7.62139E-03
+-1.87081E-02
+-1.26071E-03
+2.55160E-03
+3.08408E-03
+6.64625E-04
+AGA_abinitio.fitout
+6 6
+-2.10939E-02
+6.03383E-02
+-5.52248E-02
+1.30827E-02
+-1.40094E-02
+1.47428E-02
+-4.01256E-02
+-2.37278E-02
+-2.87652E-02
+3.68246E-02
+2.93335E-02
+4.16440E-04
+1.17436E-02
+1.16773E-01
+-5.62224E-02
+2.90645E-02
+9.23893E-03
+9.04317E-04
+8.25772E-02
+-8.68232E-03
+5.76473E-02
+-5.38481E-02
+4.24119E-03
+-2.74517E-03
+-7.20633E-01
+-1.75249E-01
+2.57130E-03
+1.87130E-02
+-3.59686E-02
+6.77989E-02
+2.08938E-02
+1.32158E-01
+-1.08429E-02
+7.44245E-02
+-1.44520E-03
+1.01815E-01
+-3.94152E-02
+-3.71396E-02
+5.52084E-02
+-1.15046E-01
+1.03393E-01
+3.15823E-02
+4.11136E-03
+2.05022E-02
+3.50590E-02
+-3.83513E-02
+2.49373E-02
+-8.93949E-02
+1.20974E-02
+-4.74375E-03
+1.72335E-02
+1.47956E-02
+-7.11183E-03
+-1.84173E-03
+2.06808E-02
+-7.58410E-03
+1.52949E-02
+-5.81264E-03
+-5.96499E-04
+-2.82883E-02
+-1.02857E-02
+2.25503E-02
+-2.57388E-02
+-2.87509E-02
+-8.97673E-03
+-8.26320E-03
+-5.34274E-03
+-1.16850E-02
+2.07672E-02
+-3.82975E-03
+-1.01681E-02
+6.05167E-03
+-5.72931E-02
+-4.97570E-02
+1.03005E-03
+4.70162E-02
+-1.06617E-03
+-2.36271E-02
+1.88343E-03
+-3.47428E-03
+1.31956E-03
+-2.15396E-02
+9.27436E-03
+-7.35804E-03
+AGP_abinitio.fitout
+6 6
+1.31640E-01
+2.58075E-01
+-8.58162E-02
+1.38005E-02
+-1.71596E-03
+5.98072E-03
+3.33712E-01
+2.93859E-02
+-3.00524E-02
+7.07210E-03
+7.75509E-03
+-8.65250E-03
+-8.74605E-02
+4.48412E-03
+-4.66310E-02
+3.06797E-02
+-2.19807E-02
+-1.58779E-02
+1.05553E-01
+6.43617E-02
+-4.08730E-02
+-2.03012E-03
+3.47495E-02
+-7.22030E-02
+-7.17920E-01
+-5.04379E-01
+-5.06488E-01
+5.31765E-01
+-1.50917E-01
+4.25707E-01
+5.91572E-02
+7.35844E-03
+-6.86600E-02
+8.34443E-03
+2.77907E-02
+2.06332E-02
+-1.13316E-01
+-6.99060E-02
+2.08245E-01
+-8.67383E-02
+-2.09219E-02
+2.28999E-02
+1.01289E-01
+-7.87242E-02
+-9.80531E-04
+1.26618E-01
+-4.27857E-02
+1.02030E-01
+-5.09267E-02
+-7.30891E-03
+-1.41543E-01
+-1.16047E-02
+6.00033E-02
+-7.06215E-02
+1.06774E-01
+4.95735E-02
+6.20532E-03
+-1.58945E-02
+1.13562E-02
+-1.70360E-01
+-2.32910E-02
+-6.32569E-03
+1.29374E-02
+-2.33028E-02
+7.41635E-02
+6.90855E-02
+3.93931E-02
+-4.32746E-02
+6.13297E-02
+3.73997E-02
+-4.94826E-03
+-3.71951E-03
+-2.28195E-03
+-6.09570E-03
+-8.25585E-03
+2.80583E-02
+5.84276E-03
+-3.18833E-02
+-3.95278E-02
+-3.23312E-02
+5.37754E-03
+3.70124E-03
+-5.30540E-05
+2.20955E-02
+AAp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AAa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+AAG_abinitio.fitout
+6 6
+-1.70504E-02
+-1.25725E-02
+-2.16572E-02
+9.17676E-03
+-7.82222E-03
+4.46235E-04
+-2.89066E-02
+-3.18047E-03
+1.97174E-03
+8.13914E-05
+2.44927E-03
+-7.40994E-04
+-1.96244E-02
+4.33134E-02
+-3.37035E-02
+7.64787E-03
+-2.13924E-02
+9.52598E-03
+-3.70523E-02
+-7.40036E-02
+2.40140E-02
+-5.10030E-03
+1.59236E-02
+7.43181E-03
+-1.31910E-02
+-7.98080E-03
+-3.09633E-02
+-7.51476E-03
+1.27383E-01
+-5.50401E-02
+5.28821E-03
+1.30486E-01
+7.11103E-03
+3.19300E-03
+-6.44252E-03
+-1.02063E-02
+6.87598E-02
+-8.99360E-02
+-6.87923E-02
+-1.23161E-01
+2.60656E-03
+-1.74383E-02
+3.18957E-02
+1.71278E-02
+6.27281E-03
+-3.34598E-03
+9.42044E-03
+-7.47981E-03
+-8.29916E-03
+2.89364E-02
+8.84389E-03
+-1.37194E-03
+3.56810E-02
+9.28219E-03
+3.85979E-02
+-2.62633E-02
+-1.93497E-02
+2.38321E-02
+-2.48270E-02
+4.03903E-02
+-3.67611E-04
+-4.36283E-03
+-9.47872E-03
+3.38944E-04
+3.18600E-03
+-4.88922E-03
+5.87363E-03
+-1.14359E-03
+-1.15826E-03
+-3.43521E-03
+7.57689E-03
+3.94852E-03
+-3.77955E-02
+-5.78792E-02
+1.21638E-02
+2.92502E-02
+1.65337E-02
+-2.18462E-02
+-9.40339E-03
+5.38053E-03
+3.03565E-03
+-1.07824E-04
+4.67967E-03
+-2.39506E-03
+AAA_abinitio.fitout
+6 6
+-2.05481E-01
+-8.26191E-02
+-6.95965E-02
+2.35665E-02
+-2.42723E-02
+1.32714E-03
+-8.89860E-02
+3.10180E-02
+-1.78645E-02
+-1.17453E-02
+6.66812E-03
+2.24833E-03
+-2.12827E-01
+-8.67822E-02
+-6.42470E-02
+2.51073E-02
+-1.87957E-02
+-2.67943E-03
+2.43460E-02
+-6.09457E-02
+3.04366E-02
+1.66922E-04
+-4.91981E-04
+4.11041E-03
+-5.57253E-01
+3.53999E-02
+-3.54366E-02
+-2.08256E-01
+-1.00701E-01
+5.79432E-03
+8.35129E-02
+7.78467E-02
+-1.23620E-01
+5.25424E-02
+-7.34795E-02
+3.79700E-02
+3.56303E-02
+-1.04002E-01
+1.77074E-02
+-6.40671E-02
+1.61121E-02
+5.81681E-02
+2.14007E-02
+6.03380E-02
+3.14908E-02
+-8.44041E-02
+-1.35241E-02
+-5.63823E-02
+-1.98125E-02
+-1.07643E-02
+3.85091E-02
+2.61695E-03
+2.67479E-02
+2.91781E-02
+3.32585E-02
+3.74364E-03
+3.95839E-02
+3.44728E-02
+-3.61017E-02
+2.51821E-02
+-1.16023E-02
+9.06885E-03
+-3.49017E-02
+-2.81423E-02
+-7.23186E-03
+-2.86460E-02
+1.58622E-02
+-1.63989E-03
+-1.90603E-02
+-6.01905E-03
+1.24698E-02
+2.47730E-03
+-3.53859E-02
+-1.77117E-02
+-2.28246E-02
+4.82700E-02
+1.54564E-02
+-5.67317E-03
+-7.01419E-03
+4.19916E-03
+7.22849E-03
+-3.30823E-02
+-8.92923E-03
+-1.67293E-02
+AAP_abinitio.fitout
+6 6
+-2.60341E-01
+-1.76464E-01
+-2.58402E-02
+5.08365E-02
+9.37785E-03
+1.34683E-02
+9.21716E-02
+4.11687E-02
+-8.52362E-02
+-1.16991E-02
+-2.83520E-02
+-2.85315E-02
+-1.15678E-01
+1.39526E-01
+1.43150E-03
+-1.24315E-02
+3.67833E-02
+-1.29502E-02
+-1.49832E-01
+-1.70965E-01
+-5.62158E-03
+-2.47031E-02
+-2.08181E-02
+1.00187E-02
+-5.09741E-01
+-3.04707E-01
+-1.77654E-01
+6.17878E-02
+-3.70183E-01
+3.16793E-01
+2.12524E-02
+2.52440E-02
+-6.09105E-02
+-8.32189E-02
+-3.45513E-02
+9.52014E-03
+-1.82716E-01
+1.57791E-02
+5.23627E-02
+-4.44659E-03
+-6.04463E-02
+7.35341E-02
+6.70677E-02
+-5.01091E-02
+1.58910E-01
+7.43892E-02
+-4.84020E-03
+2.64253E-02
+-1.74718E-01
+2.79791E-02
+-1.48718E-01
+-1.55775E-02
+2.66950E-02
+-1.89974E-02
+9.19990E-02
+-1.34598E-02
+2.58915E-02
+-8.32852E-02
+-1.21375E-02
+-1.35189E-01
+-2.34513E-03
+2.60660E-02
+2.74800E-02
+2.42119E-02
+-1.05766E-02
+1.07458E-01
+-9.49010E-02
+4.41061E-02
+2.37077E-04
+1.65542E-02
+5.17467E-03
+-2.63125E-02
+4.40376E-03
+-5.38761E-03
+-9.77473E-02
+6.71620E-02
+2.48552E-03
+-2.73268E-03
+-6.93468E-02
+-2.85697E-02
+-4.28702E-04
+1.93884E-02
+3.32264E-03
+6.53017E-03
+APp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+APa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+APG_abinitio.fitout
+6 6
+2.11374E-02
+2.96387E-02
+7.90197E-03
+2.06850E-02
+2.34088E-02
+6.25406E-03
+-6.08740E-03
+-1.55375E-03
+-5.36785E-03
+-3.11711E-02
+-9.42745E-03
+-9.88549E-03
+-2.33313E-03
+1.05580E-02
+-6.05641E-02
+2.53598E-02
+-3.71104E-03
+-5.01697E-03
+-2.89535E-02
+-2.77652E-02
+3.61965E-02
+2.00866E-02
+-3.16730E-03
+1.42707E-02
+-2.45496E-03
+-6.39974E-03
+-5.31496E-03
+1.49525E-02
+-5.33448E-02
+-6.12883E-02
+1.64008E-02
+5.17439E-02
+-1.32435E-02
+8.86931E-04
+-1.93406E-02
+1.29406E-02
+3.93005E-02
+-4.91735E-02
+8.90276E-02
+-1.29607E-01
+-4.02511E-02
+2.03071E-03
+-3.23640E-03
+1.57962E-02
+2.20466E-03
+4.80277E-03
+-7.51544E-03
+1.37773E-02
+2.79080E-02
+6.38630E-02
+-3.29278E-02
+6.21700E-03
+2.75330E-02
+-6.78977E-02
+7.03002E-02
+-2.20345E-02
+-1.90882E-02
+1.59821E-03
+1.08734E-02
+6.23326E-02
+-1.95481E-02
+6.49369E-03
+1.63273E-03
+1.99442E-02
+1.58751E-03
+-2.23369E-02
+2.25455E-02
+-1.50345E-02
+2.31505E-02
+2.36684E-02
+-2.15136E-02
+-2.13738E-02
+4.16797E-02
+-1.06406E-01
+4.31283E-02
+-5.98608E-02
+-2.21497E-02
+-4.07299E-02
+-4.56594E-04
+-1.37761E-03
+-1.48161E-02
+3.23533E-03
+-1.19902E-02
+1.20310E-02
+APA_abinitio.fitout
+6 6
+8.58406E-02
+7.11000E-02
+-2.46047E-03
+6.50547E-02
+6.13304E-02
+4.29823E-03
+-6.05849E-02
+-2.44367E-03
+-3.77551E-02
+-7.23133E-02
+-3.86123E-03
+-1.07154E-02
+-1.03709E-01
+-7.05574E-02
+-9.49350E-02
+-1.53363E-02
+-1.18499E-02
+-7.61708E-03
+-2.91869E-02
+4.65680E-02
+3.62772E-02
+3.39042E-02
+3.16662E-02
+1.47463E-02
+1.52687E-01
+3.95754E-02
+-1.32083E-02
+-1.89615E-01
+-1.83152E-02
+-3.72732E-03
+-1.41424E-02
+-4.35396E-02
+3.71739E-02
+2.14553E-02
+6.33433E-02
+1.58020E-02
+4.23314E-02
+-7.04643E-02
+1.00041E-01
+-1.66457E-01
+1.68853E-02
+-4.71492E-02
+4.53786E-02
+1.36936E-02
+1.65425E-02
+-1.09111E-01
+-4.96983E-02
+-7.14614E-02
+7.25503E-02
+1.07859E-01
+-6.38044E-02
+-5.08115E-02
+2.52785E-02
+-7.96546E-02
+8.77169E-02
+-1.86505E-02
+-4.12172E-02
+-4.92979E-02
+2.69538E-02
+-2.66457E-02
+6.73594E-02
+8.20067E-02
+1.23491E-02
+-7.82045E-02
+5.59781E-03
+1.69580E-02
+-3.36624E-03
+-2.40832E-02
+5.55433E-02
+1.45973E-02
+-1.31928E-02
+-1.57636E-02
+3.78321E-02
+-1.46667E-01
+5.68449E-02
+-5.81680E-02
+1.44393E-02
+9.01460E-03
+-2.10025E-02
+-1.45872E-02
+4.07156E-03
+3.95902E-02
+4.00640E-02
+4.22339E-02
+APP_abinitio.fitout
+6 6
+7.67218E-01
+2.33457E-01
+-1.46363E-01
+2.05224E-01
+1.06638E-01
+-6.77313E-02
+-6.30041E-01
+-3.81159E-01
+-5.15514E-01
+-2.88904E-01
+-2.90076E-02
+-2.70035E-02
+3.70005E-03
+1.95656E-02
+1.25674E-02
+3.59916E-02
+1.37024E-02
+1.01801E-02
+-3.80359E-02
+5.47337E-02
+1.01848E-02
+-2.57535E-02
+2.66764E-03
+-4.98453E-04
+7.52962E-01
+2.85588E-02
+-2.30346E-03
+-7.23259E-01
+8.10079E-02
+-1.05684E-01
+3.68628E-02
+-1.91424E-03
+2.12266E-01
+-6.32729E-02
+-1.02146E-01
+-2.18836E-01
+-6.31142E-03
+-2.91560E-02
+5.34587E-02
+-7.50095E-03
+7.50583E-02
+-8.13426E-02
+-2.32451E-02
+1.11562E-02
+1.13419E-01
+-3.85175E-01
+-4.29197E-01
+-1.16652E-01
+7.97811E-02
+9.57693E-02
+-8.52841E-02
+-2.21538E-02
+-2.39487E-03
+-8.70199E-03
+1.31160E-02
+-1.57490E-02
+4.10501E-03
+1.15439E-02
+-1.21521E-01
+1.06008E-01
+2.17808E-01
+-4.09860E-02
+-4.67063E-02
+-2.20038E-01
+-1.73742E-02
+-5.15139E-02
+1.45133E-02
+1.43836E-02
+1.12055E-02
+4.37722E-02
+-6.08277E-02
+-2.48175E-02
+1.34523E-02
+-5.61869E-03
+2.54898E-02
+-1.15690E-02
+8.28139E-02
+-9.28803E-02
+-7.82454E-02
+8.53303E-02
+-8.14192E-03
+4.37089E-02
+4.66433E-02
+-7.54954E-03
+Ppp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Ppa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PpG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PpA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PpP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Pap
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+Paa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PaG
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PaA
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PaP
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PGp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PGa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PGG_abinitio.fitout
+6 6
+-1.17152E-02
+8.08314E-04
+-1.84929E-02
+7.36520E-03
+6.78035E-04
+1.47704E-03
+-1.70250E-02
+-1.55551E-03
+2.76943E-03
+1.08343E-02
+4.12013E-03
+-3.24136E-03
+-3.01008E-02
+2.32977E-02
+-5.15750E-02
+2.27035E-02
+6.65240E-03
+-2.18380E-03
+5.05778E-04
+1.64632E-03
+-3.06580E-03
+-1.65941E-03
+1.19256E-03
+1.70662E-04
+-3.20902E-02
+1.66855E-03
+-5.58858E-02
+3.53936E-03
+3.31006E-02
+7.91879E-02
+4.61083E-02
+1.38623E-01
+3.86473E-03
+1.37982E-02
+-9.42935E-03
+-2.21267E-02
+3.39327E-02
+-1.03076E-01
+5.55447E-02
+-1.74210E-01
+-5.80200E-02
+4.68277E-02
+1.06477E-01
+-8.69627E-02
+6.78160E-03
+-3.06871E-03
+-7.58285E-04
+-2.00872E-04
+2.83759E-02
+-1.86440E-04
+4.72643E-02
+-3.65989E-03
+-3.13701E-02
+9.28177E-03
+7.65182E-02
+-1.78706E-02
+-8.74290E-03
+7.16994E-03
+3.33572E-03
+-3.65890E-03
+-7.11420E-03
+2.06385E-03
+-8.99078E-03
+2.57823E-03
+1.33229E-02
+-6.60596E-03
+2.05639E-02
+-1.16590E-02
+-7.63912E-03
+-1.97280E-02
+1.62325E-02
+3.47846E-02
+-4.83151E-02
+-6.75034E-02
+3.99377E-03
+9.70541E-03
+5.68454E-03
+-7.85137E-03
+3.89044E-03
+2.39758E-03
+-2.02212E-03
+4.78289E-03
+6.07226E-03
+-9.28848E-03
+PGA_abinitio.fitout
+6 6
+-4.21674E-02
+-1.10869E-02
+-1.91467E-01
+3.91775E-02
+1.94958E-02
+-3.54878E-02
+-3.77851E-02
+1.27993E-02
+6.84937E-03
+5.87173E-02
+-2.19318E-02
+-1.22346E-02
+3.61826E-02
+1.58457E-01
+-8.77671E-02
+5.07088E-02
+1.99345E-02
+-5.69296E-03
+1.80979E-01
+-1.48099E-02
+4.34955E-02
+-1.06913E-01
+-4.23758E-03
+-1.12771E-02
+-9.14668E-01
+-1.27576E-01
+4.31803E-01
+8.48152E-02
+-9.29375E-02
+8.11535E-02
+7.75147E-02
+-1.54831E-02
+1.80980E-02
+3.56840E-01
+1.06163E-03
+1.84371E-01
+-3.63221E-02
+-1.54518E-01
+8.01580E-02
+-1.37715E-01
+3.75783E-02
+6.25028E-02
+-9.71596E-02
+-7.76123E-02
+-7.34366E-03
+-2.53251E-02
+-8.84402E-02
+-1.33588E-01
+2.93982E-02
+-2.04265E-02
+3.61310E-02
+2.56799E-02
+-7.53693E-02
+3.97849E-03
+9.38605E-03
+-1.03295E-02
+1.08952E-02
+-1.28963E-02
+-9.99238E-03
+-1.83259E-02
+-5.49337E-02
+-3.29320E-02
+1.76373E-02
+1.68899E-02
+-1.38793E-02
+-6.36390E-03
+1.10934E-02
+-2.37010E-02
+7.99957E-03
+-8.11723E-03
+-1.10377E-02
+1.49324E-02
+-5.20932E-02
+-5.07061E-02
+9.24310E-03
+3.59607E-02
+8.39780E-03
+2.03269E-02
+3.52271E-02
+2.07302E-02
+2.99236E-02
+1.25733E-02
+2.46004E-02
+2.57522E-02
+PGP_abinitio.fitout
+6 6
+2.03597E-01
+8.31483E-02
+-1.71381E-01
+8.54226E-02
+4.25626E-02
+-5.85819E-02
+2.22794E-01
+-2.02475E-01
+3.25632E-02
+7.33475E-02
+-7.06541E-02
+4.51681E-03
+-1.67080E-01
+2.09618E-02
+-3.46297E-02
+8.43392E-02
+-5.34880E-02
+-6.10693E-02
+2.21688E-01
+2.10843E-01
+-3.28216E-02
+-2.72329E-02
+9.86024E-02
+-1.76610E-01
+-1.60565E+00
+-4.44138E-01
+-2.78194E-01
+1.38773E+00
+-3.28544E-01
+5.61299E-01
+2.68172E-01
+-2.49111E-01
+-3.04849E-02
+3.24789E-01
+-7.02413E-02
+-5.66952E-02
+-1.99543E-02
+-1.54812E-01
+3.44999E-01
+-8.80924E-02
+2.92163E-01
+-1.06140E-01
+1.13480E-01
+-6.77349E-02
+-1.00651E-02
+7.06482E-04
+-1.16447E-02
+-9.76706E-03
+-1.99690E-01
+-4.61642E-05
+-1.88271E-01
+2.39097E-02
+8.30479E-02
+-3.04097E-03
+-5.22889E-02
+-3.72105E-02
+1.89411E-02
+5.14450E-03
+1.73122E-04
+2.81198E-02
+-5.64760E-02
+-2.87088E-02
+1.98950E-02
+-1.16766E-02
+1.01974E-01
+6.66616E-02
+-1.87044E-03
+-1.15424E-01
+4.27475E-02
+1.81373E-02
+-1.20504E-01
+-1.84873E-02
+-1.08167E-01
+1.51483E-02
+-3.84445E-02
+-1.61519E-02
+8.86730E-03
+1.79342E-02
+-6.56259E-02
+-7.10179E-03
+2.27041E-02
+-1.46227E-02
+4.06429E-02
+6.08438E-03
+PAp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PAa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PAG_abinitio.fitout
+6 6
+-1.86727E-02
+-4.32929E-03
+-2.85958E-02
+1.50859E-03
+-3.07202E-03
+-1.39642E-03
+-3.69846E-02
+1.04882E-03
+-8.93575E-03
+6.91102E-03
+8.76224E-03
+-9.37333E-03
+-2.83489E-02
+9.17861E-02
+-4.06504E-02
+3.05162E-03
+-2.76511E-02
+1.12820E-02
+-6.41226E-02
+-1.64995E-01
+1.11209E-01
+2.21353E-03
+2.39645E-02
+2.01533E-02
+-2.47345E-02
+-2.50684E-03
+-3.41213E-02
+-7.94485E-03
+1.05852E-01
+8.78292E-02
+-5.17054E-02
+1.69855E-01
+1.04445E-02
+9.78832E-04
+-2.29385E-02
+-1.47634E-02
+1.18421E-01
+-1.88867E-01
+-6.21589E-02
+-1.26185E-01
+-5.33812E-02
+5.50859E-02
+7.14998E-02
+-8.04550E-02
+-2.26018E-03
+4.68748E-03
+-2.27517E-03
+-1.43078E-02
+-1.17454E-03
+1.23677E-02
+3.28704E-02
+-1.18357E-03
+6.66522E-02
+1.62106E-02
+4.96241E-02
+2.33720E-02
+-3.02511E-02
+9.67404E-03
+2.23762E-02
+-7.04732E-03
+-4.78693E-03
+-4.81439E-03
+-1.62583E-02
+-5.39745E-03
+1.03614E-02
+-1.48080E-03
+2.00905E-03
+-1.32309E-03
+2.19363E-02
+-1.24035E-02
+2.52544E-02
+5.18711E-02
+-2.76865E-02
+-5.74752E-02
+2.65025E-02
+3.94510E-02
+2.18987E-02
+-2.19298E-02
+7.84386E-04
+1.00090E-02
+-1.75104E-05
+-7.15526E-04
+4.07597E-05
+-8.03326E-03
+PAA_abinitio.fitout
+6 6
+-1.48004E-01
+3.55924E-02
+-1.63137E-01
+-8.28753E-02
+-1.06713E-02
+-6.45243E-03
+-3.21653E-02
+6.01919E-02
+-5.05636E-02
+5.67676E-02
+7.86295E-02
+-2.22937E-02
+-5.37140E-01
+-1.70759E-01
+-9.59335E-02
+6.43856E-02
+-8.81145E-03
+-1.00916E-02
+-4.40811E-02
+-3.73393E-02
+1.03283E-01
+-3.42948E-03
+-2.17269E-03
+9.17541E-03
+-9.27782E-01
+-1.11939E-02
+3.02174E-01
+-1.36657E-02
+-7.86916E-02
+6.96968E-03
+1.56723E-01
+2.32634E-02
+-1.70987E-01
+3.76170E-01
+9.99686E-02
+2.18486E-01
+1.06825E-01
+-2.06877E-01
+-2.97818E-03
+-4.52041E-02
+3.13196E-02
+7.85678E-02
+-1.01412E-02
+-3.73421E-02
+1.72860E-02
+1.22020E-01
+2.19112E-02
+-1.30464E-01
+-1.06877E-02
+-3.86686E-02
+3.99139E-02
+5.35222E-04
+1.14431E-02
+6.04451E-02
+3.05464E-02
+1.50339E-02
+6.80800E-02
+3.31187E-03
+-6.31445E-02
+-1.72000E-02
+-7.22567E-02
+2.69832E-02
+-2.09692E-02
+-6.82591E-02
+-1.64572E-02
+-1.33289E-02
+1.19150E-02
+-1.13424E-02
+-1.07905E-02
+-1.69497E-02
+4.81347E-02
+3.76561E-02
+-5.18859E-02
+-3.22088E-02
+-1.06826E-02
+3.06852E-02
+3.58685E-04
+1.38110E-02
+-8.67692E-03
+2.35927E-02
+-1.07325E-02
+-3.63660E-03
+1.88840E-02
+2.41626E-02
+PAP_abinitio.fitout
+6 6
+-6.62363E-01
+7.32861E-02
+1.94710E-01
+9.73458E-02
+-6.28769E-03
+-4.85752E-02
+3.97715E-01
+5.49366E-01
+2.30814E-02
+-8.22262E-02
+-8.64146E-02
+-2.43265E-02
+-4.11363E-01
+3.39575E-01
+1.05049E-02
+-6.65599E-02
+1.35397E-01
+-4.58790E-02
+-5.10344E-01
+-4.70674E-01
+1.31064E-02
+-1.19879E-01
+-1.29575E-02
+1.81257E-02
+-1.09088E+00
+-4.71902E-01
+2.36092E-02
+5.38778E-01
+-6.85489E-01
+4.92470E-01
+4.01670E-01
+-2.32399E-01
+-7.00634E-02
+2.83989E-01
+-1.32175E-01
+1.66960E-02
+-2.21384E-01
+-5.96587E-02
+2.72734E-01
+-4.13095E-02
+2.44356E-01
+6.36661E-02
+1.48425E-01
+-6.93542E-02
+-3.99401E-02
+5.24989E-02
+7.15320E-02
+-1.61202E-01
+-3.72458E-01
+1.25361E-02
+-4.14212E-02
+2.01276E-02
+1.48321E-01
+4.87296E-02
+3.08984E-02
+-7.43849E-02
+2.22397E-02
+-6.30931E-02
+-2.58342E-02
+-1.17253E-01
+1.16469E-03
+-4.30153E-02
+1.00187E-01
+-3.68603E-02
+-2.84632E-02
+1.25879E-01
+-7.91799E-02
+-5.81097E-02
+1.66423E-02
+6.62823E-02
+-2.10941E-02
+-4.56423E-02
+-4.47566E-02
+-2.91895E-02
+-9.58987E-02
+5.13975E-03
+-2.11538E-02
+-6.48730E-03
+-5.39683E-02
+1.34026E-02
+5.00738E-02
+4.52056E-04
+3.10756E-02
+1.90776E-02
+PPp
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PPa
+0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+ 0 0
+PPG_abinitio.fitout
+6 6
+5.16416E-02
+8.62095E-02
+-4.51303E-02
+-1.00017E-02
+5.57916E-02
+-2.82344E-03
+1.31516E-02
+-4.56497E-02
+-2.65691E-02
+-5.08100E-02
+5.49723E-03
+-2.54623E-02
+-1.16607E-02
+8.71292E-03
+-1.04028E-01
+4.88786E-02
+4.79630E-03
+-2.09226E-02
+-6.61022E-02
+-5.72385E-02
+8.20553E-02
+2.70668E-02
+-5.44738E-03
+1.03208E-02
+-1.03496E-02
+-2.79784E-04
+-4.19006E-02
+4.74221E-02
+-5.69082E-02
+-4.47927E-02
+8.07646E-03
+1.26023E-01
+-2.52358E-02
+1.21320E-02
+-3.71100E-02
+4.15186E-02
+5.02204E-02
+-1.58502E-01
+1.32449E-01
+-1.77700E-01
+-3.00666E-02
+-1.30149E-02
+1.33461E-02
+9.21573E-02
+-2.56421E-02
+2.27861E-02
+-1.73030E-02
+3.10550E-02
+3.71478E-02
+9.60699E-02
+-4.83687E-02
+-2.61395E-02
+4.01929E-02
+-1.28377E-01
+9.48191E-02
+-8.40461E-02
+-8.84160E-03
+-1.60301E-02
+1.77380E-02
+8.24025E-02
+-2.67488E-02
+2.84035E-02
+2.91455E-03
+1.70812E-02
+1.54656E-02
+-2.40176E-02
+2.76831E-02
+-5.27066E-03
+2.65944E-02
+4.76662E-02
+-4.29954E-02
+-4.04722E-02
+3.02425E-02
+-8.97502E-02
+5.58394E-02
+-5.79944E-02
+-1.14607E-02
+-5.29796E-02
+2.89066E-02
+7.05200E-02
+-3.06923E-02
+1.81037E-02
+-7.19964E-03
+1.24096E-02
+PPA_abinitio.fitout
+6 6
+1.32899E-01
+1.38710E-01
+-3.14724E-02
+1.18637E-03
+7.58328E-02
+-1.42436E-02
+-6.58168E-02
+-8.66061E-02
+-6.79304E-02
+-1.19298E-01
+-1.61300E-02
+-4.37837E-02
+-1.78927E-01
+-1.06051E-01
+-1.70089E-01
+-8.92743E-03
+-1.36536E-02
+-3.11752E-02
+-6.57058E-02
+8.25739E-02
+8.75466E-02
+4.94767E-02
+3.98260E-02
+7.59713E-03
+7.87024E-02
+-1.31469E-01
+-1.19822E-01
+-1.88926E-01
+-5.37974E-02
+-5.92828E-02
+3.66331E-02
+-7.89996E-02
+3.94025E-02
+-1.22489E-01
+-1.04510E-01
+-8.92355E-02
+3.76168E-02
+-2.21729E-01
+1.45467E-01
+-2.07780E-01
+-2.21517E-02
+-6.26420E-02
+5.66877E-02
+-8.08278E-03
+2.41190E-02
+-1.27733E-01
+-1.22023E-01
+-1.08070E-01
+6.95849E-02
+1.10424E-01
+-8.50267E-02
+-1.19373E-01
+3.44974E-02
+-1.88762E-01
+1.16889E-01
+-8.09305E-02
+-2.55243E-02
+-4.70948E-02
+3.42463E-02
+-6.88564E-03
+8.19412E-02
+-5.04839E-02
+-1.18235E-01
+-1.96336E-01
+1.05609E-02
+1.98306E-02
+-3.37354E-03
+-3.73736E-02
+4.17335E-02
+4.33113E-02
+-5.87118E-02
+-6.90520E-02
+2.89217E-02
+-1.39956E-01
+8.07782E-02
+-5.61360E-02
+-1.10854E-02
+-2.35454E-02
+-2.55672E-02
+-1.54173E-02
+5.08292E-02
+2.02335E-03
+-6.94101E-02
+-7.15398E-02
+PPP_abinitio.fitout
+6 6
+9.55141E-01
+2.82825E-01
+-1.25053E-01
+-7.72476E-02
+-1.53768E-02
+-1.23068E-01
+-1.07860E+00
+-8.60254E-01
+-5.96195E-01
+-5.73846E-01
+-1.56914E-01
+-2.25099E-01
+3.39553E-02
+5.27174E-02
+-4.70984E-04
+6.95022E-02
+3.54170E-02
+-6.13267E-04
+-7.18476E-02
+1.27301E-01
+3.65459E-02
+-6.67390E-02
+-1.04061E-02
+-1.72909E-02
+9.06180E-01
+-3.16174E-01
+-4.36987E-01
+-8.48768E-01
+1.45459E-01
+-1.03920E-01
+6.02209E-02
+-2.74110E-02
+3.85731E-01
+-4.98738E-01
+-6.17808E-01
+-3.88753E-01
+1.82417E-02
+-5.85814E-02
+8.79629E-02
+-1.17158E-02
+9.11518E-02
+-5.60357E-02
+-8.69024E-02
+7.33401E-02
+1.80120E-01
+-4.92279E-01
+-5.69457E-01
+-2.06515E-01
+7.60602E-02
+1.37305E-01
+-1.78078E-01
+-3.68494E-02
+3.13809E-02
+-4.97757E-02
+6.29741E-02
+-1.27850E-02
+3.55620E-03
+6.26058E-03
+-1.59718E-01
+1.40642E-01
+2.54613E-01
+-4.16776E-01
+-4.60517E-01
+-2.65052E-01
+4.02722E-03
+-3.47336E-02
+1.38117E-02
+4.25497E-02
+-4.07847E-03
+8.37183E-02
+-1.45515E-01
+-4.97774E-02
+2.16109E-02
+-4.19394E-02
+5.29746E-02
+-7.24450E-03
+1.28857E-03
+5.46137E-03
+-2.15724E-01
+2.27414E-01
+9.50069E-02
+-1.60267E-01
+-1.77017E-01
+-1.06693E-01
+
integer nres,nres0,nsup,nstart_sup,nend_sup,nstart_seq,
- &tabperm
- double precision c,cref,dc,xloc,xrot,dc_norm,t,r,prod,rt
+ &tabperm,chain_length
+ double precision c,cref,dc,xloc,xrot,dc_norm,t,r,prod,rt,
+ & chain_rep
common /chain/ c(3,maxres2+2),dc(3,maxres2),xloc(3,maxres),
& xrot(3,maxres),dc_norm(3,maxres2),nres,nres0
common /rotmat/ t(3,3,maxres),r(3,3,maxres),prod(3,3,maxres),
& rt(3,3,maxres)
- common /refstruct/ cref(3,maxres2+2),nsup,nstart_sup,nstart_seq,
- & nend_sup,tabperm(maxperm,maxsym)
+ common /refstruct/ cref(3,maxres2+2,maxperm),
+ & chain_rep(3,maxres2+2,maxsym), nsup,nstart_sup,
+ & nstart_seq,
+ & nend_sup, chain_length,tabperm(maxperm,maxsym)
& sigc0,dsc,dsc_inv,bsc,censc,gaussc,dsc0,vbl,vblinv,vblinv2,
& vbl_cis,vbl0,vbld_inv
integer nlob,loc_start,loc_end,ithet_start,ithet_end,
- & iphi_start,iphi_end
+ & iphi_start,iphi_end,itau_start,itau_end
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1)
+ & ,bthet(2,-ntyp:ntyp,-1:1,-1:1),
+ & polthet(0:3,-ntyp:ntyp),gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),
+ &sig0(-ntyp:ntyp), sigc0(-ntyp:ntyp)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
- & ithetyp(ntyp1),nntheterm
- double precision aa0thet(maxthetyp1,maxthetyp1,maxthetyp1),
- & aathet(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1),
- & bbthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ccthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ddthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & eethet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ffthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1),
- & ggthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1)
+ & ithetyp(-ntyp1:ntyp1),nntheterm
+ double precision aa0thet(-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & aathet(maxtheterm,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & bbthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ccthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ddthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & eethet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ffthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2),
+ & ggthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2)
common /theta_abinitio/aa0thet,aathet,bbthet,ccthet,ddthet,eethet,
& ffthet,
& ggthet,ithetyp,nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,
& ndouble,nntheterm
C Parameters of the side-chain probability distribution
common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ & dsc0(ntyp1),
& nlob(ntyp1)
C Virtual-bond lenghts
common /peptbond/ vbl,vblinv,vblinv2,vbl_cis,vbl0
common /indices/ loc_start,loc_end,ithet_start,ithet_end,
- & iphi_start,iphi_end
+ & iphi_start,iphi_end,itau_start,itau_end
C Inverses of the actual virtual bond lengths
common /invlen/ vbld_inv(maxres2)
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),onelet(-ntyp1:ntyp1)
character*3 restyp
character*1 onelet
character*10 ename,wname
-C Parameters of the SCCOR term
- double precision v1sccor,v2sccor
- integer nterm_sccor
- common/torsionsc/v1sccor(maxterm_sccor,20,20),
- & v2sccor(maxterm_sccor,20,20),
- & nterm_sccor
+cc Parameters of the SCCOR term
+ double precision v1sccor,v2sccor,vlor1sccor,
+ & vlor2sccor,vlor3sccor,gloc_sc,
+ & dcostau,dsintau,dtauangle,dcosomicron,
+ & domicron,v0sccor
+ integer nterm_sccor,isccortyp,nsccortyp,nlor_sccor
+ common /sccor/ v1sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v2sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v0sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor1sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor2sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor3sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & gloc_sc(3,0:maxres2,10),
+ & dcostau(3,3,3,maxres2),dsintau(3,3,3,maxres2),
+ & dtauangle(3,3,3,maxres2),dcosomicron(3,3,3,maxres2),
+ & domicron(3,3,3,maxres2),
+ & nterm_sccor(-ntyp:ntyp,-ntyp:ntyp),isccortyp(-ntyp:ntyp),
+ & nsccortyp,
+ & nlor_sccor(-ntyp:ntyp,-ntyp:ntyp)
C Parameters of the SC rotamers (local) term
double precision sc_parmin
- common/scrot/sc_parmin(maxsccoef,20)
+ common/scrot/sc_parmin(maxsccoef,ntyp)
C Torsional constants of the rotation about virtual-bond dihedral angles
double precision v1,v2,vlor1,vlor2,vlor3,v0
integer itortyp,ntortyp,nterm,nlor,nterm_old
- common/torsion/v0(maxtor,maxtor),v1(maxterm,maxtor,maxtor),
- & v2(maxterm,maxtor,maxtor),vlor1(maxlor,maxtor,maxtor),
+ common/torsion/v0(-maxtor:maxtor,-maxtor:maxtor,2),
+ & v1(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & v2(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & vlor1(maxlor,maxtor,maxtor),
& vlor2(maxlor,maxtor,maxtor),vlor3(maxlor,maxtor,maxtor),
- & itortyp(ntyp),ntortyp,nterm(maxtor,maxtor),nlor(maxtor,maxtor)
+ & itortyp(-ntyp:ntyp),ntortyp,
+ & nterm(-maxtor:maxtor,-maxtor:maxtor,2),
+ & nlor(-maxtor:maxtor,-maxtor:maxtor,2)
& ,nterm_old
C 6/23/01 - constants for double torsionals
double precision v1c,v1s,v2c,v2s
integer ntermd_1,ntermd_2
- common /torsiond/ v1c(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v1s(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v2c(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & v2s(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & ntermd_1(maxtor,maxtor,maxtor),ntermd_2(maxtor,maxtor,maxtor)
+ common /torsiond/
+ &v1c(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v1s(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v2c(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ &v2s(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ & ntermd_1(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ & ntermd_2(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2)
C 9/18/99 - added Fourier coeffficients of the expansion of local energy
C surface
double precision b1,b2,cc,dd,ee,ctilde,dtilde,b1tilde
integer nloctyp
- common/fourier/ b1(2,maxtor),b2(2,maxtor),cc(2,2,maxtor),
- & dd(2,2,maxtor),ee(2,2,maxtor),ctilde(2,2,maxtor),
- & dtilde(2,2,maxtor),b1tilde(2,maxtor),nloctyp
+ common/fourier/ b1(2,-maxtor:maxtor),b2(2,-maxtor:maxtor),
+ & cc(2,2,-maxtor:maxtor),
+ & dd(2,2,-maxtor:maxtor),ee(2,2,-maxtor:maxtor),
+ & ctilde(2,2,-maxtor:maxtor),
+ & dtilde(2,2,-maxtor:maxtor),b1tilde(2,-maxtor:maxtor),nloctyp
double precision b
- common /fourier1/ b(13,maxtor)
+ common /fourier1/ b(13,0:maxtor)
integer ntheta,nphi,nside,nvar,ialph,ivar
double precision theta,phi,alph,omeg,vbld,vbld_ref,
& theta_ref,phi_ref,alph_ref,omeg_ref,
- & costtab,sinttab,cost2tab,sint2tab,
+ & costtab,sinttab,cost2tab,sint2tab,tauangle,omicron,
& xxtab,yytab,zztab
common /var/ theta(maxres),phi(maxres),alph(maxres),omeg(maxres),
& vbld(2*maxres),
& costtab(maxres), sinttab(maxres), cost2tab(maxres),
& sint2tab(maxres),xxtab(maxres),yytab(maxres),
& zztab(maxres),
- & ialph(maxres,2),ivar(4*maxres2),ntheta,nphi,nside,nvar
+ & ialph(maxres,2),ivar(4*maxres2),ntheta,nphi,nside,nvar,
+ & omicron(2,maxres),tauangle(3,maxres)
C Angles from experimental structure
common /varref/ vbld_ref(maxres),
& theta_ref(maxres),phi_ref(maxres),
parameter (maxconts=maxres)
C Number of AA types (at present only natural AA's will be handled
integer ntyp,ntyp1
- parameter (ntyp=20,ntyp1=ntyp+1)
+ parameter (ntyp=24,ntyp1=ntyp+1)
C Max. number of types of dihedral angles & multiplicity of torsional barriers
integer maxtor,maxterm,maxlor,maxtermd_1,maxtermd_2
parameter (maxtor=4,maxterm=10,maxlor=3,maxtermd_1=8,maxtermd_2=8)
c Max number of torsional terms in SCCOR
integer maxterm_sccor
- parameter (maxterm_sccor=3)
+ parameter (maxterm_sccor=6)
C Max. number of residue types and parameters in expressions for
C virtual-bond angle bending potentials
integer maxthetyp,maxthetyp1,maxtheterm,maxtheterm2,maxtheterm3,
include 'COMMON.INTERACT'
dimension xx(3)
- dsci=dsc(itype(i))
- dsci_inv=dsc_inv(itype(i))
+ dsci=dsc(iabs(itype(i)))
+ dsci_inv=dsc_inv(iabs(itype(i)))
alphi=alph(i)
omegi=omeg(i)
cosalphi=dcos(alphi)
kkk=3
c print *,'nnt=',nnt,' nct=',nct
do i=nnt+kkk,nct
- iti=itype(i)
+ iti=iabs(itype(i))
do j=nnt,i-kkk
- itj=itype(j)
+ itj=iabs(itype(j))
if (ipot.ne.4) then
c rcomp=sigmaii(iti,itj)+1.0D0
rcomp=facont*sigmaii(iti,itj)
evdw=0.0D0
evdw_t=0.0d0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
cd write (iout,*) 'i=',i,' iint=',iint,' istart=',istart(i,iint),
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
evdw=0.0D0
evdw_t=0.0d0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
C
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c endif
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
chi2=chi(itypj,itypi)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
chi1=chi(itypi,itypj)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
r0ij=r0(itypi,itypj)
gcorr_loc(i)=0.0d0
enddo
do i=iatel_s,iatel_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
if (itel(i).eq.0) goto 1215
dxi=dc(1,i)
dyi=dc(2,i)
num_conti=0
c write (iout,*) 'i',i,' ielstart',ielstart(i),' ielend',ielend(i)
do j=ielstart(i),ielend(i)
- if (itype(j).eq.21 .or. itype(j+1).eq.21) cycle
+ if (itype(j).eq.ntyp1 .or. itype(j+1).eq.ntyp1) cycle
if (itel(j).eq.0) goto 1216
ind=ind+1
iteli=itel(i)
& +0.5d0*(pizda(1,1)+pizda(2,2))
enddo
endif
- else if (j.eq.i+3 .and. itype(i+2).ne.21) then
+ else if (j.eq.i+3 .and. itype(i+2).ne.ntyp1) then
CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
C
C Fourth-order contributions
c write (iout,*) 'iatscp_s=',iatscp_s,' iatscp_e=',iatscp_e,
c & ' scal14',scal14
do i=iatscp_s,iatscp_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
iteli=itel(i)
c write (iout,*) "i",i," iteli",iteli," nscp_gr",nscp_gr(i),
c & " iscp",(iscpstart(i,j),iscpend(i,j),j=1,nscp_gr(i))
do iint=1,nscp_gr(i)
do j=iscpstart(i,iint),iscpend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
endif
C 24/11/03 AL: SS bridges handled separately because of introducing a specific
C distance and angle dependent SS bond potential.
- if (ii.gt.nres .and. itype(iii).eq.1 .and. itype(jjj).eq.1) then
+ if (ii.gt.nres .and. iabs(itype(iii)).eq.1 .and.
+ & iabs(itype(jjj)).eq.1) then
call ssbond_ene(iii,jjj,eij)
ehpb=ehpb+2*eij
else
include 'COMMON.VAR'
include 'COMMON.IOUNITS'
double precision erij(3),dcosom1(3),dcosom2(3),gg(3)
- itypi=itype(i)
+ itypi=iabs(itype(i))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
dyi=dc_norm(2,nres+i)
dzi=dc_norm(3,nres+i)
dsci_inv=dsc_inv(itypi)
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=dsc_inv(itypj)
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
logical energy_dec /.false./
double precision u(3),ud(3)
estr=0.0d0
+ estr1=0.0d0
do i=nnt+1,nct
- if (itype(i-1).eq.21 .or. itype(i).eq.21) then
+ if (itype(i-1).eq.ntyp1 .or. itype(i).eq.ntyp1) then
estr1=estr1+gnmr1(vbld(i),-1.0d0,distchainmax)
do j=1,3
gradb(j,i-1)=gnmr1prim(vbld(i),-1.0d0,distchainmax)
endif
enddo
- estr=0.5d0*AKP*estr
+ estr=0.5d0*AKP*estr+estr1
c
c 09/18/07 AL: multimodal bond potential based on AM1 CA-SC PMF's included
c
do i=nnt,nct
- iti=itype(i)
- if (iti.ne.10 .and. iti.ne.21) then
+ iti=iabs(itype(i))
+ if (iti.ne.10 .and. iti.ne.ntyp1) then
nbi=nbondterm(iti)
if (nbi.eq.1) then
diff=vbld(i+nres)-vbldsc0(1,iti)
c write (*,'(a,i2)') 'EBEND ICG=',icg
c write (iout,*) ithet_start,ithet_end
do i=ithet_start,ithet_end
- if (itype(i-1).eq.21) cycle
+ if (itype(i-1).eq.ntyp1) cycle
C Zero the energy function and its derivative at 0 or pi.
call splinthet(theta(i),0.5d0*delta,ss,ssd)
it=itype(i-1)
- if (i.gt.3 .and. itype(i-2).ne.21) then
+ ichir1=isign(1,itype(i-2))
+ ichir2=isign(1,itype(i))
+ if (itype(i-2).eq.10) ichir1=isign(1,itype(i-1))
+ if (itype(i).eq.10) ichir2=isign(1,itype(i-1))
+ if (itype(i-1).eq.10) then
+ itype1=isign(10,itype(i-2))
+ ichir11=isign(1,itype(i-2))
+ ichir12=isign(1,itype(i-2))
+ itype2=isign(10,itype(i))
+ ichir21=isign(1,itype(i))
+ ichir22=isign(1,itype(i))
+ endif
+ if (i.gt.3 .and. itype(i-2).ne.ntyp1) then
#ifdef OSF
phii=phi(i)
icrc=0
y(1)=0.0D0
y(2)=0.0D0
endif
- if (i.lt.nres .and. itype(i).ne.21) then
+ if (i.lt.nres .and. itype(i).ne.ntyp1) then
#ifdef OSF
phii1=phi(i+1)
icrc=0
C In following comments this theta will be referred to as t_c.
thet_pred_mean=0.0d0
do k=1,2
- athetk=athet(k,it)
- bthetk=bthet(k,it)
+ athetk=athet(k,it,ichir1,ichir2)
+ bthetk=bthet(k,it,ichir1,ichir2)
+ if (it.eq.10) then
+ athetk=athet(k,itype1,ichir11,ichir12)
+ bthetk=bthet(k,itype2,ichir21,ichir22)
+ endif
thet_pred_mean=thet_pred_mean+athetk*y(k)+bthetk*z(k)
enddo
c write (iout,*) "thet_pred_mean",thet_pred_mean
thet_pred_mean=thet_pred_mean*ss+a0thet(it)
c write (iout,*) "thet_pred_mean",thet_pred_mean
C Derivatives of the "mean" values in gamma1 and gamma2.
- dthetg1=(-athet(1,it)*y(2)+athet(2,it)*y(1))*ss
- dthetg2=(-bthet(1,it)*z(2)+bthet(2,it)*z(1))*ss
+ dthetg1=(-athet(1,it,ichir1,ichir2)*y(2)
+ &+athet(2,it,ichir1,ichir2)*y(1))*ss
+ dthetg2=(-bthet(1,it,ichir1,ichir2)*z(2)
+ & +bthet(2,it,ichir1,ichir2)*z(1))*ss
+ if (it.eq.10) then
+ dthetg1=(-athet(1,itype1,ichir11,ichir12)*y(2)
+ &+athet(2,itype1,ichir11,ichir12)*y(1))*ss
+ dthetg2=(-bthet(1,itype2,ichir21,ichir22)*z(2)
+ & +bthet(2,itype2,ichir21,ichir22)*z(1))*ss
+ endif
if (theta(i).gt.pi-delta) then
call theteng(pi-delta,thet_pred_mean,theta0(it),f0,fprim0,
& E_tc0)
etheta=0.0D0
c write (iout,*) "ithetyp",(ithetyp(i),i=1,ntyp1)
do i=ithet_start,ithet_end
- if (itype(i-1).eq.21) cycle
+ if (itype(i-1).eq.ntyp1) cycle
+ if (iabs(itype(i+1)).eq.20) iblock=2
+ if (iabs(itype(i+1)).ne.20) iblock=1
dethetai=0.0d0
dephii=0.0d0
dephii1=0.0d0
theti2=0.5d0*theta(i)
- ityp2=ithetyp(itype(i-1))
+CC Ta zmina jest niewlasciwa
+ ityp2=ithetyp((itype(i-1)))
do k=1,nntheterm
coskt(k)=dcos(k*theti2)
sinkt(k)=dsin(k*theti2)
enddo
- if (i.gt.3 .and. itype(i-2).ne.21) then
+ if (i.gt.3 .and. itype(i-2).ne.ntyp1) then
#ifdef OSF
phii=phi(i)
if (phii.ne.phii) phii=150.0
#else
phii=phi(i)
#endif
- ityp1=ithetyp(itype(i-2))
+ ityp1=ithetyp((itype(i-2)))
do k=1,nsingle
cosph1(k)=dcos(k*phii)
sinph1(k)=dsin(k*phii)
sinph1(k)=0.0d0
enddo
endif
- if (i.lt.nres .and. itype(i).ne.21) then
+ if (i.lt.nres .and. itype(i).ne.ntyp1) then
#ifdef OSF
phii1=phi(i+1)
if (phii1.ne.phii1) phii1=150.0
#else
phii1=phi(i+1)
#endif
- ityp3=ithetyp(itype(i))
+ ityp3=ithetyp((itype(i)))
do k=1,nsingle
cosph2(k)=dcos(k*phii1)
sinph2(k)=dsin(k*phii1)
c write (iout,*) "i",i," ityp1",itype(i-2),ityp1,
c & " ityp2",itype(i-1),ityp2," ityp3",itype(i),ityp3
c call flush(iout)
- ethetai=aa0thet(ityp1,ityp2,ityp3)
+ ethetai=aa0thet(ityp1,ityp2,ityp3,iblock)
do k=1,ndouble
do l=1,k-1
ccl=cosph1(l)*cosph2(k-l)
enddo
endif
do k=1,ntheterm
- ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3)*sinkt(k)
- dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3)
+ ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3,iblock)*sinkt(k)
+ dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3,iblock)
& *coskt(k)
if (lprn)
- & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3),
+ & write (iout,*) "k",k," aathet",
+ & aathet(k,ityp1,ityp2,ityp3,iblock),
& " ethetai",ethetai
enddo
if (lprn) then
endif
do m=1,ntheterm2
do k=1,nsingle
- aux=bbthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)
- & +ccthet(k,m,ityp1,ityp2,ityp3)*sinph1(k)
- & +ddthet(k,m,ityp1,ityp2,ityp3)*cosph2(k)
- & +eethet(k,m,ityp1,ityp2,ityp3)*sinph2(k)
+ aux=bbthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)
+ & +ccthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k)
+ & +ddthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)
+ & +eethet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*aux*coskt(m)
dephii=dephii+k*sinkt(m)*(
- & ccthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)-
- & bbthet(k,m,ityp1,ityp2,ityp3)*sinph1(k))
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)-
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k))
dephii1=dephii1+k*sinkt(m)*(
- & eethet(k,m,ityp1,ityp2,ityp3)*cosph2(k)-
- & ddthet(k,m,ityp1,ityp2,ityp3)*sinph2(k))
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)-
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k))
if (lprn)
& write (iout,*) "m",m," k",k," bbthet",
- & bbthet(k,m,ityp1,ityp2,ityp3)," ccthet",
- & ccthet(k,m,ityp1,ityp2,ityp3)," ddthet",
- & ddthet(k,m,ityp1,ityp2,ityp3)," eethet",
- & eethet(k,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)," ccthet",
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)," ddthet",
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)," eethet",
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)," ethetai",ethetai
enddo
enddo
if (lprn)
do m=1,ntheterm3
do k=2,ndouble
do l=1,k-1
- aux=ffthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)
+ aux=ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*coskt(m)*aux
dephii=dephii+l*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)-
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)-
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
dephii1=dephii1+(k-l)*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)-
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)-
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
if (lprn) then
write (iout,*) "m",m," k",k," l",l," ffthet",
- & ffthet(l,k,m,ityp1,ityp2,ityp3),
- & ffthet(k,l,m,ityp1,ityp2,ityp3)," ggthet",
- & ggthet(l,k,m,ityp1,ityp2,ityp3),
- & ggthet(k,l,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & ffthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ggthet",
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock),
+ & " ethetai",ethetai
write (iout,*) cosph1ph2(l,k)*sinkt(m),
& cosph1ph2(k,l)*sinkt(m),
& sinph1ph2(l,k)*sinkt(m),sinph1ph2(k,l)*sinkt(m)
c write (iout,'(a)') 'ESC'
do i=loc_start,loc_end
it=itype(i)
- if (it.eq.21) cycle
+ if (it.eq.ntyp1) cycle
if (it.eq.10) goto 1
- nlobit=nlob(it)
+ nlobit=nlob(iabs(it))
c print *,'i=',i,' it=',it,' nlobit=',nlobit
c write (iout,*) 'i=',i,' ssa=',ssa,' ssad=',ssad
theti=theta(i+1)-pipol
do iii=-1,1
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j,iii)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j,iii)+emin)
cd print *,'j=',j,' expfac=',expfac
escloc_i=escloc_i+expfac
do k=1,3
dersc12=0.0d0
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j)+emin)
escloc_i=escloc_i+expfac
do k=1,2
dersc(k)=dersc(k)+Ax(k,j)*expfac
delta=0.02d0*pi
escloc=0.0D0
do i=loc_start,loc_end
- if (itype(i).eq.21) cycle
+ if (itype(i).eq.ntyp1) cycle
costtab(i+1) =dcos(theta(i+1))
sinttab(i+1) =dsqrt(1-costtab(i+1)*costtab(i+1))
cost2tab(i+1)=dsqrt(0.5d0*(1.0d0+costtab(i+1)))
cosfac=dsqrt(cosfac2)
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
- it=itype(i)
+ it=iabs(itype(i))
if (it.eq.10) goto 1
c
C Compute the axes of tghe local cartesian coordinates system; store in
y_prime(j) = (dc_norm(j,i) + dc_norm(j,i-1))*sinfac
enddo
do j = 1,3
- z_prime(j) = -uz(j,i-1)
+ z_prime(j) = -uz(j,i-1)*dsign(1.0d0,dfloat(itype(i)))
enddo
c write (2,*) "i",i
c write (2,*) "x_prime",(x_prime(j),j=1,3)
C Compute the energy of the ith side cbain
C
c write (2,*) "xx",xx," yy",yy," zz",zz
- it=itype(i)
+ it=iabs(itype(i))
do j = 1,65
x(j) = sc_parmin(j,it)
enddo
dZZ_Ci1(k)=0.0d0
dZZ_Ci(k)=0.0d0
do j=1,3
- dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)*dC_norm(j,i+nres)
- dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)*dC_norm(j,i+nres)
+ dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+ dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
enddo
dXX_XYZ(k)=vbld_inv(i+nres)*(x_prime(k)-xx*dC_norm(k,i+nres))
c lprn=.true.
etors=0.0D0
do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1) cycle
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
c lprn=.true.
etors=0.0D0
do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1) cycle
if (itel(i-2).eq.0 .or. itel(i-1).eq.0) goto 1215
+ if (iabs(itype(i)).eq.20) then
+ iblock=2
+ else
+ iblock=1
+ endif
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
gloci=0.0D0
C Regular cosine and sine terms
- do j=1,nterm(itori,itori1)
- v1ij=v1(j,itori,itori1)
- v2ij=v2(j,itori,itori1)
+ do j=1,nterm(itori,itori1,iblock)
+ v1ij=v1(j,itori,itori1,iblock)
+ v2ij=v2(j,itori,itori1,iblock)
cosphi=dcos(j*phii)
sinphi=dsin(j*phii)
etors=etors+v1ij*cosphi+v2ij*sinphi
C
cosphi=dcos(0.5d0*phii)
sinphi=dsin(0.5d0*phii)
- do j=1,nlor(itori,itori1)
+ do j=1,nlor(itori,itori1,iblock)
vl1ij=vlor1(j,itori,itori1)
vl2ij=vlor2(j,itori,itori1)
vl3ij=vlor3(j,itori,itori1)
gloci=gloci+vl1ij*(vl3ij*cosphi-vl2ij*sinphi)*pom
enddo
C Subtract the constant term
- etors=etors-v0(itori,itori1)
+ etors=etors-v0(itori,itori1,iblock)
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1(j,itori,itori1),j=1,6),(v2(j,itori,itori1),j=1,6)
+ & (v1(j,itori,itori1,1),j=1,6),(v2(j,itori,itori1,1),j=1,6)
gloc(i-3,icg)=gloc(i-3,icg)+wtor*fact*gloci
c write (iout,*) 'i=',i,' gloc=',gloc(i-3,icg)
1215 continue
c lprn=.true.
etors_d=0.0D0
do i=iphi_start,iphi_end-1
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
if (itel(i-2).eq.0 .or. itel(i-1).eq.0 .or. itel(i).eq.0)
& goto 1215
itori=itortyp(itype(i-2))
phii1=phi(i+1)
gloci1=0.0D0
gloci2=0.0D0
+ iblock=1
+ if (iabs(itype(i+1)).eq.20) iblock=2
C Regular cosine and sine terms
- do j=1,ntermd_1(itori,itori1,itori2)
- v1cij=v1c(1,j,itori,itori1,itori2)
- v1sij=v1s(1,j,itori,itori1,itori2)
- v2cij=v1c(2,j,itori,itori1,itori2)
- v2sij=v1s(2,j,itori,itori1,itori2)
+ do j=1,ntermd_1(itori,itori1,itori2,iblock)
+ v1cij=v1c(1,j,itori,itori1,itori2,iblock)
+ v1sij=v1s(1,j,itori,itori1,itori2,iblock)
+ v2cij=v1c(2,j,itori,itori1,itori2,iblock)
+ v2sij=v1s(2,j,itori,itori1,itori2,iblock)
cosphi1=dcos(j*phii)
sinphi1=dsin(j*phii)
cosphi2=dcos(j*phii1)
gloci1=gloci1+j*(v1sij*cosphi1-v1cij*sinphi1)
gloci2=gloci2+j*(v2sij*cosphi2-v2cij*sinphi2)
enddo
- do k=2,ntermd_2(itori,itori1,itori2)
+ do k=2,ntermd_2(itori,itori1,itori2,iblock)
do l=1,k-1
- v1cdij = v2c(k,l,itori,itori1,itori2)
- v2cdij = v2c(l,k,itori,itori1,itori2)
- v1sdij = v2s(k,l,itori,itori1,itori2)
- v2sdij = v2s(l,k,itori,itori1,itori2)
+ v1cdij = v2c(k,l,itori,itori1,itori2,iblock)
+ v2cdij = v2c(l,k,itori,itori1,itori2,iblock)
+ v1sdij = v2s(k,l,itori,itori1,itori2,iblock)
+ v2sdij = v2s(l,k,itori,itori1,itori2,iblock)
cosphi1p2=dcos(l*phii+(k-l)*phii1)
cosphi1m2=dcos(l*phii-(k-l)*phii1)
sinphi1p2=dsin(l*phii+(k-l)*phii1)
c lprn=.true.
c write (iout,*) "EBACK_SC_COR",iphi_start,iphi_end,nterm_sccor
esccor=0.0D0
- do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21) cycle
+ do i=itau_start,itau_end
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1) cycle
esccor_ii=0.0D0
- itori=itype(i-2)
- itori1=itype(i-1)
+ isccori=isccortyp(itype(i-2))
+ isccori1=isccortyp(itype(i-1))
phii=phi(i)
+ do intertyp=1,3 !intertyp
+cc Added 09 May 2012 (Adasko)
+cc Intertyp means interaction type of backbone mainchain correlation:
+c 1 = SC...Ca...Ca...Ca
+c 2 = Ca...Ca...Ca...SC
+c 3 = SC...Ca...Ca...SCi
gloci=0.0D0
- do j=1,nterm_sccor
- v1ij=v1sccor(j,itori,itori1)
- v2ij=v2sccor(j,itori,itori1)
- cosphi=dcos(j*phii)
- sinphi=dsin(j*phii)
- esccor=esccor+v1ij*cosphi+v2ij*sinphi
- gloci=gloci+j*(v2ij*cosphi-v1ij*sinphi)
- enddo
+ if (((intertyp.eq.3).and.((itype(i-2).eq.10).or.
+ & (itype(i-1).eq.10).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-1).eq.ntyp1)))
+ & .or. ((intertyp.eq.1).and.((itype(i-2).eq.10)
+ & .or.(itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)
+ & .or.(itype(i).eq.ntyp1)))
+ & .or.((intertyp.eq.2).and.((itype(i-1).eq.10).or.
+ & (itype(i-1).eq.ntyp1).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-3).eq.ntyp1)))) cycle
+ if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.ntyp1)) cycle
+ if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.ntyp1))
+ & cycle
+ do j=1,nterm_sccor(isccori,isccori1)
+ v1ij=v1sccor(j,intertyp,isccori,isccori1)
+ v2ij=v2sccor(j,intertyp,isccori,isccori1)
+ cosphi=dcos(j*tauangle(intertyp,i))
+ sinphi=dsin(j*tauangle(intertyp,i))
+ esccor=esccor+v1ij*cosphi+v2ij*sinphi
+c gloci=gloci+j*(v2ij*cosphi-v1ij*sinphi)
+ enddo
+c write (iout,*) "EBACK_SC_COR",i,esccor,intertyp
+c gloc_sc(intertyp,i-3)=gloc_sc(intertyp,i-3)+wsccor*gloci
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1sccor(j,itori,itori1),j=1,6),(v2sccor(j,itori,itori1),j=1,6)
+ & (v1sccor(j,1,itori,itori1),j=1,6),
+ & (v2sccor(j,1,itori,itori1),j=1,6)
gsccor_loc(i-3)=gloci
+ enddo !intertyp
enddo
return
end
ires=0
do i=nnt,nct
iti=itype(i)
- if (iti.eq.21) then
+ if (iti.eq.ntyp1) then
ichain=ichain+1
ires=0
write (ipdb,'(a)') 'TER'
enddo
write (ipdb,'(a)') 'TER'
do i=nnt,nct-1
- if (itype(i).eq.21) cycle
- if (itype(i).eq.10 .and. itype(i+1).ne.21) then
+ if (itype(i).eq.ntyp1) cycle
+ if (itype(i).eq.10 .and. itype(i+1).ne.ntyp1) then
write (ipdb,30) ica(i),ica(i+1)
- else if (itype(i).ne.10 .and. itype(i+1).ne.21) then
+ else if (itype(i).ne.10 .and. itype(i+1).ne.ntyp1) then
write (ipdb,30) ica(i),ica(i+1),ica(i)+1
- else if (itype(i).ne.10 .and. itype(i+1).eq.21) then
+ else if (itype(i).ne.10 .and. itype(i+1).eq.ntyp1) then
write (ipdb,30) ica(i),ica(i)+1
endif
enddo
& rs0(ntyp,ntyp),chi(ntyp,ntyp),chip(ntyp),chip0(ntyp),alp(ntyp),
& sigma0(ntyp),sigii(ntyp),rr0(ntyp),r0(ntyp,ntyp),r0e(ntyp,ntyp),
& r0d(ntyp,2),rpp(2,2),epp(2,2),elpp6(2,2),elpp3(2,2),
- & eps_scp(20,2),rscp(20,2),eps_orig(ntyp,ntyp)
+ & eps_scp(ntyp,2),rscp(ntyp,2),eps_orig(ntyp,ntyp)
c 12/5/03 modified 09/18/03 Bond stretching parameters.
double precision vbldp0,vbldsc0,akp,aksc,abond0,distchainmax
integer nbondterm
integer nlob,loc_start,loc_end,ithet_start,ithet_end,
& iphi_start,iphi_end
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp),
+ & bthet(2,-ntyp:ntyp),
+ & polthet(0:3,-ntyp:ntyp),gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),
+ & sig0(-ntyp:ntyp),
+ & sigc0(-ntyp:ntyp)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
- & ithetyp(ntyp1),nntheterm
- double precision aa0thet(maxthetyp1,maxthetyp1,maxthetyp1),
- & aathet(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1),
- & bbthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ccthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ddthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & eethet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ffthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1),
- & ggthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1)
- common /theta_abinitio/aa0thet,aathet,bbthet,ccthet,ddthet,eethet,
+ & ithetyp(-ntyp:ntyp1),nntheterm
+C Parameters of ab initio-derived potential of virtual-bond-angle bending
+ integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
+ & ithetyp(-ntyp1:ntyp1),nntheterm
+ double precision aa0thet(-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & aathet(maxtheterm,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & bbthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ccthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ddthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & eethet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ffthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2),
+ & ggthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2)
+ common /theta_abinitio/aa0thet,aathet,bbthet,ccthet,ddthet,eethet,
& ffthet,
& ggthet,ithetyp,nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,
& ndouble,nntheterm
+++ /dev/null
- character*3 restyp
- character*1 onelet
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
- character*10 ename,wname
- integer nprint_ene,print_order
- common /namterm/ ename(max_ene),wname(max_ene),nprint_ene,
- & print_order(max_ene)
C Parameters of the SCCOR term
double precision v1sccor,v2sccor
integer nterm_sccor
- common/torsion/v1sccor(maxterm_sccor,20,20),
- & v2sccor(maxterm_sccor,20,20),
+ common/torsion/v1sccor(maxterm_sccor,ntyp,ntyp),
+ & v2sccor(maxterm_sccor,ntyp,ntyp),
& nterm_sccor
C Parameters of the SC rotamers (local) term
double precision sc_parmin
- common/scrot/sc_parmin(maxsccoef,20)
+ common/scrot/sc_parmin(maxsccoef,ntyp)
& epp_low(2,2),epp_up(2,2),rpp_low(2,2),rpp_up(2,2),
& elpp6_low(2,2),elpp6_up(2,2),elpp3_low(2,2),elpp3_up(2,2),
& b_low(13,3),b_up(13,3),x_up(max_paropt),x_low(max_paropt),
- & epscp_low(0:20,2),epscp_up(0:20,2),rscp_low(0:20,2),
- & rscp_up(0:20,2),epss_low(ntyp),epss_up(ntyp),epsp_low(nntyp),
+ & epscp_low(0:ntyp,2),epscp_up(0:ntyp,2),rscp_low(0:ntyp,2),
+ & rscp_up(0:ntyp,2),epss_low(ntyp),epss_up(ntyp),epsp_low(nntyp),
& epsp_up(nntyp),
& xm(max_paropt,0:maxprot),xm1(max_paropt,0:maxprot),
& xm2(max_paropt,0:maxprot),
& imask(max_ene),nsingle_sc,npair_sc,ityp_ssc(ntyp),
& ityp_psc(2,nntyp),mask_elec(2,2,4),
& mask_fourier(13,3),
- & mask_scp(0:20,2,2),mod_other_params,mod_fourier(0:3),
+ & mask_scp(0:ntyp,2,2),mod_other_params,mod_fourier(0:3),
& mod_elec,mod_scp,mod_side,indz(maxbatch+1,maxprot),iw(max_ene)
include 'COMMON.NAMES'
include 'COMMON.FFIELD'
data restyp /
+ &'DD','DAU','DAI','DDB','DSM','DPR','DLY','DAR','DHI','DAS','DGL',
+ & 'DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
- &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
+ &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','SME','DBZ',
+ &'AIB','ABU','D'/
data onelet /
+ &'z','z','z','z','z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
- &'S','Q','N','E','D','H','R','K','P','X'/
+ &'S','Q','N','E','D','H','R','K','P','z','z','z','z','X'/
+ data potname /'LJ','LJK','BP','GB','GBV'/
data potname /'LJ','LJK','BP','GB','GBV'/
end
rr0(i)=0.0D0
a0thet(i)=0.0D0
do j=1,2
- athet(j,i)=0.0D0
- bthet(j,i)=0.0D0
+ do ichir1=-1,1
+ do ichir2=-1,1
+ athet(j,i,ichir1,ichir2)=0.0D0
+ bthet(j,i,ichir1,ichir2)=0.0D0
+ enddo
+ enddo
enddo
do j=0,3
polthet(j,i)=0.0D0
enddo
nlob(ntyp1)=0
dsc(ntyp1)=0.0D0
- do i=1,maxtor
+ do i=-maxtor,maxtor
itortyp(i)=0
- do j=1,maxtor
- do k=1,maxterm
- v1(k,j,i)=0.0D0
- v2(k,j,i)=0.0D0
- enddo
- enddo
+ do iblock=1,2
+ do j=-maxtor,maxtor
+ do k=1,maxterm
+ v1(k,j,i,iblock)=0.0D0
+ v2(k,j,i,iblock)=0.0D0
+ enddo
+ enddo
+ enddo
enddo
+ do iblock=1,2
+ do i=-maxtor,maxtor
+ do j=-maxtor,maxtor
+ do k=-maxtor,maxtor
+ do l=1,maxtermd_1
+ v1c(1,l,i,j,k,iblock)=0.0D0
+ v1s(1,l,i,j,k,iblock)=0.0D0
+ v1c(2,l,i,j,k,iblock)=0.0D0
+ v1s(2,l,i,j,k,iblock)=0.0D0
+ enddo !l
+ do l=1,maxtermd_2
+ do m=1,maxtermd_2
+ v2c(m,l,i,j,k,iblock)=0.0D0
+ v2s(m,l,i,j,k,iblock)=0.0D0
+ enddo !m
+ enddo !l
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
do i=1,maxres
itype(i)=0
itel(i)=0
include 'COMMON.NAMES'
include 'COMMON.FFIELD'
data restyp /
+ &'DD','DAU','DAI','DDB','DSM','DPR','DLY','DAR','DHI','DAS','DGL',
+ & 'DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
- &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
+ &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','SME','DBZ',
+ &'AIB','ABU','D'/
data onelet /
+ &'z','z','z','z','z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
- &'S','Q','N','E','D','H','R','K','P','X'/
+ &'S','Q','N','E','D','H','R','K','P','z','z','z','z','X'/
data potname /'LJ','LJK','BP','GB','GBV'/
data ename /
& "EVDW SC-SC","EVDW2 SC-p","EES p-p","ECORR4 ","ECORR5 ",
call int_bounds(nct-nnt-2,iphi_start,iphi_end)
iphi_start=iphi_start+nnt+2
iphi_end=iphi_end+nnt+2
+ call int_bounds(nres-3,itau_start,itau_end)
+ itau_start=itau_start+3
+ itau_end=itau_end+3
if (lprint) then
write (iout,*) 'Processor:',MyID,
& ' loc_start',loc_start,' loc_end',loc_end,
ithet_end=nres
iphi_start=nnt+3
iphi_end=nct
+ itau_start=4
+ itau_end=nres
#endif
return
end
enddo
be=0.0D0
if (i.gt.2) phi(i+1)=beta(i-2,i-1,i,i+1)
+ if (i.gt.2) tauangle(3,i+1)=beta(i+nres-1,i-1,i,i+nres)
+ if (i.gt.2) tauangle(1,i+1)=beta(i-1+nres,i-1,i,i+1)
+ if (i.gt.2) tauangle(2,i+1)=beta(i-2,i-1,i,i+nres)
omeg(i)=beta(nres+i,i,maxres2,i+1)
theta(i+1)=alpha(i-1,i,i+1)
alph(i)=alpha(nres+i,i,maxres2)
DIMENSION NN(maxconf),DISNN(maxconf)
LOGICAL FLAG(maxconf)
integer i,j,k,l,m,n,len,lev,idum,ii,ind,ioffset,jj,icut,ncon,
- & it,ncon_work,ind1
+ & it,ncon_work,ind1,kkk
double precision t1,t2,tcpu,difconf
double precision varia(maxvar)
c(l,k)=allcart(l,k,i)
enddo
enddo
+ kkk=1
do k=1,nres
do l=1,3
- cref(l,k)=c(l,k)
+ cref(l,k,kkk)=c(l,k)
enddo
enddo
DO J=I+1,NCON_work
ibezperm=(run-1)*chalen+i
do j=1,3
xx(j,ii)=allcart(j,iaperm,jcon)
- yy(j,ii)=cref(j,ibezperm)
+ yy(j,ii)=cref(j,ibezperm,kkk)
enddo
enddo
enddo
ii=ii+1
do j=1,3
xx(j,ii)=allcart(j,iaperm+nres,jcon)
- yy(j,ii)=cref(j,ibezperm+nres)
+ yy(j,ii)=cref(j,ibezperm+nres,kkk)
enddo
enddo
c endif
enddo
enddo
enddo
- call fitsq(rms,c(1,nstart),cref(1,nstart),nend-nstart+1,przes,
+ call fitsq(rms,c(1,nstart),cref(1,nstart,kkk),nend-nstart+1,
+ & przes,
& obrot,non_conv)
endif
if (rms.lt.0.0) then
include 'COMMON.SCCOR'
include 'COMMON.SCROT'
character*1 t1,t2,t3
- character*1 onelett(4) /"G","A","P","D"/
+ character*1 onelett(-2:2) /"p","a","G","A","P"/
logical lprint
dimension blower(3,3,maxlob)
double precision ip,mp
C of the virtual-bond valence angles theta
C
do i=1,ntyp
- read (ithep,*) a0thet(i),(athet(j,i),j=1,2),(bthet(j,i),j=1,2)
+ read (ithep,*) a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
read (ithep,*) (polthet(j,i),j=0,3)
read (ithep,*) (gthet(j,i),j=1,3)
read (ithep,*) theta0(i),sig0(i),sigc0(i)
sigc0(i)=sigc0(i)**2
enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
+ enddo
close (ithep)
if (lprint) then
c write (iout,'(a)')
& ' b1*10^1 ',' b2*10^1 '
do i=1,ntyp
write(iout,'(a3,1h&,2x,5(f8.3,1h&))') restyp(i),
- & a0thet(i),(100*athet(j,i),j=1,2),(10*bthet(j,i),j=1,2)
+ & a0thet(i),(100*athet(j,i,1,1),j=1,2),
+ & (10*bthet(j,i,1,1),j=1,2)
enddo
write (iout,'(/a/9x,5a/79(1h-))')
& 'Parameters of the expression for sigma(theta_c):',
& ntheterm3,nsingle,ndouble
nntheterm=max0(ntheterm,ntheterm2,ntheterm3)
read (ithep,*) (ithetyp(i),i=1,ntyp1)
- do i=1,maxthetyp
- do j=1,maxthetyp
- do k=1,maxthetyp
- aa0thet(i,j,k)=0.0d0
+ do i=-ntyp1,-1
+ ithetyp(i)=-ithetyp(-i)
+ enddo
+ do iblock=1,2
+ do i=-maxthetyp,maxthetyp
+ do j=-maxthetyp,maxthetyp
+ do k=-maxthetyp,maxthetyp
+ aa0thet(i,j,k,iblock)=0.0d0
do l=1,ntheterm
- aathet(l,i,j,k)=0.0d0
+ aathet(l,i,j,k,iblock)=0.0d0
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=0.0d0
- ccthet(m,l,i,j,k)=0.0d0
- ddthet(m,l,i,j,k)=0.0d0
- eethet(m,l,i,j,k)=0.0d0
+ bbthet(m,l,i,j,k,iblock)=0.0d0
+ ccthet(m,l,i,j,k,iblock)=0.0d0
+ ddthet(m,l,i,j,k,iblock)=0.0d0
+ eethet(m,l,i,j,k,iblock)=0.0d0
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=0.0d0
- ggthet(mm,m,l,i,j,k)=0.0d0
+ ffthet(mm,m,l,i,j,k,iblock)=0.0d0
+ ggthet(mm,m,l,i,j,k,iblock)=0.0d0
enddo
enddo
enddo
enddo
enddo
enddo
- do i=1,nthetyp
- do j=1,nthetyp
- do k=1,nthetyp
- read (ithep,'(3a)') res1,res2,res3
- read (ithep,*) aa0thet(i,j,k)
- read (ithep,*)(aathet(l,i,j,k),l=1,ntheterm)
+ enddo
+ do iblock=1,2
+ do i=0,nthetyp
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ read (ithep,'(6a)') res1
+ read (ithep,*) aa0thet(i,j,k,iblock)
+ read (ithep,*)(aathet(l,i,j,k,iblock),l=1,ntheterm)
read (ithep,*)
- & ((bbthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ccthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ddthet(lll,ll,i,j,k),lll=1,nsingle),
- & (eethet(lll,ll,i,j,k),lll=1,nsingle),ll=1,ntheterm2)
+ & ((bbthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ccthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ddthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (eethet(lll,ll,i,j,k,iblock),lll=1,nsingle)
+ & ,ll=1,ntheterm2)
read (ithep,*)
- & (((ffthet(llll,lll,ll,i,j,k),ffthet(lll,llll,ll,i,j,k),
- & ggthet(llll,lll,ll,i,j,k),ggthet(lll,llll,ll,i,j,k),
+ & (((ffthet(llll,lll,ll,i,j,k,iblock),
+ & ffthet(lll,llll,ll,i,j,k,iblock),
+ & ggthet(llll,lll,ll,i,j,k,iblock),
+ & ggthet(lll,llll,ll,i,j,k,iblock),
& llll=1,lll-1),lll=2,ndouble),ll=1,ntheterm3)
enddo
enddo
do i=1,nthetyp
do j=1,nthetyp
do l=1,ntheterm
- aathet(l,i,j,nthetyp+1)=aathet(l,i,j,1)
- aathet(l,nthetyp+1,i,j)=aathet(l,1,i,j)
+ aathet(l,i,j,nthetyp+1,iblock)=0.0d0
+ aathet(l,nthetyp+1,i,j,iblock)=0.0d0
enddo
- aa0thet(i,j,nthetyp+1)=aa0thet(i,j,1)
- aa0thet(nthetyp+1,i,j)=aa0thet(1,i,j)
+ aa0thet(i,j,nthetyp+1,iblock)=0.0d0
+ aa0thet(nthetyp+1,i,j,iblock)=0.0d0
enddo
do l=1,ntheterm
- aathet(l,nthetyp+1,i,nthetyp+1)=aathet(l,1,i,1)
+ aathet(l,nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
- aa0thet(nthetyp+1,i,nthetyp+1)=aa0thet(1,i,1)
+ aa0thet(nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
+ enddo
+C Substitution for D aminoacids from symmetry.
+ do iblock=1,2
+ do i=-nthetyp,0
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ aa0thet(i,j,k,iblock)=aa0thet(-i,-j,-k,iblock)
+ do l=1,ntheterm
+ aathet(l,i,j,k,iblock)=aathet(l,-i,-j,-k,iblock)
+ enddo
+ do ll=1,ntheterm2
+ do lll=1,nsingle
+ bbthet(lll,ll,i,j,k,iblock)=bbthet(lll,ll,-i,-j,-k,iblock)
+ ccthet(lll,ll,i,j,k,iblock)=-ccthet(lll,ll,-i,-j,-k,iblock)
+ ddthet(lll,ll,i,j,k,iblock)=ddthet(lll,ll,-i,-j,-k,iblock)
+ eethet(lll,ll,i,j,k,iblock)=-eethet(lll,ll,-i,-j,-k,iblock)
+ enddo
+ enddo
+ do ll=1,ntheterm3
+ do lll=2,ndouble
+ do llll=1,lll-1
+ ffthet(llll,lll,ll,i,j,k,iblock)=
+ & ffthet(llll,lll,ll,-i,-j,-k,iblock)
+ ffthet(lll,llll,ll,i,j,k,iblock)=
+ & ffthet(lll,llll,ll,-i,-j,-k,iblock)
+ ggthet(llll,lll,ll,i,j,k,iblock)=
+ & -ggthet(llll,lll,ll,-i,-j,-k,iblock)
+ ggthet(lll,llll,ll,i,j,k,iblock)=
+ & -ggthet(lll,llll,ll,-i,-j,-k,iblock)
+ enddo !ll
+ enddo !lll
+ enddo !llll
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
+
C
C Control printout of the coefficients of virtual-bond-angle potentials
C
write (iout,'(//4a)')
& 'Type ',onelett(i),onelett(j),onelett(k)
write (iout,'(//a,10x,a)') " l","a[l]"
- write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k)
+ write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k,iblock)
write (iout,'(i2,1pe15.5)')
- & (l,aathet(l,i,j,k),l=1,ntheterm)
+ & (l,aathet(l,i,j,k,iblock),l=1,ntheterm)
do l=1,ntheterm2
write (iout,'(//2h m,4(9x,a,3h[m,i1,1h]))')
& "b",l,"c",l,"d",l,"e",l
do m=1,nsingle
write (iout,'(i2,4(1pe15.5))') m,
- & bbthet(m,l,i,j,k),ccthet(m,l,i,j,k),
- & ddthet(m,l,i,j,k),eethet(m,l,i,j,k)
+ & bbthet(m,l,i,j,k,iblock),ccthet(m,l,i,j,k,iblock),
+ & ddthet(m,l,i,j,k,iblock),eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=2,ndouble
do n=1,m-1
write (iout,'(i1,1x,i1,4(1pe15.5))') n,m,
- & ffthet(n,m,l,i,j,k),ffthet(m,n,l,i,j,k),
- & ggthet(n,m,l,i,j,k),ggthet(m,n,l,i,j,k)
+ & ffthet(n,m,l,i,j,k,iblock),
+ & ffthet(m,n,l,i,j,k,iblock),
+ & ggthet(n,m,l,i,j,k,iblock),
+ & ggthet(m,n,l,i,j,k,iblock)
enddo
enddo
enddo
enddo
bsc(1,i)=0.0D0
read(irotam,*)(censc(k,1,i),k=1,3),((blower(k,l,1),l=1,k),k=1,3)
+ censc(1,1,-i)=censc(1,1,i)
+ censc(2,1,-i)=censc(2,1,i)
+ censc(3,1,-i)=-censc(3,1,i)
do j=2,nlob(i)
read (irotam,*) bsc(j,i)
read (irotam,*) (censc(k,j,i),k=1,3),
& ((blower(k,l,j),l=1,k),k=1,3)
+ censc(1,j,-i)=censc(1,j,i)
+ censc(2,j,-i)=censc(2,j,i)
+ censc(3,j,-i)=-censc(3,j,i)
+C BSC is amplitude of Gaussian
enddo
do j=1,nlob(i)
do k=1,3
enddo
gaussc(k,l,j,i)=akl
gaussc(l,k,j,i)=akl
+ if (((k.eq.3).and.(l.ne.3))
+ & .or.((l.eq.3).and.(k.ne.3))) then
+ gaussc(k,l,j,-i)=-akl
+ gaussc(l,k,j,-i)=-akl
+ else
+ gaussc(k,l,j,-i)=akl
+ gaussc(l,k,j,-i)=akl
+ endif
enddo
enddo
enddo
read (itorp,*) ntortyp
read (itorp,*) (itortyp(i),i=1,ntyp)
write (iout,*) 'ntortyp',ntortyp
- do i=1,ntortyp
- do j=1,ntortyp
- read (itorp,*) nterm(i,j),nlor(i,j)
+ do iblock=1,2
+ do i=-ntyp,-1
+ itortyp(i)=-itortyp(-i)
+ enddo
+c write (iout,*) 'ntortyp',ntortyp
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ read (itorp,*) nterm(i,j,iblock),
+ & nlor(i,j,iblock)
+ nterm(-i,-j,iblock)=nterm(i,j,iblock)
+ nlor(-i,-j,iblock)=nlor(i,j,iblock)
v0ij=0.0d0
si=-1.0d0
- do k=1,nterm(i,j)
- read (itorp,*) kk,v1(k,i,j),v2(k,i,j)
- v0ij=v0ij+si*v1(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ read (itorp,*) kk,v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
+ v1(k,-i,-j,iblock)=v1(k,i,j,iblock)
+ v2(k,-i,-j,iblock)=-v2(k,i,j,iblock)
+ v0ij=v0ij+si*v1(k,i,j,iblock)
si=-si
enddo
- do k=1,nlor(i,j)
- read (itorp,*) kk,vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
+ do k=1,nlor(i,j,iblock)
+ read (itorp,*) kk,vlor1(k,i,j),
+ & vlor2(k,i,j),vlor3(k,i,j)
v0ij=v0ij+vlor1(k,i,j)/(1+vlor3(k,i,j)**2)
enddo
- v0(i,j)=v0ij
+ v0(i,j,iblock)=v0ij
+ v0(-i,-j,iblock)=v0ij
enddo
enddo
+ enddo
close (itorp)
if (lprint) then
write (iout,'(/a/)') 'Torsional constants:'
do j=1,ntortyp
write (iout,*) 'ityp',i,' jtyp',j
write (iout,*) 'Fourier constants'
- do k=1,nterm(i,j)
- write (iout,'(2(1pe15.5))') v1(k,i,j),v2(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ write (iout,'(2(1pe15.5))') v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
enddo
write (iout,*) 'Lorenz constants'
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
write (iout,'(3(1pe15.5))')
& vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
enddo
C
C 6/23/01 Read parameters for double torsionals
C
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
read (itordp,'(3a1)') t1,t2,t3
if (t1.ne.onelett(i) .or. t2.ne.onelett(j)
& .or. t3.ne.onelett(k)) then
& i,j,k,t1,t2,t3
stop "Error in double torsional parameter file"
endif
- read (itordp,*) ntermd_1(i,j,k),ntermd_2(i,j,k)
- read (itordp,*) (v1c(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1c(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) ((v2c(l,m,i,j,k),v2c(m,l,i,j,k),
- & v2s(l,m,i,j,k),v2s(m,l,i,j,k),m=1,l-1),l=1,ntermd_2(i,j,k))
- enddo
- enddo
- enddo
+ read (itordp,*) ntermd_1(i,j,k,iblock),
+ & ntermd_2(i,j,k,iblock)
+ ntermd_1(-i,-j,-k,iblock)=ntermd_1(i,j,k,iblock)
+ ntermd_2(-i,-j,-k,iblock)=ntermd_2(i,j,k,iblock)
+ read (itordp,*) (v1c(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1c(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+C Martix of D parameters for one dimesional foureir series
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,-i,-j,-k,iblock)=v1c(1,l,i,j,k,iblock)
+ v1s(1,l,-i,-j,-k,iblock)=-v1s(1,l,i,j,k,iblock)
+ v1c(2,l,-i,-j,-k,iblock)=v1c(2,l,i,j,k,iblock)
+ v1s(2,l,-i,-j,-k,iblock)=-v1s(2,l,i,j,k,iblock)
+c write(iout,*) "whcodze" ,
+c & v1s(2,l,-i,-j,-k,iblock),v1s(2,l,i,j,k,iblock)
+ enddo
+ read (itordp,*) ((v2c(l,m,i,j,k,iblock),
+ & v2c(m,l,i,j,k,iblock),v2s(l,m,i,j,k,iblock),
+ & v2s(m,l,i,j,k,iblock),
+ & m=1,l-1),l=1,ntermd_2(i,j,k,iblock))
+C Martix of D parameters for two dimesional fourier series
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,l-1
+ v2c(l,m,-i,-j,-k,iblock)=v2c(l,m,i,j,k,iblock)
+ v2c(m,l,-i,-j,-k,iblock)=v2c(m,l,i,j,k,iblock)
+ v2s(l,m,-i,-j,-k,iblock)=-v2s(l,m,i,j,k,iblock)
+ v2s(m,l,-i,-j,-k,iblock)=-v2s(m,l,i,j,k,iblock)
+ enddo!m
+ enddo!l
+ enddo!k
+ enddo!j
+ enddo!i
+ enddo!iblock
if (lprint) then
write (iout,*)
write (iout,*) 'Constants for double torsionals'
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
write (iout,*) 'ityp',i,' jtyp',j,' ktyp',k,
- & ' nsingle',ntermd_1(i,j,k),' ndouble',ntermd_2(i,j,k)
+ & ' nsingle',ntermd_1(i,j,k,iblock),
+ & ' ndouble',ntermd_2(i,j,k,iblock)
write (iout,*)
write (iout,*) 'Single angles:'
- do l=1,ntermd_1(i,j,k)
- write (iout,'(i5,2f10.5,5x,2f10.5)') l,
- & v1c(1,l,i,j,k),v1s(1,l,i,j,k),
- & v1c(2,l,i,j,k),v1s(2,l,i,j,k)
+ do l=1,ntermd_1(i,j,k,iblock)
+ write (iout,'(i5,2f10.5,5x,2f10.5,5x,2f10.5)') l,
+ & v1c(1,l,i,j,k,iblock),v1s(1,l,i,j,k,iblock),
+ & v1c(2,l,i,j,k,iblock),v1s(2,l,i,j,k,iblock),
+ & v1s(1,l,-i,-j,-k,iblock),v1s(2,l,-i,-j,-k,iblock)
enddo
write (iout,*)
write (iout,*) 'Pairs of angles:'
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2c(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2c(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2s(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2s(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock)),
+ & (v2s(l,m,-i,-j,-k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
enddo
enddo
enddo
+ enddo
endif
#endif
C
-C 5/21/07 (AL) Read coefficients of the backbone-local sidechain-local
-C correlation energies.
-C
- read (isccor,*) nterm_sccor
- do i=1,20
- do j=1,20
- read (isccor,'(a)')
- do k=1,nterm_sccor
- read (isccor,*)
- & kk,v1sccor(k,i,j),v2sccor(k,i,j)
+C Read of Side-chain backbone correlation parameters
+C Modified 11 May 2012 by Adasko
+CCC
+ read (isccor,*) nsccortyp
+ read (isccor,*) (isccortyp(i),i=1,ntyp)
+ do i=-ntyp,-1
+ isccortyp(i)=-isccortyp(-i)
+ enddo
+ iscprol=isccortyp(20)
+c write (iout,*) 'ntortyp',ntortyp
+ maxinter=3
+cc maxinter is maximum interaction sites
+ do l=1,maxinter
+ do i=1,nsccortyp
+ do j=1,nsccortyp
+ read (isccor,*)
+ &nterm_sccor(i,j),nlor_sccor(i,j)
+ v0ijsccor=0.0d0
+ v0ijsccor1=0.0d0
+ v0ijsccor2=0.0d0
+ v0ijsccor3=0.0d0
+ si=-1.0d0
+ nterm_sccor(-i,j)=nterm_sccor(i,j)
+ nterm_sccor(-i,-j)=nterm_sccor(i,j)
+ nterm_sccor(i,-j)=nterm_sccor(i,j)
+ do k=1,nterm_sccor(i,j)
+ read (isccor,*) kk,v1sccor(k,l,i,j)
+ & ,v2sccor(k,l,i,j)
+ if (j.eq.iscprol) then
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)*0.5d0
+ & +v2sccor(k,l,i,j)*dsqrt(0.75d0)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)*0.5d0
+ & +v1sccor(k,l,i,j)*dsqrt(0.75d0)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ else
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ if (j.eq.isccortyp(10)) then
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=-v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ endif
+ endif
+ v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ v0ijsccor1=v0ijsccor+si*v1sccor(k,l,-i,j)
+ v0ijsccor2=v0ijsccor+si*v1sccor(k,l,i,-j)
+ v0ijsccor3=v0ijsccor+si*v1sccor(k,l,-i,-j)
+ si=-si
+ enddo
+ do k=1,nlor_sccor(i,j)
+ read (isccor,*) kk,vlor1sccor(k,i,j),
+ & vlor2sccor(k,i,j),vlor3sccor(k,i,j)
+ v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
+ &(1+vlor3sccor(k,i,j)**2)
enddo
+ v0sccor(l,i,j)=v0ijsccor
+ v0sccor(l,-i,j)=v0ijsccor1
+ v0sccor(l,i,-j)=v0ijsccor2
+ v0sccor(l,-i,-j)=v0ijsccor3
+ enddo
enddo
enddo
close (isccor)
if (lprint) then
write (iout,'(/a/)') 'Torsional constants of SCCORR:'
- do i=1,20
- do j=1,20
+ do i=1,nsccortyp
+ do j=1,nsccortyp
write (iout,*) 'ityp',i,' jtyp',j
- do k=1,nterm_sccor
- write (iout,'(2(1pe15.5))') v1sccor(k,i,j),v2sccor(k,i,j)
+ write (iout,*) 'Fourier constants'
+ do k=1,nterm_sccor(i,j)
+ write (iout,'(2(1pe15.5))')
+ & v1sccor(k,l,i,j),v2sccor(k,l,i,j)
+ enddo
+ write (iout,*) 'Lorenz constants'
+ do k=1,nlor_sccor(i,j)
+ write (iout,'(3(1pe15.5))')
+ & vlor1sccor(k,i,j),vlor2sccor(k,i,j),vlor3sccor(k,i,j)
enddo
enddo
enddo
C interaction energy of the Gly, Ala, and Pro prototypes.
C
read (ifourier,*) nloctyp
- do i=1,nloctyp
+ do i=0,nloctyp-1
read (ifourier,*)
read (ifourier,*) (b(ii,i),ii=1,13)
if (lprint) then
endif
B1(1,i) = b(3,i)
B1(2,i) = b(5,i)
+ B1(1,-i) = b(3,i)
+ B1(2,-i) = -b(5,i)
B1tilde(1,i) = b(3,i)
B1tilde(2,i) =-b(5,i)
+ B1tilde(1,-i) =-b(3,i)
+ B1tilde(2,-i) =b(5,i)
B2(1,i) = b(2,i)
B2(2,i) = b(4,i)
+ B2(1,-i) =b(2,i)
+ B2(2,-i) =-b(4,i)
CC(1,1,i)= b(7,i)
CC(2,2,i)=-b(7,i)
CC(2,1,i)= b(9,i)
CC(1,2,i)= b(9,i)
+ CC(1,1,-i)= b(7,i)
+ CC(2,2,-i)=-b(7,i)
+ CC(2,1,-i)=-b(9,i)
+ CC(1,2,-i)=-b(9,i)
Ctilde(1,1,i)=b(7,i)
Ctilde(1,2,i)=b(9,i)
Ctilde(2,1,i)=-b(9,i)
Ctilde(2,2,i)=b(7,i)
+ Ctilde(1,1,-i)=b(7,i)
+ Ctilde(1,2,-i)=-b(9,i)
+ Ctilde(2,1,-i)=b(9,i)
+ Ctilde(2,2,-i)=b(7,i)
DD(1,1,i)= b(6,i)
DD(2,2,i)=-b(6,i)
DD(2,1,i)= b(8,i)
DD(1,2,i)= b(8,i)
+ DD(1,1,-i)= b(6,i)
+ DD(2,2,-i)=-b(6,i)
+ DD(2,1,-i)=-b(8,i)
+ DD(1,2,-i)=-b(8,i)
Dtilde(1,1,i)=b(6,i)
Dtilde(1,2,i)=b(8,i)
Dtilde(2,1,i)=-b(8,i)
Dtilde(2,2,i)=b(6,i)
+ Dtilde(1,1,-i)=b(6,i)
+ Dtilde(1,2,-i)=-b(8,i)
+ Dtilde(2,1,-i)=b(8,i)
+ Dtilde(2,2,-i)=b(6,i)
EE(1,1,i)= b(10,i)+b(11,i)
EE(2,2,i)=-b(10,i)+b(11,i)
EE(2,1,i)= b(12,i)-b(13,i)
EE(1,2,i)= b(12,i)+b(13,i)
+ EE(1,1,-i)= b(10,i)+b(11,i)
+ EE(2,2,-i)=-b(10,i)+b(11,i)
+ EE(2,1,-i)=-b(12,i)+b(13,i)
+ EE(1,2,-i)=-b(12,i)-b(13,i)
enddo
if (lprint) then
do i=1,nloctyp
enddo
do j=nnt,nct
itj=itype(j)
- if (itype(j).ne.10 .and. (vbld(nres+j)-dsc(itj)).gt.2.0d0) then
+ if (itype(j).ne.10 .and. (vbld(nres+j)-dsc(iabs(itj))).gt.2.0d0)
+ & then
write (iout,*) "Conformation",jjj,jj+1
write (iout,*) "Bad CA-SC bond length",j," ",vbld(nres+j)
write (iout,*) "The Cartesian geometry is:"
else if (card(:3).eq.'TER') then
C End current chain
ires_old=ires+1
- itype(ires_old)=21
+ itype(ires_old)=ntyp1
ibeg=2
c write (iout,*) "Chain ended",ires,ishift,ires_old
call sccenter(ires,iii,sccor)
ishift=ires-1
if (res.ne.'GLY' .and. res.ne. 'ACE') then
ishift=ishift-1
- itype(1)=21
+ itype(1)=ntyp1
endif
c write (iout,*) "ires",ires," ibeg",ibeg," ishift",ishift
ibeg=0
nres=ires
do i=2,nres-1
c write (iout,*) i,itype(i)
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
c write (iout,*) "dummy",i,itype(i)
do j=1,3
c(j,i)=((c(j,i-1)+c(j,i+1))/2+2*c(j,i-1)-c(j,i-2))/2
nstart_sup=1
if (itype(nres).ne.10) then
nres=nres+1
- itype(nres)=21
+ itype(nres)=ntyp1
do j=1,3
dcj=c(j,nres-2)-c(j,nres-3)
c(j,nres)=c(j,nres-1)+dcj
c(j,nres+1)=c(j,1)
c(j,2*nres)=c(j,nres)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
nsup=nsup-1
nstart_sup=2
do j=1,3
enddo
c call chainbuild
C Copy the coordinates to reference coordinates
- do i=1,2*nres
+c do i=1,2*nres
+c do j=1,3
+c cref(j,i)=c(j,i)
+c enddo
+c enddo
+
+ kkk=1
+ lll=0
+ cou=1
+ do i=1,nres
+ lll=lll+1
+cc write (iout,*) "spraw lancuchy",(c(j,i),j=1,3)
+ if (i.gt.1) then
+ if ((itype(i-1).eq.ntyp1).and.(i.gt.2)) then
+ chain_length=lll-1
+ kkk=kkk+1
+c write (iout,*) "spraw lancuchy",(c(j,i),j=1,3)
+ lll=1
+ endif
+ endif
do j=1,3
- cref(j,i)=c(j,i)
+ cref(j,i,cou)=c(j,i)
+ cref(j,i+nres,cou)=c(j,i+nres)
+ if (i.le.nres) then
+ chain_rep(j,lll,kkk)=c(j,i)
+ chain_rep(j,lll+nres,kkk)=c(j,i+nres)
+ endif
+ enddo
+ enddo
+ do j=1,3
+ chain_rep(j,chain_length,symetr)=chain_rep(j,chain_length,1)
+ chain_rep(j,chain_length+nres,symetr)
+ &=chain_rep(j,chain_length+nres,1)
+ enddo
+
+ if (symetr.gt.1) then
+ call permut(symetr)
+ nperm=1
+ do i=1,symetr
+ nperm=nperm*i
+ enddo
+c do i=1,nperm
+c write(iout,*) "tabperm", (tabperm(i,kkk),kkk=1,4)
+c enddo
+ do i=1,nperm
+ cou=0
+ do kkk=1,symetr
+ icha=tabperm(i,kkk)
+c write (iout,*) i,icha
+ do lll=1,chain_length
+ cou=cou+1
+ if (cou.le.nres) then
+ do j=1,3
+ kupa=mod(lll,chain_length)
+ iprzes=(kkk-1)*chain_length+lll
+ if (kupa.eq.0) kupa=chain_length
+c write (iout,*) "kupa", kupa
+ cref(j,iprzes,i)=chain_rep(j,kupa,icha)
+ cref(j,iprzes+nres,i)=chain_rep(j,kupa+nres,icha)
+ enddo
+ endif
+ enddo
enddo
+ enddo
+ endif
+
+C-koniec robienia kopidm
+ do kkk=1,nperm
+ write (iout,*) "nowa struktura", nperm
+ do i=1,nres
+ write (iout,110) restyp(itype(i)),i,cref(1,i,kkk),
+ &cref(2,i,kkk),
+ &cref(3,i,kkk),cref(1,nres+i,kkk),
+ &cref(2,nres+i,kkk),cref(3,nres+i,kkk)
enddo
+ 100 format (//' alpha-carbon coordinates ',
+ & ' centroid coordinates'/
+ 1 ' ', 6X,'X',11X,'Y',11X,'Z',
+ & 10X,'X',11X,'Y',11X,'Z')
+ 110 format (a,'(',i3,')',6f12.5)
+ enddo
+
ishift_pdb=ishift
return
double precision x(maxvar)
integer itype_pdb(maxres)
logical seq_comp
- integer i,j
+ integer i,j,kkk
C
C Body
C
call reada(weightcard,'WTURN4',wturn4,1.0D0)
call reada(weightcard,'WTURN6',wturn6,1.0D0)
call reada(weightcard,'WSTRAIN',wstrain,1.0D0)
+ call reada(weightcard,'WSCCOR',wsccor,1.0D0)
call reada(weightcard,'WBOND',wbond,1.0D0)
call reada(weightcard,'WTOR',wtor,1.0D0)
call reada(weightcard,'WTORD',wtor_d,1.0D0)
weights(16)=wvdwpp
weights(17)=wbond
weights(18)=scal14
+ weights(19)=wsccor
write (iout,10) wsc,wscp,welec,wvdwpp,wbond,wang,wscloc,wtor,
& wtor_d,wstrain,wel_loc,wcorr,wcorr5,wcorr6,wturn3,
- & wturn4,wturn6
+ & wturn4,wturn6,wsccor
10 format (/'Energy-term weights (unscaled):'//
& 'WSCC= ',f10.6,' (SC-SC)'/
& 'WSCP= ',f10.6,' (SC-p)'/
& 'WCORR6= ',f10.6,' (multi-body 6th order)'/
& 'WTURN3= ',f10.6,' (turns, 3rd order)'/
& 'WTURN4= ',f10.6,' (turns, 4th order)'/
- & 'WTURN6= ',f10.6,' (turns, 6th order)')
+ & 'WTURN6= ',f10.6,' (turns, 6th order)'/
+ & 'WSCCOR= ',f10.6,' (SC-backbone torsinal correalations)')
+
if (wcorr4.gt.0.0d0) then
write (iout,'(/2a/)') 'Local-electrostatic type correlation ',
& 'between contact pairs of peptide groups'
do i=1,nres
#ifdef PROCOR
- if (itype(i).eq.21 .or. itype(i+1).eq.21) then
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) then
#else
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
#endif
itel(i)=0
#ifdef PROCOR
- else if (itype(i+1).ne.20) then
+ else if (iabs(itype(i+1)).ne.20) then
#else
- else if (itype(i).ne.20) then
+ else if (iabs(itype(i)).ne.20) then
#endif
itel(i)=1
else
nnt=1
nct=nres
print *,'NNT=',NNT,' NCT=',NCT
- if (itype(1).eq.21) nnt=2
- if (itype(nres).eq.21) nct=nct-1
+ if (itype(1).eq.ntyp1) nnt=2
+ if (itype(nres).eq.ntyp1) nct=nct-1
if (nstart.lt.nnt) nstart=nnt
if (nend.gt.nct .or. nend.eq.0) nend=nct
write (iout,*) "nstart",nstart," nend",nend
nstart_sup=nnt
nstart_seq=nnt
nsup=nct-nnt+1
+ kkk=1
do i=1,2*nres
do j=1,3
- cref(j,i)=c(j,i)
+ cref(j,i,kkk)=c(j,i)
enddo
enddo
endif
if (itype.eq.0) then
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (ucase(nam).eq.restyp(i)) then
rescode=i
return
else
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (nam(1:1).eq.onelet(i)) then
rescode=i
return
integer nlob,loc_start,loc_end,ithet_start,ithet_end,
& iphi_start,iphi_end,itau_start,itau_end
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1)
+ & ,bthet(2,-ntyp:ntyp,-1:1,-1:1),
+ & polthet(0:3,-ntyp:ntyp),gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),
+ &sig0(-ntyp:ntyp), sigc0(-ntyp:ntyp)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
& ithetyp(ntyp1),nntheterm
& ndouble,nntheterm
C Parameters of the side-chain probability distribution
common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ & dsc0(ntyp1),
& nlob(ntyp1)
C Virtual-bond lenghts
common /peptbond/ vbl,vblinv,vblinv2,vbl_cis,vbl0
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),onelet(-ntyp1:ntyp1)
character*3 restyp
character*1 onelet
character*10 ename,wname
& dcostau,dsintau,dtauangle,dcosomicron,
& domicron
integer nterm_sccor,isccortyp,nsccortyp,nlor_sccor
- common/sccor/v1sccor(maxterm_sccor,3,20,20),
- & v2sccor(maxterm_sccor,3,20,20),
- & v0sccor(maxterm_sccor,20),
- & vlor1sccor(maxterm_sccor,20,20),
- & vlor2sccor(maxterm_sccor,20,20),
- & vlor3sccor(maxterm_sccor,20,20),gloc_sc(3,0:maxres2,10),
+ common/sccor/v1sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v2sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v0sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor1sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor2sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor3sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & gloc_sc(3,0:maxres2,10),
& dcostau(3,3,3,maxres2),dsintau(3,3,3,maxres2),
& dtauangle(3,3,3,maxres2),dcosomicron(3,3,3,maxres2),
& domicron(3,3,3,maxres2),
- & nterm_sccor(ntyp,ntyp),isccortyp(ntyp),nsccortyp,
+ & nterm_sccor(-ntyp:ntyp,-ntyp:ntyp),isccortyp(-ntyp:ntyp)
+ & ,nsccortyp,
& nlor_sccor(ntyp,ntyp)
C Torsional constants of the rotation about virtual-bond dihedral angles
double precision v1,v2,vlor1,vlor2,vlor3,v0
integer itortyp,ntortyp,nterm,nlor,nterm_old
- common/torsion/v0(maxtor,maxtor),v1(maxterm,maxtor,maxtor),
- & v2(maxterm,maxtor,maxtor),vlor1(maxlor,maxtor,maxtor),
+ common/torsion/v0(-maxtor:maxtor,-maxtor:maxtor,2),
+ & v1(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & v2(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & vlor1(maxlor,maxtor,maxtor),
& vlor2(maxlor,maxtor,maxtor),vlor3(maxlor,maxtor,maxtor),
- & itortyp(ntyp),ntortyp,nterm(maxtor,maxtor),nlor(maxtor,maxtor)
+ & itortyp(-ntyp:ntyp),ntortyp,
+ & nterm(-maxtor:maxtor,-maxtor:maxtor,2),
+ & nlor(-maxtor:maxtor,-maxtor:maxtor,2)
& ,nterm_old
C 6/23/01 - constants for double torsionals
double precision v1c,v1s,v2c,v2s
integer ntermd_1,ntermd_2
- common /torsiond/ v1c(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v1s(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v2c(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & v2s(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & ntermd_1(maxtor,maxtor,maxtor),ntermd_2(maxtor,maxtor,maxtor)
+ common /torsiond/
+ &v1c(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v1s(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v2c(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ &v2s(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ & ntermd_1(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ & ntermd_2(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2)
C 9/18/99 - added Fourier coeffficients of the expansion of local energy
C surface
double precision b1,b2,cc,dd,ee,ctilde,dtilde,b1tilde
integer nloctyp
- common/fourier/ b1(2,maxtor),b2(2,maxtor),cc(2,2,maxtor),
- & dd(2,2,maxtor),ee(2,2,maxtor),ctilde(2,2,maxtor),
- & dtilde(2,2,maxtor),b1tilde(2,maxtor),nloctyp
+ common/fourier/ b1(2,-maxtor:maxtor),b2(2,-maxtor:maxtor),
+ & cc(2,2,-maxtor:maxtor),
+ & dd(2,2,-maxtor:maxtor),ee(2,2,-maxtor:maxtor),
+ & ctilde(2,2,-maxtor:maxtor),
+ & dtilde(2,2,-maxtor:maxtor),b1tilde(2,-maxtor:maxtor),nloctyp
double precision b
- common /fourier1/ b(13,maxtor)
+ common /fourier1/ b(13,0:maxtor)
include 'COMMON.INTERACT'
dimension xx(3)
- dsci=dsc(itype(i))
- dsci_inv=dsc_inv(itype(i))
+ dsci=dsc(iabs(itype(i)))
+ dsci_inv=dsc_inv(iabs(itype(i)))
alphi=alph(i)
omegi=omeg(i)
cosalphi=dcos(alphi)
kkk=3
c print *,'nnt=',nnt,' nct=',nct
do i=nnt+kkk,nct
- iti=itype(i)
+ iti=iabs(itype(i))
do j=nnt,i-kkk
- itj=itype(j)
+ itj=iabs(itype(j))
if (ipot.ne.4) then
c rcomp=sigmaii(iti,itj)+1.0D0
rcomp=facont*sigmaii(iti,itj)
cd print *,'Entering ELJ nnt=',nnt,' nct=',nct,' expon=',expon
evdw=0.0D0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
cd write (iout,*) 'i=',i,' iint=',iint,' istart=',istart(i,iint),
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
+ itypj=iabs(itype(j))
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c print *,'Entering ELJK nnt=',nnt,' nct=',nct,' expon=',expon
evdw=0.0D0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
C
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
+ itypj=iabs(itype(j))
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c endif
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
chi2=chi(itypj,itypi)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
c & 'evdw',i,j,evdwij,' ss'
ELSE
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
chi1=chi(itypi,itypj)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
c & 'evdw',i,j,evdwij,' ss'
ELSE
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
r0ij=r0(itypi,itypj)
do iint=1,nscp_gr(i)
do j=iscpstart(i,iint),iscpend(i,iint)
- itypj=itype(j)
+ itypj=iabs(itype(j))
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
C distance and angle dependent SS bond potential.
if (.not.dyn_ss .and. i.le.nss) then
C 15/02/13 CC dynamic SSbond - additional check
- if (ii.gt.nres .and. itype(iii).eq.1 .and. itype(jjj).eq.1) then
+ if (ii.gt.nres .and. iabs(itype(iii)).eq.1 .and.
+ & iabs( itype(jjj)).eq.1) then
call ssbond_ene(iii,jjj,eij)
ehpb=ehpb+2*eij
cd write (iout,*) "eij",eij
include 'COMMON.VAR'
include 'COMMON.IOUNITS'
double precision erij(3),dcosom1(3),dcosom2(3),gg(3)
- itypi=itype(i)
+ itypi=iabs(itype(i))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
dyi=dc_norm(2,nres+i)
dzi=dc_norm(3,nres+i)
dsci_inv=dsc_inv(itypi)
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=dsc_inv(itypj)
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
c 09/18/07 AL: multimodal bond potential based on AM1 CA-SC PMF's included
c
do i=nnt,nct
- iti=itype(i)
+ iti=iabs(itype(i))
if (iti.ne.10) then
nbi=nbondterm(iti)
if (nbi.eq.1) then
C Zero the energy function and its derivative at 0 or pi.
call splinthet(theta(i),0.5d0*delta,ss,ssd)
it=itype(i-1)
+ ichir1=isign(1,itype(i-2))
+ ichir2=isign(1,itype(i))
+ if (itype(i-2).eq.10) ichir1=isign(1,itype(i-1))
+ if (itype(i).eq.10) ichir2=isign(1,itype(i-1))
+ if (itype(i-1).eq.10) then
+ itype1=isign(10,itype(i-2))
+ ichir11=isign(1,itype(i-2))
+ ichir12=isign(1,itype(i-2))
+ itype2=isign(10,itype(i))
+ ichir21=isign(1,itype(i))
+ ichir22=isign(1,itype(i))
+ endif
c if (i.gt.ithet_start .and.
c & (itel(i-1).eq.0 .or. itel(i-2).eq.0)) goto 1215
c if (i.gt.3 .and. (i.le.4 .or. itel(i-3).ne.0)) then
C In following comments this theta will be referred to as t_c.
thet_pred_mean=0.0d0
do k=1,2
- athetk=athet(k,it)
- bthetk=bthet(k,it)
+ athetk=athet(k,it,ichir1,ichir2)
+ bthetk=bthet(k,it,ichir1,ichir2)
+ if (it.eq.10) then
+ athetk=athet(k,itype1,ichir11,ichir12)
+ bthetk=bthet(k,itype2,ichir21,ichir22)
+ endif
thet_pred_mean=thet_pred_mean+athetk*y(k)+bthetk*z(k)
enddo
c write (iout,*) "thet_pred_mean",thet_pred_mean
thet_pred_mean=thet_pred_mean*ss+a0thet(it)
c write (iout,*) "thet_pred_mean",thet_pred_mean
C Derivatives of the "mean" values in gamma1 and gamma2.
- dthetg1=(-athet(1,it)*y(2)+athet(2,it)*y(1))*ss
- dthetg2=(-bthet(1,it)*z(2)+bthet(2,it)*z(1))*ss
+ dthetg1=(-athet(1,it,ichir1,ichir2)*y(2)
+ &+athet(2,it,ichir1,ichir2)*y(1))*ss
+ dthetg2=(-bthet(1,it,ichir1,ichir2)*z(2)
+ & +bthet(2,it,ichir1,ichir2)*z(1))*ss
+ if (it.eq.10) then
+ dthetg1=(-athet(1,itype1,ichir11,ichir12)*y(2)
+ &+athet(2,itype1,ichir11,ichir12)*y(1))*ss
+ dthetg2=(-bthet(1,itype2,ichir21,ichir22)*z(2)
+ & +bthet(2,itype2,ichir21,ichir22)*z(1))*ss
+ endif
if (theta(i).gt.pi-delta) then
call theteng(pi-delta,thet_pred_mean,theta0(it),f0,fprim0,
& E_tc0)
etheta=0.0D0
c write (iout,*) "ithetyp",(ithetyp(i),i=1,ntyp1)
do i=ithet_start,ithet_end
+ if (itype(i-1).eq.ntyp1) cycle
+ if (iabs(itype(i+1)).eq.20) iblock=2
+ if (iabs(itype(i+1)).ne.20) iblock=1
dethetai=0.0d0
dephii=0.0d0
dephii1=0.0d0
theti2=0.5d0*theta(i)
- ityp2=ithetyp(itype(i-1))
+ ityp2=ithetyp((itype(i-1)))
do k=1,nntheterm
coskt(k)=dcos(k*theti2)
sinkt(k)=dsin(k*theti2)
#else
phii=phi(i)
#endif
- ityp1=ithetyp(itype(i-2))
+ ityp1=ithetyp((itype(i-2)))
do k=1,nsingle
cosph1(k)=dcos(k*phii)
sinph1(k)=dsin(k*phii)
#else
phii1=phi(i+1)
#endif
- ityp3=ithetyp(itype(i))
+ ityp3=ithetyp((itype(i)))
do k=1,nsingle
cosph2(k)=dcos(k*phii1)
sinph2(k)=dsin(k*phii1)
c write (iout,*) "i",i," ityp1",itype(i-2),ityp1,
c & " ityp2",itype(i-1),ityp2," ityp3",itype(i),ityp3
c call flush(iout)
- ethetai=aa0thet(ityp1,ityp2,ityp3)
+ ethetai=aa0thet(ityp1,ityp2,ityp3,iblock)
do k=1,ndouble
do l=1,k-1
ccl=cosph1(l)*cosph2(k-l)
enddo
endif
do k=1,ntheterm
- ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3)*sinkt(k)
- dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3)
+ ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3,iblock)*sinkt(k)
+ dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3,iblock)
& *coskt(k)
if (lprn)
- & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3),
+ & write (iout,*) "k",k," aathet"
+ & ,aathet(k,ityp1,ityp2,ityp3,iblock),
& " ethetai",ethetai
enddo
if (lprn) then
endif
do m=1,ntheterm2
do k=1,nsingle
- aux=bbthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)
- & +ccthet(k,m,ityp1,ityp2,ityp3)*sinph1(k)
- & +ddthet(k,m,ityp1,ityp2,ityp3)*cosph2(k)
- & +eethet(k,m,ityp1,ityp2,ityp3)*sinph2(k)
+ aux=bbthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)
+ & +ccthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k)
+ & +ddthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)
+ & +eethet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*aux*coskt(m)
dephii=dephii+k*sinkt(m)*(
- & ccthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)-
- & bbthet(k,m,ityp1,ityp2,ityp3)*sinph1(k))
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)-
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k))
dephii1=dephii1+k*sinkt(m)*(
- & eethet(k,m,ityp1,ityp2,ityp3)*cosph2(k)-
- & ddthet(k,m,ityp1,ityp2,ityp3)*sinph2(k))
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)-
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k))
if (lprn)
& write (iout,*) "m",m," k",k," bbthet",
- & bbthet(k,m,ityp1,ityp2,ityp3)," ccthet",
- & ccthet(k,m,ityp1,ityp2,ityp3)," ddthet",
- & ddthet(k,m,ityp1,ityp2,ityp3)," eethet",
- & eethet(k,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)," ccthet",
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)," ddthet",
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)," eethet",
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)," ethetai",ethetai
enddo
enddo
if (lprn)
do m=1,ntheterm3
do k=2,ndouble
do l=1,k-1
- aux=ffthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)
+ aux=ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*coskt(m)*aux
dephii=dephii+l*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)-
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)-
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
dephii1=dephii1+(k-l)*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)-
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)-
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
if (lprn) then
write (iout,*) "m",m," k",k," l",l," ffthet",
- & ffthet(l,k,m,ityp1,ityp2,ityp3),
- & ffthet(k,l,m,ityp1,ityp2,ityp3)," ggthet",
- & ggthet(l,k,m,ityp1,ityp2,ityp3),
- & ggthet(k,l,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & ffthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ggthet",
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ethetai",
+ & ethetai
write (iout,*) cosph1ph2(l,k)*sinkt(m),
& cosph1ph2(k,l)*sinkt(m),
& sinph1ph2(l,k)*sinkt(m),sinph1ph2(k,l)*sinkt(m)
do i=loc_start,loc_end
it=itype(i)
if (it.eq.10) goto 1
- nlobit=nlob(it)
+ nlobit=nlob(iabs(it))
c print *,'i=',i,' it=',it,' nlobit=',nlobit
c write (iout,*) 'i=',i,' ssa=',ssa,' ssad=',ssad
theti=theta(i+1)-pipol
do iii=-1,1
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j,iii)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j,iii)+emin)
cd print *,'j=',j,' expfac=',expfac
escloc_i=escloc_i+expfac
do k=1,3
dersc12=0.0d0
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j)+emin)
escloc_i=escloc_i+expfac
do k=1,2
dersc(k)=dersc(k)+Ax(k,j)*expfac
cosfac=dsqrt(cosfac2)
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
- it=itype(i)
+ it=iabs(itype(i))
if (it.eq.10) goto 1
c
C Compute the axes of tghe local cartesian coordinates system; store in
y_prime(j) = (dc_norm(j,i) + dc_norm(j,i-1))*sinfac
enddo
do j = 1,3
- z_prime(j) = -uz(j,i-1)
+ z_prime(j) = -uz(j,i-1)*dsign(1.0d0,dfloat(itype(i)))
enddo
c write (2,*) "i",i
c write (2,*) "x_prime",(x_prime(j),j=1,3)
xx = xx + x_prime(j)*dc_norm(j,i+nres)
yy = yy + y_prime(j)*dc_norm(j,i+nres)
zz = zz + z_prime(j)*dc_norm(j,i+nres)
+ zz = zz + z_prime(j)*dc_norm(j,i+nres)
enddo
xxtab(i)=xx
yytab(i)=yy
zztab(i)=zz
+
C
C Compute the energy of the ith side cbain
C
c write (2,*) "xx",xx," yy",yy," zz",zz
- it=itype(i)
+ it=iabs(itype(i))
do j = 1,65
x(j) = sc_parmin(j,it)
enddo
dZZ_Ci1(k)=0.0d0
dZZ_Ci(k)=0.0d0
do j=1,3
- dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)*dC_norm(j,i+nres)
- dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)*dC_norm(j,i+nres)
+ dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+ dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
enddo
dXX_XYZ(k)=vbld_inv(i+nres)*(x_prime(k)-xx*dC_norm(k,i+nres))
etors=0.0D0
do i=iphi_start,iphi_end
if (itel(i-2).eq.0 .or. itel(i-1).eq.0) goto 1215
+ if (iabs(itype(i)).eq.20) then
+ iblock=2
+ else
+ iblock=1
+ endif
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
gloci=0.0D0
C Regular cosine and sine terms
- do j=1,nterm(itori,itori1)
- v1ij=v1(j,itori,itori1)
- v2ij=v2(j,itori,itori1)
+ do j=1,nterm(itori,itori1,iblock)
+ v1ij=v1(j,itori,itori1,iblock)
+ v2ij=v2(j,itori,itori1,iblock)
cosphi=dcos(j*phii)
sinphi=dsin(j*phii)
etors=etors+v1ij*cosphi+v2ij*sinphi
C
cosphi=dcos(0.5d0*phii)
sinphi=dsin(0.5d0*phii)
- do j=1,nlor(itori,itori1)
+ do j=1,nlor(itori,itori1,iblock)
vl1ij=vlor1(j,itori,itori1)
vl2ij=vlor2(j,itori,itori1)
vl3ij=vlor3(j,itori,itori1)
gloci=gloci+vl1ij*(vl3ij*cosphi-vl2ij*sinphi)*pom
enddo
C Subtract the constant term
- etors=etors-v0(itori,itori1)
+ etors=etors-v0(itori,itori1,iblock)
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1(j,itori,itori1),j=1,6),(v2(j,itori,itori1),j=1,6)
+ & (v1(j,itori,itori1,1),j=1,6),(v2(j,itori,itori1,1),j=1,6)
gloc(i-3,icg)=gloc(i-3,icg)+wtor*fact*gloci
c write (iout,*) 'i=',i,' gloc=',gloc(i-3,icg)
1215 continue
phii1=phi(i+1)
gloci1=0.0D0
gloci2=0.0D0
+ iblock=1
+ if (iabs(itype(i+1)).eq.20) iblock=2
C Regular cosine and sine terms
- do j=1,ntermd_1(itori,itori1,itori2)
- v1cij=v1c(1,j,itori,itori1,itori2)
- v1sij=v1s(1,j,itori,itori1,itori2)
- v2cij=v1c(2,j,itori,itori1,itori2)
- v2sij=v1s(2,j,itori,itori1,itori2)
+ do j=1,ntermd_1(itori,itori1,itori2,iblock)
+ v1cij=v1c(1,j,itori,itori1,itori2,iblock)
+ v1sij=v1s(1,j,itori,itori1,itori2,iblock)
+ v2cij=v1c(2,j,itori,itori1,itori2,iblock)
+ v2sij=v1s(2,j,itori,itori1,itori2,iblock)
cosphi1=dcos(j*phii)
sinphi1=dsin(j*phii)
cosphi2=dcos(j*phii1)
gloci1=gloci1+j*(v1sij*cosphi1-v1cij*sinphi1)
gloci2=gloci2+j*(v2sij*cosphi2-v2cij*sinphi2)
enddo
- do k=2,ntermd_2(itori,itori1,itori2)
+ do k=2,ntermd_2(itori,itori1,itori2,iblock)
do l=1,k-1
- v1cdij = v2c(k,l,itori,itori1,itori2)
- v2cdij = v2c(l,k,itori,itori1,itori2)
- v1sdij = v2s(k,l,itori,itori1,itori2)
- v2sdij = v2s(l,k,itori,itori1,itori2)
+ v1cdij = v2c(k,l,itori,itori1,itori2,iblock)
+ v2cdij = v2c(l,k,itori,itori1,itori2,iblock)
+ v1sdij = v2s(k,l,itori,itori1,itori2,iblock)
+ v2sdij = v2s(l,k,itori,itori1,itori2,iblock)
cosphi1p2=dcos(l*phii+(k-l)*phii1)
cosphi1m2=dcos(l*phii-(k-l)*phii1)
sinphi1p2=dsin(l*phii+(k-l)*phii1)
c 3 = SC...Ca...Ca...SCi
gloci=0.0D0
if (((intertyp.eq.3).and.((itype(i-2).eq.10).or.
- & (itype(i-1).eq.10).or.(itype(i-2).eq.21).or.
- & (itype(i-1).eq.21)))
+ & (itype(i-1).eq.10).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-1).eq.ntyp1)))
& .or. ((intertyp.eq.1).and.((itype(i-2).eq.10)
- & .or.(itype(i-2).eq.21)))
+ & .or.(itype(i-2).eq.ntyp1)))
& .or.((intertyp.eq.2).and.((itype(i-1).eq.10).or.
- & (itype(i-1).eq.21)))) cycle
- if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.21)) cycle
- if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.21))
+ & (itype(i-1).eq.ntyp1)))) cycle
+ if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.ntyp1)) cycle
+ if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.ntyp1))
& cycle
do j=1,nterm_sccor(isccori,isccori1)
v1ij=v1sccor(j,intertyp,isccori,isccori1)
integer nlob,loc_start,loc_end,ithet_start,ithet_end,
& iphi_start,iphi_end
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1)
+ & ,bthet(2,-ntyp:ntyp,-1:1,-1:1),
+ & polthet(0:3,-ntyp:ntyp),gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),
+ &sig0(-ntyp:ntyp), sigc0(-ntyp:ntyp)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
& ithetyp(ntyp1),nntheterm
& ndouble,nntheterm
C Parameters of the side-chain probability distribution
common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ & dsc0(ntyp1)
& nlob(ntyp1)
C Virtual-bond lenghts
common /peptbond/ vbl,vblinv,vblinv2,vbl_cis,vbl0
character*3 restyp
character*1 onelet
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),onelet(-ntyp1:ntyp1)
character*10 ename,wname
integer nprint_ene,print_order
common /namterm/ ename(max_ene),wname(max_ene),nprint_ene,
C Torsional constants of the rotation about virtual-bond dihedral angles
double precision v1,v2,vlor1,vlor2,vlor3,v0
integer itortyp,ntortyp,nterm,nlor,nterm_old
- common/torsion/v0(maxtor,maxtor),v1(maxterm,maxtor,maxtor),
- & v2(maxterm,maxtor,maxtor),vlor1(maxlor,maxtor,maxtor),
+ common/torsion/v0(-maxtor:maxtor,-maxtor:maxtor,2),
+ & v1(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & v2(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & vlor1(maxlor,maxtor,maxtor),
& vlor2(maxlor,maxtor,maxtor),vlor3(maxlor,maxtor,maxtor),
- & itortyp(ntyp),ntortyp,nterm(maxtor,maxtor),nlor(maxtor,maxtor)
- & ,nterm_old
+ & itortyp(-ntyp:ntyp),ntortyp,
+ & nterm(-maxtor:maxtor,-maxtor:maxtor,2),
+ & nlor(-maxtor:maxtor,-maxtor:maxtor,2)
C 6/23/01 - constants for double torsionals
double precision v1c,v1s,v2c,v2s
integer ntermd_1,ntermd_2
- common /torsiond/ v1c(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v1s(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v2c(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & v2s(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & ntermd_1(maxtor,maxtor,maxtor),ntermd_2(maxtor,maxtor,maxtor)
+ common /torsiond/
+ &v1c(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v1s(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v2c(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ &v2s(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ & ntermd_1(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ & ntermd_2(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2)
C 9/18/99 - added Fourier coeffficients of the expansion of local energy
C surface
double precision b1,b2,cc,dd,ee,ctilde,dtilde,b1tilde
integer nloctyp
- common/fourier/ b1(2,maxtor),b2(2,maxtor),cc(2,2,maxtor),
- & dd(2,2,maxtor),ee(2,2,maxtor),ctilde(2,2,maxtor),
- & dtilde(2,2,maxtor),b1tilde(2,maxtor),nloctyp
- double precision b
+ common/fourier/ b1(2,-maxtor:maxtor),b2(2,-maxtor:maxtor),
+ & cc(2,2,-maxtor:maxtor),
+ & dd(2,2,-maxtor:maxtor),ee(2,2,-maxtor:maxtor),
+ & ctilde(2,2,-maxtor:maxtor),
+ & dtilde(2,2,-maxtor:maxtor),b1tilde(2,-maxtor:maxtor),nloctyp
+ double precision b
common /fourier1/ b(13,maxtor)
sigii(i)=0.0D0
rr0(i)=0.0D0
a0thet(i)=0.0D0
- do j=1,2
- athet(j,i)=0.0D0
- bthet(j,i)=0.0D0
+ do j=1,2
+ do ichir1=-1,1
+ do ichir2=-1,1
+ athet(j,i,ichir1,ichir2)=0.0D0
+ bthet(j,i,ichir1,ichir2)=0.0D0
+ enddo
+ enddo
enddo
do j=0,3
polthet(j,i)=0.0D0
enddo
nlob(ntyp1)=0
dsc(ntyp1)=0.0D0
- do i=1,maxtor
+ do i=-maxtor,maxtor
itortyp(i)=0
- do j=1,maxtor
- do k=1,maxterm
- v1(k,j,i)=0.0D0
- v2(k,j,i)=0.0D0
- enddo
+ do iblock=1,2
+ do j=-maxtor,maxtor
+ do k=1,maxterm
+ v1(k,j,i,iblock)=0.0D0
+ v2(k,j,i,iblock)=0.0D0
+ enddo
+ enddo
enddo
enddo
+ do iblock=1,2
+ do i=-maxtor,maxtor
+ do j=-maxtor,maxtor
+ do k=-maxtor,maxtor
+ do l=1,maxtermd_1
+ v1c(1,l,i,j,k,iblock)=0.0D0
+ v1s(1,l,i,j,k,iblock)=0.0D0
+ v1c(2,l,i,j,k,iblock)=0.0D0
+ v1s(2,l,i,j,k,iblock)=0.0D0
+ enddo !l
+ do l=1,maxtermd_2
+ do m=1,maxtermd_2
+ v2c(m,l,i,j,k,iblock)=0.0D0
+ v2s(m,l,i,j,k,iblock)=0.0D0
+ enddo !m
+ enddo !l
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
do i=1,maxres
itype(i)=0
itel(i)=0
include 'COMMON.NAMES'
include 'COMMON.FFIELD'
data restyp /
+ &'DD' ,'DPR','DLY','DAR','DHI','DAS','DGL','DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
&'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
data onelet /
+ &'z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
&'S','Q','N','E','D','H','R','K','P','X'/
data potname /'LJ','LJK','BP','GB','GBV'/
include 'COMMON.SCCOR'
include 'COMMON.SCROT'
character*1 t1,t2,t3
- character*1 onelett(4) /"G","A","P","D"/
+ character*1 onelett(-2:2) /"p","a","G","A","P"/
logical lprint
dimension blower(3,3,maxlob)
double precision ip,mp
C of the virtual-bond valence angles theta
C
do i=1,ntyp
- read (ithep,*) a0thet(i),(athet(j,i),j=1,2),(bthet(j,i),j=1,2)
+ read (ithep,*) a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
read (ithep,*) (polthet(j,i),j=0,3)
read (ithep,*) (gthet(j,i),j=1,3)
read (ithep,*) theta0(i),sig0(i),sigc0(i)
sigc0(i)=sigc0(i)**2
enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
+ enddo
close (ithep)
if (lprint) then
c write (iout,'(a)')
& ' b1*10^1 ',' b2*10^1 '
do i=1,ntyp
write(iout,'(a3,1h&,2x,5(f8.3,1h&))') restyp(i),
- & a0thet(i),(100*athet(j,i),j=1,2),(10*bthet(j,i),j=1,2)
+ & a0thet(i),(100*athet(j,i,1,1),j=1,2),
+ & (10*bthet(j,i,1,1),j=1,2)
enddo
write (iout,'(/a/9x,5a/79(1h-))')
& 'Parameters of the expression for sigma(theta_c):',
& ntheterm3,nsingle,ndouble
nntheterm=max0(ntheterm,ntheterm2,ntheterm3)
read (ithep,*) (ithetyp(i),i=1,ntyp1)
- do i=1,maxthetyp
- do j=1,maxthetyp
- do k=1,maxthetyp
- aa0thet(i,j,k)=0.0d0
+ do i=-ntyp1,-1
+ ithetyp(i)=-ithetyp(-i)
+ enddo
+ do iblock=1,2
+ do i=-maxthetyp,maxthetyp
+ do j=-maxthetyp,maxthetyp
+ do k=-maxthetyp,maxthetyp
+ aa0thet(i,j,k,iblock)=0.0d0
do l=1,ntheterm
- aathet(l,i,j,k)=0.0d0
+ aathet(l,i,j,k,iblock)=0.0d0
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=0.0d0
- ccthet(m,l,i,j,k)=0.0d0
- ddthet(m,l,i,j,k)=0.0d0
- eethet(m,l,i,j,k)=0.0d0
+ bbthet(m,l,i,j,k,iblock)=0.0d0
+ ccthet(m,l,i,j,k,iblock)=0.0d0
+ ddthet(m,l,i,j,k,iblock)=0.0d0
+ eethet(m,l,i,j,k,iblock)=0.0d0
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=0.0d0
- ggthet(mm,m,l,i,j,k)=0.0d0
+ ffthet(mm,m,l,i,j,k,iblock)=0.0d0
+ ggthet(mm,m,l,i,j,k,iblock)=0.0d0
enddo
enddo
enddo
enddo
enddo
enddo
- do i=1,nthetyp
- do j=1,nthetyp
- do k=1,nthetyp
- read (ithep,'(3a)') res1,res2,res3
- read (ithep,*) aa0thet(i,j,k)
- read (ithep,*)(aathet(l,i,j,k),l=1,ntheterm)
+ enddo
+ do iblock=1,2
+ do i=0,nthetyp
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ read (ithep,'(6a)') res1
+ read (ithep,*) aa0thet(i,j,k,iblock)
+ read (ithep,*)(aathet(l,i,j,k,iblock),l=1,ntheterm)
read (ithep,*)
- & ((bbthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ccthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ddthet(lll,ll,i,j,k),lll=1,nsingle),
- & (eethet(lll,ll,i,j,k),lll=1,nsingle),ll=1,ntheterm2)
+ & ((bbthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ccthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ddthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (eethet(lll,ll,i,j,k,iblock),lll=1,nsingle)
+ & ,ll=1,ntheterm2)
read (ithep,*)
- & (((ffthet(llll,lll,ll,i,j,k),ffthet(lll,llll,ll,i,j,k),
- & ggthet(llll,lll,ll,i,j,k),ggthet(lll,llll,ll,i,j,k),
+ & (((ffthet(llll,lll,ll,i,j,k,iblock),
+ & ffthet(lll,llll,ll,i,j,k,iblock),
+ & ggthet(llll,lll,ll,i,j,k,iblock),
+ & ggthet(lll,llll,ll,i,j,k,iblock),
& llll=1,lll-1),lll=2,ndouble),ll=1,ntheterm3)
enddo
enddo
do i=1,nthetyp
do j=1,nthetyp
do l=1,ntheterm
- aathet(l,i,j,nthetyp+1)=aathet(l,i,j,1)
- aathet(l,nthetyp+1,i,j)=aathet(l,1,i,j)
+ aathet(l,i,j,nthetyp+1,iblock)=0.0d0
+ aathet(l,nthetyp+1,i,j,iblock)=0.0d0
enddo
- aa0thet(i,j,nthetyp+1)=aa0thet(i,j,1)
- aa0thet(nthetyp+1,i,j)=aa0thet(1,i,j)
+ aa0thet(i,j,nthetyp+1,iblock)=0.0d0
+ aa0thet(nthetyp+1,i,j,iblock)=0.0d0
enddo
do l=1,ntheterm
- aathet(l,nthetyp+1,i,nthetyp+1)=aathet(l,1,i,1)
+ aathet(l,nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
- aa0thet(nthetyp+1,i,nthetyp+1)=aa0thet(1,i,1)
+ aa0thet(nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
+ enddo
+C Substitution for D aminoacids from symmetry.
+ do iblock=1,2
+ do i=-nthetyp,0
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ aa0thet(i,j,k,iblock)=aa0thet(-i,-j,-k,iblock)
+ do l=1,ntheterm
+ aathet(l,i,j,k,iblock)=aathet(l,-i,-j,-k,iblock)
+ enddo
+ do ll=1,ntheterm2
+ do lll=1,nsingle
+ bbthet(lll,ll,i,j,k,iblock)=bbthet(lll,ll,-i,-j,-k,iblock)
+ ccthet(lll,ll,i,j,k,iblock)=-ccthet(lll,ll,-i,-j,-k,iblock)
+ ddthet(lll,ll,i,j,k,iblock)=ddthet(lll,ll,-i,-j,-k,iblock)
+ eethet(lll,ll,i,j,k,iblock)=-eethet(lll,ll,-i,-j,-k,iblock)
+ enddo
+ enddo
+ do ll=1,ntheterm3
+ do lll=2,ndouble
+ do llll=1,lll-1
+ ffthet(llll,lll,ll,i,j,k,iblock)=
+ & ffthet(llll,lll,ll,-i,-j,-k,iblock)
+ ffthet(lll,llll,ll,i,j,k,iblock)=
+ & ffthet(lll,llll,ll,-i,-j,-k,iblock)
+ ggthet(llll,lll,ll,i,j,k,iblock)=
+ & -ggthet(llll,lll,ll,-i,-j,-k,iblock)
+ ggthet(lll,llll,ll,i,j,k,iblock)=
+ & -ggthet(lll,llll,ll,-i,-j,-k,iblock)
+ enddo !ll
+ enddo !lll
+ enddo !llll
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
+
C
C Control printout of the coefficients of virtual-bond-angle potentials
C
write (iout,'(//4a)')
& 'Type ',onelett(i),onelett(j),onelett(k)
write (iout,'(//a,10x,a)') " l","a[l]"
- write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k)
+ write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k,iblock)
write (iout,'(i2,1pe15.5)')
- & (l,aathet(l,i,j,k),l=1,ntheterm)
+ & (l,aathet(l,i,j,k,iblock),l=1,ntheterm)
do l=1,ntheterm2
write (iout,'(//2h m,4(9x,a,3h[m,i1,1h]))')
& "b",l,"c",l,"d",l,"e",l
do m=1,nsingle
write (iout,'(i2,4(1pe15.5))') m,
- & bbthet(m,l,i,j,k),ccthet(m,l,i,j,k),
- & ddthet(m,l,i,j,k),eethet(m,l,i,j,k)
+ & bbthet(m,l,i,j,k,iblock),ccthet(m,l,i,j,k,iblock),
+ & ddthet(m,l,i,j,k,iblock),eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=2,ndouble
do n=1,m-1
write (iout,'(i1,1x,i1,4(1pe15.5))') n,m,
- & ffthet(n,m,l,i,j,k),ffthet(m,n,l,i,j,k),
- & ggthet(n,m,l,i,j,k),ggthet(m,n,l,i,j,k)
+ & ffthet(n,m,l,i,j,k,iblock),
+ & ffthet(m,n,l,i,j,k,iblock),
+ & ggthet(n,m,l,i,j,k,iblock),
+ & ggthet(m,n,l,i,j,k,iblock)
enddo
enddo
enddo
enddo
bsc(1,i)=0.0D0
read(irotam,*)(censc(k,1,i),k=1,3),((blower(k,l,1),l=1,k),k=1,3)
+ censc(1,1,-i)=censc(1,1,i)
+ censc(2,1,-i)=censc(2,1,i)
+ censc(3,1,-i)=-censc(3,1,i)
do j=2,nlob(i)
read (irotam,*) bsc(j,i)
read (irotam,*) (censc(k,j,i),k=1,3),
& ((blower(k,l,j),l=1,k),k=1,3)
+ censc(1,j,-i)=censc(1,j,i)
+ censc(2,j,-i)=censc(2,j,i)
+ censc(3,j,-i)=-censc(3,j,i)
+C BSC is amplitude of Gaussian
enddo
do j=1,nlob(i)
do k=1,3
enddo
gaussc(k,l,j,i)=akl
gaussc(l,k,j,i)=akl
+ if (((k.eq.3).and.(l.ne.3))
+ & .or.((l.eq.3).and.(k.ne.3))) then
+ gaussc(k,l,j,-i)=-akl
+ gaussc(l,k,j,-i)=-akl
+ else
+ gaussc(k,l,j,-i)=akl
+ gaussc(l,k,j,-i)=akl
+ endif
enddo
enddo
enddo
read (itorp,*) ntortyp
read (itorp,*) (itortyp(i),i=1,ntyp)
write (iout,*) 'ntortyp',ntortyp
- do i=1,ntortyp
- do j=1,ntortyp
- read (itorp,*) nterm(i,j),nlor(i,j)
+ do iblock=1,2
+ do i=-ntyp,-1
+ itortyp(i)=-itortyp(-i)
+ enddo
+c write (iout,*) 'ntortyp',ntortyp
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ read (itorp,*) nterm(i,j,iblock),
+ & nlor(i,j,iblock)
+ nterm(-i,-j,iblock)=nterm(i,j,iblock)
+ nlor(-i,-j,iblock)=nlor(i,j,iblock)
v0ij=0.0d0
si=-1.0d0
- do k=1,nterm(i,j)
- read (itorp,*) kk,v1(k,i,j),v2(k,i,j)
- v0ij=v0ij+si*v1(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ read (itorp,*) kk,v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
+ v1(k,-i,-j,iblock)=v1(k,i,j,iblock)
+ v2(k,-i,-j,iblock)=-v2(k,i,j,iblock)
+ v0ij=v0ij+si*v1(k,i,j,iblock)
si=-si
enddo
- do k=1,nlor(i,j)
- read (itorp,*) kk,vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
+ do k=1,nlor(i,j,iblock)
+ read (itorp,*) kk,vlor1(k,i,j),
+ & vlor2(k,i,j),vlor3(k,i,j)
v0ij=v0ij+vlor1(k,i,j)/(1+vlor3(k,i,j)**2)
enddo
- v0(i,j)=v0ij
+ v0(i,j,iblock)=v0ij
+ v0(-i,-j,iblock)=v0ij
enddo
enddo
+ enddo
close (itorp)
if (lprint) then
write (iout,'(/a/)') 'Torsional constants:'
do j=1,ntortyp
write (iout,*) 'ityp',i,' jtyp',j
write (iout,*) 'Fourier constants'
- do k=1,nterm(i,j)
- write (iout,'(2(1pe15.5))') v1(k,i,j),v2(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ write (iout,'(2(1pe15.5))') v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
enddo
write (iout,*) 'Lorenz constants'
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
write (iout,'(3(1pe15.5))')
& vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
enddo
C
C 6/23/01 Read parameters for double torsionals
C
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
read (itordp,'(3a1)') t1,t2,t3
if (t1.ne.onelett(i) .or. t2.ne.onelett(j)
& .or. t3.ne.onelett(k)) then
& i,j,k,t1,t2,t3
stop "Error in double torsional parameter file"
endif
- read (itordp,*) ntermd_1(i,j,k),ntermd_2(i,j,k)
- read (itordp,*) (v1c(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1c(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) ((v2c(l,m,i,j,k),v2c(m,l,i,j,k),
- & v2s(l,m,i,j,k),v2s(m,l,i,j,k),m=1,l-1),l=1,ntermd_2(i,j,k))
- enddo
- enddo
- enddo
+ read (itordp,*) ntermd_1(i,j,k,iblock),
+ & ntermd_2(i,j,k,iblock)
+ ntermd_1(-i,-j,-k,iblock)=ntermd_1(i,j,k,iblock)
+ ntermd_2(-i,-j,-k,iblock)=ntermd_2(i,j,k,iblock)
+ read (itordp,*) (v1c(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1c(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+C Martix of D parameters for one dimesional foureir series
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,-i,-j,-k,iblock)=v1c(1,l,i,j,k,iblock)
+ v1s(1,l,-i,-j,-k,iblock)=-v1s(1,l,i,j,k,iblock)
+ v1c(2,l,-i,-j,-k,iblock)=v1c(2,l,i,j,k,iblock)
+ v1s(2,l,-i,-j,-k,iblock)=-v1s(2,l,i,j,k,iblock)
+c write(iout,*) "whcodze" ,
+c & v1s(2,l,-i,-j,-k,iblock),v1s(2,l,i,j,k,iblock)
+ enddo
+ read (itordp,*) ((v2c(l,m,i,j,k,iblock),
+ & v2c(m,l,i,j,k,iblock),v2s(l,m,i,j,k,iblock),
+ & v2s(m,l,i,j,k,iblock),
+ & m=1,l-1),l=1,ntermd_2(i,j,k,iblock))
+C Martix of D parameters for two dimesional fourier series
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,l-1
+ v2c(l,m,-i,-j,-k,iblock)=v2c(l,m,i,j,k,iblock)
+ v2c(m,l,-i,-j,-k,iblock)=v2c(m,l,i,j,k,iblock)
+ v2s(l,m,-i,-j,-k,iblock)=-v2s(l,m,i,j,k,iblock)
+ v2s(m,l,-i,-j,-k,iblock)=-v2s(m,l,i,j,k,iblock)
+ enddo!m
+ enddo!l
+ enddo!k
+ enddo!j
+ enddo!i
+ enddo!iblock
if (lprint) then
write (iout,*)
write (iout,*) 'Constants for double torsionals'
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
write (iout,*) 'ityp',i,' jtyp',j,' ktyp',k,
- & ' nsingle',ntermd_1(i,j,k),' ndouble',ntermd_2(i,j,k)
+ & ' nsingle',ntermd_1(i,j,k,iblock),
+ & ' ndouble',ntermd_2(i,j,k,iblock)
write (iout,*)
write (iout,*) 'Single angles:'
- do l=1,ntermd_1(i,j,k)
- write (iout,'(i5,2f10.5,5x,2f10.5)') l,
- & v1c(1,l,i,j,k),v1s(1,l,i,j,k),
- & v1c(2,l,i,j,k),v1s(2,l,i,j,k)
+ do l=1,ntermd_1(i,j,k,iblock)
+ write (iout,'(i5,2f10.5,5x,2f10.5,5x,2f10.5)') l,
+ & v1c(1,l,i,j,k,iblock),v1s(1,l,i,j,k,iblock),
+ & v1c(2,l,i,j,k,iblock),v1s(2,l,i,j,k,iblock),
+ & v1s(1,l,-i,-j,-k,iblock),v1s(2,l,-i,-j,-k,iblock)
enddo
write (iout,*)
write (iout,*) 'Pairs of angles:'
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2c(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2c(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2s(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2s(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock)),
+ & (v2s(l,m,-i,-j,-k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
enddo
enddo
enddo
+ enddo
endif
#endif
C Read of Side-chain backbone correlation parameters
read (isccor,*) nsccortyp
read (isccor,*) (isccortyp(i),i=1,ntyp)
c write (iout,*) 'ntortyp',ntortyp
+ do i=-ntyp,-1
+ isccortyp(i)=-isccortyp(-i)
+ enddo
+ iscprol=isccortyp(20)
maxinter=3
cc maxinter is maximum interaction sites
do l=1,maxinter
read (isccor,*)
&nterm_sccor(i,j),nlor_sccor(i,j)
v0ijsccor=0.0d0
- si=-1.0d0
-
+ v0ijsccor1=0.0d0
+ v0ijsccor2=0.0d0
+ v0ijsccor3=0.0d0
+ si=-1.0d0
+ nterm_sccor(-i,j)=nterm_sccor(i,j)
+ nterm_sccor(-i,-j)=nterm_sccor(i,j)
+ nterm_sccor(i,-j)=nterm_sccor(i,j)
do k=1,nterm_sccor(i,j)
read (isccor,*) kk,v1sccor(k,l,i,j)
& ,v2sccor(k,l,i,j)
+ if (j.eq.iscprol) then
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)*0.5d0
+ & +v2sccor(k,l,i,j)*dsqrt(0.75d0)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)*0.5d0
+ & +v1sccor(k,l,i,j)*dsqrt(0.75d0)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ else
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ if (j.eq.isccortyp(10)) then
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=-v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ endif
+ endif
v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ v0ijsccor1=v0ijsccor+si*v1sccor(k,l,-i,j)
+ v0ijsccor2=v0ijsccor+si*v1sccor(k,l,i,-j)
+ v0ijsccor3=v0ijsccor+si*v1sccor(k,l,-i,-j)
si=-si
enddo
do k=1,nlor_sccor(i,j)
v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
&(1+vlor3sccor(k,i,j)**2)
enddo
- v0sccor(i,j)=v0ijsccor
+ v0sccor(l,i,j)=v0ijsccor
+ v0sccor(l,-i,j)=v0ijsccor1
+ v0sccor(l,i,-j)=v0ijsccor2
+ v0sccor(l,-i,-j)=v0ijsccor3
enddo
enddo
enddo
C interaction energy of the Gly, Ala, and Pro prototypes.
C
read (ifourier,*) nloctyp
- do i=1,nloctyp
+ do i=0,nloctyp-1
read (ifourier,*)
read (ifourier,*) (b(ii,i),ii=1,13)
if (lprint) then
endif
B1(1,i) = b(3,i)
B1(2,i) = b(5,i)
+ B1(1,-i) = b(3,i)
+ B1(2,-i) = -b(5,i)
B1tilde(1,i) = b(3,i)
B1tilde(2,i) =-b(5,i)
+ B1tilde(1,-i) =-b(3,i)
+ B1tilde(2,-i) =b(5,i)
B2(1,i) = b(2,i)
B2(2,i) = b(4,i)
+ B2(1,-i) =b(2,i)
+ B2(2,-i) =-b(4,i)
CC(1,1,i)= b(7,i)
CC(2,2,i)=-b(7,i)
CC(2,1,i)= b(9,i)
CC(1,2,i)= b(9,i)
+ CC(1,1,-i)= b(7,i)
+ CC(2,2,-i)=-b(7,i)
+ CC(2,1,-i)=-b(9,i)
+ CC(1,2,-i)=-b(9,i)
Ctilde(1,1,i)=b(7,i)
Ctilde(1,2,i)=b(9,i)
Ctilde(2,1,i)=-b(9,i)
Ctilde(2,2,i)=b(7,i)
+ Ctilde(1,1,-i)=b(7,i)
+ Ctilde(1,2,-i)=-b(9,i)
+ Ctilde(2,1,-i)=b(9,i)
+ Ctilde(2,2,-i)=b(7,i)
DD(1,1,i)= b(6,i)
DD(2,2,i)=-b(6,i)
DD(2,1,i)= b(8,i)
DD(1,2,i)= b(8,i)
+ DD(1,1,-i)= b(6,i)
+ DD(2,2,-i)=-b(6,i)
+ DD(2,1,-i)=-b(8,i)
+ DD(1,2,-i)=-b(8,i)
Dtilde(1,1,i)=b(6,i)
Dtilde(1,2,i)=b(8,i)
Dtilde(2,1,i)=-b(8,i)
Dtilde(2,2,i)=b(6,i)
+ Dtilde(1,1,-i)=b(6,i)
+ Dtilde(1,2,-i)=-b(8,i)
+ Dtilde(2,1,-i)=b(8,i)
+ Dtilde(2,2,-i)=b(6,i)
EE(1,1,i)= b(10,i)+b(11,i)
EE(2,2,i)=-b(10,i)+b(11,i)
EE(2,1,i)= b(12,i)-b(13,i)
EE(1,2,i)= b(12,i)+b(13,i)
+ EE(1,1,-i)= b(10,i)+b(11,i)
+ EE(2,2,-i)=-b(10,i)+b(11,i)
+ EE(2,1,-i)=-b(12,i)+b(13,i)
+ EE(1,2,-i)=-b(12,i)-b(13,i)
enddo
if (lprint) then
do i=1,nloctyp
enddo
do j=nnt,nct
itj=itype(j)
- if (itype(j).ne.10 .and. (vbld(nres+j)-dsc(itj)).gt.2.0d0) then
+ if (itype(j).ne.10 .and. (vbld(nres+j)-dsc(iabs(itj))).gt.2.0d0)
+ & then
write (iout,*) "Conformation",jjj,jj+1
write (iout,*) "Bad CA-SC bond length",j," ",vbld(nres+j)
write (iout,*) "The Cartesian geometry is:"
ishift=ires-1
if (res.ne.'GLY' .and. res.ne. 'ACE') then
ishift=ishift-1
- itype(1)=21
+ itype(1)=ntyp1
endif
ibeg=0
endif
nstart_sup=1
if (itype(nres).ne.10) then
nres=nres+1
- itype(nres)=21
+ itype(nres)=ntyp1
do j=1,3
dcj=c(j,nres-2)-c(j,nres-3)
c(j,nres)=c(j,nres-1)+dcj
c(j,nres+1)=c(j,1)
c(j,2*nres)=c(j,nres)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
nsup=nsup-1
nstart_sup=2
do j=1,3
do i=1,nres
#ifdef PROCOR
- if (itype(i).eq.21 .or. itype(i+1).eq.21) then
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) then
#else
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
#endif
itel(i)=0
#ifdef PROCOR
- else if (itype(i+1).ne.20) then
+ else if (iabs(itype(i+1)).ne.20) then
#else
- else if (itype(i).ne.20) then
+ else if (iabs(itype(i)).ne.20) then
#endif
itel(i)=1
else
nnt=1
nct=nres
print *,'NNT=',NNT,' NCT=',NCT
- if (itype(1).eq.21) nnt=2
- if (itype(nres).eq.21) nct=nct-1
+ if (itype(1).eq.ntyp1) nnt=2
+ if (itype(nres).eq.ntyp1) nct=nct-1
if (nstart.lt.nnt) nstart=nnt
if (nend.gt.nct .or. nend.eq.0) nend=nct
write (iout,*) "nstart",nstart," nend",nend
if (itype.eq.0) then
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (ucase(nam).eq.restyp(i)) then
rescode=i
return
else
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (nam(1:1).eq.onelet(i)) then
rescode=i
return
#=========================================
if(UNRES_MD_FF STREQUAL "GAB" )
# set preprocesor flags
- set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DCRYST_BOND -DCRYST_THETA -DCRYST_SC" )
+ set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DCRYST_BOND -DCRYST_THETA -DCRYST_SC -DSCCORPDB" )
#=========================================
# Settings for E0LL2Y force field
#=========================================
elseif(UNRES_MD_FF STREQUAL "E0LL2Y")
# set preprocesor flags
- set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0" )
+ set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DSCCORPDB" )
endif(UNRES_MD_FF STREQUAL "GAB")
integer nres,nsup,nstart_sup,nz_start,nz_end,iz_sc,
& nres0,nstart_seq,chain_length,iprzes,tabperm,nperm
double precision c,dc,dc_old,d_c_work,xloc,xrot,dc_norm,t,r,
- & prod,rt,dc_work,cref,crefjlee,chain_rep
+ & prod,rt,dc_work,cref,crefjlee,chain_rep,dc_norm2
common /chain/ c(3,maxres2+2),dc(3,0:maxres2),dc_old(3,0:maxres2),
& xloc(3,maxres),xrot(3,maxres),dc_norm(3,0:maxres2),
+ & dc_norm2(3,0:maxres2),
& dc_work(MAXRES6),nres,nres0
common /rotmat/ t(3,3,maxres),r(3,3,maxres),prod(3,3,maxres),
& rt(3,3,maxres)
& sigmaii(ntyp,ntyp),
& rs0(ntyp,ntyp),chi(ntyp,ntyp),chip(ntyp),alp(ntyp),sigma0(ntyp),
& sigii(ntyp),rr0(ntyp),r0(ntyp,ntyp),r0e(ntyp,ntyp),r0d(ntyp,2),
- & rpp(2,2),epp(2,2),elpp6(2,2),elpp3(2,2),eps_scp(20,2),rscp(20,2)
+ & rpp(2,2),epp(2,2),elpp6(2,2),elpp3(2,2),eps_scp(ntyp,2),
+ & rscp(ntyp,2)
c 12/5/03 modified 09/18/03 Bond stretching parameters.
double precision vbldp0,vbldsc0,akp,aksc,abond0,distchainmax
integer nbondterm
integer inp,iout,igeom,intin,ipdb,imol2,ipdbin,ithep,irotam,
& itorp,itordp,ifourier,ielep,isidep,iscpp,icbase,istat,
& ientin,ientout,izs1,isecpred,ibond,irest2,iifrag,icart,
- & irest1,isccor
+ & irest1,isccor,ithep_pdb,irotam_pdb
common /iounits/ inp,iout,igeom,intin,ipdb,imol2,ipdbin,ithep,
& irotam,itorp,itordp,ifourier,ielep,isidep,iscpp,icbase,
& istat,ientin,ientout,izs1,isecpred,ibond,irest2,iifrag,
- & icart,irest1,isccor
+ & icart,irest1,isccor,ithep_pdb,irotam_pdb
character*256 outname,intname,pdbname,mol2name,statname,intinname,
& entname,prefix,secpred,rest2name,qname,cartname,tmpdir,
& mremd_rst_name,curdir,pref_orig
& icsa_bank_reminimized,icsa_native_int,icsa_in,icsa_pdb
C Parameter files
character*256 bondname,thetname,rotname,torname,tordname,
- & fouriername,elename,sidename,scpname,sccorname,patname
+ & fouriername,elename,sidename,scpname,sccorname,patname,
+ & thetname_pdb,rotname_pdb
common /parfiles/ bondname,thetname,rotname,torname,tordname,
- & fouriername,elename,sidename,scpname,sccorname,patname
+ & fouriername,elename,sidename,scpname,sccorname,patname,
+ & thetname_pdb,rotname_pdb
character*3 pot
C-----------------------------------------------------------------------
C INP - main input file
& sigc0,dsc,dsc_inv,bsc,censc,gaussc,dsc0
integer nlob
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1),
+ & bthet(2,-ntyp:ntyp,-1:1,-1:1),polthet(0:3,-ntyp:ntyp),
+ & gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),sig0(-ntyp:ntyp),
+ & sigc0(-ntyp:ntyp)
C Parameters of the side-chain probability distribution
common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ & dsc0(ntyp1),
& nlob(ntyp1)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
- & ithetyp(ntyp1),nntheterm
- double precision aa0thet(maxthetyp1,maxthetyp1,maxthetyp1),
- & aathet(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1),
- & bbthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ccthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ddthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & eethet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ffthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1),
- & ggthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1)
+ & ithetyp(-ntyp1:ntyp1),nntheterm
+ double precision aa0thet(-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & aathet(maxtheterm,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & bbthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ccthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ddthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & eethet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ffthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2),
+ & ggthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2)
common /theta_abinitio/aa0thet,aathet,bbthet,ccthet,ddthet,eethet,
& ffthet,
& ggthet,ithetyp,nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,
& iphi_end,iphid_start,iphid_end,ibond_start,ibond_end,
& ibondp_start,ibondp_end,ivec_start,ivec_end,iset_start,iset_end,
& iturn3_start,iturn3_end,iturn4_start,iturn4_end,iint_start,
- & iint_end,iphi1_start,iphi1_end,
+ & iint_end,iphi1_start,iphi1_end,itau_start,itau_end,
& ibond_displ(0:max_fg_procs-1),ibond_count(0:max_fg_procs-1),
& ithet_displ(0:max_fg_procs-1),ithet_count(0:max_fg_procs-1),
& iphi_displ(0:max_fg_procs-1),iphi_count(0:max_fg_procs-1),
& ibondp_start,ibondp_end,ivec_start,ivec_end,iset_start,iset_end,
& iturn3_start,iturn3_end,iturn4_start,iturn4_end,iint_start,
& iint_end,iphi1_start,iphi1_end,iint_count,iint_displ,ivec_displ,
- & ivec_count,iset_displ,
+ & ivec_count,iset_displ,itau_start,itau_end,
& iset_count,ibond_displ,ibond_count,ithet_displ,ithet_count,
& iphi_displ,iphi_count,iphi1_displ,iphi1_count
C Inverses of the actual virtual bond lengths
character*3 restyp
character*1 onelet
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),
+ & onelet(-ntyp1:ntyp1)
character*10 ename,wname
integer nprint_ene,print_order
common /namterm/ ename(n_ene),wname(n_ene),nprint_ene,
-C Parameters of the SCCOR term
- double precision v1sccor,v2sccor
- integer nterm_sccor
- common/sccor/v1sccor(maxterm_sccor,20,20),
- & v2sccor(maxterm_sccor,20,20),
- & nterm_sccor
+cc Parameters of the SCCOR term
+ double precision v1sccor,v2sccor,vlor1sccor,
+ & vlor2sccor,vlor3sccor,gloc_sc,
+ & dcostau,dsintau,dtauangle,dcosomicron,
+ & domicron
+ integer nterm_sccor,isccortyp,nsccortyp,nlor_sccor
+ common/sccor/v1sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v2sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v0sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & nterm_sccor(-ntyp:ntyp,-ntyp:ntyp),isccortyp(-ntyp:ntyp),
+ & nsccortyp,
+ & nlor_sccor(-ntyp:ntyp,-ntyp:ntyp),
+ & vlor1sccor(maxterm_sccor,20,20),
+ & vlor2sccor(maxterm_sccor,20,20),
+ & vlor3sccor(maxterm_sccor,20,20),gloc_sc(3,0:maxres2,10),
+ & dcostau(3,3,3,maxres2),dsintau(3,3,3,maxres2),
+ & dtauangle(3,3,3,maxres2),dcosomicron(3,3,3,maxres2),
+ & domicron(3,3,3,maxres2)
C Parameters of the SC rotamers (local) term
double precision sc_parmin
- common/scrot/sc_parmin(maxsccoef,20)
+ common/scrot/sc_parmin(maxsccoef,ntyp)
C Torsional constants of the rotation about virtual-bond dihedral angles
double precision v1,v2,vlor1,vlor2,vlor3,v0
integer itortyp,ntortyp,nterm,nlor,nterm_old
- common/torsion/ v0(maxtor,maxtor),
- & v1(maxterm,maxtor,maxtor),
- & v2(maxterm,maxtor,maxtor),
- & vlor1(maxlor,maxtor,maxtor),
- & vlor2(maxlor,maxtor,maxtor),
- & vlor3(maxlor,maxtor,maxtor),
- & nterm(maxtor,maxtor),
- & nlor(maxtor,maxtor),
- & nterm_old,
- & itortyp(ntyp),
- & ntortyp
+ common/torsion/v0(-maxtor:maxtor,-maxtor:maxtor,2),
+ & v1(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & v2(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & vlor1(maxlor,-maxtor:maxtor,-maxtor:maxtor),
+ & vlor2(maxlor,maxtor,maxtor),vlor3(maxlor,maxtor,maxtor),
+ & itortyp(-ntyp1:ntyp1),ntortyp,
+ & nterm(-maxtor:maxtor,-maxtor:maxtor,2),
+ & nlor(-maxtor:maxtor,-maxtor:maxtor,2)
+ & ,nterm_old
C 6/23/01 - constants for double torsionals
double precision v1c,v1s,v2c,v2s
integer ntermd_1,ntermd_2
- common /torsiond/ v1c(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v1s(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v2c(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & v2s(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & ntermd_1(maxtor,maxtor,maxtor),ntermd_2(maxtor,maxtor,maxtor)
+ common /torsiond/
+ &v1c(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v1s(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v2c(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ &v2s(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ & ntermd_1(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ & ntermd_2(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2)
C 9/18/99 - added Fourier coeffficients of the expansion of local energy
C surface
- double precision b1,b2,cc,dd,ee,ctilde,dtilde,b2tilde
+ double precision b1,b2,cc,dd,ee,ctilde,dtilde,b2tilde,b1tilde
integer nloctyp
- common/fourier/ b1(2,maxtor),b2(2,maxtor),cc(2,2,maxtor),
- & dd(2,2,maxtor),ee(2,2,maxtor),ctilde(2,2,maxtor),
- & dtilde(2,2,maxtor),b1tilde(2,maxtor),nloctyp
+ common/fourier/ b1(2,-maxtor:maxtor),b2(2,-maxtor:maxtor)
+ & ,cc(2,2,-maxtor:maxtor),
+ & dd(2,2,-maxtor:maxtor),ee(2,2,-maxtor:maxtor),
+ & ctilde(2,2,-maxtor:maxtor),
+ & dtilde(2,2,-maxtor:maxtor),b1tilde(2,-maxtor:maxtor),nloctyp
& mask_theta,mask_phi,mask_side
double precision theta,phi,alph,omeg,varsave,esave,varall,vbld,
& thetaref,phiref,costtab,sinttab,cost2tab,sint2tab,
+ & tauangle,omicron,
& xxtab,yytab,zztab,xxref,yyref,zzref
common /var/ theta(maxres),phi(maxres),alph(maxres),omeg(maxres),
& vbld(2*maxres),thetaref(maxres),phiref(maxres),
& costtab(maxres), sinttab(maxres), cost2tab(maxres),
+ & omicron(2,maxres),tauangle(3,maxres),
& sint2tab(maxres),xxtab(maxres),yytab(maxres),
& zztab(maxres),xxref(maxres),yyref(maxres),zzref(maxres),
& ialph(maxres,2),ivar(4*maxres2),ntheta,nphi,nside,nvar
c parameter (maxconts=50)
C Number of AA types (at present only natural AA's will be handled
integer ntyp,ntyp1
- parameter (ntyp=20,ntyp1=ntyp+1)
+ parameter (ntyp=24,ntyp1=ntyp+1)
C Max. number of types of dihedral angles & multiplicity of torsional barriers
C and the number of terms in double torsionals
integer maxtor,maxterm,maxlor,maxtermd_1,maxtermd_2
& mmaxtheterm=maxtheterm)
c Max number of torsional terms in SCCOR
integer maxterm_sccor
- parameter (maxterm_sccor=3)
+ parameter (maxterm_sccor=6)
C Max. number of lobes in SC distribution
integer maxlob
parameter (maxlob=4)
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
ind=ind+1
v_work(ind)=d_t(j,i+nres)
double precision difftol /1.0d-5/
nbond=nct-nnt
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) nbond=nbond+1
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) nbond=nbond+1
enddo
c
if (lprn1) then
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
ind1=ind1+1
do j=1,3
Bmat(ind+j,ind1)=dC_norm(j,i+nres)
Td(i)=Td(i)+vbl*Tmat(i,ind)
enddo
do k=nnt,nct
- if (itype(k).ne.10 .and. itype(i).ne.21) then
+ if (itype(k).ne.10 .and. itype(i).ne.ntyp1) then
ind=ind+1
Td(i)=Td(i)+vbldsc0(1,itype(k))*Tmat(i,ind)
endif
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
ind=ind+1
zapas(ind)=-gxcart(j,i)+stochforcvec(ind)
& i,(dC(j,i),j=1,3),xx
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
ind=ind+1
xx=vbld(i+nres)-vbldsc0(1,itype(i))
write (iout,'(i5,3f10.5,5x,f10.5,e15.5)')
endif
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
ind=ind+1
blen2 = scalar(dc(1,i+nres),dc(1,i+nres))
ppvec(ind)=2*vbldsc0(1,itype(i))**2-blen2
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc(j,i+nres)=zapas(ind+j)
dc_work(ind+j)=zapas(ind+j)
& i,(dC(j,i),j=1,3),xx
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
ind=ind+1
xx=vbld(i+nres)-vbldsc0(1,itype(i))
write (iout,'(i5,3f10.5,5x,f10.5,e15.5)')
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t(j,inres)+0.5d0*d_a(j,inres)*d_time
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
adt=d_a_old(j,inres)*d_time
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_new(j,inres)+0.5d0*d_a(j,inres)*d_time
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
adt=(d_a_old(j,inres)+d_af_work(ind+j))*d_time
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_new(j,inres)+(0.5d0*(d_a(j,inres)
do j=1,3
accel(j)=aux(j)
enddo
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
accel(j)=accel(j)+d_a(j,i+nres)-d_a_old(j,i+nres)
enddo
enddo
endif
c Side chains
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
epdriftij=
& dabs((d_a(j,i+nres)-d_a_old(j,i+nres))*gxcart(j,i))
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=fact*d_t(j,inres)
stdforcp(i)=stdfp*dsqrt(gamp)
enddo
do i=nnt,nct
- stdforcsc(i)=stdfsc(itype(i))*dsqrt(gamsc(itype(i)))
+ stdforcsc(i)=stdfsc(itype(i))*dsqrt(gamsc(iabs(itype(i))))
enddo
endif
c Open the pdb file for snapshotshots
do i=nnt,nct-1
do j=1,3
ind=ind+1
- if (itype(i).ne.21 .and. itype(i+1).ne.21) then
+ if (itype(i).ne.ntyp1 .and. itype(i+1).ne.ntyp1) then
d_t(j,i)=d_t_work(ind)
else
d_t(j,i)=0.0d0
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
ind=ind+1
d_t(j,i+nres)=d_t_work(ind)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc_work(ind+j)=dc_old(j,i+nres)
d_t_work(ind+j)=d_t_old(j,i+nres)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
dc(j,inres)=dc_work(ind+j)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_work(ind+j)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc_work(ind+j)=dc_old(j,i+nres)
d_t_work(ind+j)=d_t_old(j,i+nres)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
dc(j,inres)=dc_work(ind+j)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_work(ind+j)
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
ind=ind+1
v_work(ind)=d_t(j,i+nres)
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t(j,inres)+0.5d0*d_a(j,inres)*d_time
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
adt=d_a_old(j,inres)*d_time
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_new(j,inres)+0.5d0*d_a(j,inres)*d_time
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
adt=(d_a_old(j,inres)+d_af_work(ind+j))*d_time
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_new(j,inres)+(0.5d0*(d_a(j,inres)
c if (dabs(accel(j)).gt.amax) amax=dabs(accel(j))
if (dabs(accel(j)).gt.dabs(accel_old(j))) then
dacc=dabs(accel(j)-accel_old(j))
+c write (iout,*) i,dacc
if (dacc.gt.amax) amax=dacc
endif
enddo
enddo
endif
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
c accel(j)=accel(j)+d_a(j,i+nres)-d_a_old(j,i+nres)
accel_old(j)=accel_old(j)+d_a_old(j,i+nres)
c if (dabs(accel(j)).gt.amax) amax=dabs(accel(j))
if (dabs(accel(j)).gt.dabs(accel_old(j))) then
dacc=dabs(accel(j)-accel_old(j))
+c write (iout,*) "side-chain",i,dacc
if (dacc.gt.amax) amax=dacc
endif
enddo
enddo
endif
c Side chains
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
epdriftij=
& dabs((d_a(j,i+nres)-d_a_old(j,i+nres))*gxcart(j,i))
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=fact*d_t(j,inres)
stdforcp(i)=stdfp*dsqrt(gamp)
enddo
do i=nnt,nct
- stdforcsc(i)=stdfsc(itype(i))*dsqrt(gamsc(itype(i)))
+ stdforcsc(i)=stdfsc(iabs(itype(i)))
+ & *dsqrt(gamsc(iabs(itype(i))))
enddo
endif
c Open the pdb file for snapshotshots
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
ind=ind+1
d_t(j,i+nres)=d_t_work(ind)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc_work(ind+j)=dc_old(j,i+nres)
d_t_work(ind+j)=d_t_old(j,i+nres)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_work(ind+j)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc_work(ind+j)=dc_old(j,i+nres)
d_t_work(ind+j)=d_t_old(j,i+nres)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
dc(j,inres)=dc_work(ind+j)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
do j=1,3
d_t(j,inres)=d_t_work(ind+j)
CPPFLAGS = -DLINUX -DUNRES -DMP -DMPI \
-DPGI -DSPLITELE -DISNAN -DAMD64 \
-DPROCOR -DLANG0 \
- -DCRYST_BOND -DCRYST_THETA -DCRYST_SC
+ -DSCCORPDB
+# -DCRYST_BOND -DCRYST_THETA -DCRYST_SC
+# -DSCCORPDB
## -DPROCOR
## -DMOMENT
#-DCO_BIAS
#FC= /usr/local/opt/intel/compiler60/ia32/bin/ifc
FC= ifort
-OPT = -O3 -ip -w
-
+#OPT = -O3 -ip -w
+OPT = -g -CB
+#OPT = -g
CFLAGS = -DSGI -c
FFLAGS = -c ${OPT} -I$(INSTALL_DIR)/include
FFLAGS2 = -c -w -O0 -I$(INSTALL_DIR)/include
FFLAGSE = -c -w -O3 -ipo -ipo_obj -opt_report -I$(INSTALL_DIR)/include
-BIN = ../../../bin/unres/MD/unres_Tc_procor_oldparm_em64-D-symetr.exe
-#LIBS = -L$(INSTALL_DIR)/lib_pgi -lmpich ../../lib/xdrf/libxdrf.a
+BIN = ../../../bin/unres/MD-M/unres_Tc_procor_newparm_em64-D-symetr.exe
+#LIBS = -L$(INSTALL_DIR)/lib_pgi -lmpich xdrf/libxdrf.a
#LIBS = -L$(INSTALL_DIR)/lib_ifort -lmpich xdrf/libxdrf.a
-LIBS = -L$(INSTALL_DIR)/lib -lmpich xdrf/libxdrf.a -g -d2 -CA -CB
+LIBS = -L$(INSTALL_DIR)/lib -lmpich ../../lib/xdrf_em64/libxdrf.a -g -d2 -CA -CB
ARCH = LINUX
PP = /lib/cpp -P
& +(c(j,i+1)-c(j,i))/dnorm2)
enddo
be=0.0D0
- if (i.gt.2) phi(i+1)=beta(i-2,i-1,i,i+1)
+ if (i.gt.2) then
+ if (i.le.nres) phi(i+1)=beta(i-2,i-1,i,i+1)
+ if ((itype(i).ne.10).and.(itype(i-1).ne.10)) then
+ tauangle(3,i+1)=beta(i+nres-1,i-1,i,i+nres)
+ endif
+ if (itype(i-1).ne.10) then
+ tauangle(1,i+1)=beta(i-1+nres,i-1,i,i+1)
+ omicron(1,i)=alpha(i-2,i-1,i-1+nres)
+ omicron(2,i)=alpha(i-1+nres,i-1,i)
+ endif
+ if (itype(i).ne.10) then
+ tauangle(2,i+1)=beta(i-2,i-1,i,i+nres)
+ endif
+ endif
omeg(i)=beta(nres+i,i,maxres2,i+1)
alph(i)=alpha(nres+i,i,maxres2)
theta(i+1)=alpha(i-1,i,i+1)
--- /dev/null
+C DO NOT EDIT THIS FILE - IT HAS BEEN GENERATED BY COMPINFO.C
+C 2 3 3491
+ subroutine cinfo
+ include 'COMMON.IOUNITS'
+ write(iout,*)'++++ Compile info ++++'
+ write(iout,*)'Version 2.3 build 3491'
+ write(iout,*)'compiled Wed Dec 12 07:17:09 2012'
+ write(iout,*)'compiled by aks255@matrix.chem.cornell.edu'
+ write(iout,*)'OS name: Linux '
+ write(iout,*)'OS release: 2.6.34.9-69.fc13.x86_64 '
+ write(iout,*)'OS version:',
+ & ' #1 SMP Tue May 3 09:23:03 UTC 2011 '
+ write(iout,*)'flags:'
+ write(iout,*)'CPPFLAGS = -DLINUX -DUNRES -DMP -DMPI \\'
+ write(iout,*)' -DPGI -DSPLITELE -DISNAN -DAMD64 \\'
+ write(iout,*)' -DPROCOR -DLANG0 \\'
+ write(iout,*)' -DSCCORPDB '
+ write(iout,*)'INSTALL_DIR = /users/software/mpich-1.2.7p1_int...'
+ write(iout,*)'FC= ifort'
+ write(iout,*)'OPT = -g -CB'
+ write(iout,*)'CFLAGS = -DSGI -c'
+ write(iout,*)'FFLAGS = -c ${OPT} -I$(INSTALL_DIR)/include'
+ write(iout,*)'FFLAGS1 = -c -w -g -d2 -CA -CB -I$(INSTALL_DIR)...'
+ write(iout,*)'FFLAGS2 = -c -w -O0 -I$(INSTALL_DIR)/include'
+ write(iout,*)'FFLAGSE = -c -w -O3 -ipo -ipo_obj -opt_report ...'
+ write(iout,*)'BIN = ../../../bin/unres/MD-M/unres_Tc_procor_n...'
+ write(iout,*)'LIBS = -L$(INSTALL_DIR)/lib -lmpich ../../lib/x...'
+ write(iout,*)'ARCH = LINUX'
+ write(iout,*)'PP = /lib/cpp -P'
+ write(iout,*)'object = unres.o arcos.o cartprint.o chainbuild...'
+ write(iout,*)'++++ End of compile info ++++'
+ return
+ end
ncont=0
kkk=3
do i=nnt+kkk,nct
- iti=itype(i)
+ iti=iabs(itype(i))
do j=nnt,i-kkk
- itj=itype(j)
+ itj=iabs(itype(j))
if (ipot.ne.4) then
c rcomp=sigmaii(iti,itj)+1.0D0
rcomp=facont*sigmaii(iti,itj)
ees=0.0
evdw=0.0
do 1 i=nnt,nct-2
- if (itype(i).eq.21 .or. itype(i+1).eq.21) goto 1
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) goto 1
xi=c(1,i)
yi=c(2,i)
zi=c(3,i)
ymedi=yi+0.5*dyi
zmedi=zi+0.5*dzi
do 4 j=i+2,nct-1
- if (itype(j).eq.21 .or. itype(j+1).eq.21) goto 4
+ if (itype(j).eq.ntyp1 .or. itype(j+1).eq.ntyp1) goto 4
ind=ind+1
iteli=itel(i)
itelj=itel(j)
evdw=0.0D0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
evdw=0.0D0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
evdw=0.0D0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
evdw=0.0D0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
ind=0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
ind=0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
ind=0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
c write (iout,*) "j",j,dsc_inv(itypj),dscj_inv,
ind=0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
c write (iout,*) "j",j,dsc_inv(itypj),dscj_inv,
ind=0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
ind=0
do i=iatsc_s,iatsc_e
itypi=itype(i)
- if (itypi.eq.21) cycle
+ if (itypi.eq.ntyp1) cycle
itypi1=itype(i+1)
xi=c(1,nres+i)
yi=c(2,nres+i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
C Loop over i,i+2 and i,i+3 pairs of the peptide groups
C
do i=iturn3_start,iturn3_end
- if (itype(i).eq.21 .or. itype(i+1).eq.21
- & .or. itype(i+2).eq.21 .or. itype(i+3).eq.21) cycle
+ if (itype(i).eq.ntyp1.or. itype(i+1).eq.ntyp1
+ & .or. itype(i+2).eq.ntyp1 .or. itype(i+3).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
num_cont_hb(i)=num_conti
enddo
do i=iturn4_start,iturn4_end
- if (itype(i).eq.21 .or. itype(i+1).eq.21
- & .or. itype(i+3).eq.21
- & .or. itype(i+4).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1
+ & .or. itype(i+3).eq.ntyp1
+ & .or. itype(i+4).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
zmedi=c(3,i)+0.5d0*dzi
num_conti=num_cont_hb(i)
call eelecij_scale(i,i+3,ees,evdw1,eel_loc)
- if (wturn4.gt.0.0d0 .and. itype(i+2).ne.21)
+ if (wturn4.gt.0.0d0 .and. itype(i+2).ne.ntyp1)
& call eturn4(i,eello_turn4)
num_cont_hb(i)=num_conti
enddo ! i
c Loop over all pairs of interacting peptide groups except i,i+2 and i,i+3
c
do i=iatel_s,iatel_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
c write (iout,*) 'i',i,' ielstart',ielstart(i),' ielend',ielend(i)
num_conti=num_cont_hb(i)
do j=ielstart(i),ielend(i)
- if (itype(j).eq.21 .or. itype(j+1).eq.21) cycle
+ if (itype(j).eq.ntyp1 .or. itype(j+1).eq.ntyp1) cycle
call eelecij_scale(i,j,ees,evdw1,eel_loc)
enddo ! j
num_cont_hb(i)=num_conti
c & " iatel_e_vdw",iatel_e_vdw
call flush(iout)
do i=iatel_s_vdw,iatel_e_vdw
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1.or. itype(i+1).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
c & ' ielend',ielend_vdw(i)
call flush(iout)
do j=ielstart_vdw(i),ielend_vdw(i)
- if (itype(j).eq.21 .or. itype(j+1).eq.21) cycle
+ if (itype(j).eq.ntyp1 .or. itype(j+1).eq.ntyp1) cycle
ind=ind+1
iteli=itel(i)
itelj=itel(j)
cd print '(a)','Enter ESCP'
cd write (iout,*) 'iatscp_s=',iatscp_s,' iatscp_e=',iatscp_e
do i=iatscp_s,iatscp_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
iteli=itel(i)
xi=0.5D0*(c(1,i)+c(1,i+1))
yi=0.5D0*(c(2,i)+c(2,i+1))
do j=iscpstart(i,iint),iscpend(i,iint)
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
cd print '(a)','Enter ESCP'
cd write (iout,*) 'iatscp_s=',iatscp_s,' iatscp_e=',iatscp_e
do i=iatscp_s,iatscp_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
iteli=itel(i)
xi=0.5D0*(c(1,i)+c(1,i+1))
yi=0.5D0*(c(2,i)+c(2,i+1))
do j=iscpstart(i,iint),iscpend(i,iint)
itypj=itype(j)
- if (itypj.eq.21) cycle
+ if (itypj.eq.ntyp1) cycle
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
energia(17)=estr
energia(20)=Uconst+Uconst_back
energia(21)=esccor
+c Here are the energies showed per procesor if the are more processors
+c per molecule then we sum it up in sum_energy subroutine
c print *," Processor",myrank," calls SUM_ENERGY"
call sum_energy(energia,.true.)
c print *," Processor",myrank," left SUM_ENERGY"
#ifdef MPI
include 'mpif.h'
double precision gradbufc(3,maxres),gradbufx(3,maxres),
- & glocbuf(4*maxres),gradbufc_sum(3,maxres)
+ & glocbuf(4*maxres),gradbufc_sum(3,maxres),gloc_scbuf(3,maxres)
#endif
include 'COMMON.SETUP'
include 'COMMON.IOUNITS'
include 'COMMON.CONTROL'
include 'COMMON.TIME1'
include 'COMMON.MAXGRAD'
+ include 'COMMON.SCCOR'
#ifdef TIMING
time01=MPI_Wtime()
#endif
& +wturn3*gel_loc_turn3(i)
& +wturn6*gel_loc_turn6(i)
& +wel_loc*gel_loc_loc(i)
- & +wsccor*gsccor_loc(i)
enddo
#ifdef DEBUG
write (iout,*) "gloc after adding corr"
do i=1,4*nres
glocbuf(i)=gloc(i,icg)
enddo
+#define DEBUG
+#ifdef DEBUG
+ write (iout,*) "gloc_sc before reduce"
+ do i=1,nres
+ do j=1,1
+ write (iout,*) i,j,gloc_sc(j,i,icg)
+ enddo
+ enddo
+#endif
+#undef DEBUG
+ do i=1,nres
+ do j=1,3
+ gloc_scbuf(j,i)=gloc_sc(j,i,icg)
+ enddo
+ enddo
time00=MPI_Wtime()
call MPI_Barrier(FG_COMM,IERR)
time_barrier_g=time_barrier_g+MPI_Wtime()-time00
call MPI_Reduce(glocbuf(1),gloc(1,icg),4*nres,
& MPI_DOUBLE_PRECISION,MPI_SUM,king,FG_COMM,IERR)
time_reduce=time_reduce+MPI_Wtime()-time00
+ call MPI_Reduce(gloc_scbuf(1,1),gloc_sc(1,1,icg),3*nres,
+ & MPI_DOUBLE_PRECISION,MPI_SUM,king,FG_COMM,IERR)
+ time_reduce=time_reduce+MPI_Wtime()-time00
+#define DEBUG
+#ifdef DEBUG
+ write (iout,*) "gloc_sc after reduce"
+ do i=1,nres
+ do j=1,1
+ write (iout,*) i,j,gloc_sc(j,i,icg)
+ enddo
+ enddo
+#endif
+#undef DEBUG
#ifdef DEBUG
write (iout,*) "gloc after reduce"
do i=1,4*nres
c write(iout,*)'Entering ELJ nnt=',nnt,' nct=',nct,' expon=',expon
evdw=0.0D0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
cd write (iout,*) 'i=',i,' iint=',iint,' istart=',istart(i,iint),
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c print *,'Entering ELJK nnt=',nnt,' nct=',nct,' expon=',expon
evdw=0.0D0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
C
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c endif
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
c if (icall.eq.0) lprn=.false.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
c write (iout,*) "j",j,dsc_inv(itypj),dscj_inv,
c if (icall.eq.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
cd print *,'Entering Esoft_sphere nnt=',nnt,' nct=',nct
evdw=0.0D0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
cd write (iout,*) 'i=',i,' iint=',iint,' istart=',istart(i,iint),
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
eello_turn4=0.0d0
ind=0
do i=iatel_s,iatel_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
num_conti=0
c write (iout,*) 'i',i,' ielstart',ielstart(i),' ielend',ielend(i)
do j=ielstart(i),ielend(i)
- if (itype(j).eq.21 .or. itype(j+1).eq.21) cycle
+ if (itype(j).eq.ntyp1 .or. itype(j+1).eq.ntyp1) cycle
ind=ind+1
iteli=itel(i)
itelj=itel(j)
enddo
c if (i.gt. iatel_s+1 .and. i.lt.iatel_e+4) then
if (i.gt. nnt+1 .and. i.lt.nct+1) then
- iti1 = itortyp(itype(i-1))
+ if (itype(i-1).le.ntyp) then
+ iti1 = itortyp(itype(i-1))
+ else
+ iti1=ntortyp+1
+ endif
else
iti1=ntortyp+1
endif
C Loop over i,i+2 and i,i+3 pairs of the peptide groups
C
do i=iturn3_start,iturn3_end
- if (itype(i).eq.21 .or. itype(i+1).eq.21
- & .or. itype(i+2).eq.21 .or. itype(i+3).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1
+ & .or. itype(i+2).eq.ntyp1 .or. itype(i+3).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
num_cont_hb(i)=num_conti
enddo
do i=iturn4_start,iturn4_end
- if (itype(i).eq.21 .or. itype(i+1).eq.21
- & .or. itype(i+3).eq.21
- & .or. itype(i+4).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1
+ & .or. itype(i+3).eq.ntyp1
+ & .or. itype(i+4).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
zmedi=c(3,i)+0.5d0*dzi
num_conti=num_cont_hb(i)
call eelecij(i,i+3,ees,evdw1,eel_loc)
- if (wturn4.gt.0.0d0 .and. itype(i+2).ne.21)
+ if (wturn4.gt.0.0d0 .and. itype(i+2).ne.ntyp1)
& call eturn4(i,eello_turn4)
num_cont_hb(i)=num_conti
enddo ! i
c Loop over all pairs of interacting peptide groups except i,i+2 and i,i+3
c
do i=iatel_s,iatel_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
dxi=dc(1,i)
dyi=dc(2,i)
dzi=dc(3,i)
num_conti=num_cont_hb(i)
do j=ielstart(i),ielend(i)
c write (iout,*) i,j,itype(i),itype(j)
- if (itype(j).eq.21 .or. itype(j+1).eq.21) cycle
+ if (itype(j).eq.ntyp1.or. itype(j+1).eq.ntyp1) cycle
call eelecij(i,j,ees,evdw1,eel_loc)
enddo ! j
num_cont_hb(i)=num_conti
cd & xmedi,ymedi,zmedi,xj,yj,zj
if (energy_dec) then
- write (iout,'(a6,2i5,0pf7.3)') 'evdw1',i,j,evdwij
+ write (iout,'(a6,2i5,0pf7.3,2i5,2e11.3)')
+ &'evdw1',i,j,evdwij
+ &,iteli,itelj,aaa,evdw1
write (iout,'(a6,2i5,0pf7.3)') 'ees',i,j,eesij
endif
if (energy_dec) write (iout,'(a6,2i5,0pf7.3)')
& 'eelloc',i,j,eel_loc_ij
+c write (iout,*) a22,muij(1),a23,muij(2),a32,muij(3)
eel_loc=eel_loc+eel_loc_ij
C Partial derivatives in virtual-bond dihedral angles gamma
cd print '(a)','Enter ESCP'
cd write (iout,*) 'iatscp_s=',iatscp_s,' iatscp_e=',iatscp_e
do i=iatscp_s,iatscp_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
iteli=itel(i)
xi=0.5D0*(c(1,i)+c(1,i+1))
yi=0.5D0*(c(2,i)+c(2,i+1))
do iint=1,nscp_gr(i)
do j=iscpstart(i,iint),iscpend(i,iint)
- if (itype(j).eq.21) cycle
- itypj=itype(j)
+ if (itype(j).eq.ntyp1) cycle
+ itypj=iabs(itype(j))
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
cd print '(a)','Enter ESCP'
cd write (iout,*) 'iatscp_s=',iatscp_s,' iatscp_e=',iatscp_e
do i=iatscp_s,iatscp_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
iteli=itel(i)
xi=0.5D0*(c(1,i)+c(1,i+1))
yi=0.5D0*(c(2,i)+c(2,i+1))
do iint=1,nscp_gr(i)
do j=iscpstart(i,iint),iscpend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
endif
evdwij=e1+e2
evdw2=evdw2+evdwij
- if (energy_dec) write (iout,'(a6,2i5,0pf7.3)')
- & 'evdw2',i,j,evdwij
+ if (energy_dec) write (iout,'(a6,2i5,0pf7.3,2i3,3e11.3)')
+ & 'evdw2',i,j,evdwij,iteli,itypj,fac,aad(itypj,iteli),
+ & bad(itypj,iteli)
C
C Calculate contributions to the gradient in the virtual-bond and SC vectors.
C
cd write (iout,*) "i",i," ii",ii," iii",iii," jj",jj," jjj",jjj
C 24/11/03 AL: SS bridges handled separately because of introducing a specific
C distance and angle dependent SS bond potential.
- if (ii.gt.nres .and. itype(iii).eq.1 .and. itype(jjj).eq.1) then
+ if (ii.gt.nres .and. iabs(itype(iii)).eq.1 .and.
+ & iabs(itype(jjj)).eq.1) then
call ssbond_ene(iii,jjj,eij)
ehpb=ehpb+2*eij
cd write (iout,*) "eij",eij
include 'COMMON.VAR'
include 'COMMON.IOUNITS'
double precision erij(3),dcosom1(3),dcosom2(3),gg(3)
- itypi=itype(i)
+ itypi=iabs(itype(i))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
dzi=dc_norm(3,nres+i)
c dsci_inv=dsc_inv(itypi)
dsci_inv=vbld_inv(nres+i)
- itypj=itype(j)
+ itypj=iabs(itype(j))
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(nres+j)
xj=c(1,nres+j)-xi
estr=0.0d0
estr1=0.0d0
do i=ibondp_start,ibondp_end
- if (itype(i-1).eq.21 .or. itype(i).eq.21) then
+ if (itype(i-1).eq.ntyp1 .or. itype(i).eq.ntyp1) then
estr1=estr1+gnmr1(vbld(i),-1.0d0,distchainmax)
do j=1,3
gradb(j,i-1)=gnmr1prim(vbld(i),-1.0d0,distchainmax)
c 09/18/07 AL: multimodal bond potential based on AM1 CA-SC PMF's included
c
do i=ibond_start,ibond_end
- iti=itype(i)
- if (iti.ne.10 .and. iti.ne.21) then
+ iti=iabs(itype(i))
+ if (iti.ne.10 .and. iti.ne.ntyp1) then
nbi=nbondterm(iti)
if (nbi.eq.1) then
diff=vbld(i+nres)-vbldsc0(1,iti)
etheta=0.0D0
c write (*,'(a,i2)') 'EBEND ICG=',icg
do i=ithet_start,ithet_end
- if (itype(i-1).eq.21) cycle
+ if (itype(i-1).eq.ntyp1) cycle
C Zero the energy function and its derivative at 0 or pi.
call splinthet(theta(i),0.5d0*delta,ss,ssd)
it=itype(i-1)
- if (i.gt.3 .and. itype(i-2).ne.21) then
+ ichir1=isign(1,itype(i-2))
+ ichir2=isign(1,itype(i))
+ if (itype(i-2).eq.10) ichir1=isign(1,itype(i-1))
+ if (itype(i).eq.10) ichir2=isign(1,itype(i-1))
+ if (itype(i-1).eq.10) then
+ itype1=isign(10,itype(i-2))
+ ichir11=isign(1,itype(i-2))
+ ichir12=isign(1,itype(i-2))
+ itype2=isign(10,itype(i))
+ ichir21=isign(1,itype(i))
+ ichir22=isign(1,itype(i))
+ endif
+
+ if (i.gt.3 .and. itype(i-2).ne.ntyp1) then
#ifdef OSF
phii=phi(i)
if (phii.ne.phii) phii=150.0
y(1)=0.0D0
y(2)=0.0D0
endif
- if (i.lt.nres .and. itype(i).ne.21) then
+ if (i.lt.nres .and. itype(i).ne.ntyp1) then
#ifdef OSF
phii1=phi(i+1)
if (phii1.ne.phii1) phii1=150.0
C In following comments this theta will be referred to as t_c.
thet_pred_mean=0.0d0
do k=1,2
- athetk=athet(k,it)
- bthetk=bthet(k,it)
- thet_pred_mean=thet_pred_mean+athetk*y(k)+bthetk*z(k)
+ athetk=athet(k,it,ichir1,ichir2)
+ bthetk=bthet(k,it,ichir1,ichir2)
+ if (it.eq.10) then
+ athetk=athet(k,itype1,ichir11,ichir12)
+ bthetk=bthet(k,itype2,ichir21,ichir22)
+ endif
+ thet_pred_mean=thet_pred_mean+athetk*y(k)+bthetk*z(k)
enddo
dthett=thet_pred_mean*ssd
thet_pred_mean=thet_pred_mean*ss+a0thet(it)
C Derivatives of the "mean" values in gamma1 and gamma2.
- dthetg1=(-athet(1,it)*y(2)+athet(2,it)*y(1))*ss
- dthetg2=(-bthet(1,it)*z(2)+bthet(2,it)*z(1))*ss
+ dthetg1=(-athet(1,it,ichir1,ichir2)*y(2)
+ &+athet(2,it,ichir1,ichir2)*y(1))*ss
+ dthetg2=(-bthet(1,it,ichir1,ichir2)*z(2)
+ & +bthet(2,it,ichir1,ichir2)*z(1))*ss
+ if (it.eq.10) then
+ dthetg1=(-athet(1,itype1,ichir11,ichir12)*y(2)
+ &+athet(2,itype1,ichir11,ichir12)*y(1))*ss
+ dthetg2=(-bthet(1,itype2,ichir21,ichir22)*z(2)
+ & +bthet(2,itype2,ichir21,ichir22)*z(1))*ss
+ endif
if (theta(i).gt.pi-delta) then
call theteng(pi-delta,thet_pred_mean,theta0(it),f0,fprim0,
& E_tc0)
logical lprn /.false./, lprn1 /.false./
etheta=0.0D0
do i=ithet_start,ithet_end
- if (itype(i-1).eq.21) cycle
+ if (itype(i-1).eq.ntyp1) cycle
+ if (iabs(itype(i+1)).eq.20) iblock=2
+ if (iabs(itype(i+1)).ne.20) iblock=1
dethetai=0.0d0
dephii=0.0d0
dephii1=0.0d0
theti2=0.5d0*theta(i)
- ityp2=ithetyp(itype(i-1))
+ ityp2=ithetyp((itype(i-1)))
do k=1,nntheterm
coskt(k)=dcos(k*theti2)
sinkt(k)=dsin(k*theti2)
enddo
- if (i.gt.3 .and. itype(i-2).ne.21) then
+ if (i.gt.3 .and. itype(i-2).ne.ntyp1) then
#ifdef OSF
phii=phi(i)
if (phii.ne.phii) phii=150.0
#else
phii=phi(i)
#endif
- ityp1=ithetyp(itype(i-2))
+ ityp1=ithetyp((itype(i-2)))
+C propagation of chirality for glycine type
do k=1,nsingle
cosph1(k)=dcos(k*phii)
sinph1(k)=dsin(k*phii)
sinph1(k)=0.0d0
enddo
endif
- if (i.lt.nres .and. itype(i).ne.21) then
+ if (i.lt.nres .and. itype(i).ne.ntyp1) then
#ifdef OSF
phii1=phi(i+1)
if (phii1.ne.phii1) phii1=150.0
#else
phii1=phi(i+1)
#endif
- ityp3=ithetyp(itype(i))
+ ityp3=ithetyp((itype(i)))
do k=1,nsingle
cosph2(k)=dcos(k*phii1)
sinph2(k)=dsin(k*phii1)
sinph2(k)=0.0d0
enddo
endif
- ethetai=aa0thet(ityp1,ityp2,ityp3)
+ ethetai=aa0thet(ityp1,ityp2,ityp3,iblock)
do k=1,ndouble
do l=1,k-1
ccl=cosph1(l)*cosph2(k-l)
enddo
endif
do k=1,ntheterm
- ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3)*sinkt(k)
- dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3)
+ ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3,iblock)*sinkt(k)
+ dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3,iblock)
& *coskt(k)
if (lprn)
- & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3),
+ & write (iout,*) "k",k,"
+ & aathet",aathet(k,ityp1,ityp2,ityp3,iblock),
& " ethetai",ethetai
enddo
if (lprn) then
endif
do m=1,ntheterm2
do k=1,nsingle
- aux=bbthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)
- & +ccthet(k,m,ityp1,ityp2,ityp3)*sinph1(k)
- & +ddthet(k,m,ityp1,ityp2,ityp3)*cosph2(k)
- & +eethet(k,m,ityp1,ityp2,ityp3)*sinph2(k)
+ aux=bbthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)
+ & +ccthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k)
+ & +ddthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)
+ & +eethet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*aux*coskt(m)
dephii=dephii+k*sinkt(m)*(
- & ccthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)-
- & bbthet(k,m,ityp1,ityp2,ityp3)*sinph1(k))
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)-
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k))
dephii1=dephii1+k*sinkt(m)*(
- & eethet(k,m,ityp1,ityp2,ityp3)*cosph2(k)-
- & ddthet(k,m,ityp1,ityp2,ityp3)*sinph2(k))
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)-
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k))
if (lprn)
& write (iout,*) "m",m," k",k," bbthet",
- & bbthet(k,m,ityp1,ityp2,ityp3)," ccthet",
- & ccthet(k,m,ityp1,ityp2,ityp3)," ddthet",
- & ddthet(k,m,ityp1,ityp2,ityp3)," eethet",
- & eethet(k,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)," ccthet",
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)," ddthet",
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)," eethet",
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)," ethetai",ethetai
enddo
enddo
if (lprn)
do m=1,ntheterm3
do k=2,ndouble
do l=1,k-1
- aux=ffthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)
+ aux=ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*coskt(m)*aux
dephii=dephii+l*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)-
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)-
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
dephii1=dephii1+(k-l)*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)-
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)-
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
if (lprn) then
write (iout,*) "m",m," k",k," l",l," ffthet",
- & ffthet(l,k,m,ityp1,ityp2,ityp3),
- & ffthet(k,l,m,ityp1,ityp2,ityp3)," ggthet",
- & ggthet(l,k,m,ityp1,ityp2,ityp3),
- & ggthet(k,l,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & ffthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ggthet",
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock),
+ & " ethetai",ethetai
write (iout,*) cosph1ph2(l,k)*sinkt(m),
& cosph1ph2(k,l)*sinkt(m),
& sinph1ph2(l,k)*sinkt(m),sinph1ph2(k,l)*sinkt(m)
enddo
enddo
10 continue
- if (lprn1) write (iout,'(i2,3f8.1,9h ethetai ,f10.5)')
+c lprn1=.true.
+ if (lprn1)
+ & write (iout,'(i2,3f8.1,9h ethetai ,f10.5)')
& i,theta(i)*rad2deg,phii*rad2deg,
& phii1*rad2deg,ethetai
+c lprn1=.false.
etheta=etheta+ethetai
if (i.gt.3) gloc(i-3,icg)=gloc(i-3,icg)+wang*dephii
if (i.lt.nres) gloc(i-2,icg)=gloc(i-2,icg)+wang*dephii1
c write (iout,'(a)') 'ESC'
do i=loc_start,loc_end
it=itype(i)
- if (it.eq.21) cycle
+ if (it.eq.ntyp1) cycle
if (it.eq.10) goto 1
- nlobit=nlob(it)
+ nlobit=nlob(iabs(it))
c print *,'i=',i,' it=',it,' nlobit=',nlobit
c write (iout,*) 'i=',i,' ssa=',ssa,' ssad=',ssad
theti=theta(i+1)-pipol
do j=1,nlobit
#ifdef OSF
- adexp=bsc(j,it)-0.5D0*contr(j,iii)+emin
+ adexp=bsc(j,iabs(it))-0.5D0*contr(j,iii)+emin
if(adexp.ne.adexp) adexp=1.0
expfac=dexp(adexp)
#else
- expfac=dexp(bsc(j,it)-0.5D0*contr(j,iii)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j,iii)+emin)
#endif
cd print *,'j=',j,' expfac=',expfac
escloc_i=escloc_i+expfac
dersc12=0.0d0
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j)+emin)
escloc_i=escloc_i+expfac
do k=1,2
dersc(k)=dersc(k)+Ax(k,j)*expfac
delta=0.02d0*pi
escloc=0.0D0
do i=loc_start,loc_end
- if (itype(i).eq.21) cycle
+ if (itype(i).eq.ntyp1) cycle
costtab(i+1) =dcos(theta(i+1))
sinttab(i+1) =dsqrt(1-costtab(i+1)*costtab(i+1))
cost2tab(i+1)=dsqrt(0.5d0*(1.0d0+costtab(i+1)))
cosfac=dsqrt(cosfac2)
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
- it=itype(i)
+ it=iabs(itype(i))
if (it.eq.10) goto 1
c
C Compute the axes of tghe local cartesian coordinates system; store in
y_prime(j) = (dc_norm(j,i) + dc_norm(j,i-1))*sinfac
enddo
do j = 1,3
- z_prime(j) = -uz(j,i-1)
+ z_prime(j) = -uz(j,i-1)*dsign(1.0d0,dfloat(itype(i)))
enddo
c write (2,*) "i",i
c write (2,*) "x_prime",(x_prime(j),j=1,3)
C Compute the energy of the ith side cbain
C
c write (2,*) "xx",xx," yy",yy," zz",zz
- it=itype(i)
+ it=iabs(itype(i))
do j = 1,65
x(j) = sc_parmin(j,it)
enddo
Cc diagnostics - remove later
xx1 = dcos(alph(2))
yy1 = dsin(alph(2))*dcos(omeg(2))
- zz1 = -dsin(alph(2))*dsin(omeg(2))
+ zz1 = -dsign(1.0,dfloat(itype(i)))*dsin(alph(2))*dsin(omeg(2))
write(2,'(3f8.1,3f9.3,1x,3f9.3)')
& alph(2)*rad2deg,omeg(2)*rad2deg,theta(3)*rad2deg,xx,yy,zz,
& xx1,yy1,zz1
c & dscp1,dscp2,sumene
c sumene = enesc(x,xx,yy,zz,cost2tab(i+1),sint2tab(i+1))
escloc = escloc + sumene
-c write (2,*) "i",i," escloc",sumene,escloc
+c write (2,*) "i",i," escloc",sumene,escloc,it,itype(i)
+c & ,zz,xx,yy
+c#define DEBUG
#ifdef DEBUG
C
C This section to check the numerical derivatives of the energy of ith side
C
C Compute the gradient of esc
C
+c zz=zz*dsign(1.0,dfloat(itype(i)))
pom_s1=(1.0d0+x(63))/(0.1d0 + dscp1)**2
pom_s16=6*(1.0d0+x(64))/(0.1d0 + dscp1**6)**2
pom_s2=(1.0d0+x(65))/(0.1d0 + dscp2)**2
& +(sumene2x+sumene4x*cost2tab(i+1))*(s2+s2_6)
& +(pom1+pom2)*pom_dx
#ifdef DEBUG
- write(2,*), "de_dxx = ", de_dxx,de_dxx_num
+ write(2,*), "de_dxx = ", de_dxx,de_dxx_num,itype(i)
#endif
C
sumene1y=x(3) + 2*x(6)*yy + x(9)*xx + x(10)*zz
& +(sumene2y+sumene4y*cost2tab(i+1))*(s2+s2_6)
& +(pom1-pom2)*pom_dy
#ifdef DEBUG
- write(2,*), "de_dyy = ", de_dyy,de_dyy_num
+ write(2,*), "de_dyy = ", de_dyy,de_dyy_num,itype(i)
#endif
C
de_dzz =(x(24) +2*x(27)*zz +x(28)*xx +x(30)*yy
& +x(60)*xx*yy)*cost2tab(i+1)*(s2+s2_6)
& + ( x(14) + 2*x(17)*zz+ x(18)*xx + x(20)*yy)*(s2+s2_6)
#ifdef DEBUG
- write(2,*), "de_dzz = ", de_dzz,de_dzz_num
+ write(2,*), "de_dzz = ", de_dzz,de_dzz_num,itype(i)
#endif
C
de_dt = 0.5d0*sumene3*cost2tab(i+1)*(s1+s1_6)
& -0.5d0*sumene4*sint2tab(i+1)*(s2+s2_6)
& +pom1*pom_dt1+pom2*pom_dt2
#ifdef DEBUG
- write(2,*), "de_dt = ", de_dt,de_dt_num
+ write(2,*), "de_dt = ", de_dt,de_dt_num,itype(i)
#endif
+c#undef DEBUG
c
C
cossc=scalar(dc_norm(1,i),dc_norm(1,i+nres))
dZZ_Ci1(k)=0.0d0
dZZ_Ci(k)=0.0d0
do j=1,3
- dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)*dC_norm(j,i+nres)
- dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)*dC_norm(j,i+nres)
+ dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+ dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
enddo
dXX_XYZ(k)=vbld_inv(i+nres)*(x_prime(k)-xx*dC_norm(k,i+nres))
dYY_XYZ(k)=vbld_inv(i+nres)*(y_prime(k)-yy*dC_norm(k,i+nres))
- dZZ_XYZ(k)=vbld_inv(i+nres)*(z_prime(k)-zz*dC_norm(k,i+nres))
+ dZZ_XYZ(k)=vbld_inv(i+nres)*
+ & (z_prime(k)-zz*dC_norm(k,i+nres))
c
dt_dCi(k) = -dt_dCi(k)/sinttab(i+1)
dt_dCi1(k)= -dt_dCi1(k)/sinttab(i+1)
etors=0.0D0
do i=iphi_start,iphi_end
etors_ii=0.0D0
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21) cycle
+ if (itype(i-2).eq.ntyp1.or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1) cycle
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
c lprn=.true.
etors=0.0D0
do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1) cycle
etors_ii=0.0D0
+ if (iabs(itype(i)).eq.20) then
+ iblock=2
+ else
+ iblock=1
+ endif
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
gloci=0.0D0
C Regular cosine and sine terms
- do j=1,nterm(itori,itori1)
- v1ij=v1(j,itori,itori1)
- v2ij=v2(j,itori,itori1)
+ do j=1,nterm(itori,itori1,iblock)
+ v1ij=v1(j,itori,itori1,iblock)
+ v2ij=v2(j,itori,itori1,iblock)
cosphi=dcos(j*phii)
sinphi=dsin(j*phii)
etors=etors+v1ij*cosphi+v2ij*sinphi
C
cosphi=dcos(0.5d0*phii)
sinphi=dsin(0.5d0*phii)
- do j=1,nlor(itori,itori1)
+ do j=1,nlor(itori,itori1,iblock)
vl1ij=vlor1(j,itori,itori1)
vl2ij=vlor2(j,itori,itori1)
vl3ij=vlor3(j,itori,itori1)
gloci=gloci+vl1ij*(vl3ij*cosphi-vl2ij*sinphi)*pom
enddo
C Subtract the constant term
- etors=etors-v0(itori,itori1)
+ etors=etors-v0(itori,itori1,iblock)
if (energy_dec) write (iout,'(a6,i5,0pf7.3)')
- & 'etor',i,etors_ii-v0(itori,itori1)
+ & 'etor',i,etors_ii-v0(itori,itori1,iblock)
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1(j,itori,itori1),j=1,6),(v2(j,itori,itori1),j=1,6)
+ & (v1(j,itori,itori1,iblock),j=1,6),
+ & (v2(j,itori,itori1,iblock),j=1,6)
gloc(i-3,icg)=gloc(i-3,icg)+wtor*gloci
c write (iout,*) 'i=',i,' gloc=',gloc(i-3,icg)
enddo
lprn=.false.
c lprn=.true.
etors_d=0.0D0
+c write(iout,*) "a tu??"
do i=iphid_start,iphid_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
itori2=itortyp(itype(i))
phii1=phi(i+1)
gloci1=0.0D0
gloci2=0.0D0
+ iblock=1
+ if (iabs(itype(i+1)).eq.20) iblock=2
+
C Regular cosine and sine terms
- do j=1,ntermd_1(itori,itori1,itori2)
- v1cij=v1c(1,j,itori,itori1,itori2)
- v1sij=v1s(1,j,itori,itori1,itori2)
- v2cij=v1c(2,j,itori,itori1,itori2)
- v2sij=v1s(2,j,itori,itori1,itori2)
+ do j=1,ntermd_1(itori,itori1,itori2,iblock)
+ v1cij=v1c(1,j,itori,itori1,itori2,iblock)
+ v1sij=v1s(1,j,itori,itori1,itori2,iblock)
+ v2cij=v1c(2,j,itori,itori1,itori2,iblock)
+ v2sij=v1s(2,j,itori,itori1,itori2,iblock)
cosphi1=dcos(j*phii)
sinphi1=dsin(j*phii)
cosphi2=dcos(j*phii1)
gloci1=gloci1+j*(v1sij*cosphi1-v1cij*sinphi1)
gloci2=gloci2+j*(v2sij*cosphi2-v2cij*sinphi2)
enddo
- do k=2,ntermd_2(itori,itori1,itori2)
+ do k=2,ntermd_2(itori,itori1,itori2,iblock)
do l=1,k-1
- v1cdij = v2c(k,l,itori,itori1,itori2)
- v2cdij = v2c(l,k,itori,itori1,itori2)
- v1sdij = v2s(k,l,itori,itori1,itori2)
- v2sdij = v2s(l,k,itori,itori1,itori2)
+ v1cdij = v2c(k,l,itori,itori1,itori2,iblock)
+ v2cdij = v2c(l,k,itori,itori1,itori2,iblock)
+ v1sdij = v2s(k,l,itori,itori1,itori2,iblock)
+ v2sdij = v2s(l,k,itori,itori1,itori2,iblock)
cosphi1p2=dcos(l*phii+(k-l)*phii1)
cosphi1m2=dcos(l*phii-(k-l)*phii1)
sinphi1p2=dsin(l*phii+(k-l)*phii1)
C Set lprn=.true. for debugging
lprn=.false.
c lprn=.true.
-c write (iout,*) "EBACK_SC_COR",iphi_start,iphi_end,nterm_sccor
+c write (iout,*) "EBACK_SC_COR",itau_start,itau_end
esccor=0.0D0
- do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21) cycle
+ do i=itau_start,itau_end
+ if ((itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)) cycle
esccor_ii=0.0D0
- itori=itype(i-2)
- itori1=itype(i-1)
+ isccori=isccortyp(itype(i-2))
+ isccori1=isccortyp(itype(i-1))
+c write (iout,*) "EBACK_SC_COR",i,nterm_sccor(isccori,isccori1)
phii=phi(i)
+ do intertyp=1,3 !intertyp
+cc Added 09 May 2012 (Adasko)
+cc Intertyp means interaction type of backbone mainchain correlation:
+c 1 = SC...Ca...Ca...Ca
+c 2 = Ca...Ca...Ca...SC
+c 3 = SC...Ca...Ca...SCi
gloci=0.0D0
- do j=1,nterm_sccor
- v1ij=v1sccor(j,itori,itori1)
- v2ij=v2sccor(j,itori,itori1)
- cosphi=dcos(j*phii)
- sinphi=dsin(j*phii)
+ if (((intertyp.eq.3).and.((itype(i-2).eq.10).or.
+ & (itype(i-1).eq.10).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-1).eq.ntyp1)))
+ & .or. ((intertyp.eq.1).and.((itype(i-2).eq.10)
+ & .or.(itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)
+ & .or.(itype(i).eq.ntyp1)))
+ & .or.((intertyp.eq.2).and.((itype(i-1).eq.10).or.
+ & (itype(i-1).eq.ntyp1).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-3).eq.ntyp1)))) cycle
+ if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.ntyp1)) cycle
+ if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.ntyp1))
+ & cycle
+ do j=1,nterm_sccor(isccori,isccori1)
+ v1ij=v1sccor(j,intertyp,isccori,isccori1)
+ v2ij=v2sccor(j,intertyp,isccori,isccori1)
+ cosphi=dcos(j*tauangle(intertyp,i))
+ sinphi=dsin(j*tauangle(intertyp,i))
esccor=esccor+v1ij*cosphi+v2ij*sinphi
gloci=gloci+j*(v2ij*cosphi-v1ij*sinphi)
enddo
+c write (iout,*) "EBACK_SC_COR",i,v1ij*cosphi+v2ij*sinphi,intertyp
+ gloc_sc(intertyp,i-3,icg)=gloc_sc(intertyp,i-3,icg)+wsccor*gloci
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
- & restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1sccor(j,itori,itori1),j=1,6),(v2sccor(j,itori,itori1),j=1,6)
+ & restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,isccori,isccori1,
+ & (v1sccor(j,intertyp,isccori,isccori1),j=1,6)
+ & ,(v2sccor(j,intertyp,isccori,isccori1),j=1,6)
gsccor_loc(i-3)=gsccor_loc(i-3)+gloci
+ enddo !intertyp
enddo
+
return
end
c----------------------------------------------------------------------------
maxsi=100
cd write (iout,*) 'Gen_Rand_conf: nstart=',nstart
if (nstart.lt.5) then
- it1=itype(2)
- phi(4)=gen_phi(4,itype(2),itype(3))
+ it1=iabs(itype(2))
+ phi(4)=gen_phi(4,iabs(itype(2)),iabs(itype(3)))
c write(iout,*)'phi(4)=',rad2deg*phi(4)
- if (nstart.lt.3) theta(3)=gen_theta(itype(2),pi,phi(4))
+ if (nstart.lt.3) theta(3)=gen_theta(iabs(itype(2)),pi,phi(4))
c write(iout,*)'theta(3)=',rad2deg*theta(3)
if (it1.ne.10) then
nsi=0
endif
return1
endif
- it1=itype(i-1)
- it2=itype(i-2)
- it=itype(i)
+ it1=iabs(itype(i-1))
+ it2=iabs(itype(i-2))
+ it=iabs(itype(i))
c print *,'Gen_Rand_Conf: i=',i,' it=',it,' it1=',it1,' it2=',it2,
c & ' nit=',nit,' niter=',niter,' maxgen=',maxgen
phi(i+1)=gen_phi(i+1,it1,it)
include 'COMMON.FFIELD'
data redfac /0.5D0/
overlap=.false.
- iti=itype(i)
+ iti=iabs(itype(i))
if (iti.gt.ntyp) return
C Check for SC-SC overlaps.
cd print *,'nnt=',nnt,' nct=',nct
do j=nnt,i-1
- itj=itype(j)
+ itj=iabs(itype(j))
if (j.lt.i-1 .or. ipot.ne.4) then
rcomp=sigmaii(iti,itj)
else
c(j,maxres2+1)=0.5D0*(c(j,i)+c(j,i+1))
enddo
do j=nnt,i-2
- itj=itype(j)
+ itj=iabs(itype(j))
cd print *,'overlap, p-Sc: i=',i,' j=',j,
cd & ' dist=',dist(nres+j,maxres2+1)
if (dist(nres+j,maxres2+1).lt.4.0D0*redfac) then
endif
thet_pred_mean=a0thet(it)
do k=1,2
- thet_pred_mean=thet_pred_mean+athet(k,it)*y(k)+bthet(k,it)*z(k)
+ thet_pred_mean=thet_pred_mean+athet(k,it,1,1)*y(k)
+ & +bthet(k,it,1,1)*z(k)
enddo
sig=polthet(3,it)
do j=2,0,-1
do ires=1,ioverlap_last
i=ioverlap(ires)
- iti=itype(i)
+ iti=iabs(itype(i))
if (iti.ne.10) then
nsi=0
fail=.true.
c print *,'>>overlap_sc nnt=',nnt,' nct=',nct
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=dsc_inv(itypj)
sig0ij=sigma(itypi,itypj)
chi1=chi(itypi,itypj)
ires=0
do i=nnt,nct
iti=itype(i)
- if (iti.eq.21) then
+ if (iti.eq.ntyp1) then
ichain=ichain+1
ires=0
write (iunit,'(a)') 'TER'
enddo
write (iunit,'(a)') 'TER'
do i=nnt,nct-1
- if (itype(i).eq.21) cycle
- if (itype(i).eq.10 .and. itype(i+1).ne.21) then
+ if (itype(i).eq.ntyp1) cycle
+ if (itype(i).eq.10 .and. itype(i+1).ne.ntyp1) then
write (iunit,30) ica(i),ica(i+1)
- else if (itype(i).ne.10 .and. itype(i+1).ne.21) then
+ else if (itype(i).ne.10 .and. itype(i+1).ne.ntyp1) then
write (iunit,30) ica(i),ica(i+1),ica(i)+1
- else if (itype(i).ne.10 .and. itype(i+1).eq.21) then
+ else if (itype(i).ne.10 .and. itype(i+1).eq.ntyp1) then
write (iunit,30) ica(i),ica(i)+1
endif
enddo
include 'COMMON.INTERACT'
include 'COMMON.NAMES'
include 'COMMON.GEO'
+ include 'COMMON.TORSION'
write (iout,'(/a)') 'Geometry of the virtual chain.'
write (iout,'(7a)') ' Res ',' d',' Theta',
& ' Phi',' Dsc',' Alpha',' Omega'
include 'COMMON.CHAIN'
include 'COMMON.VAR'
include 'COMMON.MD'
+ include 'COMMON.SCCOR'
C
C Initialize Cartesian-coordinate gradient
C
gradx(j,i,icg)=0.0d0
gscloc(j,i)=0.0d0
gsclocx(j,i)=0.0d0
+ do intertyp=1,3
+ gloc_sc(intertyp,i,icg)=0.0d0
+ enddo
enddo
enddo
C
igeom= 8
intin= 9
ithep= 11
+ ithep_pdb=51
irotam=12
+ irotam_pdb=52
itorp= 13
itordp= 23
ielep= 14
rr0(i)=0.0D0
a0thet(i)=0.0D0
do j=1,2
- athet(j,i)=0.0D0
- bthet(j,i)=0.0D0
+ do ichir1=-1,1
+ do ichir2=-1,1
+ athet(j,i,ichir1,ichir2)=0.0D0
+ bthet(j,i,ichir1,ichir2)=0.0D0
+ enddo
+ enddo
enddo
- do j=0,3
+ do j=0,3
polthet(j,i)=0.0D0
enddo
do j=1,3
enddo
nlob(ntyp1)=0
dsc(ntyp1)=0.0D0
- do i=1,maxtor
- itortyp(i)=0
- do j=1,maxtor
- do k=1,maxterm
- v1(k,j,i)=0.0D0
- v2(k,j,i)=0.0D0
+ do i=-maxtor,maxtor
+ itortyp(i)=0
+cc write (iout,*) "TU DOCHODZE",i,itortyp(i)
+ do iblock=1,2
+ do j=-maxtor,maxtor
+ do k=1,maxterm
+ v1(k,j,i,iblock)=0.0D0
+ v2(k,j,i,iblock)=0.0D0
enddo
enddo
+ enddo
enddo
+ do iblock=1,2
+ do i=-maxtor,maxtor
+ do j=-maxtor,maxtor
+ do k=-maxtor,maxtor
+ do l=1,maxtermd_1
+ v1c(1,l,i,j,k,iblock)=0.0D0
+ v1s(1,l,i,j,k,iblock)=0.0D0
+ v1c(2,l,i,j,k,iblock)=0.0D0
+ v1s(2,l,i,j,k,iblock)=0.0D0
+ enddo !l
+ do l=1,maxtermd_2
+ do m=1,maxtermd_2
+ v2c(m,l,i,j,k,iblock)=0.0D0
+ v2s(m,l,i,j,k,iblock)=0.0D0
+ enddo !m
+ enddo !l
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
+
do i=1,maxres
itype(i)=0
itel(i)=0
include 'COMMON.NAMES'
include 'COMMON.FFIELD'
data restyp /
+ &'DD','DAU','DAI','DDB','DSM','DPR','DLY','DAR','DHI','DAS','DGL',
+ & 'DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
- &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
+ &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','SME','DBZ',
+ &'AIB','ABU','D'/
data onelet /
+ &'z','z','z','z','z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
- &'S','Q','N','E','D','H','R','K','P','X'/
+ &'S','Q','N','E','D','H','R','K','P','z','z','z','z','X'/
data potname /'LJ','LJK','BP','GB','GBV'/
data ename /
& "EVDW SC-SC","EVDW2 SC-p","EES p-p","ECORR4 ","ECORR5 ",
iphi_end=iturn3_end+2
iturn3_start=iturn3_start-1
iturn3_end=iturn3_end-1
+ call int_bounds(nres-3,itau_start,itau_end)
+ itau_start=itau_start+3
+ itau_end=itau_end+3
call int_bounds(nres-3,iphi1_start,iphi1_end)
iphi1_start=iphi1_start+3
iphi1_end=iphi1_end+3
idihconstr_end=ndih_constr
iphid_start=iphi_start
iphid_end=iphi_end-1
+ itau_start=4
+ itau_end=nres
ibond_start=2
ibond_end=nres-1
ibondp_start=nnt
include 'COMMON.INTERACT'
include 'COMMON.MD'
include 'COMMON.IOUNITS'
-
+ include 'COMMON.SCCOR'
c calculating dE/ddc1
- if (nres.lt.3) return
+ if (nres.lt.3) go to 18
do j=1,3
gcart(j,1)=gcart(j,1)+gloc(1,icg)*dphi(j,1,4)
& +gloc(nres-2,icg)*dtheta(j,1,3)
enddo
c The side-chain vector derivatives
do i=2,nres-1
- if(itype(i).ne.10 .and. itype(i).ne.21) then
+ if(itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
gxcart(j,i)=gxcart(j,i)+gloc(ialph(i,1),icg)*dalpha(j,3,i)
& +gloc(ialph(i,1)+nside,icg)*domega(j,3,i)
enddo
endif
enddo
+c----------------------------------------------------------------------
+C INTERTYP=1 SC...Ca...Ca...Ca
+C INTERTYP=2 Ca...Ca...Ca...SC
+C INTERTYP=3 SC...Ca...Ca...SC
+c calculating dE/ddc1
+ 18 continue
+c do i=1,nres
+c gloc(i,icg)=0.0D0
+c write (iout,*) "poczotkoawy",i,gloc_sc(1,i,icg)
+c enddo
+ if (nres.lt.2) return
+ if ((nres.lt.3).and.(itype(1).eq.10)) return
+ if ((itype(1).ne.10).and.(itype(1).ne.ntyp1)) then
+ do j=1,3
+cc Derviative was calculated for oposite vector of side chain therefore
+c there is "-" sign before gloc_sc
+ gxcart(j,1)=gxcart(j,1)-gloc_sc(1,0,icg)*
+ & dtauangle(j,1,1,3)
+ gcart(j,1)=gcart(j,1)+gloc_sc(1,0,icg)*
+ & dtauangle(j,1,2,3)
+ if ((itype(2).ne.10).and.(itype(2).ne.ntyp1)) then
+ gxcart(j,1)= gxcart(j,1)
+ & -gloc_sc(3,0,icg)*dtauangle(j,3,1,3)
+ gcart(j,1)=gcart(j,1)+gloc_sc(3,0,icg)*
+ & dtauangle(j,3,2,3)
+ endif
+ enddo
+ endif
+ if ((nres.ge.3).and.(itype(3).ne.10).and.(itype(3).ne.ntyp1))
+ & then
+ do j=1,3
+ gcart(j,1)=gcart(j,1)+gloc_sc(2,1,icg)*dtauangle(j,2,1,4)
+ enddo
+ endif
+c As potetnial DO NOT depend on omicron anlge their derivative is
+c ommited
+c & +gloc_sc(intertyp,nres-2,icg)*dtheta(j,1,3)
+
+c Calculating the remainder of dE/ddc2
+ do j=1,3
+ if((itype(2).ne.10).and.(itype(2).ne.ntyp1)) then
+ if (itype(1).ne.10) gxcart(j,2)=gxcart(j,2)+
+ & gloc_sc(3,0,icg)*dtauangle(j,3,3,3)
+ if ((itype(3).ne.10).and.(nres.ge.3).and.(itype(3).ne.ntyp1))
+ & then
+ gxcart(j,2)=gxcart(j,2)-gloc_sc(3,1,icg)*dtauangle(j,3,1,4)
+cc the - above is due to different vector direction
+ gcart(j,2)=gcart(j,2)+gloc_sc(3,1,icg)*dtauangle(j,3,2,4)
+ endif
+ if (nres.gt.3) then
+ gxcart(j,2)=gxcart(j,2)-gloc_sc(1,1,icg)*dtauangle(j,1,1,4)
+cc the - above is due to different vector direction
+ gcart(j,2)=gcart(j,2)+gloc_sc(1,1,icg)*dtauangle(j,1,2,4)
+c write(iout,*) gloc_sc(1,1,icg),dtauangle(j,1,2,4),"gcart"
+c write(iout,*) gloc_sc(1,1,icg),dtauangle(j,1,1,4),"gx"
+ endif
+ endif
+ if ((itype(1).ne.10).and.(itype(1).ne.ntyp1)) then
+ gcart(j,2)=gcart(j,2)+gloc_sc(1,0,icg)*dtauangle(j,1,3,3)
+c write(iout,*) gloc_sc(1,0,icg),dtauangle(j,1,3,3)
+ endif
+ if ((itype(3).ne.10).and.(nres.ge.3)) then
+ gcart(j,2)=gcart(j,2)+gloc_sc(2,1,icg)*dtauangle(j,2,2,4)
+c write(iout,*) gloc_sc(2,1,icg),dtauangle(j,2,2,4)
+ endif
+ if ((itype(4).ne.10).and.(nres.ge.4)) then
+ gcart(j,2)=gcart(j,2)+gloc_sc(2,2,icg)*dtauangle(j,2,1,5)
+c write(iout,*) gloc_sc(2,2,icg),dtauangle(j,2,1,5)
+ endif
+
+c write(iout,*) gcart(j,2),itype(2),itype(1),itype(3), "gcart2"
+ enddo
+c If there are more than five residues
+ if(nres.ge.5) then
+ do i=3,nres-2
+ do j=1,3
+c write(iout,*) "before", gcart(j,i)
+ if ((itype(i).ne.10).and.(itype(i).ne.ntyp1)) then
+ gxcart(j,i)=gxcart(j,i)+gloc_sc(2,i-2,icg)
+ & *dtauangle(j,2,3,i+1)
+ & -gloc_sc(1,i-1,icg)*dtauangle(j,1,1,i+2)
+ gcart(j,i)=gcart(j,i)+gloc_sc(1,i-1,icg)
+ & *dtauangle(j,1,2,i+2)
+c write(iout,*) "new",j,i,
+c & gcart(j,i),gloc_sc(1,i-1,icg),dtauangle(j,1,2,i+2)
+ if (itype(i-1).ne.10) then
+ gxcart(j,i)=gxcart(j,i)+gloc_sc(3,i-2,icg)
+ &*dtauangle(j,3,3,i+1)
+ endif
+ if (itype(i+1).ne.10) then
+ gxcart(j,i)=gxcart(j,i)-gloc_sc(3,i-1,icg)
+ &*dtauangle(j,3,1,i+2)
+ gcart(j,i)=gcart(j,i)+gloc_sc(3,i-1,icg)
+ &*dtauangle(j,3,2,i+2)
+ endif
+ endif
+ if (itype(i-1).ne.10) then
+ gcart(j,i)=gcart(j,i)+gloc_sc(1,i-2,icg)*
+ & dtauangle(j,1,3,i+1)
+ endif
+ if (itype(i+1).ne.10) then
+ gcart(j,i)=gcart(j,i)+gloc_sc(2,i-1,icg)*
+ & dtauangle(j,2,2,i+2)
+c write(iout,*) "numer",i,gloc_sc(2,i-1,icg),
+c & dtauangle(j,2,2,i+2)
+ endif
+ if (itype(i+2).ne.10) then
+ gcart(j,i)=gcart(j,i)+gloc_sc(2,i,icg)*
+ & dtauangle(j,2,1,i+3)
+ endif
+ enddo
+ enddo
+ endif
+c Setting dE/ddnres-1
+ if(nres.ge.4) then
+ do j=1,3
+ if ((itype(nres-1).ne.10).and.(itype(nres-1).ne.ntyp1)) then
+ gxcart(j,nres-1)=gxcart(j,nres-1)+gloc_sc(2,nres-3,icg)
+ & *dtauangle(j,2,3,nres)
+c write (iout,*) "gxcart(nres-1)", gloc_sc(2,nres-3,icg),
+c & dtauangle(j,2,3,nres), gxcart(j,nres-1)
+ if (itype(nres-2).ne.10) then
+ gxcart(j,nres-1)=gxcart(j,nres-1)+gloc_sc(3,nres-3,icg)
+ & *dtauangle(j,3,3,nres)
+ endif
+ if ((itype(nres).ne.10).and.(itype(nres).ne.ntyp1)) then
+ gxcart(j,nres-1)=gxcart(j,nres-1)-gloc_sc(3,nres-2,icg)
+ & *dtauangle(j,3,1,nres+1)
+ gcart(j,nres-1)=gcart(j,nres-1)+gloc_sc(3,nres-2,icg)
+ & *dtauangle(j,3,2,nres+1)
+ endif
+ endif
+ if ((itype(nres-2).ne.10).and.(itype(nres-2).ne.ntyp1)) then
+ gcart(j,nres-1)=gcart(j,nres-1)+gloc_sc(1,nres-3,icg)*
+ & dtauangle(j,1,3,nres)
+ endif
+ if ((itype(nres).ne.10).and.(itype(nres).ne.ntyp1)) then
+ gcart(j,nres-1)=gcart(j,nres-1)+gloc_sc(2,nres-2,icg)*
+ & dtauangle(j,2,2,nres+1)
+c write (iout,*) "gcart(nres-1)", gloc_sc(2,nres-2,icg),
+c & dtauangle(j,2,2,nres+1), itype(nres-1),itype(nres)
+ endif
+ enddo
+ endif
+c Settind dE/ddnres
+ if ((nres.ge.3).and.(itype(nres).ne.10).and.
+ & (itype(nres).ne.ntyp1))then
+ do j=1,3
+ gxcart(j,nres)=gxcart(j,nres)+gloc_sc(3,nres-2,icg)
+ & *dtauangle(j,3,3,nres+1)+gloc_sc(2,nres-2,icg)
+ & *dtauangle(j,2,3,nres+1)
+ enddo
+ endif
+c The side-chain vector derivatives
return
end
include 'COMMON.DERIV'
include 'COMMON.IOUNITS'
include 'COMMON.LOCAL'
+ include 'COMMON.SCCOR'
double precision dcostheta(3,2,maxres),
& dcosphi(3,3,maxres),dsinphi(3,3,maxres),
& dcosalpha(3,3,maxres),dcosomega(3,3,maxres),
do j=1,3
dcostheta(j,1,i)=-(dc_norm(j,i-1)+cost*dc_norm(j,i-2))/
& vbld(i-1)
- if (itype(i-1).ne.21) dtheta(j,1,i)=-dcostheta(j,1,i)/sint
+ if (itype(i-1).ne.ntyp1) dtheta(j,1,i)=-dcostheta(j,1,i)/sint
dcostheta(j,2,i)=-(dc_norm(j,i-2)+cost*dc_norm(j,i-1))/
& vbld(i)
- if (itype(i-1).ne.21) dtheta(j,2,i)=-dcostheta(j,2,i)/sint
+ if (itype(i-1).ne.ntyp1) dtheta(j,2,i)=-dcostheta(j,2,i)/sint
enddo
enddo
-
+#if defined(MPI) && defined(PARINTDER)
+c We need dtheta(:,:,i-1) to compute dphi(:,:,i)
+ do i=max0(ithet_start-1,3),ithet_end
+#else
+ do i=3,nres
+#endif
+ if ((itype(i-1).ne.10).and.(itype(i-1).ne.ntyp1)) then
+ cost1=dcos(omicron(1,i))
+ sint1=sqrt(1-cost1*cost1)
+ cost2=dcos(omicron(2,i))
+ sint2=sqrt(1-cost2*cost2)
+ do j=1,3
+CC Calculate derivative over first omicron (Cai-2,Cai-1,SCi-1)
+ dcosomicron(j,1,1,i)=-(dc_norm(j,i-1+nres)+
+ & cost1*dc_norm(j,i-2))/
+ & vbld(i-1)
+ domicron(j,1,1,i)=-1/sint1*dcosomicron(j,1,1,i)
+ dcosomicron(j,1,2,i)=-(dc_norm(j,i-2)
+ & +cost1*(dc_norm(j,i-1+nres)))/
+ & vbld(i-1+nres)
+ domicron(j,1,2,i)=-1/sint1*dcosomicron(j,1,2,i)
+CC Calculate derivative over second omicron Sci-1,Cai-1 Cai
+CC Looks messy but better than if in loop
+ dcosomicron(j,2,1,i)=-(-dc_norm(j,i-1+nres)
+ & +cost2*dc_norm(j,i-1))/
+ & vbld(i)
+ domicron(j,2,1,i)=-1/sint2*dcosomicron(j,2,1,i)
+ dcosomicron(j,2,2,i)=-(dc_norm(j,i-1)
+ & +cost2*(-dc_norm(j,i-1+nres)))/
+ & vbld(i-1+nres)
+c write(iout,*) "vbld", i,itype(i),vbld(i-1+nres)
+ domicron(j,2,2,i)=-1/sint2*dcosomicron(j,2,2,i)
+ enddo
+ endif
+ enddo
+
c Derivatives of phi:
c If phi is 0 or 180 degrees, then the formulas
c have to be derived by power series expansion of the
ctgt=cost/sint
ctgt1=cost1/sint1
cosg_inv=1.0d0/cosg
- if (itype(i-1).ne.21 .and. itype(i-2).ne.21) then
+ if (itype(i-1).ne.ntyp1 .and. itype(i-2).ne.ntyp1) then
dsinphi(j,1,i)=-sing*ctgt1*dtheta(j,1,i-1)
& -(fac0*vp1(j)+sing*dc_norm(j,i-3))*vbld_inv(i-2)
dphi(j,1,i)=cosg_inv*dsinphi(j,1,i)
c Obtaining the gamma derivatives from cosine derivative
else
do j=1,3
- if (itype(i-1).ne.21 .and. itype(i-2).ne.21) then
+ if (itype(i-1).ne.ntyp1 .and. itype(i-2).ne.ntyp1) then
dcosphi(j,1,i)=fac1*dcostheta(j,1,i-1)+fac3*
& dcostheta(j,1,i-1)-fac0*(dc_norm(j,i-1)-scalp*
& dc_norm(j,i-3))/vbld(i-2)
enddo
endif
enddo
+Calculate derivative of Tauangle
+#ifdef PARINTDER
+ do i=itau_start,itau_end
+#else
+ do i=3,nres
+#endif
+ if ((itype(i-2).eq.ntyp1).or.(itype(i-2).eq.10)) cycle
+c if ((itype(i-2).eq.ntyp1).or.(itype(i-2).eq.10).or.
+c & (itype(i-1).eq.ntyp1).or.(itype(i).eq.ntyp1)) cycle
+cc dtauangle(j,intertyp,dervityp,residue number)
+cc INTERTYP=1 SC...Ca...Ca..Ca
+c the conventional case
+ sint=dsin(theta(i))
+ sint1=dsin(omicron(2,i-1))
+ sing=dsin(tauangle(1,i))
+ cost=dcos(theta(i))
+ cost1=dcos(omicron(2,i-1))
+ cosg=dcos(tauangle(1,i))
+ do j=1,3
+ dc_norm2(j,i-2+nres)=-dc_norm(j,i-2+nres)
+cc write(iout,*) dc_norm2(j,i-2+nres),"dcnorm"
+ enddo
+ scalp=scalar(dc_norm2(1,i-2+nres),dc_norm(1,i-1))
+ fac0=1.0d0/(sint1*sint)
+ fac1=cost*fac0
+ fac2=cost1*fac0
+ fac3=cosg*cost1/(sint1*sint1)
+ fac4=cosg*cost/(sint*sint)
+cc write(iout,*) "faki",fac0,fac1,fac2,fac3,fac4
+c Obtaining the gamma derivatives from sine derivative
+ if (tauangle(1,i).gt.-pi4.and.tauangle(1,i).le.pi4.or.
+ & tauangle(1,i).gt.pi34.and.tauangle(1,i).le.pi.or.
+ & tauangle(1,i).gt.-pi.and.tauangle(1,i).le.-pi34) then
+ call vecpr(dc_norm(1,i-1),dc_norm(1,i-2),vp1)
+ call vecpr(dc_norm2(1,i-2+nres),dc_norm(1,i-1),vp2)
+ call vecpr(dc_norm2(1,i-2+nres),dc_norm(1,i-2),vp3)
+ do j=1,3
+ ctgt=cost/sint
+ ctgt1=cost1/sint1
+ cosg_inv=1.0d0/cosg
+ dsintau(j,1,1,i)=-sing*ctgt1*domicron(j,2,2,i-1)
+ &-(fac0*vp1(j)+sing*(dc_norm2(j,i-2+nres)))
+ & *vbld_inv(i-2+nres)
+ dtauangle(j,1,1,i)=cosg_inv*dsintau(j,1,1,i)
+ dsintau(j,1,2,i)=
+ & -sing*(ctgt1*domicron(j,2,1,i-1)+ctgt*dtheta(j,1,i))
+ & -(fac0*vp2(j)+sing*dc_norm(j,i-2))*vbld_inv(i-1)
+c write(iout,*) "dsintau", dsintau(j,1,2,i)
+ dtauangle(j,1,2,i)=cosg_inv*dsintau(j,1,2,i)
+c Bug fixed 3/24/05 (AL)
+ dsintau(j,1,3,i)=-sing*ctgt*dtheta(j,2,i)
+ & +(fac0*vp3(j)-sing*dc_norm(j,i-1))*vbld_inv(i)
+c & +(fac0*vp3(j)-sing*dc_norm(j,i-1))*vbld_inv(i-1)
+ dtauangle(j,1,3,i)=cosg_inv*dsintau(j,1,3,i)
+ enddo
+c Obtaining the gamma derivatives from cosine derivative
+ else
+ do j=1,3
+ dcostau(j,1,1,i)=fac1*dcosomicron(j,2,2,i-1)+fac3*
+ & dcosomicron(j,2,2,i-1)-fac0*(dc_norm(j,i-1)-scalp*
+ & (dc_norm2(j,i-2+nres)))/vbld(i-2+nres)
+ dtauangle(j,1,1,i)=-1/sing*dcostau(j,1,1,i)
+ dcostau(j,1,2,i)=fac1*dcosomicron(j,2,1,i-1)+fac2*
+ & dcostheta(j,1,i)+fac3*dcosomicron(j,2,1,i-1)+fac4*
+ & dcostheta(j,1,i)
+ dtauangle(j,1,2,i)=-1/sing*dcostau(j,1,2,i)
+ dcostau(j,1,3,i)=fac2*dcostheta(j,2,i)+fac4*
+ & dcostheta(j,2,i)-fac0*(-dc_norm(j,i-2+nres)-scalp*
+ & dc_norm(j,i-1))/vbld(i)
+ dtauangle(j,1,3,i)=-1/sing*dcostau(j,1,3,i)
+c write (iout,*) "else",i
+ enddo
+ endif
+c do k=1,3
+c write(iout,*) "tu",i,k,(dtauangle(j,1,k,i),j=1,3)
+c enddo
+ enddo
+CC Second case Ca...Ca...Ca...SC
+#ifdef PARINTDER
+ do i=itau_start,itau_end
+#else
+ do i=4,nres
+#endif
+ if ((itype(i-1).eq.ntyp1).or.(itype(i-1).eq.10).or.
+ & (itype(i-2).eq.ntyp1).or.(itype(i-3).eq.ntyp1)) cycle
+c the conventional case
+ sint=dsin(omicron(1,i))
+ sint1=dsin(theta(i-1))
+ sing=dsin(tauangle(2,i))
+ cost=dcos(omicron(1,i))
+ cost1=dcos(theta(i-1))
+ cosg=dcos(tauangle(2,i))
+c do j=1,3
+c dc_norm2(j,i-1+nres)=-dc_norm(j,i-1+nres)
+c enddo
+ scalp=scalar(dc_norm(1,i-3),dc_norm(1,i-1+nres))
+ fac0=1.0d0/(sint1*sint)
+ fac1=cost*fac0
+ fac2=cost1*fac0
+ fac3=cosg*cost1/(sint1*sint1)
+ fac4=cosg*cost/(sint*sint)
+c Obtaining the gamma derivatives from sine derivative
+ if (tauangle(2,i).gt.-pi4.and.tauangle(2,i).le.pi4.or.
+ & tauangle(2,i).gt.pi34.and.tauangle(2,i).le.pi.or.
+ & tauangle(2,i).gt.-pi.and.tauangle(2,i).le.-pi34) then
+ call vecpr(dc_norm2(1,i-1+nres),dc_norm(1,i-2),vp1)
+ call vecpr(dc_norm(1,i-3),dc_norm(1,i-1+nres),vp2)
+ call vecpr(dc_norm(1,i-3),dc_norm(1,i-2),vp3)
+ do j=1,3
+ ctgt=cost/sint
+ ctgt1=cost1/sint1
+ cosg_inv=1.0d0/cosg
+ dsintau(j,2,1,i)=-sing*ctgt1*dtheta(j,1,i-1)
+ & +(fac0*vp1(j)-sing*dc_norm(j,i-3))*vbld_inv(i-2)
+c write(iout,*) i,j,dsintau(j,2,1,i),sing*ctgt1*dtheta(j,1,i-1),
+c &fac0*vp1(j),sing*dc_norm(j,i-3),vbld_inv(i-2),"dsintau(2,1)"
+ dtauangle(j,2,1,i)=cosg_inv*dsintau(j,2,1,i)
+ dsintau(j,2,2,i)=
+ & -sing*(ctgt1*dtheta(j,2,i-1)+ctgt*domicron(j,1,1,i))
+ & -(fac0*vp2(j)+sing*dc_norm(j,i-2))*vbld_inv(i-1)
+c write(iout,*) "sprawdzenie",i,j,sing*ctgt1*dtheta(j,2,i-1),
+c & sing*ctgt*domicron(j,1,2,i),
+c & (fac0*vp2(j)+sing*dc_norm(j,i-2))*vbld_inv(i-1)
+ dtauangle(j,2,2,i)=cosg_inv*dsintau(j,2,2,i)
+c Bug fixed 3/24/05 (AL)
+ dsintau(j,2,3,i)=-sing*ctgt*domicron(j,1,2,i)
+ & +(fac0*vp3(j)-sing*dc_norm(j,i-1+nres))*vbld_inv(i-1+nres)
+c & +(fac0*vp3(j)-sing*dc_norm(j,i-1))*vbld_inv(i-1)
+ dtauangle(j,2,3,i)=cosg_inv*dsintau(j,2,3,i)
+ enddo
+c Obtaining the gamma derivatives from cosine derivative
+ else
+ do j=1,3
+ dcostau(j,2,1,i)=fac1*dcostheta(j,1,i-1)+fac3*
+ & dcostheta(j,1,i-1)-fac0*(dc_norm(j,i-1+nres)-scalp*
+ & dc_norm(j,i-3))/vbld(i-2)
+ dtauangle(j,2,1,i)=-1/sing*dcostau(j,2,1,i)
+ dcostau(j,2,2,i)=fac1*dcostheta(j,2,i-1)+fac2*
+ & dcosomicron(j,1,1,i)+fac3*dcostheta(j,2,i-1)+fac4*
+ & dcosomicron(j,1,1,i)
+ dtauangle(j,2,2,i)=-1/sing*dcostau(j,2,2,i)
+ dcostau(j,2,3,i)=fac2*dcosomicron(j,1,2,i)+fac4*
+ & dcosomicron(j,1,2,i)-fac0*(dc_norm(j,i-3)-scalp*
+ & dc_norm(j,i-1+nres))/vbld(i-1+nres)
+ dtauangle(j,2,3,i)=-1/sing*dcostau(j,2,3,i)
+c write(iout,*) i,j,"else", dtauangle(j,2,3,i)
+ enddo
+ endif
+ enddo
+
+CCC third case SC...Ca...Ca...SC
+#ifdef PARINTDER
+
+ do i=itau_start,itau_end
+#else
+ do i=3,nres
+#endif
+c the conventional case
+ if ((itype(i-1).eq.ntyp1).or.(itype(i-1).eq.10).or.
+ &(itype(i-2).eq.ntyp1).or.(itype(i-2).eq.10)) cycle
+ sint=dsin(omicron(1,i))
+ sint1=dsin(omicron(2,i-1))
+ sing=dsin(tauangle(3,i))
+ cost=dcos(omicron(1,i))
+ cost1=dcos(omicron(2,i-1))
+ cosg=dcos(tauangle(3,i))
+ do j=1,3
+ dc_norm2(j,i-2+nres)=-dc_norm(j,i-2+nres)
+c dc_norm2(j,i-1+nres)=-dc_norm(j,i-1+nres)
+ enddo
+ scalp=scalar(dc_norm2(1,i-2+nres),dc_norm(1,i-1+nres))
+ fac0=1.0d0/(sint1*sint)
+ fac1=cost*fac0
+ fac2=cost1*fac0
+ fac3=cosg*cost1/(sint1*sint1)
+ fac4=cosg*cost/(sint*sint)
+c Obtaining the gamma derivatives from sine derivative
+ if (tauangle(3,i).gt.-pi4.and.tauangle(3,i).le.pi4.or.
+ & tauangle(3,i).gt.pi34.and.tauangle(3,i).le.pi.or.
+ & tauangle(3,i).gt.-pi.and.tauangle(3,i).le.-pi34) then
+ call vecpr(dc_norm(1,i-1+nres),dc_norm(1,i-2),vp1)
+ call vecpr(dc_norm2(1,i-2+nres),dc_norm(1,i-1+nres),vp2)
+ call vecpr(dc_norm2(1,i-2+nres),dc_norm(1,i-2),vp3)
+ do j=1,3
+ ctgt=cost/sint
+ ctgt1=cost1/sint1
+ cosg_inv=1.0d0/cosg
+ dsintau(j,3,1,i)=-sing*ctgt1*domicron(j,2,2,i-1)
+ & -(fac0*vp1(j)-sing*dc_norm(j,i-2+nres))
+ & *vbld_inv(i-2+nres)
+ dtauangle(j,3,1,i)=cosg_inv*dsintau(j,3,1,i)
+ dsintau(j,3,2,i)=
+ & -sing*(ctgt1*domicron(j,2,1,i-1)+ctgt*domicron(j,1,1,i))
+ & -(fac0*vp2(j)+sing*dc_norm(j,i-2))*vbld_inv(i-1)
+ dtauangle(j,3,2,i)=cosg_inv*dsintau(j,3,2,i)
+c Bug fixed 3/24/05 (AL)
+ dsintau(j,3,3,i)=-sing*ctgt*domicron(j,1,2,i)
+ & +(fac0*vp3(j)-sing*dc_norm(j,i-1+nres))
+ & *vbld_inv(i-1+nres)
+c & +(fac0*vp3(j)-sing*dc_norm(j,i-1))*vbld_inv(i-1)
+ dtauangle(j,3,3,i)=cosg_inv*dsintau(j,3,3,i)
+ enddo
+c Obtaining the gamma derivatives from cosine derivative
+ else
+ do j=1,3
+ dcostau(j,3,1,i)=fac1*dcosomicron(j,2,2,i-1)+fac3*
+ & dcosomicron(j,2,2,i-1)-fac0*(dc_norm(j,i-1+nres)-scalp*
+ & dc_norm2(j,i-2+nres))/vbld(i-2+nres)
+ dtauangle(j,3,1,i)=-1/sing*dcostau(j,3,1,i)
+ dcostau(j,3,2,i)=fac1*dcosomicron(j,2,1,i-1)+fac2*
+ & dcosomicron(j,1,1,i)+fac3*dcosomicron(j,2,1,i-1)+fac4*
+ & dcosomicron(j,1,1,i)
+ dtauangle(j,3,2,i)=-1/sing*dcostau(j,3,2,i)
+ dcostau(j,3,3,i)=fac2*dcosomicron(j,1,2,i)+fac4*
+ & dcosomicron(j,1,2,i)-fac0*(dc_norm2(j,i-2+nres)-scalp*
+ & dc_norm(j,i-1+nres))/vbld(i-1+nres)
+ dtauangle(j,3,3,i)=-1/sing*dcostau(j,3,3,i)
+c write(iout,*) "else",i
+ enddo
+ endif
+ enddo
+
#ifdef CRYST_SC
c Derivatives of side-chain angles alpha and omega
#if defined(MPI) && defined(PARINTDER)
#else
do i=2,nres-1
#endif
- if(itype(i).ne.10 .and. itype(i).ne.21) then
+ if(itype(i).ne.10 .and. itype(i).ne.ntyp1) then
fac5=1.0d0/dsqrt(2*(1+dcos(theta(i+1))))
fac6=fac5/vbld(i)
fac7=fac5*fac5
incr(j)=d_t(j,0)
enddo
do i=nnt,nct
- iti=itype(i)
+ iti=iabs(itype(i))
if (itype(i).eq.10) then
do j=1,3
v(j)=incr(j)
c The rotational part of the side chain virtual bond
KEr_sc=0.0D0
do i=nnt,nct
- iti=itype(i)
+ iti=iabs(itype(i))
if (itype(i).ne.10) then
do j=1,3
incr(j)=d_t(j,nres+i)
enddo
if (lprn) write (iout,*) "Potential forces sidechain"
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
if (lprn) write (iout,'(i5,3e15.5,5x,3e15.5)')
& i,(-gcart(j,i),j=1,3)
do j=1,3
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
ind=ind+1
d_a(j,i+nres)=d_a_work(ind)
m1=nct-nnt+1
ind=0
ind1=0
- msc(21)=1.0d0
+ msc(ntyp1)=1.0d0
do i=nnt,nct
ind=ind+1
ii = ind+m
iti=itype(i)
- massvec(ii)=msc(iti)
- if (iti.ne.10 .and. iti.ne.21) then
+ massvec(ii)=msc(iabs(iti))
+ if (iti.ne.10 .and. iti.ne.ntyp1) then
ind1=ind1+1
ii1= ind1+m1
A(ii,ii1)=1.0d0
- Gmat(ii1,ii1)=ISC(iti)
+ Gmat(ii1,ii1)=ISC(iabs(iti))
endif
enddo
c Off-diagonal elements of the dX part of A
enddo
M_SC=0.0d0
do i=nnt,nct
- iti=itype(i)
- M_SC=M_SC+msc(iti)
+ iti=iabs(itype(i))
+ M_SC=M_SC+msc(iabs(iti))
inres=i+nres
do j=1,3
- cm(j)=cm(j)+msc(iti)*c(j,inres)
+ cm(j)=cm(j)+msc(iabs(iti))*c(j,inres)
enddo
enddo
do j=1,3
enddo
do i=nnt,nct
- iti=itype(i)
+ iti=iabs(itype(i))
inres=i+nres
do j=1,3
pr(j)=c(j,inres)-cm(j)
enddo
- Im(1,1)=Im(1,1)+msc(iti)*(pr(2)*pr(2)+pr(3)*pr(3))
- Im(1,2)=Im(1,2)-msc(iti)*pr(1)*pr(2)
- Im(1,3)=Im(1,3)-msc(iti)*pr(1)*pr(3)
- Im(2,3)=Im(2,3)-msc(iti)*pr(2)*pr(3)
- Im(2,2)=Im(2,2)+msc(iti)*(pr(3)*pr(3)+pr(1)*pr(1))
- Im(3,3)=Im(3,3)+msc(iti)*(pr(1)*pr(1)+pr(2)*pr(2))
+ Im(1,1)=Im(1,1)+msc(iabs(iti))*(pr(2)*pr(2)+pr(3)*pr(3))
+ Im(1,2)=Im(1,2)-msc(iabs(iti))*pr(1)*pr(2)
+ Im(1,3)=Im(1,3)-msc(iabs(iti))*pr(1)*pr(3)
+ Im(2,3)=Im(2,3)-msc(iabs(iti))*pr(2)*pr(3)
+ Im(2,2)=Im(2,2)+msc(iabs(iti))*(pr(3)*pr(3)+pr(1)*pr(1))
+ Im(3,3)=Im(3,3)+msc(iabs(iti))*(pr(1)*pr(1)+pr(2)*pr(2))
enddo
do i=nnt,nct-1
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
- iti=itype(i)
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
+ iti=iabs(itype(i))
inres=i+nres
Im(1,1)=Im(1,1)+Isc(iti)*(1-dc_norm(1,inres)*
& dc_norm(1,inres))*vbld(inres)*vbld(inres)
enddo
enddo
do i=nnt,nct
- if(itype(i).ne.10 .and. itype(i).ne.21) then
+ if(itype(i).ne.10 .and. itype(i).ne.ntyp1) then
inres=i+nres
call vecpr(vrot(1),dc(1,inres),vp)
do j=1,3
incr(j)=d_t(j,0)
enddo
do i=nnt,nct
- iti=itype(i)
+ iti=iabs(itype(i))
inres=i+nres
do j=1,3
pr(j)=c(j,inres)-cm(j)
enddo
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
v(j)=incr(j)+d_t(j,inres)
enddo
c write (iout,*) "i",i," iti",iti," pr",(pr(j),j=1,3),
c & " v",(v(j),j=1,3)," vp",(vp(j),j=1,3)
do j=1,3
- L(j)=L(j)+msc(iti)*vp(j)
+ L(j)=L(j)+msc(iabs(iti))*vp(j)
enddo
c write (iout,*) "L",(l(j),j=1,3)
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
v(j)=incr(j)+d_t(j,inres)
enddo
vcm(j)=vcm(j)+mp*(vv(j)+0.5d0*d_t(j,i))
enddo
endif
- amas=msc(itype(i))
+ amas=msc(iabs(itype(i)))
summas=summas+amas
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
vcm(j)=vcm(j)+amas*(vv(j)+d_t(j,i+nres))
enddo
include 'COMMON.SETUP'
character*1 t1,t2,t3
character*1 onelett(4) /"G","A","P","D"/
+ character*1 toronelet(-2:2) /"p","a","G","A","P"/
logical lprint,LaTeX
dimension blower(3,3,maxlob)
dimension b(13)
C of the virtual-bond valence angles theta
C
do i=1,ntyp
- read (ithep,*,err=111,end=111) a0thet(i),(athet(j,i),j=1,2),
- & (bthet(j,i),j=1,2)
+ read (ithep,*,err=111,end=111) a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
read (ithep,*,err=111,end=111) (polthet(j,i),j=0,3)
- read (ithep,*,err=111,end=111) (gthet(j,i),j=1,3)
- read (ithep,*,err=111,end=111) theta0(i),sig0(i),sigc0(i)
- sigc0(i)=sigc0(i)**2
+ read (ithep,*,err=111,end=111) (gthet(j,i),j=1,3)
+ read (ithep,*,err=111,end=111) theta0(i),sig0(i),sigc0(i)
+ sigc0(i)=sigc0(i)**2
enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
+ enddo
+
close (ithep)
if (lprint) then
if (.not.LaTeX) then
& ' B1 ',' B2 '
do i=1,ntyp
write(iout,'(a3,i4,2x,5(1pe14.5))') restyp(i),i,
- & a0thet(i),(athet(j,i),j=1,2),(bthet(j,i),j=1,2)
+ & a0thet(i),(athet(j,i,1,1),j=1,2),(bthet(j,i,1,1),j=1,2)
enddo
write (iout,'(/a/9x,5a/79(1h-))')
& 'Parameters of the expression for sigma(theta_c):',
& ' b1*10^1 ',' b2*10^1 '
do i=1,ntyp
write(iout,'(a3,1h&,2x,5(f8.3,1h&))') restyp(i),
- & a0thet(i),(100*athet(j,i),j=1,2),(10*bthet(j,i),j=1,2)
+ & a0thet(i),(100*athet(j,i,1,1),j=1,2),
+ & (10*bthet(j,i,1,1),j=1,2)
enddo
write (iout,'(/a/9x,5a/79(1h-))')
& 'Parameters of the expression for sigma(theta_c):',
& ntheterm3,nsingle,ndouble
nntheterm=max0(ntheterm,ntheterm2,ntheterm3)
read (ithep,*,err=111,end=111) (ithetyp(i),i=1,ntyp1)
- do i=1,maxthetyp
- do j=1,maxthetyp
- do k=1,maxthetyp
- aa0thet(i,j,k)=0.0d0
+ do i=-ntyp1,-1
+ ithetyp(i)=-ithetyp(-i)
+ enddo
+ do iblock=1,2
+ do i=-maxthetyp,maxthetyp
+ do j=-maxthetyp,maxthetyp
+ do k=-maxthetyp,maxthetyp
+ aa0thet(i,j,k,iblock)=0.0d0
do l=1,ntheterm
- aathet(l,i,j,k)=0.0d0
+ aathet(l,i,j,k,iblock)=0.0d0
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=0.0d0
- ccthet(m,l,i,j,k)=0.0d0
- ddthet(m,l,i,j,k)=0.0d0
- eethet(m,l,i,j,k)=0.0d0
+ bbthet(m,l,i,j,k,iblock)=0.0d0
+ ccthet(m,l,i,j,k,iblock)=0.0d0
+ ddthet(m,l,i,j,k,iblock)=0.0d0
+ eethet(m,l,i,j,k,iblock)=0.0d0
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=0.0d0
- ggthet(mm,m,l,i,j,k)=0.0d0
+ ffthet(mm,m,l,i,j,k,iblock)=0.0d0
+ ggthet(mm,m,l,i,j,k,iblock)=0.0d0
enddo
enddo
enddo
enddo
enddo
- enddo
- do i=1,nthetyp
- do j=1,nthetyp
- do k=1,nthetyp
- read (ithep,'(3a)',end=111,err=111) res1,res2,res3
- read (ithep,*,end=111,err=111) aa0thet(i,j,k)
- read (ithep,*,end=111,err=111)(aathet(l,i,j,k),l=1,ntheterm)
+ enddo
+ enddo
+c VAR:iblock means terminally blocking group 1=non-proline 2=proline
+ do iblock=1,2
+c VAR:ntethtyp is type of theta potentials type currently 0=glycine
+c VAR:1=non-glicyne non-proline 2=proline
+c VAR:negative values for D-aminoacid
+ do i=0,nthetyp
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ read (ithep,'(6a)',end=111,err=111) res1
+ read (ithep,*,end=111,err=111) aa0thet(i,j,k,iblock)
+c VAR: aa0thet is variable describing the average value of Foureir
+c VAR: expansion series
+c VAR: aathet is foureir expansion in theta/2 angle for full formula
+c VAR: look at the fitting equation in Kozlowska et al., J. Phys.:
+Condens. Matter 19 (2007) 285203 and Sieradzan et al., unpublished
+ read (ithep,*,end=111,err=111)
+ &(aathet(l,i,j,k,iblock),l=1,ntheterm)
read (ithep,*,end=111,err=111)
- & ((bbthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ccthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ddthet(lll,ll,i,j,k),lll=1,nsingle),
- & (eethet(lll,ll,i,j,k),lll=1,nsingle),ll=1,ntheterm2)
+ & ((bbthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ccthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ddthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (eethet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & ll=1,ntheterm2)
read (ithep,*,end=111,err=111)
- & (((ffthet(llll,lll,ll,i,j,k),ffthet(lll,llll,ll,i,j,k),
- & ggthet(llll,lll,ll,i,j,k),ggthet(lll,llll,ll,i,j,k),
+ & (((ffthet(llll,lll,ll,i,j,k,iblock),
+ & ffthet(lll,llll,ll,i,j,k,iblock),
+ & ggthet(llll,lll,ll,i,j,k,iblock),
+ & ggthet(lll,llll,ll,i,j,k,iblock),
& llll=1,lll-1),lll=2,ndouble),ll=1,ntheterm3)
enddo
enddo
C
C For dummy ends assign glycine-type coefficients of theta-only terms; the
C coefficients of theta-and-gamma-dependent terms are zero.
-C
+C IF YOU WANT VALENCE POTENTIALS FOR DUMMY ATOM UNCOMENT BELOW (NOT
+C RECOMENTDED AFTER VERSION 3.3)
+c do i=1,nthetyp
+c do j=1,nthetyp
+c do l=1,ntheterm
+c aathet(l,i,j,nthetyp+1,iblock)=aathet(l,i,j,1,iblock)
+c aathet(l,nthetyp+1,i,j,iblock)=aathet(l,1,i,j,iblock)
+c enddo
+c aa0thet(i,j,nthetyp+1,iblock)=aa0thet(i,j,1,iblock)
+c aa0thet(nthetyp+1,i,j,iblock)=aa0thet(1,i,j,iblock)
+c enddo
+c do l=1,ntheterm
+c aathet(l,nthetyp+1,i,nthetyp+1,iblock)=aathet(l,1,i,1,iblock)
+c enddo
+c aa0thet(nthetyp+1,i,nthetyp+1,iblock)=aa0thet(1,i,1,iblock)
+c enddo
+c enddo
+C AND COMMENT THE LOOPS BELOW
do i=1,nthetyp
do j=1,nthetyp
do l=1,ntheterm
- aathet(l,i,j,nthetyp+1)=aathet(l,i,j,1)
- aathet(l,nthetyp+1,i,j)=aathet(l,1,i,j)
+ aathet(l,i,j,nthetyp+1,iblock)=0.0d0
+ aathet(l,nthetyp+1,i,j,iblock)=0.0d0
enddo
- aa0thet(i,j,nthetyp+1)=aa0thet(i,j,1)
- aa0thet(nthetyp+1,i,j)=aa0thet(1,i,j)
+ aa0thet(i,j,nthetyp+1,iblock)=0.0d0
+ aa0thet(nthetyp+1,i,j,iblock)=0.0d0
enddo
do l=1,ntheterm
- aathet(l,nthetyp+1,i,nthetyp+1)=aathet(l,1,i,1)
+ aathet(l,nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
- aa0thet(nthetyp+1,i,nthetyp+1)=aa0thet(1,i,1)
+ aa0thet(nthetyp+1,i,nthetyp+1,iblock)=0.0d0
+ enddo
enddo
+C TILL HERE
+C Substitution for D aminoacids from symmetry.
+ do iblock=1,2
+ do i=-nthetyp,0
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ aa0thet(i,j,k,iblock)=aa0thet(-i,-j,-k,iblock)
+ do l=1,ntheterm
+ aathet(l,i,j,k,iblock)=aathet(l,-i,-j,-k,iblock)
+ enddo
+ do ll=1,ntheterm2
+ do lll=1,nsingle
+ bbthet(lll,ll,i,j,k,iblock)=bbthet(lll,ll,-i,-j,-k,iblock)
+ ccthet(lll,ll,i,j,k,iblock)=-ccthet(lll,ll,-i,-j,-k,iblock)
+ ddthet(lll,ll,i,j,k,iblock)=ddthet(lll,ll,-i,-j,-k,iblock)
+ eethet(lll,ll,i,j,k,iblock)=-eethet(lll,ll,-i,-j,-k,iblock)
+ enddo
+ enddo
+ do ll=1,ntheterm3
+ do lll=2,ndouble
+ do llll=1,lll-1
+ ffthet(llll,lll,ll,i,j,k,iblock)=
+ & ffthet(llll,lll,ll,-i,-j,-k,iblock)
+ ffthet(lll,llll,ll,i,j,k,iblock)=
+ & ffthet(lll,llll,ll,-i,-j,-k,iblock)
+ ggthet(llll,lll,ll,i,j,k,iblock)=
+ & -ggthet(llll,lll,ll,-i,-j,-k,iblock)
+ ggthet(lll,llll,ll,i,j,k,iblock)=
+ & -ggthet(lll,llll,ll,-i,-j,-k,iblock)
+ enddo !ll
+ enddo !lll
+ enddo !llll
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
C
C Control printout of the coefficients of virtual-bond-angle potentials
C
write (iout,'(//4a)')
& 'Type ',onelett(i),onelett(j),onelett(k)
write (iout,'(//a,10x,a)') " l","a[l]"
- write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k)
+ write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k,iblock)
write (iout,'(i2,1pe15.5)')
- & (l,aathet(l,i,j,k),l=1,ntheterm)
+ & (l,aathet(l,i,j,k,iblock),l=1,ntheterm)
do l=1,ntheterm2
write (iout,'(//2h m,4(9x,a,3h[m,,i1,1h]))')
& "b",l,"c",l,"d",l,"e",l
do m=1,nsingle
write (iout,'(i2,4(1pe15.5))') m,
- & bbthet(m,l,i,j,k),ccthet(m,l,i,j,k),
- & ddthet(m,l,i,j,k),eethet(m,l,i,j,k)
+ & bbthet(m,l,i,j,k,iblock),ccthet(m,l,i,j,k,iblock),
+ & ddthet(m,l,i,j,k,iblock),eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=2,ndouble
do n=1,m-1
write (iout,'(i1,1x,i1,4(1pe15.5))') n,m,
- & ffthet(n,m,l,i,j,k),ffthet(m,n,l,i,j,k),
- & ggthet(n,m,l,i,j,k),ggthet(m,n,l,i,j,k)
+ & ffthet(n,m,l,i,j,k,iblock),
+ & ffthet(m,n,l,i,j,k,iblock),
+ & ggthet(n,m,l,i,j,k,iblock),
+ & ggthet(m,n,l,i,j,k,iblock)
enddo
enddo
enddo
enddo
call flush(iout)
endif
+ write (2,*) "Start reading THETA_PDB",ithep_pdb
+ do i=1,ntyp
+c write (2,*) 'i=',i
+ read (ithep_pdb,*,err=111,end=111)
+ & a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
+ read (ithep_pdb,*,err=111,end=111) (polthet(j,i),j=0,3)
+ read (ithep_pdb,*,err=111,end=111) (gthet(j,i),j=1,3)
+ read (ithep_pdb,*,err=111,end=111) theta0(i),sig0(i),sigc0(i)
+ sigc0(i)=sigc0(i)**2
+ enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
+ enddo
+ write (2,*) "End reading THETA_PDB"
+ close (ithep_pdb)
#endif
close(ithep)
#ifdef CRYST_SC
bsc(1,i)=0.0D0
read(irotam,*,end=112,err=112)(censc(k,1,i),k=1,3),
& ((blower(k,l,1),l=1,k),k=1,3)
+ censc(1,1,-i)=censc(1,1,i)
+ censc(2,1,-i)=censc(2,1,i)
+ censc(3,1,-i)=-censc(3,1,i)
do j=2,nlob(i)
read (irotam,*,end=112,err=112) bsc(j,i)
read (irotam,*,end=112,err=112) (censc(k,j,i),k=1,3),
& ((blower(k,l,j),l=1,k),k=1,3)
+ censc(1,j,-i)=censc(1,j,i)
+ censc(2,j,-i)=censc(2,j,i)
+ censc(3,j,-i)=-censc(3,j,i)
+C BSC is amplitude of Gaussian
enddo
do j=1,nlob(i)
do k=1,3
enddo
gaussc(k,l,j,i)=akl
gaussc(l,k,j,i)=akl
+ if (((k.eq.3).and.(l.ne.3))
+ & .or.((l.eq.3).and.(k.ne.3))) then
+ gaussc(k,l,j,-i)=-akl
+ gaussc(l,k,j,-i)=-akl
+ else
+ gaussc(k,l,j,-i)=akl
+ gaussc(l,k,j,-i)=akl
+ endif
enddo
enddo
enddo
enddo
endif
enddo
+C
+C Read the parameters of the probability distribution/energy expression
+C of the side chains.
+C
+ write (2,*) "Start reading ROTAM_PDB"
+ do i=1,ntyp
+ read (irotam_pdb,'(3x,i3,f8.3)',end=112,err=112) nlob(i),dsc(i)
+ if (i.eq.10) then
+ dsc_inv(i)=0.0D0
+ else
+ dsc_inv(i)=1.0D0/dsc(i)
+ endif
+ if (i.ne.10) then
+ do j=1,nlob(i)
+ do k=1,3
+ do l=1,3
+ blower(l,k,j)=0.0D0
+ enddo
+ enddo
+ enddo
+ bsc(1,i)=0.0D0
+ read(irotam_pdb,*,end=112,err=112)(censc(k,1,i),k=1,3),
+ & ((blower(k,l,1),l=1,k),k=1,3)
+ do j=2,nlob(i)
+ read (irotam_pdb,*,end=112,err=112) bsc(j,i)
+ read (irotam_pdb,*,end=112,err=112) (censc(k,j,i),k=1,3),
+ & ((blower(k,l,j),l=1,k),k=1,3)
+ enddo
+ do j=1,nlob(i)
+ do k=1,3
+ do l=1,k
+ akl=0.0D0
+ do m=1,3
+ akl=akl+blower(k,m,j)*blower(l,m,j)
+ enddo
+ gaussc(k,l,j,i)=akl
+ gaussc(l,k,j,i)=akl
+ enddo
+ enddo
+ enddo
+ endif
+ enddo
+ close (irotam_pdb)
+ write (2,*) "End reading ROTAM_PDB"
#endif
close(irotam)
C
read (itorp,*,end=113,err=113) ntortyp
read (itorp,*,end=113,err=113) (itortyp(i),i=1,ntyp)
-c write (iout,*) 'ntortyp',ntortyp
- do i=1,ntortyp
- do j=1,ntortyp
- read (itorp,*,end=113,err=113) nterm(i,j),nlor(i,j)
+ do iblock=1,2
+ do i=-ntyp,-1
+ itortyp(i)=-itortyp(-i)
+ enddo
+ write (iout,*) 'ntortyp',ntortyp
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ read (itorp,*,end=113,err=113) nterm(i,j,iblock),
+ & nlor(i,j,iblock)
+ nterm(-i,-j,iblock)=nterm(i,j,iblock)
+ nlor(-i,-j,iblock)=nlor(i,j,iblock)
v0ij=0.0d0
si=-1.0d0
- do k=1,nterm(i,j)
- read (itorp,*,end=113,err=113) kk,v1(k,i,j),v2(k,i,j)
- v0ij=v0ij+si*v1(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ read (itorp,*,end=113,err=113) kk,v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
+ v1(k,-i,-j,iblock)=v1(k,i,j,iblock)
+ v2(k,-i,-j,iblock)=-v2(k,i,j,iblock)
+ v0ij=v0ij+si*v1(k,i,j,iblock)
si=-si
+c write(iout,*) i,j,k,iblock,nterm(i,j,iblock)
+c write(iout,*) v1(k,-i,-j,iblock),v1(k,i,j,iblock),
+c &v2(k,-i,-j,iblock),v2(k,i,j,iblock)
enddo
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
read (itorp,*,end=113,err=113) kk,vlor1(k,i,j),
- & vlor2(k,i,j),vlor3(k,i,j)
+ & vlor2(k,i,j),vlor3(k,i,j)
v0ij=v0ij+vlor1(k,i,j)/(1+vlor3(k,i,j)**2)
enddo
- v0(i,j)=v0ij
+ v0(i,j,iblock)=v0ij
+ v0(-i,-j,iblock)=v0ij
enddo
enddo
+ enddo
close (itorp)
if (lprint) then
- write (iout,'(/a/)') 'Torsional constants:'
- do i=1,ntortyp
- do j=1,ntortyp
+ write (iout,'(/a/)') 'Torsional constants:'
+ do i=1,ntortyp
+ do j=1,ntortyp
write (iout,*) 'ityp',i,' jtyp',j
write (iout,*) 'Fourier constants'
- do k=1,nterm(i,j)
- write (iout,'(2(1pe15.5))') v1(k,i,j),v2(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ write (iout,'(2(1pe15.5))') v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
enddo
write (iout,*) 'Lorenz constants'
- do k=1,nlor(i,j)
- write (iout,'(3(1pe15.5))')
+ do k=1,nlor(i,j,iblock)
+ write (iout,'(3(1pe15.5))')
& vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
enddo
enddo
enddo
endif
+
C
C 6/23/01 Read parameters for double torsionals
C
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
read (itordp,'(3a1)',end=114,err=114) t1,t2,t3
- if (t1.ne.onelett(i) .or. t2.ne.onelett(j)
- & .or. t3.ne.onelett(k)) then
+c write (iout,*) "OK onelett",
+c & i,j,k,t1,t2,t3
+
+ if (t1.ne.toronelet(i) .or. t2.ne.toronelet(j)
+ & .or. t3.ne.toronelet(k)) then
write (iout,*) "Error in double torsional parameter file",
& i,j,k,t1,t2,t3
#ifdef MPI
#endif
stop "Error in double torsional parameter file"
endif
- read (itordp,*,end=114,err=114) ntermd_1(i,j,k),
- & ntermd_2(i,j,k)
- read (itordp,*,end=114,err=114) (v1c(1,l,i,j,k),l=1,
- & ntermd_1(i,j,k))
- read (itordp,*,end=114,err=114) (v1s(1,l,i,j,k),l=1,
- & ntermd_1(i,j,k))
- read (itordp,*,end=114,err=114) (v1c(2,l,i,j,k),l=1,
- & ntermd_1(i,j,k))
- read (itordp,*,end=114,err=114) (v1s(2,l,i,j,k),l=1,
- & ntermd_1(i,j,k))
- read (itordp,*,end=114,err=114) ((v2c(l,m,i,j,k),
- & v2c(m,l,i,j,k),v2s(l,m,i,j,k),v2s(m,l,i,j,k),
- & m=1,l-1),l=1,ntermd_2(i,j,k))
- enddo
- enddo
- enddo
+ read (itordp,*,end=114,err=114) ntermd_1(i,j,k,iblock),
+ & ntermd_2(i,j,k,iblock)
+ ntermd_1(-i,-j,-k,iblock)=ntermd_1(i,j,k,iblock)
+ ntermd_2(-i,-j,-k,iblock)=ntermd_2(i,j,k,iblock)
+ read (itordp,*,end=114,err=114) (v1c(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*,end=114,err=114) (v1s(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*,end=114,err=114) (v1c(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*,end=114,err=114) (v1s(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+C Martix of D parameters for one dimesional foureir series
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,-i,-j,-k,iblock)=v1c(1,l,i,j,k,iblock)
+ v1s(1,l,-i,-j,-k,iblock)=-v1s(1,l,i,j,k,iblock)
+ v1c(2,l,-i,-j,-k,iblock)=v1c(2,l,i,j,k,iblock)
+ v1s(2,l,-i,-j,-k,iblock)=-v1s(2,l,i,j,k,iblock)
+c write(iout,*) "whcodze" ,
+c & v1s(2,l,-i,-j,-k,iblock),v1s(2,l,i,j,k,iblock)
+ enddo
+ read (itordp,*,end=114,err=114) ((v2c(l,m,i,j,k,iblock),
+ & v2c(m,l,i,j,k,iblock),v2s(l,m,i,j,k,iblock),
+ & v2s(m,l,i,j,k,iblock),
+ & m=1,l-1),l=1,ntermd_2(i,j,k,iblock))
+C Martix of D parameters for two dimesional fourier series
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,l-1
+ v2c(l,m,-i,-j,-k,iblock)=v2c(l,m,i,j,k,iblock)
+ v2c(m,l,-i,-j,-k,iblock)=v2c(m,l,i,j,k,iblock)
+ v2s(l,m,-i,-j,-k,iblock)=-v2s(l,m,i,j,k,iblock)
+ v2s(m,l,-i,-j,-k,iblock)=-v2s(m,l,i,j,k,iblock)
+ enddo!m
+ enddo!l
+ enddo!k
+ enddo!j
+ enddo!i
+ enddo!iblock
if (lprint) then
- write (iout,*)
+ write (iout,*)
write (iout,*) 'Constants for double torsionals'
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
write (iout,*) 'ityp',i,' jtyp',j,' ktyp',k,
- & ' nsingle',ntermd_1(i,j,k),' ndouble',ntermd_2(i,j,k)
+ & ' nsingle',ntermd_1(i,j,k,iblock),
+ & ' ndouble',ntermd_2(i,j,k,iblock)
write (iout,*)
write (iout,*) 'Single angles:'
- do l=1,ntermd_1(i,j,k)
- write (iout,'(i5,2f10.5,5x,2f10.5)') l,
- & v1c(1,l,i,j,k),v1s(1,l,i,j,k),
- & v1c(2,l,i,j,k),v1s(2,l,i,j,k)
+ do l=1,ntermd_1(i,j,k,iblock)
+ write (iout,'(i5,2f10.5,5x,2f10.5,5x,2f10.5)') l,
+ & v1c(1,l,i,j,k,iblock),v1s(1,l,i,j,k,iblock),
+ & v1c(2,l,i,j,k,iblock),v1s(2,l,i,j,k,iblock),
+ & v1s(1,l,-i,-j,-k,iblock),v1s(2,l,-i,-j,-k,iblock)
enddo
write (iout,*)
write (iout,*) 'Pairs of angles:'
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2c(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2c(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2s(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2s(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock)),
+ & (v2s(l,m,-i,-j,-k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
enddo
enddo
enddo
+ enddo
endif
#endif
+C Read of Side-chain backbone correlation parameters
+C Modified 11 May 2012 by Adasko
+CCC
C
-C 5/21/07 (AL) Read coefficients of the backbone-local sidechain-local
-C correlation energies.
-C
- read (isccor,*,end=119,err=119) nterm_sccor
- do i=1,20
- do j=1,20
- read (isccor,'(a)')
- do k=1,nterm_sccor
- read (isccor,*,end=119,err=119) kk,v1sccor(k,i,j),
- & v2sccor(k,i,j)
+ read (isccor,*,end=119,err=119) nsccortyp
+#ifdef SCCORPDB
+ read (isccor,*,end=119,err=119) (isccortyp(i),i=1,ntyp)
+ do i=-ntyp,-1
+ isccortyp(i)=-isccortyp(-i)
+ enddo
+ iscprol=isccortyp(20)
+c write (iout,*) 'ntortyp',ntortyp
+ maxinter=3
+cc maxinter is maximum interaction sites
+ do l=1,maxinter
+ do i=1,nsccortyp
+ do j=1,nsccortyp
+ read (isccor,*,end=119,err=119)
+ &nterm_sccor(i,j),nlor_sccor(i,j)
+ v0ijsccor=0.0d0
+ v0ijsccor1=0.0d0
+ v0ijsccor2=0.0d0
+ v0ijsccor3=0.0d0
+ si=-1.0d0
+ nterm_sccor(-i,j)=nterm_sccor(i,j)
+ nterm_sccor(-i,-j)=nterm_sccor(i,j)
+ nterm_sccor(i,-j)=nterm_sccor(i,j)
+ do k=1,nterm_sccor(i,j)
+ read (isccor,*,end=119,err=119) kk,v1sccor(k,l,i,j)
+ & ,v2sccor(k,l,i,j)
+ if (j.eq.iscprol) then
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)*0.5d0
+ & +v2sccor(k,l,i,j)*dsqrt(0.75d0)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)*0.5d0
+ & +v1sccor(k,l,i,j)*dsqrt(0.75d0)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ else
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ if (j.eq.isccortyp(10)) then
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=-v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ endif
+ endif
+ v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ v0ijsccor1=v0ijsccor+si*v1sccor(k,l,-i,j)
+ v0ijsccor2=v0ijsccor+si*v1sccor(k,l,i,-j)
+ v0ijsccor3=v0ijsccor+si*v1sccor(k,l,-i,-j)
+ si=-si
+ enddo
+ do k=1,nlor_sccor(i,j)
+ read (isccor,*,end=119,err=119) kk,vlor1sccor(k,i,j),
+ & vlor2sccor(k,i,j),vlor3sccor(k,i,j)
+ v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
+ &(1+vlor3sccor(k,i,j)**2)
enddo
+ v0sccor(l,i,j)=v0ijsccor
+ v0sccor(l,-i,j)=v0ijsccor1
+ v0sccor(l,i,-j)=v0ijsccor2
+ v0sccor(l,-i,-j)=v0ijsccor3
enddo
enddo
+ enddo
close (isccor)
+#else
+ read (isccor,*,end=119,err=119) (isccortyp(i),i=1,ntyp)
+c write (iout,*) 'ntortyp',ntortyp
+ maxinter=3
+cc maxinter is maximum interaction sites
+ do l=1,maxinter
+ do i=1,nsccortyp
+ do j=1,nsccortyp
+ read (isccor,*,end=119,err=119)
+ & nterm_sccor(i,j),nlor_sccor(i,j)
+ v0ijsccor=0.0d0
+ si=-1.0d0
+
+ do k=1,nterm_sccor(i,j)
+ read (isccor,*,end=119,err=119) kk,v1sccor(k,l,i,j)
+ & ,v2sccor(k,l,i,j)
+ v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ si=-si
+ enddo
+ do k=1,nlor_sccor(i,j)
+ read (isccor,*,end=119,err=119) kk,vlor1sccor(k,i,j),
+ & vlor2sccor(k,i,j),vlor3sccor(k,i,j)
+ v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
+ &(1+vlor3sccor(k,i,j)**2)
+ enddo
+ v0sccor(i,j,iblock)=v0ijsccor
+ enddo
+ enddo
+ enddo
+ close (isccor)
+
+#endif
if (lprint) then
- write (iout,'(/a/)') 'Torsional constants of SCCORR:'
- do i=1,20
- do j=1,20
+ write (iout,'(/a/)') 'Torsional constants:'
+ do i=1,nsccortyp
+ do j=1,nsccortyp
write (iout,*) 'ityp',i,' jtyp',j
- do k=1,nterm_sccor
- write (iout,'(2(1pe15.5))') v1sccor(k,i,j),v2sccor(k,i,j)
+ write (iout,*) 'Fourier constants'
+ do k=1,nterm_sccor(i,j)
+ write (iout,'(2(1pe15.5))') v1sccor(k,l,i,j),v2sccor(k,l,i,j)
+ enddo
+ write (iout,*) 'Lorenz constants'
+ do k=1,nlor_sccor(i,j)
+ write (iout,'(3(1pe15.5))')
+ & vlor1sccor(k,i,j),vlor2sccor(k,i,j),vlor3sccor(k,i,j)
enddo
enddo
enddo
endif
+
C
C 9/18/99 (AL) Read coefficients of the Fourier expansion of the local
C interaction energy of the Gly, Ala, and Pro prototypes.
write (iout,*) "Coefficients of the cumulants"
endif
read (ifourier,*) nloctyp
- do i=1,nloctyp
+ do i=0,nloctyp-1
read (ifourier,*,end=115,err=115)
read (ifourier,*,end=115,err=115) (b(ii),ii=1,13)
if (lprint) then
endif
B1(1,i) = b(3)
B1(2,i) = b(5)
+ B1(1,-i) = b(3)
+ B1(2,-i) = -b(5)
c b1(1,i)=0.0d0
c b1(2,i)=0.0d0
B1tilde(1,i) = b(3)
- B1tilde(2,i) =-b(5)
+ B1tilde(2,i) =-b(5)
+ B1tilde(1,-i) =-b(3)
+ B1tilde(2,-i) =b(5)
c b1tilde(1,i)=0.0d0
c b1tilde(2,i)=0.0d0
B2(1,i) = b(2)
B2(2,i) = b(4)
+ B2(1,-i) =b(2)
+ B2(2,-i) =-b(4)
+
c b2(1,i)=0.0d0
c b2(2,i)=0.0d0
CC(1,1,i)= b(7)
CC(2,2,i)=-b(7)
CC(2,1,i)= b(9)
CC(1,2,i)= b(9)
+ CC(1,1,-i)= b(7)
+ CC(2,2,-i)=-b(7)
+ CC(2,1,-i)=-b(9)
+ CC(1,2,-i)=-b(9)
c CC(1,1,i)=0.0d0
c CC(2,2,i)=0.0d0
c CC(2,1,i)=0.0d0
Ctilde(1,2,i)=b(9)
Ctilde(2,1,i)=-b(9)
Ctilde(2,2,i)=b(7)
+ Ctilde(1,1,-i)=b(7)
+ Ctilde(1,2,-i)=-b(9)
+ Ctilde(2,1,-i)=b(9)
+ Ctilde(2,2,-i)=b(7)
+
c Ctilde(1,1,i)=0.0d0
c Ctilde(1,2,i)=0.0d0
c Ctilde(2,1,i)=0.0d0
DD(2,2,i)=-b(6)
DD(2,1,i)= b(8)
DD(1,2,i)= b(8)
+ DD(1,1,-i)= b(6)
+ DD(2,2,-i)=-b(6)
+ DD(2,1,-i)=-b(8)
+ DD(1,2,-i)=-b(8)
c DD(1,1,i)=0.0d0
c DD(2,2,i)=0.0d0
c DD(2,1,i)=0.0d0
Dtilde(1,2,i)=b(8)
Dtilde(2,1,i)=-b(8)
Dtilde(2,2,i)=b(6)
+ Dtilde(1,1,-i)=b(6)
+ Dtilde(1,2,-i)=-b(8)
+ Dtilde(2,1,-i)=b(8)
+ Dtilde(2,2,-i)=b(6)
+
c Dtilde(1,1,i)=0.0d0
c Dtilde(1,2,i)=0.0d0
c Dtilde(2,1,i)=0.0d0
EE(2,2,i)=-b(10)+b(11)
EE(2,1,i)= b(12)-b(13)
EE(1,2,i)= b(12)+b(13)
+ EE(1,1,-i)= b(10)+b(11)
+ EE(2,2,-i)=-b(10)+b(11)
+ EE(2,1,-i)=-b(12)+b(13)
+ EE(1,2,-i)=-b(12)-b(13)
+
c ee(1,1,i)=1.0d0
c ee(2,2,i)=1.0d0
c ee(2,1,i)=0.0d0
enddo
enddo
endif
+
C
C Read electrostatic-interaction parameters
C
bpp (i,j)=-2.0D0*epp(i,j)*rri
ael6(i,j)=elpp6(i,j)*4.2D0**6
ael3(i,j)=elpp3(i,j)*4.2D0**3
+c lprint=.true.
if (lprint) write(iout,'(2i3,4(1pe15.4))')i,j,app(i,j),bpp(i,j),
& ael6(i,j),ael3(i,j)
+c lprint=.false.
enddo
enddo
C
endif
goto 50
C---------------------- GB or BP potential -----------------------------
- 30 read (isidep,*,end=116,err=116)((eps(i,j),j=i,ntyp),i=1,ntyp),
- & (sigma0(i),i=1,ntyp),(sigii(i),i=1,ntyp),(chip(i),i=1,ntyp),
- & (alp(i),i=1,ntyp)
+ 30 do i=1,ntyp
+ read (isidep,*,end=116,err=116)(eps(i,j),j=i,ntyp)
+ enddo
+ read (isidep,*,end=116,err=116)(sigma0(i),i=1,ntyp)
+ read (isidep,*,end=116,err=116)(sigii(i),i=1,ntyp)
+ read (isidep,*,end=116,err=116)(chip(i),i=1,ntyp)
+ read (isidep,*,end=116,err=116)(alp(i),i=1,ntyp)
C For the GB potential convert sigma'**2 into chi'
if (ipot.eq.4) then
do i=1,ntyp
C
C Define the SC-p interaction constants (hard-coded; old style)
C
- do i=1,20
+ do i=1,ntyp
C "Soft" SC-p repulsion (causes helices to be too flat, but facilitates
C helix formation)
c aad(i,1)=0.3D0*4.0D0**12
bad(i,1)=-2*eps_scp(i,1)*rscp(i,1)**6
bad(i,2)=-2*eps_scp(i,2)*rscp(i,2)**6
enddo
-
+c lprint=.true.
if (lprint) then
write (iout,*) "Parameters of SC-p interactions:"
- do i=1,20
+ do i=1,ntyp
write (iout,'(4f8.3,4e12.4)') eps_scp(i,1),rscp(i,1),
& eps_scp(i,2),rscp(i,2),aad(i,1),bad(i,1),aad(i,2),bad(i,2)
enddo
endif
+c lprint=.false.
#endif
C
C Define the constants of the disulfide bridge
else if (card(:3).eq.'TER') then
C End current chain
ires_old=ires+1
- itype(ires_old)=21
+ itype(ires_old)=ntyp1
ibeg=2
c write (iout,*) "Chain ended",ires,ishift,ires_old
if (unres_pdb) then
ishift=ires-1
if (res.ne.'GLY' .and. res.ne. 'ACE') then
ishift=ishift-1
- itype(1)=21
+ itype(1)=ntyp1
endif
c write (iout,*) "ires",ires," ibeg",ibeg," ishift",ishift
ibeg=0
ires=ires-ishift
c write (2,*) "ires",ires," ishift",ishift
if (res.eq.'ACE') then
- ity=10
+ itype(ires)=10
else
itype(ires)=rescode(ires,res,0)
endif
nres=ires
do i=2,nres-1
c write (iout,*) i,itype(i)
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
c write (iout,*) "dummy",i,itype(i)
do j=1,3
c(j,i)=((c(j,i-1)+c(j,i+1))/2+2*c(j,i-1)-c(j,i-2))/2
nstart_sup=1
if (itype(nres).ne.10) then
nres=nres+1
- itype(nres)=21
+ itype(nres)=ntyp1
if (unres_pdb) then
C 2/15/2013 by Adam: corrected insertion of the last dummy residue
call refsys(nres-3,nres-2,nres-1,e1,e2,e3,fail)
c(j,nres+1)=c(j,1)
c(j,2*nres)=c(j,nres)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
nsup=nsup-1
nstart_sup=2
if (unres_pdb) then
lll=lll+1
cc write (iout,*) "spraw lancuchy",(c(j,i),j=1,3)
if (i.gt.1) then
- if ((itype(i-1).eq.21)) then
+ if ((itype(i-1).eq.ntyp1).and.(i.gt.2)) then
chain_length=lll-1
kkk=kkk+1
c write (iout,*) "spraw lancuchy",(c(j,i),j=1,3)
endif
enddo
enddo
+ write (iout,*) chain_length
+ if (chain_length.eq.0) chain_length=nres
do j=1,3
chain_rep(j,chain_length,symetr)=chain_rep(j,chain_length,1)
chain_rep(j,chain_length+nres,symetr)
#endif
do i=1,nres-1
iti=itype(i)
- if (iti.ne.21 .and. itype(i+1).ne.21 .and.
+ if (iti.ne.ntyp1 .and. itype(i+1).ne.ntyp1 .and.
& (dist(i,i+1).lt.2.0D0 .or. dist(i,i+1).gt.5.0D0)) then
write (iout,'(a,i4)') 'Bad Cartesians for residue',i
ctest stop
enddo
enddo
do i=2,nres-1
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc_norm(j,i+nres)=vbld_inv(i+nres)*(c(j,i+nres)-c(j,i))
enddo
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
it=itype(i)
- if (it.ne.10 .and. itype(i).ne.21) then
+ if (it.ne.10 .and. itype(i).ne.ntyp1) then
c
C Compute the axes of tghe local cartesian coordinates system; store in
c x_prime, y_prime and z_prime
do i=1,nres-1
vbld(i+1)=vbl
vbld_inv(i+1)=1.0d0/vbld(i+1)
- vbld(i+1+nres)=dsc(itype(i+1))
- vbld_inv(i+1+nres)=dsc_inv(itype(i+1))
+ vbld(i+1+nres)=dsc(iabs(itype(i+1)))
+ vbld_inv(i+1+nres)=dsc_inv(iabs(itype(i+1)))
c print *,vbld(i+1),vbld(i+1+nres)
enddo
return
& 'General scaling factor of SC-p interactions:',scalscp
endif
r0_corr=cutoff_corr-delt_corr
- do i=1,20
+ do i=1,ntyp
aad(i,1)=scalscp*aad(i,1)
aad(i,2)=scalscp*aad(i,2)
bad(i,1)=scalscp*bad(i,1)
maxsi=1000
do i=2,nres-1
iti=itype(i)
- if (iti.ne.10 .and. itype(i).ne.21) then
+ if (iti.ne.10 .and. itype(i).ne.ntyp1) then
nsi=0
fail=.true.
do while (fail.and.nsi.le.maxsi)
vbld_inv(i)=vblinv
enddo
do i=2,nres-1
- vbld(i+nres)=dsc(itype(i))
- vbld_inv(i+nres)=dsc_inv(itype(i))
+ vbld(i+nres)=dsc(iabs(itype(i)))
+ vbld_inv(i+nres)=dsc_inv(iabs(itype(i)))
c write (iout,*) "i",i," itype",itype(i),
c & " dsc",dsc(itype(i))," vbld",vbld(i),vbld(i+nres)
enddo
c print '(20i4)',(itype(i),i=1,nres)
do i=1,nres
#ifdef PROCOR
- if (itype(i).eq.21 .or. itype(i+1).eq.21) then
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) then
#else
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
#endif
itel(i)=0
#ifdef PROCOR
- else if (itype(i+1).ne.20) then
+ else if (iabs(itype(i+1)).ne.20) then
#else
- else if (itype(i).ne.20) then
+ else if (iabs(itype(i)).ne.20) then
#endif
itel(i)=1
else
#endif
nct=nres
cd print *,'NNT=',NNT,' NCT=',NCT
- if (itype(1).eq.21) nnt=2
- if (itype(nres).eq.21) nct=nct-1
+ if (itype(1).eq.ntyp1) nnt=2
+ if (itype(nres).eq.ntyp1) nct=nct-1
if (pdbref) then
if(me.eq.king.or..not.out1file)
& write (iout,'(a,i3)') 'nsup=',nsup
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc(j,i+nres)=c(j,i+nres)-c(j,i)
dc_norm(j,i+nres)=dc_norm(j,i+nres)*vbld_inv(i+nres)
enddo
do i=2,nres-1
omeg(i)=-120d0*deg2rad
+ if (itype(i).le.0) omeg(i)=-omeg(i)
enddo
else
if(me.eq.king.or..not.out1file)
enddo
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
do j=1,3
dc(j,i+nres)=c(j,i+nres)-c(j,i)
dc_norm(j,i+nres)=dc(j,i+nres)*vbld_inv(i+nres)
nvar=ntheta+nphi
nside=0
do i=2,nres-1
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10 .and. itype(i).ne.ntyp1) then
nside=nside+1
ialph(i,1)=nvar+nside
ialph(nside,2)=i
open (itordp,file=tordname,status='old',readonly)
call getenv_loc('SCCORPAR',sccorname)
open (isccor,file=sccorname,status='old',readonly)
+#ifndef CRYST_THETA
+ call getenv_loc('THETPARPDB',thetname_pdb)
+ print *,"thetname_pdb ",thetname_pdb
+ open (ithep_pdb,file=thetname_pdb,status='old',action='read')
+ print *,ithep_pdb," opened"
+#endif
call getenv_loc('FOURIER',fouriername)
open (ifourier,file=fouriername,status='old',readonly)
call getenv_loc('ELEPAR',elename)
open (ielep,file=elename,status='old',readonly)
call getenv_loc('SIDEPAR',sidename)
open (isidep,file=sidename,status='old',readonly)
+#ifndef CRYST_SC
+ call getenv_loc('ROTPARPDB',rotname_pdb)
+ open (irotam_pdb,file=rotname_pdb,status='old',action='read')
+#endif
#endif
#ifndef OLDSCP
C
& thetname(:ilen(thetname))
write (iout,*) "Rotamer parameter file : ",
& rotname(:ilen(rotname))
+ write (iout,*) "Thetpdb parameter file : ",
+ & thetname_pdb(:ilen(thetname_pdb))
write (iout,*) "Threading database : ",
& patname(:ilen(patname))
if (lentmp.ne.0)
if (itype.eq.0) then
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (ucase(nam).eq.restyp(i)) then
rescode=i
return
else
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (nam(1:1).eq.onelet(i)) then
rescode=i
return
c Don't do glycine or ends
i=itype(res_pick)
- if (i.eq.10 .or. i.eq.21) return
+ if (i.eq.10 .or. i.eq.ntyp1) return
c Freeze everything (later will relax only selected side-chains)
mask_r=.true.
n_try=0
do while (n_try.lt.n_maxtry .and. orig_e-cur_e.lt.e_drop)
c Move the selected residue (don't worry if it fails)
- call gen_side(itype(res_pick),theta(res_pick+1),
+ call gen_side(iabs(itype(res_pick)),theta(res_pick+1),
+ alph(res_pick),omeg(res_pick),fail)
c Minimize the side-chains starting from the new arrangement
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do j=istart(i,iint),iend(i,iint)
IF (mask_side(j).eq.1.or.mask_side(i).eq.1) THEN
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=dsc_inv(itypj)
sig0ij=sigma(itypi,itypj)
chi1=chi(itypi,itypj)
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10) then
do j=1,3
d_t_work(ind+j)=d_t(j,i+nres)
enddo
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10) then
do j=1,3
friction(j,i+nres)=fric_work(ind+j)
enddo
enddo
x=0.0d0
+#ifdef MPI
time00=MPI_Wtime()
+#else
+ time00=tcpu()
+#endif
c Compute the stochastic forces acting on bodies. Store in force.
do i=nnt,nct-1
sig=stdforcp(i)
force(j,i+nres)=anorm_distr(x,sig2,lowb2,highb2)
enddo
enddo
+#ifdef MPI
time_fsample=time_fsample+MPI_Wtime()-time00
+#else
+ time_fsample=time_fsample+tcpu()-time00
+#endif
c Compute the stochastic forces acting on virtual-bond vectors.
do j=1,3
ff(j)=0.0d0
do j=1,3
ff(j)=ff(j)+force(j,i)
enddo
- if (itype(i+1).ne.21) then
+ if (itype(i+1).ne.ntyp1) then
do j=1,3
stochforc(j,i)=stochforc(j,i)+force(j,i+nres+1)
ff(j)=ff(j)+force(j,i+nres+1)
stochforc(j,0)=ff(j)+force(j,nnt+nres)
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10) then
do j=1,3
stochforc(j,i+nres)=force(j,i+nres)
enddo
ind=ind+3
enddo
do i=nnt,nct
- if (itype(i).ne.10 .and. itype(i).ne.21) then
+ if (itype(i).ne.10) then
do j=1,3
stochforcvec(ind+j)=stochforc(j,i+nres)
enddo
c------------------------------------------------------------------
subroutine setup_fricmat
implicit real*8 (a-h,o-z)
+#ifdef MPI
include 'mpif.h'
+#endif
include 'DIMENSIONS'
include 'COMMON.VAR'
include 'COMMON.CHAIN'
ind=ind+1
ii = ind+m
iti=itype(i)
- gamvec(ii)=gamsc(iti)
+ gamvec(ii)=gamsc(iabs(iti))
enddo
if (surfarea) call sdarea(gamvec)
c if (lprn) then
if (nfgtasks.gt.1) then
if (fg_rank.eq.0) then
c The matching BROADCAST for fg processors is called in ERGASTULUM
+#ifdef MPI
time00=MPI_Wtime()
+#else
+ time00=tcpu()
+#endif
call MPI_Bcast(10,1,MPI_INTEGER,king,FG_COMM,IERROR)
+#ifdef MPI
time_Bcast=time_Bcast+MPI_Wtime()-time00
+#else
+ time_Bcast=time_Bcast+tcpu()-time00
+#endif
c print *,"Processor",myrank,
c & " BROADCAST iorder in SETUP_FRICMAT"
endif
c licznik=licznik+1
c write (iout,*) "setup_fricmat licznik",licznik
+#ifdef MPI
time00=MPI_Wtime()
+#else
+ time00=tcpu()
+#endif
c Scatter the friction matrix
call MPI_Scatterv(fricmat(1,1),nginv_counts(0),
& nginv_start(0),MPI_DOUBLE_PRECISION,fcopy(1,1),
& myginv_ng_count,MPI_DOUBLE_PRECISION,king,FG_COMM,IERROR)
- time_scatter=time_scatter+MPI_Wtime()-time00
#ifdef TIMING
+#ifdef MPI
+ time_scatter=time_scatter+MPI_Wtime()-time00
time_scatter_fmat=time_scatter_fmat+MPI_Wtime()-time00
+#else
+ time_scatter=time_scatter+tcpu()-time00
+ time_scatter_fmat=time_scatter_fmat+tcpu()-time00
+#endif
#endif
do i=1,dimen
do j=1,2*my_ng_count
include 'COMMON.NAMES'
double precision radius(maxres2),gamvec(maxres2)
parameter (twosix=1.122462048309372981d0)
- logical lprn /.true./
+ logical lprn /.false./
c
c determine new friction coefficients every few SD steps
c
cd non_conv)
cd write (iout,'(a,f10.5)')
cd & 'Initial RMS deviation from reference structure:',rms
- if (itype(nres).eq.21) then
+ if (itype(nres).eq.ntyp1) then
do j=1,3
dcj=c(j,nres-2)-c(j,nres-3)
c(j,nres)=c(j,nres-1)+dcj
c(j,2*nres)=c(j,nres)
enddo
endif
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
do j=1,3
dcj=c(j,4)-c(j,3)
c(j,1)=c(j,2)-dcj
#=========================================
if(UNRES_MD_FF STREQUAL "GAB" )
# set preprocesor flags
- set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DCRYST_BOND -DCRYST_THETA -DCRYST_SC" )
+ set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DCRYST_BOND -DCRYST_THETA -DCRYST_SC -DSCCORPDB" )
#=========================================
# Settings for E0LL2Y force field
#=========================================
elseif(UNRES_MD_FF STREQUAL "E0LL2Y")
# set preprocesor flags
- set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0" )
+ set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DSCCORPDB" )
endif(UNRES_MD_FF STREQUAL "GAB")
#=========================================
& sigc0,dsc,dsc_inv,bsc,censc,gaussc,dsc0
integer nlob
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1),
+ & bthet(2,-ntyp:ntyp,-1:1,-1:1),polthet(0:3,-ntyp:ntyp),
+ & gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),sig0(-ntyp:ntyp),
+ & sigc0(-ntyp:ntyp)
C Parameters of the side-chain probability distribution
common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ & dsc0(ntyp1),
& nlob(ntyp1)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
- & ithetyp(ntyp1),nntheterm
- double precision aa0thet(maxthetyp1,maxthetyp1,maxthetyp1),
- & aathet(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1),
- & bbthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ccthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ddthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & eethet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ffthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1),
- & ggthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1)
+ & ithetyp(-ntyp1:ntyp1),nntheterm
+ double precision aa0thet(-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & aathet(maxtheterm,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & bbthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ccthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ddthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & eethet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ffthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2),
+ & ggthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2)
common /theta_abinitio/aa0thet,aathet,bbthet,ccthet,ddthet,eethet,
& ffthet,
& ggthet,ithetyp,nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,
C Virtual-bond lenghts
double precision vbl,vblinv,vblinv2,vbl_cis,vbl0,vbld_inv
integer loc_start,loc_end,ithet_start,ithet_end,iphi_start,
- & iphi_end,iphid_start,iphid_end,itau_start,itau_end,ibond_start,
- & ibond_end,
+ & iphi_end,iphid_start,iphid_end,ibond_start,ibond_end,
& ibondp_start,ibondp_end,ivec_start,ivec_end,iset_start,iset_end,
& iturn3_start,iturn3_end,iturn4_start,iturn4_end,iint_start,
- & iint_end,iphi1_start,iphi1_end,
+ & iint_end,iphi1_start,iphi1_end,itau_start,itau_end,
& ibond_displ(0:max_fg_procs-1),ibond_count(0:max_fg_procs-1),
& ithet_displ(0:max_fg_procs-1),ithet_count(0:max_fg_procs-1),
& iphi_displ(0:max_fg_procs-1),iphi_count(0:max_fg_procs-1),
& iint_count(0:max_fg_procs-1),iint_displ(0:max_fg_procs-1)
common /peptbond/ vbl,vblinv,vblinv2,vbl_cis,vbl0
common /indices/ loc_start,loc_end,ithet_start,ithet_end,
- & iphi_start,iphi_end,iphid_start,iphid_end,itau_start,itau_end,
- & ibond_start,ibond_end,
+ & iphi_start,iphi_end,iphid_start,iphid_end,ibond_start,ibond_end,
& ibondp_start,ibondp_end,ivec_start,ivec_end,iset_start,iset_end,
& iturn3_start,iturn3_end,iturn4_start,iturn4_end,iint_start,
& iint_end,iphi1_start,iphi1_end,iint_count,iint_displ,ivec_displ,
- & ivec_count,iset_displ,
+ & ivec_count,iset_displ,itau_start,itau_end,
& iset_count,ibond_displ,ibond_count,ithet_displ,ithet_count,
& iphi_displ,iphi_count,iphi1_displ,iphi1_count
C Inverses of the actual virtual bond lengths
& dcostau,dsintau,dtauangle,dcosomicron,
& domicron
integer nterm_sccor,isccortyp,nsccortyp,nlor_sccor
- common/sccor/v1sccor(maxterm_sccor,3,20,20),
- & v2sccor(maxterm_sccor,3,20,20),
+ common/sccor/v1sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v2sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v0sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & nterm_sccor(-ntyp:ntyp,-ntyp:ntyp),isccortyp(-ntyp:ntyp),
+ & nsccortyp,
+ & nlor_sccor(-ntyp:ntyp,-ntyp:ntyp),
& vlor1sccor(maxterm_sccor,20,20),
& vlor2sccor(maxterm_sccor,20,20),
& vlor3sccor(maxterm_sccor,20,20),gloc_sc(3,0:maxres2,10),
+++ /dev/null
-Makefile_MPICH_pgf90
\ No newline at end of file
--- /dev/null
+INSTALL_DIR = /users/software/mpich-1.2.7p1_intel-10.1_em64_ssh
+
+
+FC= ifort
+
+OPT = -g -ip -w -CB
+
+FFLAGS = -c ${OPT} -I$(INSTALL_DIR)/include
+FFLAGS1 = -c -w -g -d2 -CA -CB -I$(INSTALL_DIR)/include
+FFLAGS2 = -c -w -g -O0 -I$(INSTALL_DIR)/include
+FFLAGSE = -c -w -O3 -CB -ipo -ipo_obj -opt_report -I$(INSTALL_DIR)/include
+
+
+LIBS = -L$(INSTALL_DIR)/lib -lmpich ../../lib/xdrf/libxdrf.a
+
+ARCH = LINUX
+PP = /lib/cpp -P
+
+
+all: unres
+
+.SUFFIXES: .F
+.F.o:
+ ${FC} ${FFLAGS} ${CPPFLAGS} $*.F
+
+
+object = unres.o arcos.o cartprint.o chainbuild.o convert.o initialize_p.o \
+ matmult.o readrtns.o parmread.o gen_rand_conf.o printmat.o map.o \
+ pinorm.o randgens.o rescode.o intcor.o timing.o misc.o intlocal.o \
+ cartder.o checkder_p.o econstr_local.o energy_p_new_barrier.o \
+ energy_p_new-sep_barrier.o gradient_p.o minimize_p.o sumsld.o \
+ cored.o rmdd.o geomout.o readpdb.o regularize.o thread.o fitsq.o mcm.o \
+ mc.o bond_move.o refsys.o check_sc_distr.o check_bond.o contact.o djacob.o \
+ eigen.o blas.o add.o entmcm.o minim_mcmf.o \
+ MP.o compare_s1.o prng.o \
+ banach.o rmsd.o elecont.o dihed_cons.o \
+ sc_move.o local_move.o \
+ intcartderiv.o lagrangian_lesyng.o\
+ stochfric.o kinetic_lesyng.o MD_A-MTS.o moments.o int_to_cart.o \
+ surfatom.o sort.o muca_md.o MREMD.o rattle.o gauss.o energy_split-sep.o \
+ q_measure.o gnmr1.o test.o
+
+GAB: CPPFLAGS = -DPROCOR -DLINUX -DPGI -DUNRES -DISNAN -DMP -DMPI \
+ -DSPLITELE -DLANG0 -DCRYST_BOND -DCRYST_THETA -DCRYST_SC\
+ -DSCCORPDB
+GAB: BIN = ../../../bin/unres/MD/unres_ifort_MPICH_GAB_czyt.exe
+GAB: ${object} xdrf/libxdrf.a
+ cc -o compinfo compinfo.c
+ ./compinfo | true
+ ${FC} ${FFLAGS} cinfo.f
+ ${FC} ${OPT} ${object} cinfo.o ${LIBS} -o ${BIN}
+
+E0LL2Y: CPPFLAGS = -DPROCOR -DLINUX -DPGI -DUNRES -DISNAN -DMP -DMPI \
+ -DSPLITELE -DLANG0
+E0LL2Y: BIN = ../../../bin/unres/MD/unres_ifort_MPICH_E0LL2Y.exe
+E0LL2Y: ${object} xdrf/libxdrf.a
+ cc -o compinfo compinfo.c
+ ./compinfo | true
+ ${FC} ${FFLAGS} cinfo.f
+ ${FC} ${OPT} ${object} cinfo.o ${LIBS} -o ${BIN}
+
+xdrf/libxdrf.a:
+ cd ../../lib/xdrf && make
+
+
+clean:
+ /bin/rm -f *.o && /bin/rm -f compinfo && cd xdrf && make clean
+
+test.o: test.F
+ ${FC} ${FFLAGS} ${CPPFLAGS} test.F
+
+chainbuild.o: chainbuild.F
+ ${FC} ${FFLAGS} ${CPPFLAGS} chainbuild.F
+
+matmult.o: matmult.f
+ ${FC} ${FFLAGS} ${CPPFLAGS} matmult.f
+
+parmread.o : parmread.F
+ ${FC} ${FFLAGS} ${CPPFLAGS} parmread.F
+
+intcor.o : intcor.f
+ ${FC} ${FFLAGS} ${CPPFLAGS} intcor.f
+
+cartder.o : cartder.F
+ ${FC} ${FFLAGS} ${CPPFLAGS} cartder.F
+
+readpdb.o : readpdb.F
+ ${FC} ${FFLAGS2} ${CPPFLAGS} readpdb.F
+
+sumsld.o : sumsld.f
+ ${FC} ${FFLAGS} ${CPPFLAGS} sumsld.f
+
+cored.o : cored.f
+ ${FC} ${FFLAGS1} ${CPPFLAGS} cored.f
+
+rmdd.o : rmdd.f
+ ${FC} ${FFLAGS} ${CPPFLAGS} rmdd.f
+
+energy_p_new_barrier.o : energy_p_new_barrier.F
+ ${FC} ${FFLAGSE} ${CPPFLAGS} energy_p_new_barrier.F
+
+gradient_p.o : gradient_p.F
+ ${FC} ${FFLAGSE} ${CPPFLAGS} gradient_p.F
+
+energy_p_new-sep_barrier.o : energy_p_new-sep_barrier.F
+ ${FC} ${FFLAGSE} ${CPPFLAGS} energy_p_new-sep_barrier.F
+
+lagrangian_lesyng.o : lagrangian_lesyng.F
+ ${FC} ${FFLAGSE} ${CPPFLAGS} lagrangian_lesyng.F
+
+MD_A-MTS.o : MD_A-MTS.F
+ ${FC} ${FFLAGSE} ${CPPFLAGS} MD_A-MTS.F
+
+blas.o : blas.f
+ ${FC} ${FFLAGS1} blas.f
+
+add.o : add.f
+ ${FC} ${FFLAGS1} add.f
+
+eigen.o : eigen.f
+ ${FC} ${FFLAGS2} eigen.f
+
+proc_proc.o: proc_proc.c
+ ${CC} ${CFLAGS} proc_proc.c
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
c dscj_inv=dsc_inv(itypj)
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
enddo
endif
if (i.lt.nres) then
+
+ if (iabs(itype(i+1)).eq.20) iblock=2
+ if (iabs(itype(i+1)).ne.20) iblock=1
#ifdef OSF
phii1=phi(i+1)
if (phii1.ne.phii1) phii1=150.0
sinph2(k)=0.0d0
enddo
endif
- ethetai=aa0thet(ityp1,ityp2,ityp3)
+ ethetai=aa0thet(ityp1,ityp2,ityp3,iblock)
do k=1,ndouble
do l=1,k-1
ccl=cosph1(l)*cosph2(k-l)
enddo
endif
do k=1,ntheterm
- ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3)*sinkt(k)
- dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3)
+ ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3,iblock)*sinkt(k)
+ dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3,iblock)
& *coskt(k)
if (lprn)
- & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3),
+ & write (iout,*) "k",k,
+ & "aathet",aathet(k,ityp1,ityp2,ityp3,iblock),
& " ethetai",ethetai
enddo
if (lprn) then
endif
do m=1,ntheterm2
do k=1,nsingle
- aux=bbthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)
- & +ccthet(k,m,ityp1,ityp2,ityp3)*sinph1(k)
- & +ddthet(k,m,ityp1,ityp2,ityp3)*cosph2(k)
- & +eethet(k,m,ityp1,ityp2,ityp3)*sinph2(k)
+ aux=bbthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)
+ & +ccthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k)
+ & +ddthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)
+ & +eethet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*aux*coskt(m)
dephii=dephii+k*sinkt(m)*(
- & ccthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)-
- & bbthet(k,m,ityp1,ityp2,ityp3)*sinph1(k))
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)-
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k))
dephii1=dephii1+k*sinkt(m)*(
- & eethet(k,m,ityp1,ityp2,ityp3)*cosph2(k)-
- & ddthet(k,m,ityp1,ityp2,ityp3)*sinph2(k))
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)-
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k))
if (lprn)
& write (iout,*) "m",m," k",k," bbthet",
- & bbthet(k,m,ityp1,ityp2,ityp3)," ccthet",
- & ccthet(k,m,ityp1,ityp2,ityp3)," ddthet",
- & ddthet(k,m,ityp1,ityp2,ityp3)," eethet",
- & eethet(k,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)," ccthet",
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)," ddthet",
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)," eethet",
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)," ethetai",ethetai
enddo
enddo
if (lprn)
do m=1,ntheterm3
do k=2,ndouble
do l=1,k-1
- aux=ffthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)
+ aux=ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)
+
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*coskt(m)*aux
dephii=dephii+l*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)-
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)-
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
+
dephii1=dephii1+(k-l)*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)-
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ &-ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)-
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
+
if (lprn) then
write (iout,*) "m",m," k",k," l",l," ffthet",
- & ffthet(l,k,m,ityp1,ityp2,ityp3),
- & ffthet(k,l,m,ityp1,ityp2,ityp3)," ggthet",
- & ggthet(l,k,m,ityp1,ityp2,ityp3),
- & ggthet(k,l,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & ffthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ggthet",
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock),
+ & " ethetai",ethetai
+
write (iout,*) cosph1ph2(l,k)*sinkt(m),
& cosph1ph2(k,l)*sinkt(m),
& sinph1ph2(l,k)*sinkt(m),sinph1ph2(k,l)*sinkt(m)
cosfac=dsqrt(cosfac2)
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
- it=itype(i)
+ it=iabs(itype(i))
if (it.eq.10) goto 1
c
C Compute the axes of tghe local cartesian coordinates system; store in
y_prime(j) = (dc_norm(j,i) + dc_norm(j,i-1))*sinfac
enddo
do j = 1,3
- z_prime(j) = -uz(j,i-1)
+ z_prime(j) = -uz(j,i-1)*dsign(1.0d0,dfloat(itype(i)))
enddo
c write (2,*) "i",i
c write (2,*) "x_prime",(x_prime(j),j=1,3)
C Compute the energy of the ith side cbain
C
c write (2,*) "xx",xx," yy",yy," zz",zz
- it=itype(i)
+ it=iabs(itype(i))
do j = 1,65
x(j) = sc_parmin(j,it)
enddo
Cc diagnostics - remove later
xx1 = dcos(alph(2))
yy1 = dsin(alph(2))*dcos(omeg(2))
- zz1 = -dsin(alph(2))*dsin(omeg(2))
+ zz1 = -dsign(1.0, dfloat(itype(i)))*dsin(alph(2))*dsin(omeg(2))
write(2,'(3f8.1,3f9.3,1x,3f9.3)')
& alph(2)*rad2deg,omeg(2)*rad2deg,theta(3)*rad2deg,xx,yy,zz,
& xx1,yy1,zz1
dZZ_Ci1(k)=0.0d0
dZZ_Ci(k)=0.0d0
do j=1,3
- dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)*dC_norm(j,i+nres)
- dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)*dC_norm(j,i+nres)
+ dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+ dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
enddo
dXX_XYZ(k)=vbld_inv(i+nres)*(x_prime(k)-xx*dC_norm(k,i+nres))
etors=0.0D0
do i=iphi_start,iphi_end
etors_ii=0.0D0
+c if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+c & .or. itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
c lprn=.true.
etors_d=0.0D0
do i=iphid_start,iphid_end
+c if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+c & .or. itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
itori2=itortyp(itype(i))
C Set lprn=.true. for debugging
lprn=.false.
c lprn=.true.
-c write (iout,*) "EBACK_SC_COR",iphi_start,iphi_end,nterm_sccor
+c write (iout,*) "EBACK_SC_COR",itau_start,itau_end
esccor=0.0D0
do i=itau_start,itau_end
esccor_ii=0.0D0
+ if ((itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)) cycle
isccori=isccortyp(itype(i-2))
isccori1=isccortyp(itype(i-1))
phii=phi(i)
c 3 = SC...Ca...Ca...SCi
gloci=0.0D0
if (((intertyp.eq.3).and.((itype(i-2).eq.10).or.
- & (itype(i-1).eq.10).or.(itype(i-2).eq.21).or.
- & (itype(i-1).eq.21)))
+ & (itype(i-1).eq.10).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-1).eq.ntyp1)))
& .or. ((intertyp.eq.1).and.((itype(i-2).eq.10)
- & .or.(itype(i-2).eq.21)))
+ & .or.(itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)
+ & .or.(itype(i).eq.ntyp1)))
& .or.((intertyp.eq.2).and.((itype(i-1).eq.10).or.
- & (itype(i-1).eq.21)))) cycle
- if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.21)) cycle
- if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.21))
+ & (itype(i-1).eq.ntyp1).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-3).eq.ntyp1)))) cycle
+ if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.ntyp1)) cycle
+ if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.ntyp1))
& cycle
do j=1,nterm_sccor(isccori,isccori1)
v1ij=v1sccor(j,intertyp,isccori,isccori1)
c &gloc_sc(intertyp,i-3,icg)
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
- & restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1sccor(j,intertyp,itori,itori1),j=1,6)
- & ,(v2sccor(j,intertyp,itori,itori1),j=1,6)
+ & restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,isccori,isccori1,
+ & (v1sccor(j,intertyp,isccori,isccori1),j=1,6)
+ & ,(v2sccor(j,intertyp,isccori,isccori1),j=1,6)
gsccor_loc(i-3)=gsccor_loc(i-3)+gloci
enddo !intertyp
enddo
c enddo
if (nres.lt.2) return
if ((nres.lt.3).and.(itype(1).eq.10)) return
- if ((itype(1).ne.10).and.(itype(1).ne.21)) then
+ if ((itype(1).ne.10).and.(itype(1).ne.ntyp1)) then
do j=1,3
cc Derviative was calculated for oposite vector of side chain therefore
c there is "-" sign before gloc_sc
& dtauangle(j,1,1,3)
gcart(j,1)=gcart(j,1)+gloc_sc(1,0,icg)*
& dtauangle(j,1,2,3)
- if ((itype(2).ne.10).and.(itype(2).ne.21)) then
+ if ((itype(2).ne.10).and.(itype(2).ne.ntyp1)) then
gxcart(j,1)= gxcart(j,1)
& -gloc_sc(3,0,icg)*dtauangle(j,3,1,3)
gcart(j,1)=gcart(j,1)+gloc_sc(3,0,icg)*
endif
enddo
endif
- if ((nres.ge.3).and.(itype(3).ne.10).and.(itype(3).ne.21))
+ if ((nres.ge.3).and.(itype(3).ne.10).and.(itype(3).ne.ntyp1))
& then
do j=1,3
gcart(j,1)=gcart(j,1)+gloc_sc(2,1,icg)*dtauangle(j,2,1,4)
c Calculating the remainder of dE/ddc2
do j=1,3
- if((itype(2).ne.10).and.(itype(2).ne.21)) then
+ if((itype(2).ne.10).and.(itype(2).ne.ntyp1)) then
if (itype(1).ne.10) gxcart(j,2)=gxcart(j,2)+
& gloc_sc(3,0,icg)*dtauangle(j,3,3,3)
- if ((itype(3).ne.10).and.(nres.ge.3).and.(itype(3).ne.21)) then
+ if ((itype(3).ne.10).and.(nres.ge.3).and.(itype(3).ne.ntyp1))
+ & then
gxcart(j,2)=gxcart(j,2)-gloc_sc(3,1,icg)*dtauangle(j,3,1,4)
cc the - above is due to different vector direction
gcart(j,2)=gcart(j,2)+gloc_sc(3,1,icg)*dtauangle(j,3,2,4)
c write(iout,*) gloc_sc(1,1,icg),dtauangle(j,1,1,4),"gx"
endif
endif
- if ((itype(1).ne.10).and.(itype(1).ne.21)) then
+ if ((itype(1).ne.10).and.(itype(1).ne.ntyp1)) then
gcart(j,2)=gcart(j,2)+gloc_sc(1,0,icg)*dtauangle(j,1,3,3)
c write(iout,*) gloc_sc(1,0,icg),dtauangle(j,1,3,3)
endif
c Setting dE/ddnres-1
if(nres.ge.4) then
do j=1,3
- if ((itype(nres-1).ne.10).and.(itype(nres-1).ne.21)) then
+ if ((itype(nres-1).ne.10).and.(itype(nres-1).ne.ntyp1)) then
gxcart(j,nres-1)=gxcart(j,nres-1)+gloc_sc(2,nres-3,icg)
& *dtauangle(j,2,3,nres)
c write (iout,*) "gxcart(nres-1)", gloc_sc(2,nres-3,icg),
gxcart(j,nres-1)=gxcart(j,nres-1)+gloc_sc(3,nres-3,icg)
& *dtauangle(j,3,3,nres)
endif
- if ((itype(nres).ne.10).and.(itype(nres).ne.21)) then
+ if ((itype(nres).ne.10).and.(itype(nres).ne.ntyp1)) then
gxcart(j,nres-1)=gxcart(j,nres-1)-gloc_sc(3,nres-2,icg)
& *dtauangle(j,3,1,nres+1)
gcart(j,nres-1)=gcart(j,nres-1)+gloc_sc(3,nres-2,icg)
& *dtauangle(j,3,2,nres+1)
endif
endif
- if ((itype(nres-2).ne.10).and.(itype(nres-2).ne.21)) then
+ if ((itype(nres-2).ne.10).and.(itype(nres-2).ne.ntyp1)) then
gcart(j,nres-1)=gcart(j,nres-1)+gloc_sc(1,nres-3,icg)*
& dtauangle(j,1,3,nres)
endif
- if ((itype(nres).ne.10).and.(itype(nres).ne.21)) then
+ if ((itype(nres).ne.10).and.(itype(nres).ne.ntyp1)) then
gcart(j,nres-1)=gcart(j,nres-1)+gloc_sc(2,nres-2,icg)*
& dtauangle(j,2,2,nres+1)
c write (iout,*) "gcart(nres-1)", gloc_sc(2,nres-2,icg),
#else
do i=3,nres
#endif
- if ((itype(i-1).ne.10).and.(itype(i-1).ne.21)) then
+ if ((itype(i-1).ne.10).and.(itype(i-1).ne.ntyp1)) then
cost1=dcos(omicron(1,i))
sint1=sqrt(1-cost1*cost1)
cost2=dcos(omicron(2,i))
#else
do i=3,nres
#endif
- if ((itype(i-2).eq.21).or.(itype(i-2).eq.10)) cycle
+ if ((itype(i-2).eq.ntyp1).or.(itype(i-2).eq.10)) cycle
cc dtauangle(j,intertyp,dervityp,residue number)
cc INTERTYP=1 SC...Ca...Ca..Ca
c the conventional case
#else
do i=4,nres
#endif
- if ((itype(i-1).eq.21).or.(itype(i-1).eq.10)) cycle
+ if ((itype(i-1).eq.ntyp1).or.(itype(i-1).eq.10)) cycle
c the conventional case
sint=dsin(omicron(1,i))
sint1=dsin(theta(i-1))
do i=3,nres
#endif
c the conventional case
- if ((itype(i-1).eq.21).or.(itype(i-1).eq.10).or.
- &(itype(i-2).eq.21).or.(itype(i-2).eq.10)) cycle
+ if ((itype(i-1).eq.ntyp1).or.(itype(i-1).eq.10).or.
+ &(itype(i-2).eq.ntyp1).or.(itype(i-2).eq.10)) cycle
sint=dsin(omicron(1,i))
sint1=dsin(omicron(2,i-1))
sing=dsin(tauangle(3,i))
& ntheterm3,nsingle,ndouble
nntheterm=max0(ntheterm,ntheterm2,ntheterm3)
read (ithep,*,err=111,end=111) (ithetyp(i),i=1,ntyp1)
- do i=1,maxthetyp
- do j=1,maxthetyp
- do k=1,maxthetyp
- aa0thet(i,j,k)=0.0d0
+ do i=-ntyp1,-1
+ ithetyp(i)=-ithetyp(-i)
+ enddo
+ do iblock=1,2
+ do i=-maxthetyp,maxthetyp
+ do j=-maxthetyp,maxthetyp
+ do k=-maxthetyp,maxthetyp
+ aa0thet(i,j,k,iblock)=0.0d0
do l=1,ntheterm
- aathet(l,i,j,k)=0.0d0
+ aathet(l,i,j,k,iblock)=0.0d0
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=0.0d0
- ccthet(m,l,i,j,k)=0.0d0
- ddthet(m,l,i,j,k)=0.0d0
- eethet(m,l,i,j,k)=0.0d0
+ bbthet(m,l,i,j,k,iblock)=0.0d0
+ ccthet(m,l,i,j,k,iblock)=0.0d0
+ ddthet(m,l,i,j,k,iblock)=0.0d0
+ eethet(m,l,i,j,k,iblock)=0.0d0
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=0.0d0
- ggthet(mm,m,l,i,j,k)=0.0d0
+ ffthet(mm,m,l,i,j,k,iblock)=0.0d0
+ ggthet(mm,m,l,i,j,k,iblock)=0.0d0
enddo
enddo
enddo
enddo
enddo
- enddo
- do i=1,nthetyp
- do j=1,nthetyp
- do k=1,nthetyp
- read (ithep,'(3a)',end=111,err=111) res1,res2,res3
- read (ithep,*,end=111,err=111) aa0thet(i,j,k)
- read (ithep,*,end=111,err=111)(aathet(l,i,j,k),l=1,ntheterm)
+ enddo
+ enddo
+c VAR:iblock means terminally blocking group 1=non-proline 2=proline
+ do iblock=1,2
+c VAR:ntethtyp is type of theta potentials type currently 0=glycine
+c VAR:1=non-glicyne non-proline 2=proline
+c VAR:negative values for D-aminoacid
+ do i=0,nthetyp
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ read (ithep,'(6a)',end=111,err=111) res1
+c VAR: aa0thet is variable describing the average value of Foureir
+c VAR: expansion series
+ read (ithep,*,end=111,err=111) aa0thet(i,j,k,iblock)
+c VAR: aathet is foureir expansion in theta/2 angle for full formula
+c VAR: look at the fitting equation in Kozlowska et al., J. Phys.:
+Condens. Matter 19 (2007) 285203 and Sieradzan et al., unpublished
+ read (ithep,*,end=111,err=111)
+ &(aathet(l,i,j,k,iblock),l=1,ntheterm)
read (ithep,*,end=111,err=111)
- & ((bbthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ccthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ddthet(lll,ll,i,j,k),lll=1,nsingle),
- & (eethet(lll,ll,i,j,k),lll=1,nsingle),ll=1,ntheterm2)
+ & ((bbthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ccthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ddthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (eethet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & ll=1,ntheterm2)
read (ithep,*,end=111,err=111)
- & (((ffthet(llll,lll,ll,i,j,k),ffthet(lll,llll,ll,i,j,k),
- & ggthet(llll,lll,ll,i,j,k),ggthet(lll,llll,ll,i,j,k),
+ & (((ffthet(llll,lll,ll,i,j,k,iblock),
+ & ffthet(lll,llll,ll,i,j,k,iblock),
+ & ggthet(llll,lll,ll,i,j,k,iblock),
+ & ggthet(lll,llll,ll,i,j,k,iblock),
& llll=1,lll-1),lll=2,ndouble),ll=1,ntheterm3)
enddo
enddo
enddo
+
+
C
C For dummy ends assign glycine-type coefficients of theta-only terms; the
C coefficients of theta-and-gamma-dependent terms are zero.
-C
+C IF YOU WANT VALENCE POTENTIALS FOR DUMMY ATOM UNCOMENT BELOW (NOT
+C RECOMENTDED AFTER VERSION 3.3)
+c do i=1,nthetyp
+c do j=1,nthetyp
+c do l=1,ntheterm
+c aathet(l,i,j,nthetyp+1,iblock)=aathet(l,i,j,1,iblock)
+c aathet(l,nthetyp+1,i,j,iblock)=aathet(l,1,i,j,iblock)
+c enddo
+c aa0thet(i,j,nthetyp+1,iblock)=aa0thet(i,j,1,iblock)
+c aa0thet(nthetyp+1,i,j,iblock)=aa0thet(1,i,j,iblock)
+c enddo
+c do l=1,ntheterm
+c aathet(l,nthetyp+1,i,nthetyp+1,iblock)=aathet(l,1,i,1,iblock)
+c enddo
+c aa0thet(nthetyp+1,i,nthetyp+1,iblock)=aa0thet(1,i,1,iblock)
+c enddo
+c enddo
+C AND COMMENT THE LOOPS BELOW
do i=1,nthetyp
do j=1,nthetyp
do l=1,ntheterm
- aathet(l,i,j,nthetyp+1)=aathet(l,i,j,1)
- aathet(l,nthetyp+1,i,j)=aathet(l,1,i,j)
+ aathet(l,i,j,nthetyp+1,iblock)=0.0d0
+ aathet(l,nthetyp+1,i,j,iblock)=0.0d0
enddo
- aa0thet(i,j,nthetyp+1)=aa0thet(i,j,1)
- aa0thet(nthetyp+1,i,j)=aa0thet(1,i,j)
+ aa0thet(i,j,nthetyp+1,iblock)=0.0d0
+ aa0thet(nthetyp+1,i,j,iblock)=0.0d0
enddo
do l=1,ntheterm
- aathet(l,nthetyp+1,i,nthetyp+1)=aathet(l,1,i,1)
+ aathet(l,nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
- aa0thet(nthetyp+1,i,nthetyp+1)=aa0thet(1,i,1)
+ aa0thet(nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
+ enddo
+C TILL HERE
+C Substitution for D aminoacids from symmetry.
+ do iblock=1,2
+ do i=-nthetyp,0
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ aa0thet(i,j,k,iblock)=aa0thet(-i,-j,-k,iblock)
+ do l=1,ntheterm
+ aathet(l,i,j,k,iblock)=aathet(l,-i,-j,-k,iblock)
+ enddo
+ do ll=1,ntheterm2
+ do lll=1,nsingle
+ bbthet(lll,ll,i,j,k,iblock)=bbthet(lll,ll,-i,-j,-k,iblock)
+ ccthet(lll,ll,i,j,k,iblock)=-ccthet(lll,ll,-i,-j,-k,iblock)
+ ddthet(lll,ll,i,j,k,iblock)=ddthet(lll,ll,-i,-j,-k,iblock)
+ eethet(lll,ll,i,j,k,iblock)=-eethet(lll,ll,-i,-j,-k,iblock)
+ enddo
+ enddo
+ do ll=1,ntheterm3
+ do lll=2,ndouble
+ do llll=1,lll-1
+ ffthet(llll,lll,ll,i,j,k,iblock)=
+ & ffthet(llll,lll,ll,-i,-j,-k,iblock)
+ ffthet(lll,llll,ll,i,j,k,iblock)=
+ & ffthet(lll,llll,ll,-i,-j,-k,iblock)
+ ggthet(llll,lll,ll,i,j,k,iblock)=
+ & -ggthet(llll,lll,ll,-i,-j,-k,iblock)
+ ggthet(lll,llll,ll,i,j,k,iblock)=
+ & -ggthet(lll,llll,ll,-i,-j,-k,iblock)
+ enddo !ll
+ enddo !lll
+ enddo !llll
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
C
C Control printout of the coefficients of virtual-bond-angle potentials
C
do i=1,nthetyp+1
do j=1,nthetyp+1
do k=1,nthetyp+1
- write (iout,'(//4a)')
- & 'Type ',onelett(i),onelett(j),onelett(k)
+ write (iout,'(//4a)')
+ & 'Type ',onelett(i),onelett(j),onelett(k)
write (iout,'(//a,10x,a)') " l","a[l]"
- write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k)
+ write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k,iblock)
write (iout,'(i2,1pe15.5)')
- & (l,aathet(l,i,j,k),l=1,ntheterm)
+ & (l,aathet(l,i,j,k,iblock),l=1,ntheterm)
do l=1,ntheterm2
- write (iout,'(//2h m,4(9x,a,3h[m,,i1,1h]))')
+ write (iout,'(//2h m,4(9x,a,3h[m,,i1,1h]))')
& "b",l,"c",l,"d",l,"e",l
do m=1,nsingle
write (iout,'(i2,4(1pe15.5))') m,
- & bbthet(m,l,i,j,k),ccthet(m,l,i,j,k),
- & ddthet(m,l,i,j,k),eethet(m,l,i,j,k)
+ & bbthet(m,l,i,j,k,iblock),ccthet(m,l,i,j,k,iblock),
+ & ddthet(m,l,i,j,k,iblock),eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=2,ndouble
do n=1,m-1
write (iout,'(i1,1x,i1,4(1pe15.5))') n,m,
- & ffthet(n,m,l,i,j,k),ffthet(m,n,l,i,j,k),
- & ggthet(n,m,l,i,j,k),ggthet(m,n,l,i,j,k)
+ & ffthet(n,m,l,i,j,k,iblock),
+ & ffthet(m,n,l,i,j,k,iblock),
+ & ggthet(n,m,l,i,j,k,iblock),
+ & ggthet(m,n,l,i,j,k,iblock)
enddo
enddo
enddo
endif
write (2,*) "Start reading THETA_PDB"
do i=1,ntyp
- read (ithep_pdb,*,err=111,end=111) a0thet(i),(athet(j,i),j=1,2),
- & (bthet(j,i),j=1,2)
+ read (ithep_pdb,*,err=111,end=111)
+ & a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
read (ithep_pdb,*,err=111,end=111) (polthet(j,i),j=0,3)
read (ithep_pdb,*,err=111,end=111) (gthet(j,i),j=1,3)
read (ithep_pdb,*,err=111,end=111) theta0(i),sig0(i),sigc0(i)
sigc0(i)=sigc0(i)**2
enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
+ enddo
write (2,*) "End reading THETA_PDB"
close (ithep_pdb)
#endif
C Read the parameters of the probability distribution/energy expression
C of the side chains.
C
+ write (2,*) "Start reading ROTAM_PDB"
+
do i=1,ntyp
read (irotam_pdb,'(3x,i3,f8.3)',end=112,err=112) nlob(i),dsc(i)
if (i.eq.10) then
endif
enddo
close (irotam_pdb)
+ write (2,*) "Ending reading ROTAM_PDB"
#endif
close(irotam)
do j=1,ntortyp
do k=1,ntortyp
read (itordp,'(3a1)',end=114,err=114) t1,t2,t3
+<<<<<<< HEAD
+c write (iout,*) "OK onelett",
+c & i,j,k,t1,t2,t3
+
+ if (t1.ne.toronelet(i) .or. t2.ne.toronelet(j)
+ & .or. t3.ne.toronelet(k)) then
+=======
if (t1.ne.onelett(i) .or. t2.ne.onelett(j)
& .or. t3.ne.onelett(k)) then
+>>>>>>> devel
write (iout,*) "Error in double torsional parameter file",
& i,j,k,t1,t2,t3
#ifdef MPI
if (lprint) then
write (iout,*)
write (iout,*) 'Constants for double torsionals'
+<<<<<<< HEAD
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
+=======
do i=1,ntortyp
do j=1,ntortyp
do k=1,ntortyp
+>>>>>>> devel
write (iout,*) 'ityp',i,' jtyp',j,' ktyp',k,
& ' nsingle',ntermd_1(i,j,k),' ndouble',ntermd_2(i,j,k)
write (iout,*)
C Modified 11 May 2012 by Adasko
CCC
C
+<<<<<<< HEAD
+ read (isccor,*,end=119,err=119) nsccortyp
+#ifdef SCCORPDB
+ read (isccor,*,end=119,err=119) (isccortyp(i),i=1,ntyp)
+ do i=-ntyp,-1
+ isccortyp(i)=-isccortyp(-i)
+ enddo
+ iscprol=isccortyp(20)
+=======
read (isccor,*,end=1113,err=1113) nsccortyp
read (isccor,*,end=1113,err=1113) (isccortyp(i),i=1,ntyp)
+>>>>>>> devel
c write (iout,*) 'ntortyp',ntortyp
maxinter=3
cc maxinter is maximum interaction sites
do l=1,maxinter
do i=1,nsccortyp
do j=1,nsccortyp
+<<<<<<< HEAD
+ read (isccor,*,end=119,err=119) nterm_sccor(i,j),nlor_sccor(i,j)
+=======
read (isccor,*,end=1113,err=1113) nterm_sccor(i,j),
& nlor_sccor(i,j)
+>>>>>>> devel
v0ijsccor=0.0d0
+ v0ijsccor1=0.0d0
+ v0ijsccor2=0.0d0
+ v0ijsccor3=0.0d0
si=-1.0d0
-
+ nterm_sccor(-i,j)=nterm_sccor(i,j)
+ nterm_sccor(-i,-j)=nterm_sccor(i,j)
+ nterm_sccor(i,-j)=nterm_sccor(i,j)
do k=1,nterm_sccor(i,j)
+<<<<<<< HEAD
+ read (isccor,*,end=119,err=119) kk,v1sccor(k,l,i,j)
+ & ,v2sccor(k,l,i,j)
+ if (j.eq.iscprol) then
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)*0.5d0
+ & +v2sccor(k,l,i,j)*dsqrt(0.75d0)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)*0.5d0
+ & +v1sccor(k,l,i,j)*dsqrt(0.75d0)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ else
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ if (j.eq.isccortyp(10)) then
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=-v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ endif
+ endif
+=======
read (isccor,*,end=1113,err=1113) kk,v1sccor(k,l,i,j)
& ,v2sccor(k,l,i,j)
+>>>>>>> devel
v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ v0ijsccor1=v0ijsccor+si*v1sccor(k,l,-i,j)
+ v0ijsccor2=v0ijsccor+si*v1sccor(k,l,i,-j)
+ v0ijsccor3=v0ijsccor+si*v1sccor(k,l,-i,-j)
si=-si
enddo
do k=1,nlor_sccor(i,j)
+<<<<<<< HEAD
+ read (isccor,*,end=119,err=119) kk,vlor1sccor(k,i,j),
+=======
read (isccor,*,end=1113,err=1113) kk,vlor1sccor(k,i,j),
+>>>>>>> devel
& vlor2sccor(k,i,j),vlor3sccor(k,i,j)
v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
&(1+vlor3sccor(k,i,j)**2)
enddo
- v0sccor(i,j)=v0ijsccor
+ v0sccor(l,i,j)=v0ijsccor
+ v0sccor(l,-i,j)=v0ijsccor1
+ v0sccor(l,i,-j)=v0ijsccor2
+ v0sccor(l,-i,-j)=v0ijsccor3
enddo
enddo
enddo
close (isccor)
-
+#else
+ read (isccor,*,end=119,err=119) (isccortyp(i),i=1,ntyp)
+c write (iout,*) 'ntortyp',ntortyp
+ maxinter=3
+cc maxinter is maximum interaction sites
+ do l=1,maxinter
+ do i=1,nsccortyp
+ do j=1,nsccortyp
+ read (isccor,*,end=119,err=119)
+ & nterm_sccor(i,j),nlor_sccor(i,j)
+ v0ijsccor=0.0d0
+ si=-1.0d0
+
+ do k=1,nterm_sccor(i,j)
+ read (isccor,*,end=119,err=119) kk,v1sccor(k,l,i,j)
+ & ,v2sccor(k,l,i,j)
+ v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ si=-si
+ enddo
+ do k=1,nlor_sccor(i,j)
+ read (isccor,*,end=119,err=119) kk,vlor1sccor(k,i,j),
+ & vlor2sccor(k,i,j),vlor3sccor(k,i,j)
+ v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
+ &(1+vlor3sccor(k,i,j)**2)
+ enddo
+ v0sccor(i,j,iblock)=v0ijsccor
+ enddo
+ enddo
+ enddo
+ close (isccor)
+
+#endif
if (lprint) then
write (iout,'(/a/)') 'Torsional constants:'
do i=1,nsccortyp
c b1(1,i)=0.0d0
c b1(2,i)=0.0d0
B1tilde(1,i) = b(3)
+<<<<<<< HEAD
+ B1tilde(2,i) =-b(5)
+ B1tilde(1,-i) =-b(3)
+ B1tilde(2,-i) =b(5)
+=======
B1tilde(2,i) =-b(5)
+>>>>>>> devel
c b1tilde(1,i)=0.0d0
c b1tilde(2,i)=0.0d0
B2(1,i) = b(2)
endif
goto 50
C---------------------- GB or BP potential -----------------------------
- 30 read (isidep,*,end=116,err=116)((eps(i,j),j=i,ntyp),i=1,ntyp),
- & (sigma0(i),i=1,ntyp),(sigii(i),i=1,ntyp),(chip(i),i=1,ntyp),
- & (alp(i),i=1,ntyp)
+ 30 do i=1,ntyp
+ read (isidep,*,end=116,err=116)(eps(i,j),j=i,ntyp)
+ enddo
+ read (isidep,*,end=116,err=116)(sigma0(i),i=1,ntyp)
+ read (isidep,*,end=116,err=116)(sigii(i),i=1,ntyp)
+ read (isidep,*,end=116,err=116)(chip(i),i=1,ntyp)
+ read (isidep,*,end=116,err=116)(alp(i),i=1,ntyp)
+
+c 30 read (isidep,*,end=116,err=116)((eps(i,j),j=i,ntyp),i=1,ntyp),
+c & (sigma0(i),i=1,ntyp),(sigii(i),i=1,ntyp),(chip(i),i=1,ntyp),
+c & (alp(i),i=1,ntyp)
C For the GB potential convert sigma'**2 into chi'
if (ipot.eq.4) then
do i=1,ntyp
C
C Define the SC-p interaction constants (hard-coded; old style)
C
- do i=1,20
+ do i=1,ntyp
C "Soft" SC-p repulsion (causes helices to be too flat, but facilitates
C helix formation)
c aad(i,1)=0.3D0*4.0D0**12
if (lprint) then
write (iout,*) "Parameters of SC-p interactions:"
- do i=1,20
+ do i=1,ntyp
write (iout,'(4f8.3,4e12.4)') eps_scp(i,1),rscp(i,1),
& eps_scp(i,2),rscp(i,2),aad(i,1),bad(i,1),aad(i,2),bad(i,2)
enddo
ishift=ires-1
if (res.ne.'GLY' .and. res.ne. 'ACE') then
ishift=ishift-1
- itype(1)=21
+ itype(1)=ntyp1
endif
ibeg=0
endif
nstart_sup=1
if (itype(nres).ne.10) then
nres=nres+1
- itype(nres)=21
+ itype(nres)=ntyp1
if (unres_pdb) then
C 2/15/2013 by Adam: corrected insertion of the last dummy residue
call refsys(nres-3,nres-2,nres-1,e1,e2,e3,fail)
c(j,nres+1)=c(j,1)
c(j,2*nres)=c(j,nres)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
nsup=nsup-1
nstart_sup=2
if (unres_pdb) then
c print '(20i4)',(itype(i),i=1,nres)
do i=1,nres
#ifdef PROCOR
- if (itype(i).eq.21 .or. itype(i+1).eq.21) then
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) then
#else
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
#endif
itel(i)=0
#ifdef PROCOR
#endif
nct=nres
cd print *,'NNT=',NNT,' NCT=',NCT
- if (itype(1).eq.21) nnt=2
- if (itype(nres).eq.21) nct=nct-1
+ if (itype(1).eq.ntyp1) nnt=2
+ if (itype(nres).eq.ntyp1) nct=nct-1
if (pdbref) then
if(me.eq.king.or..not.out1file)
& write (iout,'(a,i3)') 'nsup=',nsup
c Don't do glycine or ends
i=itype(res_pick)
- if (i.eq.10 .or. i.eq.21) return
+ if (i.eq.10 .or. i.eq.ntyp1) return
c Freeze everything (later will relax only selected side-chains)
mask_r=.true.
do j=1,3
ff(j)=ff(j)+force(j,i)
enddo
- if (itype(i+1).ne.21) then
+ if (itype(i+1).ne.ntyp1) then
do j=1,3
stochforc(j,i)=stochforc(j,i)+force(j,i+nres+1)
ff(j)=ff(j)+force(j,i+nres+1)
ind=ind+1
ii = ind+m
iti=itype(i)
- gamvec(ii)=gamsc(iti)
+ gamvec(ii)=gamsc(iabs(iti))
enddo
if (surfarea) call sdarea(gamvec)
c if (lprn) then
cd non_conv)
cd write (iout,'(a,f10.5)')
cd & 'Initial RMS deviation from reference structure:',rms
- if (itype(nres).eq.21) then
+ if (itype(nres).eq.ntyp1) then
do j=1,3
dcj=c(j,nres-2)-c(j,nres-3)
c(j,nres)=c(j,nres-1)+dcj
c(j,2*nres)=c(j,nres)
enddo
endif
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
do j=1,3
dcj=c(j,4)-c(j,3)
c(j,1)=c(j,2)-dcj
# set preprocesor flags
set(CPPFLAGS "PROCOR -DSPLITELE -DCRYST_BOND -DCRYST_THETA -DCRYST_SC -DSCCORPDB" )
+<<<<<<< HEAD
+if(UNRES_MD_FF STREQUAL "GAB" )
+ # set preprocesor flags
+ set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DCRYST_BOND -DCRYST_THETA -DCRYST_SC -DSCCORPDB" )
+
+=======
+>>>>>>> devel
#=========================================
# Settings for E0LL2Y force field
#=========================================
elseif(UNRES_MD_FF STREQUAL "E0LL2Y")
# set preprocesor flags
+<<<<<<< HEAD
+ set(CPPFLAGS "PROCOR -DUNRES -DISNAN -DSPLITELE -DLANG0 -DSCCORPDB" )
+endif(UNRES_MD_FF STREQUAL "GAB")
+=======
set(CPPFLAGS "PROCOR -DSPLITELE -DSCCORPDB" )
endif(UNRES_MD_FF STREQUAL "GAB")
# Additional flags
#=========================================
set(CPPFLAGS "${CPPFLAGS} -DUNRES -DISNAN")
+>>>>>>> devel
#=========================================
# System specific flags
& vbldsc0_all(maxbondterm,ntyp,max_parm),
& aksc_all(maxbondterm,ntyp,max_parm),
& abond0_all(maxbondterm,ntyp,max_parm),
- & a0thet_all(ntyp,max_parm),athet_all(2,ntyp,max_parm),
- & bthet_all(2,ntyp,max_parm),polthet_all(0:3,ntyp,max_parm),
- & gthet_all(3,ntyp,max_parm),theta0_all(ntyp,max_parm),
- & sig0_all(ntyp,max_parm),sigc0_all(ntyp,max_parm),
- & aa0thet_all(maxthetyp1,maxthetyp1,maxthetyp1,max_parm),
- & aathet_all(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1,max_parm),
- & bbthet_all(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,
- & maxthetyp1,max_parm),
- & ccthet_all(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,
- & maxthetyp1,max_parm),
- & ddthet_all(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,
- & maxthetyp1,max_parm),
- & eethet_all(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,
- & maxthetyp1,max_parm),
- & ffthet_all(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1,max_parm),
- & ggthet_all(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1,max_parm),
+ & a0thet_all(-ntyp:ntyp,max_parm),
+ & athet_all(2,-ntyp:ntyp,-1:1,-1:1,max_parm),
+ & bthet_all(2,-ntyp:ntyp,-1:1,-1:1,max_parm),
+ & polthet_all(0:3,-ntyp:ntyp,max_parm),
+ & gthet_all(3,-ntyp:ntyp,max_parm),theta0_all(-ntyp:ntyp,max_parm),
+ & sig0_all(-ntyp:ntyp,max_parm),sigc0_all(-ntyp:ntyp,max_parm),
+ & aa0thet_all(-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,2,max_parm),
+ & aathet_all(maxtheterm,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2,max_parm),
+ & bbthet_all(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2,max_parm),
+ & ccthet_all(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,2,max_parm),
+ & ddthet_all(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,2,max_parm),
+ & eethet_all(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,2,max_parm),
+ & ffthet_all1(maxdouble,maxdouble,maxtheterm3,
+ & -maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,max_parm),
+ & ggthet_all1(maxdouble,maxdouble,maxtheterm3,
+ & -maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,max_parm),
+ & ffthet_all2(maxdouble,maxdouble,maxtheterm3,
+ & -maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,max_parm),
+ & ggthet_all2(maxdouble,maxdouble,maxtheterm3,
+ & -maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,
+ & -maxthetyp1:maxthetyp1,max_parm),
& dsc_all(ntyp1,max_parm),bsc_all(maxlob,ntyp,max_parm),
- & censc_all(3,maxlob,ntyp,max_parm),
- & gaussc_all(3,3,maxlob,ntyp,max_parm),dsc0_all(ntyp1,max_parm),
+ & censc_all(3,maxlob,-ntyp:ntyp,max_parm),
+ & gaussc_all(3,3,maxlob,-ntyp:ntyp,max_parm),
+ & dsc0_all(ntyp1,max_parm),
& sc_parmin_all(65,ntyp,max_parm),
- & v0_all(maxtor,maxtor,max_parm),
- & v1_all(maxterm,maxtor,maxtor,max_parm),
- & v2_all(maxterm,maxtor,maxtor,max_parm),
+ & v0_all(-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & v1_all(maxterm,-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & v2_all(maxterm,-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
& vlor1_all(maxlor,maxtor,maxtor,max_parm),
& vlor2_all(maxlor,maxtor,maxtor,max_parm),
& vlor3_all(maxlor,maxtor,maxtor,max_parm),
- & v1c_all(2,maxtermd_1,maxtor,maxtor,maxtor,max_parm),
- & v1s_all(2,maxtermd_1,maxtor,maxtor,maxtor,max_parm),
- & v2c_all(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor,max_parm),
- & v2s_all(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor,max_parm),
- & b1_all(2,maxtor,max_parm),b2_all(2,maxtor,max_parm),
- & cc_all(2,2,maxtor,max_parm),dd_all(2,2,maxtor,max_parm),
- & ee_all(2,2,maxtor,max_parm),ctilde_all(2,2,maxtor,max_parm),
- & dtilde_all(2,2,maxtor,max_parm),b1tilde_all(2,maxtor,max_parm),
+ & v1c_all(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & v1s_all(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & v2c_all(maxtermd_2,maxtermd_2,-maxtor:maxtor,
+ & -maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & v2s_all(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & b1_all(2,-maxtor:maxtor,max_parm),
+ & b2_all(2,-maxtor:maxtor,max_parm),
+ & cc_all(2,2,-maxtor:maxtor,max_parm),
+ & dd_all(2,2,-maxtor:maxtor,max_parm),
+ & ee_all(2,2,-maxtor:maxtor,max_parm),
+ & ctilde_all(2,2,-maxtor:maxtor,max_parm),
+ & dtilde_all(2,2,-maxtor:maxtor,max_parm),
+ & b1tilde_all(2,-maxtor:maxtor,max_parm),
& app_all(2,2,max_parm),bpp_all(2,2,max_parm),
& ael6_all(2,2,max_parm),ael3_all(2,2,max_parm),
& aad_all(ntyp,2,max_parm),bad_all(ntyp,2,max_parm),
& alp_all(ntyp,max_parm),ebr_all(max_parm),d0cm_all(max_parm),
& akcm_all(max_parm),akth_all(max_parm),akct_all(max_parm),
& v1ss_all(max_parm),v2ss_all(max_parm),v3ss_all(max_parm),
- & v1sccor_all(maxterm_sccor,ntyp,ntyp,max_parm),
- & v2sccor_all(maxterm_sccor,ntyp,ntyp,max_parm)
- integer nlob_all(ntyp1,max_parm),nlor_all(maxtor,maxtor,max_parm),
- & nterm_all(maxtor,maxtor,max_parm),
- & ntermd1_all(maxtor,maxtor,maxtor,max_parm),
- & ntermd2_all(maxtor,maxtor,maxtor,max_parm),
+ & v1sccor_all(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp,max_parm),
+ & v2sccor_all(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp,max_parm)
+ integer nlob_all(ntyp1,max_parm),
+ & nlor_all(-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & nterm_all(-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & ntermd1_all(-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & ntermd2_all(-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
& nbondterm_all(ntyp,max_parm),nthetyp_all(max_parm),
- & ithetyp_all(ntyp1,max_parm),ntheterm_all(max_parm),
+ & ithetyp_all(-ntyp1:ntyp1,max_parm),ntheterm_all(max_parm),
& ntheterm2_all(max_parm),ntheterm3_all(max_parm),
& nsingle_all(max_parm),ndouble_all(max_parm),
- & nntheterm_all(max_parm),nterm_sccor_all(max_parm)
+ & nntheterm_all(max_parm),
+ &nterm_sccor_all(-ntyp:ntyp,-ntyp:ntyp,max_parm)
common /allparm/ ww_all,vbldp0_all,akp_all,vbldsc0_all,aksc_all,
& abond0_all,aa0thet_all,aathet_all,bbthet_all,ccthet_all,
- & ddthet_all,eethet_all,ffthet_all,ggthet_all,
+ & ddthet_all,eethet_all,ffthet_all1,ggthet_all1,
+ & ffthet_all2,ggthet_all2,
& a0thet_all,athet_all,bthet_all,polthet_all,gthet_all,theta0_all,
& sig0_all,sigc0_all,dsc_all,bsc_all,censc_all,gaussc_all,dsc0_all,
& sc_parmin_all,
integer ntheta,nphi,nside,nvar,ialph,ivar
double precision theta,phi,alph,omeg,vbld,vbld_ref,
& theta_ref,phi_ref,alph_ref,omeg_ref,
- & costtab,sinttab,cost2tab,sint2tab,
+ & costtab,sinttab,cost2tab,sint2tab,tauangle,omicron,
& xxtab,yytab,zztab
common /var/ theta(maxres),phi(maxres),alph(maxres),omeg(maxres),
& vbld(2*maxres),
& costtab(maxres), sinttab(maxres), cost2tab(maxres),
& sint2tab(maxres),xxtab(maxres),yytab(maxres),
& zztab(maxres),
- & ialph(maxres,2),ivar(4*maxres2),ntheta,nphi,nside,nvar
+ & ialph(maxres,2),ivar(4*maxres2),ntheta,nphi,nside,nvar,
+ & omicron(2,maxres),tauangle(3,maxres)
C Angles from experimental structure
common /varref/ vbld_ref(maxres),
& theta_ref(maxres),phi_ref(maxres),
parameter (maxconts=maxres)
C Number of AA types (at present only natural AA's will be handled
integer ntyp,ntyp1
- parameter (ntyp=20,ntyp1=ntyp+1)
+ parameter (ntyp=24,ntyp1=ntyp+1)
integer nntyp
parameter (nntyp=ntyp*(ntyp+1)/2)
C Max. number of types of dihedral angles & multiplicity of torsional barriers
parameter (maxtor=4,maxterm=10,maxlor=3,maxtermd_1=8,maxtermd_2=8)
c Max number of torsional terms in SCCOR
integer maxterm_sccor
- parameter (maxterm_sccor=3)
+ parameter (maxterm_sccor=6)
C Max. number of residue types and parameters in expressions for
C virtual-bond angle bending potentials
integer maxthetyp,maxthetyp1,maxtheterm,maxtheterm2,maxtheterm3,
INSTALL_DIR = /users/software/mpich-1.2.7p1_intel-10.1_em64_ssh
-BIN = ../bin
+BIN = ../../../bin
CC = cc
FC = ifort
#OPT = -O3 -ip -w
OPT = -g -CB
FFLAGS = -c ${OPT} -I. -I./include_unres -I$(INSTALL_DIR)/include
#FFLAGS = -c -g -C -I. -I./include_unres -I$(INSTALL_DIR)/include
-LIBS = -L$(INSTALL_DIR)/lib -lmpich xdrf/libxdrf.a
+LIBS = -L$(INSTALL_DIR)/lib -lmpich ../../lib/xdrf/libxdrf.a
#LIBS = -L$(INSTALL_DIR)/lib_pgi -lmpich -lpmpich -Vaxlib
#CPPFLAGS = -DMPI -DLINUX -DUNRES -DMOMENT -DCHECKGRAD -DPGI
#CPPFLAGS = -DMPI -DLINUX -DUNRES -DCHECKGRAD -DPGI -DMYGETENV
* Derivatives in alpha and omega:
*
do i=2,nres-1
- dsci=dsc(itype(i))
+ dsci=dsc(iabs(itype(i)))
alphi=alph(i)
omegi=omeg(i)
cd print *,'i=',i,' dsci=',dsci,' alphi=',alphi,' omegi=',omegi
--- /dev/null
+C DO NOT EDIT THIS FILE - IT HAS BEEN GENERATED BY COMPINFO.C
+C 0 0 702
+ subroutine cinfo
+ include 'COMMON.IOUNITS'
+ write(iout,*)'++++ Compile info ++++'
+ write(iout,*)'Version 0.0 build 702'
+ write(iout,*)'compiled Mon Dec 3 05:37:30 2012'
+ write(iout,*)'compiled by aks255@matrix.chem.cornell.edu'
+ write(iout,*)'OS name: Linux '
+ write(iout,*)'OS release: 2.6.34.9-69.fc13.x86_64 '
+ write(iout,*)'OS version:',
+ & ' #1 SMP Tue May 3 09:23:03 UTC 2011 '
+ write(iout,*)'flags:'
+ write(iout,*)'INSTALL_DIR = /users/software/mpich-1.2.7p1_int...'
+ write(iout,*)'BIN = ../../../bin'
+ write(iout,*)'CC = cc'
+ write(iout,*)'FC = ifort'
+ write(iout,*)'OPT = -g -CB'
+ write(iout,*)'FFLAGS = -c ${OPT} -I. -I./include_unres -I$(IN...'
+ write(iout,*)'LIBS = -L$(INSTALL_DIR)/lib -lmpich ../../lib/x...'
+ write(iout,*)'CPPFLAGS = -DMPI -DLINUX -DUNRES -DSPLITELE -DP...'
+ write(iout,*)'objects = \\'
+ write(iout,*)' wham_multparm.o \\'
+ write(iout,*)' bxread.o \\'
+ write(iout,*)' xread.o \\'
+ write(iout,*)' cxread.o \\'
+ write(iout,*)' enecalc1.o \\'
+ write(iout,*)' energy_p_new.o \\'
+ write(iout,*)' gnmr1.o \\'
+ write(iout,*)' initialize_p.o \\'
+ write(iout,*)' molread_zs.o \\'
+ write(iout,*)' openunits.o \\'
+ write(iout,*)' readrtns.o \\'
+ write(iout,*)' read_dist_constr.o \\'
+ write(iout,*)' arcos.o \\'
+ write(iout,*)' cartder.o \\'
+ write(iout,*)' cartprint.o \\'
+ write(iout,*)' chainbuild.o \\'
+ write(iout,*)' geomout.o \\'
+ write(iout,*)' icant.o \\'
+ write(iout,*)' intcor.o \\'
+ write(iout,*)' int_from_cart.o \\'
+ write(iout,*)' make_ensemble1.o \\'
+ write(iout,*)' matmult.o \\'
+ write(iout,*)' misc.o \\'
+ write(iout,*)' mygetenv.o \\'
+ write(iout,*)' parmread.o \\'
+ write(iout,*)' pinorm.o \\'
+ write(iout,*)' printmat.o \\'
+ write(iout,*)' proc_proc.o \\'
+ write(iout,*)' rescode.o \\'
+ write(iout,*)' setup_var.o \\'
+ write(iout,*)' slices.o \\'
+ write(iout,*)' store_parm.o \\'
+ write(iout,*)' timing.o \\'
+ write(iout,*)' wham_calc1.o'
+ write(iout,*)'objects_compar = \\'
+ write(iout,*)' readrtns_compar.o \\'
+ write(iout,*)' readpdb.o permut.o fitsq.o contact.o \\'
+ write(iout,*)' elecont.o contfunc.o cont_frag.o conf_c...'
+ write(iout,*)'++++ End of compile info ++++'
+ return
+ end
endif
110 format (a,'(',i3,')',9f8.3)
do i=ist,ien-kkk
- iti=itype(i)
+ iti=iabs(itype(i))
if (iti.le.0 .or. iti.gt.ntyp) cycle
do j=i+kkk,ien
- itj=itype(j)
+ itj=iabs(itype(j))
if (itj.le.0 .or. itj.gt.ntyp) cycle
itypi=iti
itypj=itj
it2=itype(i2)
write (iout,'(i3,2x,a,i4,2x,a,i4,5f8.3,3f10.5)')
& i,restyp(it1),i1,restyp(it2),i2,cscore(i),
- & sc_cutoff(it1,it2),ddsc(i),ddla(i),ddlb(i),
+ & sc_cutoff(iabs(it1),iabs(it2)),ddsc(i),ddla(i),ddlb(i),
& omt1(i),omt2(i),omt12(i)
enddo
endif
& " the value read in: ",energia(0),eini," point",
& iii+1,indstart(me1)+iii," T",
& 1.0d0/(1.987D-3*beta_h(ib,ipar))
+c call intout
+ call pdbout(indstart(me1)+iii,
+ & 1.0d0/(1.987D-3*beta_h(ib,ipar)),
+ &energia(0),eini,0.0d0,0.0d0)
+ call enerprint(energia(0),fT)
errmsg_count=errmsg_count+1
if (errmsg_count.gt.maxerrmsg_count)
& write (iout,*) "Too many warning messages"
include "COMMON.ENERGIES"
include "COMMON.COMPAR"
include "COMMON.PROT"
+ include "COMMON.CONTACTS1"
character*64 nazwa
character*80 bxname,cxname
character*64 bprotfile_temp
integer ilen,iroof
external ilen,iroof
integer ir,ib,iparm
+ integer isecstr(maxres)
write (licz2,'(bz,i2.2)') islice
call opentmp(islice,ientout,bprotfile_temp)
write (iout,*) "bprotfile_temp ",bprotfile_temp
iscore=0
c write (iout,*) "Calling conf_compar",i
c call flush(iout)
+ anatemp= 1.0d0/(beta_h(ib,iparm)*1.987D-3)
if (indpdb.gt.0) then
call conf_compar(i,.false.,.true.)
+c else
+c call elecont(.false.,ncont,icont,nnt,nct)
+c call secondary2(.false.,.false.,ncont,icont,isecstr)
endif
c write (iout,*) "Exit conf_compar",i
c call flush(iout)
endif
call int_from_cart1(.false.)
do j=nnt+1,nct
- if (itype(j-1).ne.21 .and. itype(j).ne.21 .and.
+ if (itype(j-1).ne.ntyp1 .and. itype(j).ne.ntyp1 .and.
& (vbld(j).lt.2.0d0 .or. vbld(j).gt.5.0d0)) then
if (iprint.gt.0)
& write (iout,*) "Bad CA-CA bond length",j," ",vbld(j),
enddo
do j=nnt,nct
itj=itype(j)
- if (itype(j).ne.10 .and.itype(j).ne.21 .and.
- & (vbld(nres+j)-dsc(itj)).gt.2.0d0) then
+ if (itype(j).ne.10 .and.itype(j).ne.ntyp1 .and.
+ & (vbld(nres+j)-dsc(iabs(itj))).gt.2.0d0) then
if (iprint.gt.0)
& write (iout,*) "Bad CA-SC bond length",j," ",vbld(nres+j),
& " for conformation",ii
& +wturn3*fact(2)*gel_loc_turn3(i)
& +wturn6*fact(5)*gel_loc_turn6(i)
& +wel_loc*fact(2)*gel_loc_loc(i)
- & +wsccor*fact(1)*gsccor_loc(i)
enddo
endif
return
evdw=0.0D0
evdw_t=0.0d0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
cd write (iout,*) 'i=',i,' iint=',iint,' istart=',istart(i,iint),
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
evdw=0.0D0
evdw_t=0.0d0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
C
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c endif
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
chi2=chi(itypj,itypi)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
chi1=chi(itypi,itypj)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- if (itypi.eq.21) cycle
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
r0ij=r0(itypi,itypj)
gcorr_loc(i)=0.0d0
enddo
do i=iatel_s,iatel_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
if (itel(i).eq.0) goto 1215
dxi=dc(1,i)
dyi=dc(2,i)
num_conti=0
c write (iout,*) 'i',i,' ielstart',ielstart(i),' ielend',ielend(i)
do j=ielstart(i),ielend(i)
- if (itype(j).eq.21 .or. itype(j+1).eq.21) cycle
+ if (itype(j).eq.ntyp1 .or. itype(j+1).eq.ntyp1) cycle
if (itel(j).eq.0) goto 1216
ind=ind+1
iteli=itel(i)
ees0ij=4.0D0+fac*fac-3.0D0*(cosb*cosb+cosg*cosg)
ees=ees+eesij
evdw1=evdw1+evdwij
-cd write(iout,'(2(2i3,2x),7(1pd12.4)/2(3(1pd12.4),5x)/)')
-cd & iteli,i,itelj,j,aaa,bbb,ael6i,ael3i,
-cd & 1.0D0/dsqrt(rrmij),evdwij,eesij,
-cd & xmedi,ymedi,zmedi,xj,yj,zj
+c write (iout,'(a6,2i5,0pf7.3,2i5,2e11.3)')
+c &'evdw1',i,j,evdwij
+c &,iteli,itelj,aaa,evdw1
+
+c write (iout,'(a6,2i5,0pf7.3)') 'ees',i,j,eesij
+c write(iout,'(2(2i3,2x),7(1pd12.4)/2(3(1pd12.4),5x)/)')
+c & iteli,i,itelj,j,aaa,bbb,ael6i,ael3i,
+c & 1.0D0/dsqrt(rrmij),evdwij,eesij,
+c & xmedi,ymedi,zmedi,xj,yj,zj
C
C Calculate contributions to the Cartesian gradient.
C
C Contribution to the local-electrostatic energy coming from the i-j pair
eel_loc_ij=a22*muij(1)+a23*muij(2)+a32*muij(3)
& +a33*muij(4)
-cd write (iout,*) 'i',i,' j',j,' eel_loc_ij',eel_loc_ij
-cd write (iout,*) a22,muij(1),a23,muij(2),a32,muij(3)
+c write (iout,*) 'i',i,' j',j,' eel_loc_ij',eel_loc_ij
+c write (iout,'(a6,2i5,0pf7.3)')
+c & 'eelloc',i,j,eel_loc_ij
+c write (iout,*) a22,muij(1),a23,muij(2),a32,muij(3)
eel_loc=eel_loc+eel_loc_ij
C Partial derivatives in virtual-bond dihedral angles gamma
if (calc_grad) then
& +0.5d0*(pizda(1,1)+pizda(2,2))
enddo
endif
- else if (j.eq.i+3 .and. itype(i+2).ne.21) then
+ else if (j.eq.i+3 .and. itype(i+2).ne.ntyp1) then
CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
C
C Fourth-order contributions
c write (iout,*) 'iatscp_s=',iatscp_s,' iatscp_e=',iatscp_e,
c & ' scal14',scal14
do i=iatscp_s,iatscp_e
- if (itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
iteli=itel(i)
c write (iout,*) "i",i," iteli",iteli," nscp_gr",nscp_gr(i),
c & " iscp",(iscpstart(i,j),iscpend(i,j),j=1,nscp_gr(i))
do iint=1,nscp_gr(i)
do j=iscpstart(i,iint),iscpend(i,iint)
- itypj=itype(j)
- if (itypj.eq.21) cycle
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
evdw2_14=evdw2_14+e1+e2
endif
evdwij=e1+e2
-c write (iout,*) i,j,evdwij
+c write (iout,'(a6,2i5,0pf7.3,2i3,3e11.3)')
+c & 'evdw2',i,j,evdwij,iteli,itypj,fac,aad(itypj,iteli),
+c & bad(itypj,iteli)
evdw2=evdw2+evdwij
if (calc_grad) then
C
endif
C 24/11/03 AL: SS bridges handled separately because of introducing a specific
C distance and angle dependent SS bond potential.
- if (ii.gt.nres .and. itype(iii).eq.1 .and. itype(jjj).eq.1) then
+ if (ii.gt.nres .and. iabs(itype(iii)).eq.1 .and.
+ & iabs(itype(jjj)).eq.1) then
call ssbond_ene(iii,jjj,eij)
ehpb=ehpb+2*eij
else
include 'COMMON.VAR'
include 'COMMON.IOUNITS'
double precision erij(3),dcosom1(3),dcosom2(3),gg(3)
- itypi=itype(i)
+ itypi=iabs(itype(i))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
dyi=dc_norm(2,nres+i)
dzi=dc_norm(3,nres+i)
dsci_inv=dsc_inv(itypi)
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=dsc_inv(itypj)
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
logical energy_dec /.false./
double precision u(3),ud(3)
estr=0.0d0
- write (iout,*) "distchainmax",distchainmax
+ estr1=0.0d0
+c write (iout,*) "distchainmax",distchainmax
do i=nnt+1,nct
- if (itype(i-1).eq.21 .or. itype(i).eq.21) then
+ if (itype(i-1).eq.ntyp1 .or. itype(i).eq.ntyp1) then
estr1=estr1+gnmr1(vbld(i),-1.0d0,distchainmax)
do j=1,3
gradb(j,i-1)=gnmr1prim(vbld(i),-1.0d0,distchainmax)
endif
enddo
- estr=0.5d0*AKP*estr
+ estr=0.5d0*AKP*estr+estr1
c
c 09/18/07 AL: multimodal bond potential based on AM1 CA-SC PMF's included
c
do i=nnt,nct
- iti=itype(i)
- if (iti.ne.10 .and. iti.ne.21) then
+ iti=iabs(itype(i))
+ if (iti.ne.10 .and. iti.ne.ntyp1) then
nbi=nbondterm(iti)
if (nbi.eq.1) then
diff=vbld(i+nres)-vbldsc0(1,iti)
c write (*,'(a,i2)') 'EBEND ICG=',icg
c write (iout,*) ithet_start,ithet_end
do i=ithet_start,ithet_end
- if (itype(i-1).eq.21) cycle
+ if (itype(i-1).eq.ntyp1) cycle
C Zero the energy function and its derivative at 0 or pi.
call splinthet(theta(i),0.5d0*delta,ss,ssd)
it=itype(i-1)
- if (i.gt.3 .and. itype(i-2).ne.21) then
+ ichir1=isign(1,itype(i-2))
+ ichir2=isign(1,itype(i))
+ if (itype(i-2).eq.10) ichir1=isign(1,itype(i-1))
+ if (itype(i).eq.10) ichir2=isign(1,itype(i-1))
+ if (itype(i-1).eq.10) then
+ itype1=isign(10,itype(i-2))
+ ichir11=isign(1,itype(i-2))
+ ichir12=isign(1,itype(i-2))
+ itype2=isign(10,itype(i))
+ ichir21=isign(1,itype(i))
+ ichir22=isign(1,itype(i))
+ endif
+
+ if (i.gt.3 .and. itype(i-2).ne.ntyp1) then
#ifdef OSF
phii=phi(i)
icrc=0
y(1)=0.0D0
y(2)=0.0D0
endif
- if (i.lt.nres .and. itype(i).ne.21) then
+ if (i.lt.nres .and. itype(i).ne.ntyp1) then
#ifdef OSF
phii1=phi(i+1)
icrc=0
C In following comments this theta will be referred to as t_c.
thet_pred_mean=0.0d0
do k=1,2
- athetk=athet(k,it)
- bthetk=bthet(k,it)
+ athetk=athet(k,it,ichir1,ichir2)
+ bthetk=bthet(k,it,ichir1,ichir2)
+ if (it.eq.10) then
+ athetk=athet(k,itype1,ichir11,ichir12)
+ bthetk=bthet(k,itype2,ichir21,ichir22)
+ endif
thet_pred_mean=thet_pred_mean+athetk*y(k)+bthetk*z(k)
enddo
c write (iout,*) "thet_pred_mean",thet_pred_mean
thet_pred_mean=thet_pred_mean*ss+a0thet(it)
c write (iout,*) "thet_pred_mean",thet_pred_mean
C Derivatives of the "mean" values in gamma1 and gamma2.
- dthetg1=(-athet(1,it)*y(2)+athet(2,it)*y(1))*ss
- dthetg2=(-bthet(1,it)*z(2)+bthet(2,it)*z(1))*ss
+ dthetg1=(-athet(1,it,ichir1,ichir2)*y(2)
+ &+athet(2,it,ichir1,ichir2)*y(1))*ss
+ dthetg2=(-bthet(1,it,ichir1,ichir2)*z(2)
+ & +bthet(2,it,ichir1,ichir2)*z(1))*ss
+ if (it.eq.10) then
+ dthetg1=(-athet(1,itype1,ichir11,ichir12)*y(2)
+ &+athet(2,itype1,ichir11,ichir12)*y(1))*ss
+ dthetg2=(-bthet(1,itype2,ichir21,ichir22)*z(2)
+ & +bthet(2,itype2,ichir21,ichir22)*z(1))*ss
+ endif
if (theta(i).gt.pi-delta) then
call theteng(pi-delta,thet_pred_mean,theta0(it),f0,fprim0,
& E_tc0)
etheta=0.0D0
c write (iout,*) "ithetyp",(ithetyp(i),i=1,ntyp1)
do i=ithet_start,ithet_end
- if (itype(i-1).eq.21) cycle
+ if (itype(i-1).eq.ntyp1) cycle
+ if (iabs(itype(i+1)).eq.20) iblock=2
+ if (iabs(itype(i+1)).ne.20) iblock=1
dethetai=0.0d0
dephii=0.0d0
dephii1=0.0d0
theti2=0.5d0*theta(i)
- ityp2=ithetyp(itype(i-1))
+ ityp2=ithetyp((itype(i-1)))
do k=1,nntheterm
coskt(k)=dcos(k*theti2)
sinkt(k)=dsin(k*theti2)
enddo
- if (i.gt.3 .and. itype(i-2).ne.21) then
+ if (i.gt.3 .and. itype(i-2).ne.ntyp1) then
#ifdef OSF
phii=phi(i)
if (phii.ne.phii) phii=150.0
#else
phii=phi(i)
#endif
- ityp1=ithetyp(itype(i-2))
+ ityp1=ithetyp((itype(i-2)))
do k=1,nsingle
cosph1(k)=dcos(k*phii)
sinph1(k)=dsin(k*phii)
sinph1(k)=0.0d0
enddo
endif
- if (i.lt.nres .and. itype(i).ne.21) then
+ if (i.lt.nres .and. itype(i).ne.ntyp1) then
#ifdef OSF
phii1=phi(i+1)
if (phii1.ne.phii1) phii1=150.0
#else
phii1=phi(i+1)
#endif
- ityp3=ithetyp(itype(i))
+ ityp3=ithetyp((itype(i)))
do k=1,nsingle
cosph2(k)=dcos(k*phii1)
sinph2(k)=dsin(k*phii1)
c write (iout,*) "i",i," ityp1",itype(i-2),ityp1,
c & " ityp2",itype(i-1),ityp2," ityp3",itype(i),ityp3
c call flush(iout)
- ethetai=aa0thet(ityp1,ityp2,ityp3)
+ ethetai=aa0thet(ityp1,ityp2,ityp3,iblock)
do k=1,ndouble
do l=1,k-1
ccl=cosph1(l)*cosph2(k-l)
enddo
endif
do k=1,ntheterm
- ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3)*sinkt(k)
- dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3)
+ ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3,iblock)*sinkt(k)
+ dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3,iblock)
& *coskt(k)
if (lprn)
- & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3),
+ & write (iout,*) "k",k,"
+ & aathet",aathet(k,ityp1,ityp2,ityp3,iblock),
& " ethetai",ethetai
enddo
if (lprn) then
endif
do m=1,ntheterm2
do k=1,nsingle
- aux=bbthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)
- & +ccthet(k,m,ityp1,ityp2,ityp3)*sinph1(k)
- & +ddthet(k,m,ityp1,ityp2,ityp3)*cosph2(k)
- & +eethet(k,m,ityp1,ityp2,ityp3)*sinph2(k)
+ aux=bbthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)
+ & +ccthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k)
+ & +ddthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)
+ & +eethet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*aux*coskt(m)
dephii=dephii+k*sinkt(m)*(
- & ccthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)-
- & bbthet(k,m,ityp1,ityp2,ityp3)*sinph1(k))
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)-
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k))
dephii1=dephii1+k*sinkt(m)*(
- & eethet(k,m,ityp1,ityp2,ityp3)*cosph2(k)-
- & ddthet(k,m,ityp1,ityp2,ityp3)*sinph2(k))
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)-
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k))
if (lprn)
& write (iout,*) "m",m," k",k," bbthet",
- & bbthet(k,m,ityp1,ityp2,ityp3)," ccthet",
- & ccthet(k,m,ityp1,ityp2,ityp3)," ddthet",
- & ddthet(k,m,ityp1,ityp2,ityp3)," eethet",
- & eethet(k,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)," ccthet",
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)," ddthet",
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)," eethet",
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)," ethetai",ethetai
enddo
enddo
if (lprn)
do m=1,ntheterm3
do k=2,ndouble
do l=1,k-1
- aux=ffthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)
+ aux=ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*coskt(m)*aux
dephii=dephii+l*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)-
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)-
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
dephii1=dephii1+(k-l)*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)-
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)-
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
if (lprn) then
write (iout,*) "m",m," k",k," l",l," ffthet",
- & ffthet(l,k,m,ityp1,ityp2,ityp3),
- & ffthet(k,l,m,ityp1,ityp2,ityp3)," ggthet",
- & ggthet(l,k,m,ityp1,ityp2,ityp3),
- & ggthet(k,l,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & ffthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ggthet",
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock),
+ & " ethetai",ethetai
write (iout,*) cosph1ph2(l,k)*sinkt(m),
& cosph1ph2(k,l)*sinkt(m),
& sinph1ph2(l,k)*sinkt(m),sinph1ph2(k,l)*sinkt(m)
c write (iout,'(a)') 'ESC'
do i=loc_start,loc_end
it=itype(i)
- if (it.eq.21) cycle
+ if (it.eq.ntyp1) cycle
if (it.eq.10) goto 1
- nlobit=nlob(it)
+ nlobit=nlob(iabs(it))
c print *,'i=',i,' it=',it,' nlobit=',nlobit
c write (iout,*) 'i=',i,' ssa=',ssa,' ssad=',ssad
theti=theta(i+1)-pipol
do iii=-1,1
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j,iii)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j,iii)+emin)
cd print *,'j=',j,' expfac=',expfac
escloc_i=escloc_i+expfac
do k=1,3
dersc12=0.0d0
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j)+emin)
escloc_i=escloc_i+expfac
do k=1,2
dersc(k)=dersc(k)+Ax(k,j)*expfac
delta=0.02d0*pi
escloc=0.0D0
do i=loc_start,loc_end
- if (itype(i).eq.21) cycle
+ if (itype(i).eq.ntyp1) cycle
costtab(i+1) =dcos(theta(i+1))
sinttab(i+1) =dsqrt(1-costtab(i+1)*costtab(i+1))
cost2tab(i+1)=dsqrt(0.5d0*(1.0d0+costtab(i+1)))
cosfac=dsqrt(cosfac2)
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
- it=itype(i)
+ it=iabs(itype(i))
if (it.eq.10) goto 1
c
C Compute the axes of tghe local cartesian coordinates system; store in
y_prime(j) = (dc_norm(j,i) + dc_norm(j,i-1))*sinfac
enddo
do j = 1,3
- z_prime(j) = -uz(j,i-1)
+ z_prime(j) = -uz(j,i-1)*dsign(1.0d0,dfloat(itype(i)))
enddo
c write (2,*) "i",i
c write (2,*) "x_prime",(x_prime(j),j=1,3)
C Compute the energy of the ith side cbain
C
c write (2,*) "xx",xx," yy",yy," zz",zz
- it=itype(i)
+ it=iabs(itype(i))
do j = 1,65
x(j) = sc_parmin(j,it)
enddo
Cc diagnostics - remove later
xx1 = dcos(alph(2))
yy1 = dsin(alph(2))*dcos(omeg(2))
- zz1 = -dsin(alph(2))*dsin(omeg(2))
+ zz1 = -dsign(1.0d0,itype(i))*dsin(alph(2))*dsin(omeg(2))
write(2,'(3f8.1,3f9.3,1x,3f9.3)')
& alph(2)*rad2deg,omeg(2)*rad2deg,theta(3)*rad2deg,xx,yy,zz,
& xx1,yy1,zz1
c sumene = enesc(x,xx,yy,zz,cost2tab(i+1),sint2tab(i+1))
escloc = escloc + sumene
c write (2,*) "escloc",escloc
+c write (2,*) "i",i," escloc",sumene,escloc,it,itype(i),
+c & zz,xx,yy
if (.not. calc_grad) goto 1
#ifdef DEBUG
C
dZZ_Ci1(k)=0.0d0
dZZ_Ci(k)=0.0d0
do j=1,3
- dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)*dC_norm(j,i+nres)
- dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)*dC_norm(j,i+nres)
+ dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+ dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
enddo
dXX_XYZ(k)=vbld_inv(i+nres)*(x_prime(k)-xx*dC_norm(k,i+nres))
c lprn=.true.
etors=0.0D0
do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1) cycle
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
c lprn=.true.
etors=0.0D0
do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21) cycle
+ if (itype(i-2).eq.ntyp1 .or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1) cycle
if (itel(i-2).eq.0 .or. itel(i-1).eq.0) goto 1215
+ if (iabs(itype(i)).eq.20) then
+ iblock=2
+ else
+ iblock=1
+ endif
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
gloci=0.0D0
C Regular cosine and sine terms
- do j=1,nterm(itori,itori1)
- v1ij=v1(j,itori,itori1)
- v2ij=v2(j,itori,itori1)
+ do j=1,nterm(itori,itori1,iblock)
+ v1ij=v1(j,itori,itori1,iblock)
+ v2ij=v2(j,itori,itori1,iblock)
cosphi=dcos(j*phii)
sinphi=dsin(j*phii)
etors=etors+v1ij*cosphi+v2ij*sinphi
C
cosphi=dcos(0.5d0*phii)
sinphi=dsin(0.5d0*phii)
- do j=1,nlor(itori,itori1)
+ do j=1,nlor(itori,itori1,iblock)
vl1ij=vlor1(j,itori,itori1)
vl2ij=vlor2(j,itori,itori1)
vl3ij=vlor3(j,itori,itori1)
pom=vl2ij*cosphi+vl3ij*sinphi
pom1=1.0d0/(pom*pom+1.0d0)
etors=etors+vl1ij*pom1
+c if (energy_dec) etors_ii=etors_ii+
+c & vl1ij*pom1
pom=-pom*pom1*pom1
gloci=gloci+vl1ij*(vl3ij*cosphi-vl2ij*sinphi)*pom
enddo
C Subtract the constant term
- etors=etors-v0(itori,itori1)
+ etors=etors-v0(itori,itori1,iblock)
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1(j,itori,itori1),j=1,6),(v2(j,itori,itori1),j=1,6)
+ & (v1(j,itori,itori1,1),j=1,6),(v2(j,itori,itori1,1),j=1,6)
gloc(i-3,icg)=gloc(i-3,icg)+wtor*fact*gloci
c write (iout,*) 'i=',i,' gloc=',gloc(i-3,icg)
1215 continue
c lprn=.true.
etors_d=0.0D0
do i=iphi_start,iphi_end-1
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21
- & .or. itype(i).eq.21 .or. itype(i+1).eq.21) cycle
+ if (itype(i-2).eq.ntyp1.or. itype(i-1).eq.ntyp1
+ & .or. itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) cycle
if (itel(i-2).eq.0 .or. itel(i-1).eq.0 .or. itel(i).eq.0)
& goto 1215
itori=itortyp(itype(i-2))
phii1=phi(i+1)
gloci1=0.0D0
gloci2=0.0D0
+ iblock=1
+ if (iabs(itype(i+1)).eq.20) iblock=2
C Regular cosine and sine terms
- do j=1,ntermd_1(itori,itori1,itori2)
- v1cij=v1c(1,j,itori,itori1,itori2)
- v1sij=v1s(1,j,itori,itori1,itori2)
- v2cij=v1c(2,j,itori,itori1,itori2)
- v2sij=v1s(2,j,itori,itori1,itori2)
+ do j=1,ntermd_1(itori,itori1,itori2,iblock)
+ v1cij=v1c(1,j,itori,itori1,itori2,iblock)
+ v1sij=v1s(1,j,itori,itori1,itori2,iblock)
+ v2cij=v1c(2,j,itori,itori1,itori2,iblock)
+ v2sij=v1s(2,j,itori,itori1,itori2,iblock)
cosphi1=dcos(j*phii)
sinphi1=dsin(j*phii)
cosphi2=dcos(j*phii1)
gloci1=gloci1+j*(v1sij*cosphi1-v1cij*sinphi1)
gloci2=gloci2+j*(v2sij*cosphi2-v2cij*sinphi2)
enddo
- do k=2,ntermd_2(itori,itori1,itori2)
+ do k=2,ntermd_2(itori,itori1,itori2,iblock)
do l=1,k-1
- v1cdij = v2c(k,l,itori,itori1,itori2)
- v2cdij = v2c(l,k,itori,itori1,itori2)
- v1sdij = v2s(k,l,itori,itori1,itori2)
- v2sdij = v2s(l,k,itori,itori1,itori2)
+ v1cdij = v2c(k,l,itori,itori1,itori2,iblock)
+ v2cdij = v2c(l,k,itori,itori1,itori2,iblock)
+ v1sdij = v2s(k,l,itori,itori1,itori2,iblock)
+ v2sdij = v2s(l,k,itori,itori1,itori2,iblock)
cosphi1p2=dcos(l*phii+(k-l)*phii1)
cosphi1m2=dcos(l*phii-(k-l)*phii1)
sinphi1p2=dsin(l*phii+(k-l)*phii1)
gloci1=gloci1+l*(v1sdij*cosphi1p2+v2sdij*cosphi1m2
& -v1cdij*sinphi1p2-v2cdij*sinphi1m2)
gloci2=gloci2+(k-l)*(v1sdij*cosphi1p2-v2sdij*cosphi1m2
- & -v1cdij*sinphi1p2+v2cdij*sinphi1m2)
+ & -v1cdij*sinphi1p2+v2cdij*sinphi1m2)
enddo
enddo
gloc(i-3,icg)=gloc(i-3,icg)+wtor_d*fact2*gloci1
c lprn=.true.
c write (iout,*) "EBACK_SC_COR",iphi_start,iphi_end,nterm_sccor
esccor=0.0D0
- do i=iphi_start,iphi_end
- if (itype(i-2).eq.21 .or. itype(i-1).eq.21) cycle
+ do i=itau_start,itau_end
+ if ((itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)) cycle
esccor_ii=0.0D0
- itori=itype(i-2)
- itori1=itype(i-1)
+ isccori=isccortyp(itype(i-2))
+ isccori1=isccortyp(itype(i-1))
phii=phi(i)
+ do intertyp=1,3 !intertyp
+cc Added 09 May 2012 (Adasko)
+cc Intertyp means interaction type of backbone mainchain correlation:
+c 1 = SC...Ca...Ca...Ca
+c 2 = Ca...Ca...Ca...SC
+c 3 = SC...Ca...Ca...SCi
gloci=0.0D0
- do j=1,nterm_sccor
- v1ij=v1sccor(j,itori,itori1)
- v2ij=v2sccor(j,itori,itori1)
- cosphi=dcos(j*phii)
- sinphi=dsin(j*phii)
- esccor=esccor+v1ij*cosphi+v2ij*sinphi
- gloci=gloci+j*(v2ij*cosphi-v1ij*sinphi)
- enddo
+ if (((intertyp.eq.3).and.((itype(i-2).eq.10).or.
+ & (itype(i-1).eq.10).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-1).eq.ntyp1)))
+ & .or. ((intertyp.eq.1).and.((itype(i-2).eq.10)
+ & .or.(itype(i-2).eq.ntyp1).or.(itype(i-1).eq.ntyp1)
+ & .or.(itype(i).eq.ntyp1)))
+ & .or.((intertyp.eq.2).and.((itype(i-1).eq.10).or.
+ & (itype(i-1).eq.ntyp1).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-3).eq.ntyp1)))) cycle
+ if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.ntyp1)) cycle
+ if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.ntyp1))
+ & cycle
+ do j=1,nterm_sccor(isccori,isccori1)
+ v1ij=v1sccor(j,intertyp,isccori,isccori1)
+ v2ij=v2sccor(j,intertyp,isccori,isccori1)
+ cosphi=dcos(j*tauangle(intertyp,i))
+ sinphi=dsin(j*tauangle(intertyp,i))
+ esccor=esccor+v1ij*cosphi+v2ij*sinphi
+ gloci=gloci+j*(v2ij*cosphi-v1ij*sinphi)
+ enddo
+c write (iout,*) "EBACK_SC_COR",i,v1ij*cosphi+v2ij*sinphi,intertyp,
+c & nterm_sccor(isccori,isccori1),isccori,isccori1
+c gloc_sc(intertyp,i-3,icg)=gloc_sc(intertyp,i-3,icg)+wsccor*gloci
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1sccor(j,itori,itori1),j=1,6),(v2sccor(j,itori,itori1),j=1,6)
- gsccor_loc(i-3)=gloci
+ & (v1sccor(j,1,itori,itori1),j=1,6)
+ & ,(v2sccor(j,1,itori,itori1),j=1,6)
+c gsccor_loc(i-3)=gloci
+ enddo !intertyp
enddo
return
end
integer dimen1,dimen2,atom,indx
double precision buffer(dimen1,dimen2)
double precision zapas
- common /contacts_hb/ zapas(3,20,maxres,7),
- & facont_hb(20,maxres),ees0p(20,maxres),ees0m(20,maxres),
- & num_cont_hb(maxres),jcont_hb(20,maxres)
+ common /contacts_hb/ zapas(3,ntyp,maxres,7),
+ & facont_hb(ntyp,maxres),ees0p(ntyp,maxres),ees0m(ntyp,maxres),
+ & num_cont_hb(maxres),jcont_hb(ntyp,maxres)
num_kont=num_cont_hb(atom)
do i=1,num_kont
do k=1,7
integer dimen1,dimen2,atom,indx
double precision buffer(dimen1,dimen2)
double precision zapas
- common /contacts_hb/ zapas(3,20,maxres,7),
- & facont_hb(20,maxres),ees0p(20,maxres),ees0m(20,maxres),
- & num_cont_hb(maxres),jcont_hb(20,maxres)
+ common /contacts_hb/ zapas(3,ntyp,maxres,7),
+ & facont_hb(ntyp,maxres),ees0p(ntyp,maxres),
+ & ees0m(ntyp,maxres),
+ & num_cont_hb(maxres),jcont_hb(ntyp,maxres)
num_kont=buffer(1,indx+26)
num_kont_old=num_cont_hb(atom)
num_cont_hb(atom)=num_kont+num_kont_old
ires=0
do i=nnt,nct
iti=itype(i)
- if (iti.eq.21) then
+ if (iti.eq.ntyp1) then
ichain=ichain+1
ires=0
write (ipdb,'(a)') 'TER'
enddo
write (ipdb,'(a)') 'TER'
do i=nnt,nct-1
- if (itype(i).eq.21) cycle
- if (itype(i).eq.10 .and. itype(i+1).ne.21) then
+ if (itype(i).eq.ntyp1) cycle
+ if (itype(i).eq.10 .and. itype(i+1).ne.ntyp1) then
write (ipdb,30) ica(i),ica(i+1)
- else if (itype(i).ne.10 .and. itype(i+1).ne.21) then
+ else if (itype(i).ne.10 .and. itype(i+1).ne.ntyp1) then
write (ipdb,30) ica(i),ica(i+1),ica(i)+1
- else if (itype(i).ne.10 .and. itype(i+1).eq.21) then
+ else if (itype(i).ne.10 .and. itype(i+1).eq.ntyp1) then
write (ipdb,30) ica(i),ica(i)+1
endif
enddo
& rs0(ntyp,ntyp),chi(ntyp,ntyp),chip(ntyp),chip0(ntyp),alp(ntyp),
& sigma0(ntyp),sigii(ntyp),rr0(ntyp),r0(ntyp,ntyp),r0e(ntyp,ntyp),
& r0d(ntyp,2),rpp(2,2),epp(2,2),elpp6(2,2),elpp3(2,2),
- & eps_scp(20,2),rscp(20,2),eps_orig(ntyp,ntyp)
+ & eps_scp(ntyp,2),rscp(ntyp,2),eps_orig(ntyp,ntyp)
c 12/5/03 modified 09/18/03 Bond stretching parameters.
double precision vbldp0,vbldsc0,akp,aksc,abond0,distchainmax
integer nbondterm
double precision a0thet,athet,bthet,polthet,gthet,theta0,sig0,
- & sigc0,dsc,dsc_inv,bsc,censc,gaussc,dsc0,vbl,vblinv,vblinv2,
- & vbl_cis,vbl0,vbld_inv
- integer nlob,loc_start,loc_end,ithet_start,ithet_end,
- & iphi_start,iphi_end
+ & sigc0,dsc,dsc_inv,bsc,censc,gaussc,dsc0
+ integer nlob
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1),
+ & bthet(2,-ntyp:ntyp,-1:1,-1:1),polthet(0:3,-ntyp:ntyp),
+ & gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),sig0(-ntyp:ntyp),
+ & sigc0(-ntyp:ntyp)
+C Parameters of the side-chain probability distribution
+ common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ &d sc0(ntyp1),
+ & nlob(ntyp1)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
- & ithetyp(ntyp1),nntheterm
- double precision aa0thet(maxthetyp1,maxthetyp1,maxthetyp1),
- & aathet(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1),
- & bbthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ccthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ddthet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & eethet(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,maxthetyp1),
- & ffthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1),
- & ggthet(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
- & maxthetyp1)
+ & ithetyp(-ntyp1:ntyp1),nntheterm
+ double precision aa0thet(-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & aathet(maxtheterm,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & bbthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ccthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ddthet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & eethet(maxsingle,maxtheterm2,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1,-maxthetyp1:maxthetyp1,2),
+ & ffthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2),
+ & ggthet(maxdouble,maxdouble,maxtheterm3,-maxthetyp1:maxthetyp1,
+ &-maxthetyp1:maxthetyp1, -maxthetyp1:maxthetyp1,2)
common /theta_abinitio/aa0thet,aathet,bbthet,ccthet,ddthet,eethet,
& ffthet,
& ggthet,ithetyp,nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,
& ndouble,nntheterm
-C Parameters of the side-chain probability distribution
- common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
- & nlob(ntyp1)
C Virtual-bond lenghts
+ double precision vbl,vblinv,vblinv2,vbl_cis,vbl0,vbld_inv
+ integer loc_start,loc_end,ithet_start,ithet_end,iphi_start,
+ & iphi_end,iphid_start,iphid_end,ibond_start,ibond_end,
+ & ibondp_start,ibondp_end,ivec_start,ivec_end,iset_start,iset_end,
+ & iturn3_start,iturn3_end,iturn4_start,iturn4_end,iint_start,
+ & iint_end,iphi1_start,iphi1_end,itau_start,itau_end
common /peptbond/ vbl,vblinv,vblinv2,vbl_cis,vbl0
common /indices/ loc_start,loc_end,ithet_start,ithet_end,
- & iphi_start,iphi_end
+ & iphi_start,iphi_end,iphid_start,iphid_end,ibond_start,ibond_end,
+ & ibondp_start,ibondp_end,ivec_start,ivec_end,iset_start,iset_end,
+ & iturn3_start,iturn3_end,iturn4_start,iturn4_end,iint_start,
+ & iint_end,iphi1_start,iphi1_end,itau_start,itau_end
C Inverses of the actual virtual bond lengths
common /invlen/ vbld_inv(maxres2)
character*3 restyp
character*1 onelet
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),
+ & onelet(-ntyp1:ntyp1)
character*10 ename,wname
integer nprint_ene,print_order
common /namterm/ ename(max_ene),wname(max_ene),nprint_ene,
-C Parameters of the SCCOR term
- double precision v1sccor,v2sccor
- integer nterm_sccor
- common/sccor/v1sccor(maxterm_sccor,20,20),
- & v2sccor(maxterm_sccor,20,20),
- & nterm_sccor
+cc Parameters of the SCCOR term
+ double precision v1sccor,v2sccor,vlor1sccor,
+ & vlor2sccor,vlor3sccor,gloc_sc,
+ & dcostau,dsintau,dtauangle,dcosomicron,
+ & domicron,v0sccor
+ integer nterm_sccor,isccortyp,nsccortyp,nlor_sccor
+ common /sccor/ v1sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v2sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v0sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor1sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor2sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor3sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & gloc_sc(3,0:maxres2,10),
+ & dcostau(3,3,3,maxres2),dsintau(3,3,3,maxres2),
+ & dtauangle(3,3,3,maxres2),dcosomicron(3,3,3,maxres2),
+ & domicron(3,3,3,maxres2),
+ & nterm_sccor(-ntyp:ntyp,-ntyp:ntyp),isccortyp(-ntyp:ntyp),
+ & nsccortyp,
+ & nlor_sccor(-ntyp:ntyp,-ntyp:ntyp)
+
C Parameters of the SC rotamers (local) term
double precision sc_parmin
- common/scrot/sc_parmin(maxsccoef,20)
+ common/scrot/sc_parmin(maxsccoef,ntyp)
C Torsional constants of the rotation about virtual-bond dihedral angles
double precision v1,v2,vlor1,vlor2,vlor3,v0
integer itortyp,ntortyp,nterm,nlor,nterm_old
- common/torsion/v0(maxtor,maxtor),v1(maxterm,maxtor,maxtor),
- & v2(maxterm,maxtor,maxtor),vlor1(maxlor,maxtor,maxtor),
+ common/torsion/v0(-maxtor:maxtor,-maxtor:maxtor,2),
+ & v1(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & v2(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & vlor1(maxlor,-maxtor:maxtor,-maxtor:maxtor),
& vlor2(maxlor,maxtor,maxtor),vlor3(maxlor,maxtor,maxtor),
- & itortyp(ntyp),ntortyp,nterm(maxtor,maxtor),
- & nlor(maxtor,maxtor),nterm_old
+ & itortyp(-ntyp:ntyp),ntortyp,
+ & nterm(-maxtor:maxtor,-maxtor:maxtor,2),
+ & nlor(-maxtor:maxtor,-maxtor:maxtor,2)
+ & ,nterm_old
C 6/23/01 - constants for double torsionals
double precision v1c,v1s,v2c,v2s
integer ntermd_1,ntermd_2
- common /torsiond/ v1c(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v1s(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v2c(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & v2s(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & ntermd_1(maxtor,maxtor,maxtor),ntermd_2(maxtor,maxtor,maxtor)
+ common /torsiond/
+ &v1c(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v1s(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v2c(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ &v2s(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ & ntermd_1(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ & ntermd_2(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2)
C 9/18/99 - added Fourier coeffficients of the expansion of local energy
C surface
- double precision b1,b2,cc,dd,ee,ctilde,dtilde,b1tilde
+ double precision b1,b2,cc,dd,ee,ctilde,dtilde,b2tilde,b1tilde
integer nloctyp
- common/fourier/ b1(2,maxtor),b2(2,maxtor),cc(2,2,maxtor),
- & dd(2,2,maxtor),ee(2,2,maxtor),ctilde(2,2,maxtor),
- & dtilde(2,2,maxtor),b1tilde(2,maxtor),nloctyp
+ common/fourier/ b1(2,-maxtor:maxtor),b2(2,-maxtor:maxtor)
+ & ,cc(2,2,-maxtor:maxtor),
+ & dd(2,2,-maxtor:maxtor),ee(2,2,-maxtor:maxtor),
+ & ctilde(2,2,-maxtor:maxtor),
+ & dtilde(2,2,-maxtor:maxtor),b1tilde(2,-maxtor:maxtor),nloctyp
double precision b
- common /fourier1/ b(13,maxtor)
+ common /fourier1/ b(13,0:maxtor)
& epp_low(2,2),epp_up(2,2),rpp_low(2,2),rpp_up(2,2),
& elpp6_low(2,2),elpp6_up(2,2),elpp3_low(2,2),elpp3_up(2,2),
& b_low(13,3),b_up(13,3),x_up(max_paropt),x_low(max_paropt),
- & epscp_low(0:20,2),epscp_up(0:20,2),rscp_low(0:20,2),
- & rscp_up(0:20,2),epss_low(ntyp),epss_up(ntyp),epsp_low(nntyp),
+ & epscp_low(0:ntyp,2),epscp_up(0:ntyp,2),rscp_low(0:ntyp,2),
+ & rscp_up(0:ntyp,2),epss_low(ntyp),epss_up(ntyp),epsp_low(nntyp),
& epsp_up(nntyp),
& xm(max_paropt,0:maxprot),xm1(max_paropt,0:maxprot),
& xm2(max_paropt,0:maxprot),
& imask(max_ene),nsingle_sc,npair_sc,ityp_ssc(ntyp),
& ityp_psc(2,nntyp),mask_elec(2,2,4),
& mask_fourier(13,3),
- & mask_scp(0:20,2,2),mod_other_params,mod_fourier(0:3),
+ & mask_scp(0:ntyp,2,2),mod_other_params,mod_fourier(0:3),
& mod_elec,mod_scp,mod_side,indz(maxbatch+1,maxprot),iw(max_ene)
sigii(i)=0.0D0
rr0(i)=0.0D0
a0thet(i)=0.0D0
- do j=1,2
- athet(j,i)=0.0D0
- bthet(j,i)=0.0D0
+ do j=1,2
+ do ichir1=-1,1
+ do ichir2=-1,1
+ athet(j,i,ichir1,ichir2)=0.0D0
+ bthet(j,i,ichir1,ichir2)=0.0D0
+ enddo
+ enddo
enddo
do j=0,3
polthet(j,i)=0.0D0
enddo
nlob(ntyp1)=0
dsc(ntyp1)=0.0D0
- do i=1,maxtor
- itortyp(i)=0
- do j=1,maxtor
- do k=1,maxterm
- v1(k,j,i)=0.0D0
- v2(k,j,i)=0.0D0
+ do i=-maxtor,maxtor
+ itortyp(i)=0
+ do iblock=1,2
+ do j=-maxtor,maxtor
+ do k=1,maxterm
+ v1(k,j,i,iblock)=0.0D0
+ v2(k,j,i,iblock)=0.0D0
enddo
enddo
+ enddo
enddo
+ do iblock=1,2
+ do i=-maxtor,maxtor
+ do j=-maxtor,maxtor
+ do k=-maxtor,maxtor
+ do l=1,maxtermd_1
+ v1c(1,l,i,j,k,iblock)=0.0D0
+ v1s(1,l,i,j,k,iblock)=0.0D0
+ v1c(2,l,i,j,k,iblock)=0.0D0
+ v1s(2,l,i,j,k,iblock)=0.0D0
+ enddo !l
+ do l=1,maxtermd_2
+ do m=1,maxtermd_2
+ v2c(m,l,i,j,k,iblock)=0.0D0
+ v2s(m,l,i,j,k,iblock)=0.0D0
+ enddo !m
+ enddo !l
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
do i=1,maxres
itype(i)=0
itel(i)=0
include 'COMMON.WEIGHTS'
include 'COMMON.FFIELD'
data restyp /
+ &'DD','DAU','DAI','DDB','DSM','DPR','DLY','DAR','DHI','DAS','DGL',
+ & 'DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
- &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
+ &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','SME','DBZ',
+ &'AIB','ABU','D'/
data onelet /
+ &'z','z','z','z','z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
- &'S','Q','N','E','D','H','R','K','P','X'/
+ &'S','Q','N','E','D','H','R','K','P','z','z','z','z','X'/
data potname /'LJ','LJK','BP','GB','GBV'/
data ename /
& "EVDW SC-SC","EVDW2 SC-p","EES p-p","ECORR4 ","ECORR5 ",
call int_bounds(nct-nnt-2,iphi_start,iphi_end)
iphi_start=iphi_start+nnt+2
iphi_end=iphi_end+nnt+2
+ call int_bounds(nres-3,itau_start,itau_end)
+ itau_start=itau_start+3
+ itau_end=itau_end+3
if (lprint) then
write (iout,*) 'Processor:',MyID,
& ' loc_start',loc_start,' loc_end',loc_end,
ithet_end=nres
iphi_start=nnt+3
iphi_end=nct
+ itau_start=4
+ itau_end=nres
#endif
return
end
enddo
be=0.0D0
if (i.gt.2) phi(i+1)=beta(i-2,i-1,i,i+1)
+ if (i.gt.2) tauangle(3,i+1)=beta(i+nres-1,i-1,i,i+nres)
+ if (i.gt.2) tauangle(1,i+1)=beta(i-1+nres,i-1,i,i+1)
+ if (i.gt.2) tauangle(2,i+1)=beta(i-2,i-1,i,i+nres)
omeg(i)=beta(nres+i,i,maxres2,i+1)
theta(i+1)=alpha(i-1,i,i+1)
alph(i)=alpha(nres+i,i,maxres2)
write (iout,'(20i4)') (itype(i),i=1,nres)
do i=1,nres-1
#ifdef PROCOR
- if (itype(i).eq.21 .or. itype(i+1).eq.21) then
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) then
#else
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
#endif
itel(i)=0
#ifdef PROCOR
- else if (itype(i+1).ne.20) then
+ else if (iabs(itype(i+1)).ne.20) then
#else
- else if (itype(i).ne.20) then
+ else if (iabs(itype(i)).ne.20) then
#endif
itel(i)=1
else
itel(i)=2
endif
enddo
+ write (iout,*) "ITEL"
+ do i=1,nres-1
+ write (iout,*) i,itype(i),itel(i)
+ enddo
call read_bridge
if (with_dihed_constr) then
nnt=1
nct=nres
- if (itype(1).eq.21) nnt=2
- if (itype(nres).eq.21) nct=nct-1
+ if (itype(1).eq.ntyp1) nnt=2
+ if (itype(nres).eq.ntyp1) nct=nct-1
write(iout,*) 'NNT=',NNT,' NCT=',NCT
call setup_var
call init_int_table
include 'COMMON.FREE'
character*1 t1,t2,t3
character*1 onelett(4) /"G","A","P","D"/
+ character*1 toronelet(-2:2) /"p","a","G","A","P"/
logical lprint
dimension blower(3,3,maxlob)
character*800 controlcard
call reads(controlcard,"TORDPAR",tordname_t,tordname)
open (itordp,file=tordname_t,status='old')
rewind(itordp)
- call reads(controlcard,"SCCORAR",sccorname_t,sccorname)
+ call reads(controlcard,"SCCORPAR",sccorname_t,sccorname)
open (isccor,file=sccorname_t,status='old')
rewind(isccor)
call reads(controlcard,"FOURIER",fouriername_t,fouriername)
C of the virtual-bond valence angles theta
C
do i=1,ntyp
- read (ithep,*) a0thet(i),(athet(j,i),j=1,2),(bthet(j,i),j=1,2)
+ read (ithep,*) a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
read (ithep,*) (polthet(j,i),j=0,3)
- read (ithep,*) (gthet(j,i),j=1,3)
- read (ithep,*) theta0(i),sig0(i),sigc0(i)
- sigc0(i)=sigc0(i)**2
+ read (ithep,*) (gthet(j,i),j=1,3)
+ read (ithep,*) theta0(i),sig0(i),sigc0(i)
+ sigc0(i)=sigc0(i)**2
+ enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
enddo
close (ithep)
if (lprint) then
& ' b1*10^1 ',' b2*10^1 '
do i=1,ntyp
write(iout,'(a3,1h&,2x,5(f8.3,1h&))') restyp(i),
- & a0thet(i),(100*athet(j,i),j=1,2),(10*bthet(j,i),j=1,2)
+ & a0thet(i),(100*athet(j,i,1,1),j=1,2),
+ & (10*bthet(j,i,1,1),j=1,2)
enddo
write (iout,'(/a/9x,5a/79(1h-))')
& 'Parameters of the expression for sigma(theta_c):',
C Read the parameters of Utheta determined from ab initio surfaces
C Kozlowska et al., J. Phys.: Condens. Matter 19 (2007) 285203
C
+c write (iout,*) "tu dochodze"
read (ithep,*) nthetyp,ntheterm,ntheterm2,
& ntheterm3,nsingle,ndouble
nntheterm=max0(ntheterm,ntheterm2,ntheterm3)
read (ithep,*) (ithetyp(i),i=1,ntyp1)
- do i=1,maxthetyp
- do j=1,maxthetyp
- do k=1,maxthetyp
- aa0thet(i,j,k)=0.0d0
+ do i=-ntyp1,-1
+ ithetyp(i)=-ithetyp(-i)
+ enddo
+c write (iout,*) "tu dochodze"
+ do iblock=1,2
+ do i=-maxthetyp,maxthetyp
+ do j=-maxthetyp,maxthetyp
+ do k=-maxthetyp,maxthetyp
+ aa0thet(i,j,k,iblock)=0.0d0
do l=1,ntheterm
- aathet(l,i,j,k)=0.0d0
+ aathet(l,i,j,k,iblock)=0.0d0
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=0.0d0
- ccthet(m,l,i,j,k)=0.0d0
- ddthet(m,l,i,j,k)=0.0d0
- eethet(m,l,i,j,k)=0.0d0
+ bbthet(m,l,i,j,k,iblock)=0.0d0
+ ccthet(m,l,i,j,k,iblock)=0.0d0
+ ddthet(m,l,i,j,k,iblock)=0.0d0
+ eethet(m,l,i,j,k,iblock)=0.0d0
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=0.0d0
- ggthet(mm,m,l,i,j,k)=0.0d0
+ ffthet(mm,m,l,i,j,k,iblock)=0.0d0
+ ggthet(mm,m,l,i,j,k,iblock)=0.0d0
enddo
enddo
enddo
enddo
enddo
enddo
- do i=1,nthetyp
- do j=1,nthetyp
- do k=1,nthetyp
- read (ithep,'(3a)') res1,res2,res3
- read (ithep,*) aa0thet(i,j,k)
- read (ithep,*)(aathet(l,i,j,k),l=1,ntheterm)
+ enddo
+ do iblock=1,2
+ do i=0,nthetyp
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ read (ithep,'(6a)') res1
+ read (ithep,*) aa0thet(i,j,k,iblock)
+ read (ithep,*)(aathet(l,i,j,k,iblock),l=1,ntheterm)
read (ithep,*)
- & ((bbthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ccthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ddthet(lll,ll,i,j,k),lll=1,nsingle),
- & (eethet(lll,ll,i,j,k),lll=1,nsingle),ll=1,ntheterm2)
+ & ((bbthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ccthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ddthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (eethet(lll,ll,i,j,k,iblock),lll=1,nsingle)
+ & ,ll=1,ntheterm2)
read (ithep,*)
- & (((ffthet(llll,lll,ll,i,j,k),ffthet(lll,llll,ll,i,j,k),
- & ggthet(llll,lll,ll,i,j,k),ggthet(lll,llll,ll,i,j,k),
+ & (((ffthet(llll,lll,ll,i,j,k,iblock),
+ & ffthet(lll,llll,ll,i,j,k,iblock),
+ & ggthet(llll,lll,ll,i,j,k,iblock)
+ & ,ggthet(lll,llll,ll,i,j,k,iblock),
& llll=1,lll-1),lll=2,ndouble),ll=1,ntheterm3)
enddo
enddo
do i=1,nthetyp
do j=1,nthetyp
do l=1,ntheterm
- aathet(l,i,j,nthetyp+1)=aathet(l,i,j,1)
- aathet(l,nthetyp+1,i,j)=aathet(l,1,i,j)
+ aathet(l,i,j,nthetyp+1,iblock)=0.0d0
+ aathet(l,nthetyp+1,i,j,iblock)=0.0d0
enddo
- aa0thet(i,j,nthetyp+1)=aa0thet(i,j,1)
- aa0thet(nthetyp+1,i,j)=aa0thet(1,i,j)
+ aa0thet(i,j,nthetyp+1,iblock)=0.0d0
+ aa0thet(nthetyp+1,i,j,iblock)=0.0d0
enddo
do l=1,ntheterm
- aathet(l,nthetyp+1,i,nthetyp+1)=aathet(l,1,i,1)
+ aathet(l,nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
- aa0thet(nthetyp+1,i,nthetyp+1)=aa0thet(1,i,1)
+ aa0thet(nthetyp+1,i,nthetyp+1,iblock)=0.0d0
+ enddo
enddo
+C Substitution for D aminoacids from symmetry.
+ do iblock=1,2
+ do i=-nthetyp,0
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ aa0thet(i,j,k,iblock)=aa0thet(-i,-j,-k,iblock)
+ do l=1,ntheterm
+ aathet(l,i,j,k,iblock)=aathet(l,-i,-j,-k,iblock)
+ enddo
+ do ll=1,ntheterm2
+ do lll=1,nsingle
+ bbthet(lll,ll,i,j,k,iblock)=bbthet(lll,ll,-i,-j,-k,iblock)
+ ccthet(lll,ll,i,j,k,iblock)=-ccthet(lll,ll,-i,-j,-k,iblock)
+ ddthet(lll,ll,i,j,k,iblock)=ddthet(lll,ll,-i,-j,-k,iblock)
+ eethet(lll,ll,i,j,k,iblock)=-eethet(lll,ll,-i,-j,-k,iblock)
+ enddo
+ enddo
+ do ll=1,ntheterm3
+ do lll=2,ndouble
+ do llll=1,lll-1
+ ffthet(llll,lll,ll,i,j,k,iblock)=
+ & ffthet(llll,lll,ll,-i,-j,-k,iblock)
+ ffthet(lll,llll,ll,i,j,k,iblock)=
+ & ffthet(lll,llll,ll,-i,-j,-k,iblock)
+ ggthet(llll,lll,ll,i,j,k,iblock)=
+ & -ggthet(llll,lll,ll,-i,-j,-k,iblock)
+ ggthet(lll,llll,ll,i,j,k,iblock)=
+ & -ggthet(lll,llll,ll,-i,-j,-k,iblock)
+ enddo !ll
+ enddo !lll
+ enddo !llll
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
+
C
C Control printout of the coefficients of virtual-bond-angle potentials
C
write (iout,'(//4a)')
& 'Type ',onelett(i),onelett(j),onelett(k)
write (iout,'(//a,10x,a)') " l","a[l]"
- write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k)
+ write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k,iblock)
write (iout,'(i2,1pe15.5)')
- & (l,aathet(l,i,j,k),l=1,ntheterm)
+ & (l,aathet(l,i,j,k,iblock),l=1,ntheterm)
do l=1,ntheterm2
write (iout,'(//2h m,4(9x,a,3h[m,i1,1h]))')
& "b",l,"c",l,"d",l,"e",l
do m=1,nsingle
write (iout,'(i2,4(1pe15.5))') m,
- & bbthet(m,l,i,j,k),ccthet(m,l,i,j,k),
- & ddthet(m,l,i,j,k),eethet(m,l,i,j,k)
+ & bbthet(m,l,i,j,k,iblock),ccthet(m,l,i,j,k,iblock),
+ & ddthet(m,l,i,j,k,iblock),eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=2,ndouble
do n=1,m-1
write (iout,'(i1,1x,i1,4(1pe15.5))') n,m,
- & ffthet(n,m,l,i,j,k),ffthet(m,n,l,i,j,k),
- & ggthet(n,m,l,i,j,k),ggthet(m,n,l,i,j,k)
+ & ffthet(n,m,l,i,j,k,iblock),
+ & ffthet(m,n,l,i,j,k,iblock),
+ & ggthet(n,m,l,i,j,k,iblock),
+ & ggthet(m,n,l,i,j,k,iblock)
enddo
enddo
enddo
C of the side chains.
C
do i=1,ntyp
+cc write (iout,*) "tu dochodze",i
read (irotam,'(3x,i3,f8.3)') nlob(i),dsc(i)
if (i.eq.10) then
dsc_inv(i)=0.0D0
enddo
bsc(1,i)=0.0D0
read(irotam,*)(censc(k,1,i),k=1,3),((blower(k,l,1),l=1,k),k=1,3)
+ censc(1,1,-i)=censc(1,1,i)
+ censc(2,1,-i)=censc(2,1,i)
+ censc(3,1,-i)=-censc(3,1,i)
do j=2,nlob(i)
read (irotam,*) bsc(j,i)
read (irotam,*) (censc(k,j,i),k=1,3),
& ((blower(k,l,j),l=1,k),k=1,3)
+ censc(1,j,-i)=censc(1,j,i)
+ censc(2,j,-i)=censc(2,j,i)
+ censc(3,j,-i)=-censc(3,j,i)
+C BSC is amplitude of Gaussian
enddo
do j=1,nlob(i)
do k=1,3
enddo
gaussc(k,l,j,i)=akl
gaussc(l,k,j,i)=akl
+ if (((k.eq.3).and.(l.ne.3))
+ & .or.((l.eq.3).and.(k.ne.3))) then
+ gaussc(k,l,j,-i)=-akl
+ gaussc(l,k,j,-i)=-akl
+ else
+ gaussc(k,l,j,-i)=akl
+ gaussc(l,k,j,-i)=akl
+ endif
enddo
enddo
enddo
read (itorp,*) ntortyp
read (itorp,*) (itortyp(i),i=1,ntyp)
write (iout,*) 'ntortyp',ntortyp
- do i=1,ntortyp
- do j=1,ntortyp
- read (itorp,*) nterm(i,j),nlor(i,j)
+ do iblock=1,2
+ do i=-ntyp,-1
+ itortyp(i)=-itortyp(-i)
+ enddo
+c write (iout,*) 'ntortyp',ntortyp
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ read (itorp,*) nterm(i,j,iblock),
+ & nlor(i,j,iblock)
+ nterm(-i,-j,iblock)=nterm(i,j,iblock)
+ nlor(-i,-j,iblock)=nlor(i,j,iblock)
v0ij=0.0d0
si=-1.0d0
- do k=1,nterm(i,j)
- read (itorp,*) kk,v1(k,i,j),v2(k,i,j)
- v0ij=v0ij+si*v1(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ read (itorp,*) kk,v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
+ v1(k,-i,-j,iblock)=v1(k,i,j,iblock)
+ v2(k,-i,-j,iblock)=-v2(k,i,j,iblock)
+ v0ij=v0ij+si*v1(k,i,j,iblock)
si=-si
- enddo
- do k=1,nlor(i,j)
- read (itorp,*) kk,vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
+ enddo
+ do k=1,nlor(i,j,iblock)
+ read (itorp,*) kk,vlor1(k,i,j),
+ & vlor2(k,i,j),vlor3(k,i,j)
v0ij=v0ij+vlor1(k,i,j)/(1+vlor3(k,i,j)**2)
enddo
- v0(i,j)=v0ij
+ v0(i,j,iblock)=v0ij
+ v0(-i,-j,iblock)=v0ij
enddo
enddo
+ enddo
close (itorp)
if (lprint) then
- write (iout,'(/a/)') 'Torsional constants:'
- do i=1,ntortyp
- do j=1,ntortyp
+ write (iout,'(/a/)') 'Torsional constants:'
+ do i=1,ntortyp
+ do j=1,ntortyp
write (iout,*) 'ityp',i,' jtyp',j
write (iout,*) 'Fourier constants'
- do k=1,nterm(i,j)
- write (iout,'(2(1pe15.5))') v1(k,i,j),v2(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ write (iout,'(2(1pe15.5))') v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
enddo
write (iout,*) 'Lorenz constants'
- do k=1,nlor(i,j)
- write (iout,'(3(1pe15.5))')
+ do k=1,nlor(i,j,iblock)
+ write (iout,'(3(1pe15.5))')
& vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
enddo
enddo
C
C 6/23/01 Read parameters for double torsionals
C
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
read (itordp,'(3a1)') t1,t2,t3
- if (t1.ne.onelett(i) .or. t2.ne.onelett(j)
- & .or. t3.ne.onelett(k)) then
+c write (iout,*) "OK onelett",
+c & i,j,k,t1,t2,t3
+
+ if (t1.ne.toronelet(i) .or. t2.ne.toronelet(j)
+ & .or. t3.ne.toronelet(k)) then
write (iout,*) "Error in double torsional parameter file",
& i,j,k,t1,t2,t3
+#ifdef MPI
+ call MPI_Finalize(Ierror)
+#endif
stop "Error in double torsional parameter file"
endif
- read (itordp,*) ntermd_1(i,j,k),ntermd_2(i,j,k)
- read (itordp,*) (v1c(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1c(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) ((v2c(l,m,i,j,k),v2c(m,l,i,j,k),
- & v2s(l,m,i,j,k),v2s(m,l,i,j,k),m=1,l-1),l=1,ntermd_2(i,j,k))
- enddo
- enddo
- enddo
+ read (itordp,*) ntermd_1(i,j,k,iblock),
+ & ntermd_2(i,j,k,iblock)
+ ntermd_1(-i,-j,-k,iblock)=ntermd_1(i,j,k,iblock)
+ ntermd_2(-i,-j,-k,iblock)=ntermd_2(i,j,k,iblock)
+ read (itordp,*) (v1c(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1c(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+C Martix of D parameters for one dimesional foureir series
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,-i,-j,-k,iblock)=v1c(1,l,i,j,k,iblock)
+ v1s(1,l,-i,-j,-k,iblock)=-v1s(1,l,i,j,k,iblock)
+ v1c(2,l,-i,-j,-k,iblock)=v1c(2,l,i,j,k,iblock)
+ v1s(2,l,-i,-j,-k,iblock)=-v1s(2,l,i,j,k,iblock)
+c write(iout,*) "whcodze" ,
+c & v1s(2,l,-i,-j,-k,iblock),v1s(2,l,i,j,k,iblock)
+ enddo
+ read (itordp,*) ((v2c(l,m,i,j,k,iblock),
+ & v2c(m,l,i,j,k,iblock),v2s(l,m,i,j,k,iblock),
+ & v2s(m,l,i,j,k,iblock),
+ & m=1,l-1),l=1,ntermd_2(i,j,k,iblock))
+C Martix of D parameters for two dimesional fourier series
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,l-1
+ v2c(l,m,-i,-j,-k,iblock)=v2c(l,m,i,j,k,iblock)
+ v2c(m,l,-i,-j,-k,iblock)=v2c(m,l,i,j,k,iblock)
+ v2s(l,m,-i,-j,-k,iblock)=-v2s(l,m,i,j,k,iblock)
+ v2s(m,l,-i,-j,-k,iblock)=-v2s(m,l,i,j,k,iblock)
+ enddo!m
+ enddo!l
+ enddo!k
+ enddo!j
+ enddo!i
+ enddo!iblock
if (lprint) then
- write (iout,*)
+ write (iout,*)
write (iout,*) 'Constants for double torsionals'
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
write (iout,*) 'ityp',i,' jtyp',j,' ktyp',k,
- & ' nsingle',ntermd_1(i,j,k),' ndouble',ntermd_2(i,j,k)
+ & ' nsingle',ntermd_1(i,j,k,iblock),
+ & ' ndouble',ntermd_2(i,j,k,iblock)
write (iout,*)
write (iout,*) 'Single angles:'
- do l=1,ntermd_1(i,j,k)
- write (iout,'(i5,2f10.5,5x,2f10.5)') l,
- & v1c(1,l,i,j,k),v1s(1,l,i,j,k),
- & v1c(2,l,i,j,k),v1s(2,l,i,j,k)
+ do l=1,ntermd_1(i,j,k,iblock)
+ write (iout,'(i5,2f10.5,5x,2f10.5,5x,2f10.5)') l,
+ & v1c(1,l,i,j,k,iblock),v1s(1,l,i,j,k,iblock),
+ & v1c(2,l,i,j,k,iblock),v1s(2,l,i,j,k,iblock),
+ & v1s(1,l,-i,-j,-k,iblock),v1s(2,l,-i,-j,-k,iblock)
enddo
write (iout,*)
write (iout,*) 'Pairs of angles:'
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2c(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2c(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
- write (iout,'(i5,20f10.5)')
- & l,(v2s(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
+ write (iout,'(i5,20f10.5)')
+ & l,(v2s(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock)),
+ & (v2s(l,m,-i,-j,-k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
enddo
enddo
enddo
+ enddo
endif
#endif
+C Read of Side-chain backbone correlation parameters
+C Modified 11 May 2012 by Adasko
+CCC
C
-C 5/21/07 (AL) Read coefficients of the backbone-local sidechain-local
-C correlation energies.
-C
- read (isccor,*) nterm_sccor
- do i=1,20
- do j=1,20
- read (isccor,'(a)')
- do k=1,nterm_sccor
- read (isccor,*)
- & kk,v1sccor(k,i,j),v2sccor(k,i,j)
+ read (isccor,*) nsccortyp
+ read (isccor,*) (isccortyp(i),i=1,ntyp)
+ do i=-ntyp,-1
+ isccortyp(i)=-isccortyp(-i)
+ enddo
+ iscprol=isccortyp(20)
+c write (iout,*) 'ntortyp',ntortyp
+ maxinter=3
+cc maxinter is maximum interaction sites
+ do l=1,maxinter
+ do i=1,nsccortyp
+ do j=1,nsccortyp
+ read (isccor,*)
+ &nterm_sccor(i,j),nlor_sccor(i,j)
+ write (iout,*) nterm_sccor(i,j)
+ v0ijsccor=0.0d0
+ v0ijsccor1=0.0d0
+ v0ijsccor2=0.0d0
+ v0ijsccor3=0.0d0
+ si=-1.0d0
+ nterm_sccor(-i,j)=nterm_sccor(i,j)
+ nterm_sccor(-i,-j)=nterm_sccor(i,j)
+ nterm_sccor(i,-j)=nterm_sccor(i,j)
+ write (iout,*) nterm_sccor(i,j),nterm_sccor(-i,j),
+ & nterm_sccor(-i,-j),nterm_sccor(i,-j)
+ do k=1,nterm_sccor(i,j)
+ read (isccor,*) kk,v1sccor(k,l,i,j)
+ & ,v2sccor(k,l,i,j)
+ if (j.eq.iscprol) then
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)*0.5d0
+ & +v2sccor(k,l,i,j)*dsqrt(0.75d0)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)*0.5d0
+ & +v1sccor(k,l,i,j)*dsqrt(0.75d0)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ else
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ if (j.eq.isccortyp(10)) then
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=-v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ endif
+ endif
+ v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ v0ijsccor1=v0ijsccor+si*v1sccor(k,l,-i,j)
+ v0ijsccor2=v0ijsccor+si*v1sccor(k,l,i,-j)
+ v0ijsccor3=v0ijsccor+si*v1sccor(k,l,-i,-j)
+ si=-si
+ enddo
+ do k=1,nlor_sccor(i,j)
+ read (isccor,*) kk,vlor1sccor(k,i,j),
+ & vlor2sccor(k,i,j),vlor3sccor(k,i,j)
+ v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
+ &(1+vlor3sccor(k,i,j)**2)
+ enddo
+ v0sccor(l,i,j)=v0ijsccor
+ v0sccor(l,-i,j)=v0ijsccor1
+ v0sccor(l,i,-j)=v0ijsccor2
+ v0sccor(l,-i,-j)=v0ijsccor3
enddo
enddo
enddo
close (isccor)
if (lprint) then
write (iout,'(/a/)') 'Torsional constants of SCCORR:'
- do i=1,20
- do j=1,20
+ do i=1,nsccortyp
+ do j=1,nsccortyp
write (iout,*) 'ityp',i,' jtyp',j
- do k=1,nterm_sccor
- write (iout,'(2(1pe15.5))') v1sccor(k,i,j),v2sccor(k,i,j)
+ write (iout,*) 'Fourier constants'
+ do k=1,nterm_sccor(i,j)
+ write (iout,'(2(1pe15.5))')
+ & v1sccor(k,l,i,j),v2sccor(k,l,i,j)
+ enddo
+ write (iout,*) 'Lorenz constants'
+ do k=1,nlor_sccor(i,j)
+ write (iout,'(3(1pe15.5))')
+ & vlor1sccor(k,i,j),vlor2sccor(k,i,j),vlor3sccor(k,i,j)
enddo
enddo
enddo
C interaction energy of the Gly, Ala, and Pro prototypes.
C
read (ifourier,*) nloctyp
- do i=1,nloctyp
+ do i=0,nloctyp-1
read (ifourier,*)
read (ifourier,*) (b(ii,i),ii=1,13)
if (lprint) then
endif
B1(1,i) = b(3,i)
B1(2,i) = b(5,i)
+ B1(1,-i) = b(3,i)
+ B1(2,-i) = -b(5,i)
+c b1(1,i)=0.0d0
+c b1(2,i)=0.0d0
B1tilde(1,i) = b(3,i)
- B1tilde(2,i) =-b(5,i)
+ B1tilde(2,i) =-b(5,i)
+ B1tilde(1,-i) =-b(3,i)
+ B1tilde(2,-i) =b(5,i)
+c b1tilde(1,i)=0.0d0
+c b1tilde(2,i)=0.0d0
B2(1,i) = b(2,i)
B2(2,i) = b(4,i)
+ B2(1,-i) =b(2,i)
+ B2(2,-i) =-b(4,i)
+
+c b2(1,i)=0.0d0
+c b2(2,i)=0.0d0
CC(1,1,i)= b(7,i)
CC(2,2,i)=-b(7,i)
CC(2,1,i)= b(9,i)
CC(1,2,i)= b(9,i)
+ CC(1,1,-i)= b(7,i)
+ CC(2,2,-i)=-b(7,i)
+ CC(2,1,-i)=-b(9,i)
+ CC(1,2,-i)=-b(9,i)
+c CC(1,1,i)=0.0d0
+c CC(2,2,i)=0.0d0
+c CC(2,1,i)=0.0d0
+c CC(1,2,i)=0.0d0
Ctilde(1,1,i)=b(7,i)
Ctilde(1,2,i)=b(9,i)
Ctilde(2,1,i)=-b(9,i)
Ctilde(2,2,i)=b(7,i)
+ Ctilde(1,1,-i)=b(7,i)
+ Ctilde(1,2,-i)=-b(9,i)
+ Ctilde(2,1,-i)=b(9,i)
+ Ctilde(2,2,-i)=b(7,i)
+
+c Ctilde(1,1,i)=0.0d0
+c Ctilde(1,2,i)=0.0d0
+c Ctilde(2,1,i)=0.0d0
+c Ctilde(2,2,i)=0.0d0
DD(1,1,i)= b(6,i)
DD(2,2,i)=-b(6,i)
DD(2,1,i)= b(8,i)
DD(1,2,i)= b(8,i)
+ DD(1,1,-i)= b(6,i)
+ DD(2,2,-i)=-b(6,i)
+ DD(2,1,-i)=-b(8,i)
+ DD(1,2,-i)=-b(8,i)
+c DD(1,1,i)=0.0d0
+c DD(2,2,i)=0.0d0
+c DD(2,1,i)=0.0d0
+c DD(1,2,i)=0.0d0
Dtilde(1,1,i)=b(6,i)
Dtilde(1,2,i)=b(8,i)
Dtilde(2,1,i)=-b(8,i)
Dtilde(2,2,i)=b(6,i)
+ Dtilde(1,1,-i)=b(6,i)
+ Dtilde(1,2,-i)=-b(8,i)
+ Dtilde(2,1,-i)=b(8,i)
+ Dtilde(2,2,-i)=b(6,i)
+
+c Dtilde(1,1,i)=0.0d0
+c Dtilde(1,2,i)=0.0d0
+c Dtilde(2,1,i)=0.0d0
+c Dtilde(2,2,i)=0.0d0
EE(1,1,i)= b(10,i)+b(11,i)
EE(2,2,i)=-b(10,i)+b(11,i)
EE(2,1,i)= b(12,i)-b(13,i)
EE(1,2,i)= b(12,i)+b(13,i)
+ EE(1,1,-i)= b(10,i)+b(11,i)
+ EE(2,2,-i)=-b(10,i)+b(11,i)
+ EE(2,1,-i)=-b(12,i)+b(13,i)
+ EE(1,2,-i)=-b(12,i)-b(13,i)
+
+c ee(1,1,i)=1.0d0
+c ee(2,2,i)=1.0d0
+c ee(2,1,i)=0.0d0
+c ee(1,2,i)=0.0d0
+c ee(2,1,i)=ee(1,2,i)
+
enddo
if (lprint) then
do i=1,nloctyp
bpp (i,j)=-2.0D0*epp(i,j)*rri
ael6(i,j)=elpp6(i,j)*4.2D0**6
ael3(i,j)=elpp3(i,j)*4.2D0**3
+ lprint=.true.
if (lprint) write(iout,'(2i3,4(1pe15.4))')i,j,app(i,j),bpp(i,j),
& ael6(i,j),ael3(i,j)
+ lprint=.false.
enddo
enddo
C
endif
goto 50
C---------------------- GB or BP potential -----------------------------
- 30 read (isidep,*)((eps(i,j),j=i,ntyp),i=1,ntyp),
- & (sigma0(i),i=1,ntyp),(sigii(i),i=1,ntyp),(chip0(i),i=1,ntyp),
- & (alp(i),i=1,ntyp)
+ 30 do i=1,ntyp
+ read (isidep,*)(eps(i,j),j=i,ntyp)
+ enddo
+ read (isidep,*)(sigma0(i),i=1,ntyp)
+ read (isidep,*)(sigii(i),i=1,ntyp)
+ read (isidep,*)(chip(i),i=1,ntyp)
+ read (isidep,*)(alp(i),i=1,ntyp)
C For the GB potential convert sigma'**2 into chi'
if (ipot.eq.4) then
do i=1,ntyp
- chip(i)=(chip0(i)-1.0D0)/(chip0(i)+1.0D0)
+ chip(i)=(chip(i)-1.0D0)/(chip(i)+1.0D0)
enddo
endif
if (lprint) then
enddo
close (isidep1)
do i=1,ntyp1
- if (i.eq.10 .or. i.eq.21) then
+ if (i.eq.10 .or. i.eq.ntyp1) then
dsc_inv(i)=0.0d0
else
dsc_inv(i)=1.0d0/dsc(i)
else if (card(:3).eq.'TER') then
C End current chain
ires_old=ires+1
- itype(ires_old)=21
+ itype(ires_old)=ntyp1
ibeg=2
c write (iout,*) "Chain ended",ires,ishift,ires_old
call sccenter(ires,iii,sccor)
ishift=ires-1
if (res.ne.'GLY' .and. res.ne. 'ACE') then
ishift=ishift-1
- itype(1)=21
+ itype(1)=ntyp1
endif
c write (iout,*) "ires",ires," ibeg",ibeg," ishift",ishift
ibeg=0
nres=ires
do i=2,nres-1
c write (iout,*) i,itype(i)
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
c write (iout,*) "dummy",i,itype(i)
do j=1,3
c(j,i)=((c(j,i-1)+c(j,i+1))/2+2*c(j,i-1)-c(j,i-2))/2
nstart_sup=1
if (itype(nres).ne.10) then
nres=nres+1
- itype(nres)=21
+ itype(nres)=ntyp1
do j=1,3
dcj=c(j,nres-2)-c(j,nres-3)
c(j,nres)=c(j,nres-1)+dcj
c(j,nres+1)=c(j,1)
c(j,2*nres)=c(j,nres)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
nsup=nsup-1
nstart_sup=2
do j=1,3
lll=lll+1
cc write (iout,*) "spraw lancuchy",(c(j,i),j=1,3)
if (i.gt.1) then
- if (itype(i-1).eq.21) then
+ if ((itype(i-1).eq.ntyp1).and.(i.gt.2).and.(i.ne.nres)) then
chain_length=lll-1
kkk=kkk+1
c write (iout,*) "spraw lancuchy",(c(j,i),j=1,3)
endif
enddo
enddo
+ if (chain_length.eq.0) chain_length=nres
+ write (iout,*) chain_length
do j=1,3
chain_rep(j,chain_length,symetr)=chain_rep(j,chain_length,1)
chain_rep(j,chain_length+nres,symetr)
do i=2,nres
iti=itype(i)
write (iout,*) i,i-1,(c(j,i),j=1,3),(c(j,i-1),j=1,3),dist(i,i-1)
- if (itype(i-1).ne.21 .and. itype(i).ne.21 .and.
+ if (itype(i-1).ne.ntyp1 .and. itype(i).ne.ntyp1 .and.
& (dist(i,i-1).lt.2.0D0 .or. dist(i,i-1).gt.5.0D0)) then
write (iout,'(a,i4)') 'Bad Cartesians for residue',i
stop
theta(i+1)=alpha(i-1,i,i+1)
if (i.gt.2) phi(i+1)=beta(i-2,i-1,i,i+1)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
do j=1,3
c(j,1)=c(j,2)+(c(j,3)-c(j,4))
enddo
endif
- if (itype(nres).eq.21) then
+ if (itype(nres).eq.ntyp1) then
do j=1,3
c(j,nres)=c(j,nres-1)+(c(j,nres-2)-c(j,nres-3))
enddo
if (itype.eq.0) then
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (ucase(nam).eq.restyp(i)) then
rescode=i
return
else
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (nam(1:1).eq.onelet(i)) then
rescode=i
return
do kkk=1,nperm
nnsup=0
do i=1,nres
- if (itype(i).ne.21) then
+ if (itype(i).ne.ntyp1) then
nnsup=nnsup+1
do j=1,3
cc(j,nnsup)=c(j,i)
if (lprint) then
- write(iout,*) 'UNRES seq:'
+ write(iout,*) 'UNRES seq:',anatemp
do j=1,nbfrag
write(iout,*) 'beta ',(bfrag(i,j),i=1,4)
enddo
do j=1,nhfrag
- write(iout,*) 'helix ',(hfrag(i,j),i=1,2)
+ write(iout,*) 'helix ',(hfrag(i,j),i=1,2),anatemp
enddo
endif
- subroutine store_parm(iparm)
+ subroutine store_parm(iparm)
C
C Store parameters of set IPARM
C valence angles and the side chains and energy parameters.
include 'COMMON.SCROT'
include 'COMMON.SCCOR'
include 'COMMON.ALLPARM'
- integer i,j,k,l,m,mm,iparm
+ integer i,j,k,l,m,mm,iparm,ichir1,ichir2,iblock,iii
c Store weights
ww_all(1,iparm)=wsc
enddo
c Store bond angle parameters
#ifdef CRYST_THETA
- do i=1,ntyp
+ do i=-ntyp,ntyp
a0thet_all(i,iparm)=a0thet(i)
+ do ichir1=-1,1
+ do ichir2=-1,1
do j=1,2
- athet_all(j,i,iparm)=athet(j,i)
- bthet_all(j,i,iparm)=bthet(j,i)
+ athet_all(j,i,ichir1,ichir2,iparm)=athet(j,i,ichir1,ichir2)
+ bthet_all(j,i,ichir1,ichir2,iparm)=bthet(j,i,ichir1,ichir2)
+ enddo
+ enddo
enddo
do j=0,3
polthet_all(j,i,iparm)=polthet(j,i)
nsingle_all(iparm)=nsingle
ndouble_all(iparm)=ndouble
nntheterm_all(iparm)=nntheterm
- do i=1,ntyp1
+ do i=-ntyp,ntyp
ithetyp_all(i,iparm)=ithetyp(i)
enddo
- do i=1,maxthetyp1
- do j=1,maxthetyp1
- do k=1,maxthetyp1
- aa0thet_all(i,j,k,iparm)=aa0thet(i,j,k)
+ do iblock=1,2
+ do i=-maxthetyp1,maxthetyp1
+ do j=-maxthetyp1,maxthetyp1
+ do k=-maxthetyp1,maxthetyp1
+ aa0thet_all(i,j,k,iblock,iparm)=aa0thet(i,j,k,iblock)
do l=1,ntheterm
- aathet_all(l,i,j,k,iparm)=aathet(l,i,j,k)
+ aathet_all(l,i,j,k,iblock,iparm)=aathet(l,i,j,k,iblock)
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet_all(m,l,i,j,k,iparm)=bbthet(m,l,i,j,k)
- ccthet_all(m,l,i,j,k,iparm)=ccthet(m,l,i,j,k)
- ddthet_all(m,l,i,j,k,iparm)=ddthet(m,l,i,j,k)
- eethet_all(m,l,i,j,k,iparm)=eethet(m,l,i,j,k)
+ bbthet_all(m,l,i,j,k,iblock,iparm)=
+ & bbthet(m,l,i,j,k,iblock)
+ ccthet_all(m,l,i,j,k,iblock,iparm)=
+ &ccthet(m,l,i,j,k,iblock)
+ ddthet_all(m,l,i,j,k,iblock,iparm)=
+ &ddthet(m,l,i,j,k,iblock)
+ eethet_all(m,l,i,j,k,iblock,iparm)=
+ &eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet_all(mm,m,l,i,j,k,iparm)=ffthet(mm,m,l,i,j,k)
- ggthet_all(mm,m,l,i,j,k,iparm)=ggthet(mm,m,l,i,j,k)
+ if (iblock.eq.1) then
+ ffthet_all1(mm,m,l,i,j,k,iparm)=
+ & ffthet(mm,m,l,i,j,k,iblock)
+ ggthet_all1(mm,m,l,i,j,k,iparm)=
+ &ggthet(mm,m,l,i,j,k,iblock)
+ else
+ ffthet_all2(mm,m,l,i,j,k,iparm)=
+ & ffthet(mm,m,l,i,j,k,iblock)
+ ggthet_all2(mm,m,l,i,j,k,iparm)=
+ &ggthet(mm,m,l,i,j,k,iblock)
+ endif
enddo
enddo
enddo
enddo
enddo
enddo
+ enddo
#endif
#ifdef CRYST_SC
c Store the sidechain rotamer parameters
- do i=1,ntyp
- nlob_all(i,iparm)=nlob(i)
- do j=1,nlob(i)
- bsc_all(j,i,iparm)=bsc(j,i)
+ do i=-ntyp,ntyp
+ iii=iabs(i)
+cc write (iout,*) i,"storeparm1"
+ if (i.eq.0) cycle
+ nlob_all(iii,iparm)=nlob(iii)
+ do j=1,nlob(iii)
+ bsc_all(j,iii,iparm)=bsc(j,iii)
do k=1,3
censc_all(k,j,i,iparm)=censc(k,j,i)
enddo
enddo
#endif
c Store the torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- v0_all(i,j,iparm)=v0(i,j)
- nterm_all(i,j,iparm)=nterm(i,j)
- nlor_all(i,j,iparm)=nlor(i,j)
- do k=1,nterm(i,j)
- v1_all(k,i,j,iparm)=v1(k,i,j)
- v2_all(k,i,j,iparm)=v2(i,i,j)
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ v0_all(i,j,iblock,iparm)=v0(i,j,iblock)
+ nterm_all(i,j,iblock,iparm)=nterm(i,j,iblock)
+ nlor_all(i,j,iblock,iparm)=nlor(i,j,iblock)
+ do k=1,nterm(i,j,iblock)
+ v1_all(k,i,j,iblock,iparm)=v1(k,i,j,iblock)
+ v2_all(k,i,j,iblock,iparm)=v2(k,i,j,iblock)
enddo
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
vlor1_all(k,i,j,iparm)=vlor1(k,i,j)
vlor2_all(k,i,j,iparm)=vlor2(k,i,j)
vlor3_all(k,i,j,iparm)=vlor3(k,i,j)
enddo
enddo
+ enddo
enddo
c Store the double torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
- ntermd1_all(i,j,k,iparm)=ntermd_1(i,j,k)
- ntermd2_all(i,j,k,iparm)=ntermd_2(i,j,k)
- do l=1,ntermd_1(i,j,k)
- v1c_all(1,l,i,j,k,iparm)=v1c(1,l,i,j,k)
- v1c_all(2,l,i,j,k,iparm)=v1c(2,l,i,j,k)
- v2c_all(1,l,i,j,k,iparm)=v2c(1,l,i,j,k)
- v2c_all(2,l,i,j,k,iparm)=v2c(2,l,i,j,k)
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
+ ntermd1_all(i,j,k,iblock,iparm)=ntermd_1(i,j,k,iblock)
+ ntermd2_all(i,j,k,iblock,iparm)=ntermd_2(i,j,k,iblock)
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c_all(1,l,i,j,k,iblock,iparm)=v1c(1,l,i,j,k,iblock)
+ v1c_all(2,l,i,j,k,iblock,iparm)=v1c(2,l,i,j,k,iblock)
+ v2c_all(1,l,i,j,k,iblock,iparm)=v2c(1,l,i,j,k,iblock)
+ v2c_all(2,l,i,j,k,iblock,iparm)=v2c(2,l,i,j,k,iblock)
enddo
- do l=1,ntermd_2(i,j,k)
- do m=1,ntermd_2(i,j,k)
- v2s_all(l,m,i,j,k,iparm)=v2s(l,m,i,j,k)
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,ntermd_2(i,j,k,iblock)
+ v2s_all(l,m,i,j,k,iblock,iparm)=v2s(l,m,i,j,k,iblock)
enddo
enddo
enddo
enddo
enddo
+ enddo
c Store parameters of the cumulants
- do i=1,nloctyp
+ do i=-nloctyp,nloctyp
do j=1,2
b1_all(j,i,iparm)=b1(j,i)
b1tilde_all(j,i,iparm)=b1tilde(j,i)
v2ss_all(iparm)=v2ss
v3ss_all(iparm)=v3ss
c Store SC-backbone correlation parameters
- nterm_sccor_all(iparm)=nterm_sccor
- do i=1,20
- do j=1,20
- do k=1,nterm_sccor
- v1sccor_all(k,i,j,iparm)=v1sccor(k,i,j)
- v2sccor_all(k,i,j,iparm)=v2sccor(k,i,j)
+ do i=-nsccortyp,nsccortyp
+ do j=-nsccortyp,nsccortyp
+
+ nterm_sccor_all(j,i,iparm)=nterm_sccor(j,i)
+c do i=1,20
+c do j=1,20
+ do l=1,3
+ do k=1,nterm_sccor(j,i)
+ v1sccor_all(k,l,j,i,iparm)=v1sccor(k,l,j,i)
+ v2sccor_all(k,l,j,i,iparm)=v2sccor(k,l,j,i)
+ enddo
enddo
enddo
enddo
include 'COMMON.SCROT'
include 'COMMON.SCCOR'
include 'COMMON.ALLPARM'
- integer i,j,k,l,m,mm,iparm
+ integer i,j,k,l,m,mm,iparm,ichir1,ichir2,iblock,iii
c Restore weights
wsc=ww_all(1,iparm)
enddo
c Restore bond angle parameters
#ifdef CRYST_THETA
- do i=1,ntyp
+ do i=-ntyp,ntyp
a0thet(i)=a0thet_all(i,iparm)
+ do ichir1=-1,1
+ do ichir2=-1,1
do j=1,2
- athet(j,i)=athet_all(j,i,iparm)
- bthet(j,i)=bthet_all(j,i,iparm)
+ athet(j,i,ichir1,ichir2)=athet_all(j,i,ichir1,ichir2,iparm)
+ bthet(j,i,ichir1,ichir2)=bthet_all(j,i,ichir1,ichir2,iparm)
+ enddo
+ enddo
enddo
do j=0,3
polthet(j,i)=polthet_all(j,i,iparm)
nsingle=nsingle_all(iparm)
ndouble=ndouble_all(iparm)
nntheterm=nntheterm_all(iparm)
- do i=1,ntyp1
+ do i=-ntyp,ntyp
ithetyp(i)=ithetyp_all(i,iparm)
enddo
- do i=1,maxthetyp1
- do j=1,maxthetyp1
- do k=1,maxthetyp1
- aa0thet(i,j,k)=aa0thet_all(i,j,k,iparm)
+ do iblock=1,2
+ do i=-maxthetyp1,maxthetyp1
+ do j=-maxthetyp1,maxthetyp1
+ do k=-maxthetyp1,maxthetyp1
+ aa0thet(i,j,k,iblock)=aa0thet_all(i,j,k,iblock,iparm)
do l=1,ntheterm
- aathet(l,i,j,k)=aathet_all(l,i,j,k,iparm)
+ aathet(l,i,j,k,iblock)=aathet_all(l,i,j,k,iblock,iparm)
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=bbthet_all(m,l,i,j,k,iparm)
- ccthet(m,l,i,j,k)=ccthet_all(m,l,i,j,k,iparm)
- ddthet(m,l,i,j,k)=ddthet_all(m,l,i,j,k,iparm)
- eethet(m,l,i,j,k)=eethet_all(m,l,i,j,k,iparm)
+ bbthet(m,l,i,j,k,iblock)=
+ &bbthet_all(m,l,i,j,k,iblock,iparm)
+ ccthet(m,l,i,j,k,iblock)=
+ &ccthet_all(m,l,i,j,k,iblock,iparm)
+ ddthet(m,l,i,j,k,iblock)=
+ &ddthet_all(m,l,i,j,k,iblock,iparm)
+ eethet(m,l,i,j,k,iblock)=
+ &eethet_all(m,l,i,j,k,iblock,iparm)
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=ffthet_all(mm,m,l,i,j,k,iparm)
- ggthet(mm,m,l,i,j,k)=ggthet_all(mm,m,l,i,j,k,iparm)
+ if (iblock.eq.1) then
+ ffthet(mm,m,l,i,j,k,iblock)=
+ &ffthet_all1(mm,m,l,i,j,k,iparm)
+ ggthet(mm,m,l,i,j,k,iblock)=
+ &ggthet_all1(mm,m,l,i,j,k,iparm)
+ else
+ ffthet(mm,m,l,i,j,k,iblock)=
+ &ffthet_all2(mm,m,l,i,j,k,iparm)
+ ggthet(mm,m,l,i,j,k,iblock)=
+ &ggthet_all2(mm,m,l,i,j,k,iparm)
+ endif
enddo
enddo
enddo
enddo
enddo
enddo
+ enddo
#endif
c Restore the sidechain rotamer parameters
#ifdef CRYST_SC
- do i=1,ntyp
- nlob(i)=nlob_all(i,iparm)
- do j=1,nlob(i)
- bsc(j,i)=bsc_all(j,i,iparm)
+ do i=-ntyp,ntyp
+ if (i.eq.0) cycle
+ iii=iabs(i)
+ nlob(iii)=nlob_all(iii,iparm)
+ do j=1,nlob(iii)
+ bsc(j,iii)=bsc_all(j,iii,iparm)
do k=1,3
censc(k,j,i)=censc_all(k,j,i,iparm)
enddo
enddo
#endif
c Restore the torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- v0(i,j)=v0_all(i,j,iparm)
- nterm(i,j)=nterm_all(i,j,iparm)
- nlor(i,j)=nlor_all(i,j,iparm)
- do k=1,nterm(i,j)
- v1(k,i,j)=v1_all(k,i,j,iparm)
- v2(i,i,j)=v2_all(k,i,j,iparm)
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ v0(i,j,iblock)=v0_all(i,j,iblock,iparm)
+ nterm(i,j,iblock)=nterm_all(i,j,iblock,iparm)
+ nlor(i,j,iblock)=nlor_all(i,j,iblock,iparm)
+ do k=1,nterm(i,j,iblock)
+ v1(k,i,j,iblock)=v1_all(k,i,j,iblock,iparm)
+ v2(k,i,j,iblock)=v2_all(k,i,j,iblock,iparm)
enddo
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
vlor1(k,i,j)=vlor1_all(k,i,j,iparm)
vlor2(k,i,j)=vlor2_all(k,i,j,iparm)
vlor3(k,i,j)=vlor3_all(k,i,j,iparm)
enddo
enddo
enddo
+ enddo
c Restore the double torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
- ntermd_1(i,j,k)=ntermd1_all(i,j,k,iparm)
- ntermd_2(i,j,k)=ntermd2_all(i,j,k,iparm)
- do l=1,ntermd_1(i,j,k)
- v1c(1,l,i,j,k)=v1c_all(1,l,i,j,k,iparm)
- v1c(2,l,i,j,k)=v1c_all(2,l,i,j,k,iparm)
- v2c(1,l,i,j,k)=v2c_all(1,l,i,j,k,iparm)
- v2c(2,l,i,j,k)=v2c_all(2,l,i,j,k,iparm)
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
+ ntermd_1(i,j,k,iblock)=ntermd1_all(i,j,k,iblock,iparm)
+ ntermd_2(i,j,k,iblock)=ntermd2_all(i,j,k,iblock,iparm)
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,i,j,k,iblock)=v1c_all(1,l,i,j,k,iblock,iparm)
+ v1c(2,l,i,j,k,iblock)=v1c_all(2,l,i,j,k,iblock,iparm)
+ v2c(1,l,i,j,k,iblock)=v2c_all(1,l,i,j,k,iblock,iparm)
+ v2c(2,l,i,j,k,iblock)=v2c_all(2,l,i,j,k,iblock,iparm)
enddo
- do l=1,ntermd_2(i,j,k)
- do m=1,ntermd_2(i,j,k)
- v2s(l,m,i,j,k)=v2s_all(l,m,i,j,k,iparm)
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,ntermd_2(i,j,k,iblock)
+ v2s(l,m,i,j,k,iblock)=v2s_all(l,m,i,j,k,iblock,iparm)
enddo
enddo
enddo
enddo
enddo
+ enddo
c Restore parameters of the cumulants
- do i=1,nloctyp
+ do i=-nloctyp,nloctyp
do j=1,2
b1(j,i)=b1_all(j,i,iparm)
b1tilde(j,i)=b1tilde_all(j,i,iparm)
v2ss=v2ss_all(iparm)
v3ss=v3ss_all(iparm)
c Restore SC-backbone correlation parameters
- nterm_sccor=nterm_sccor_all(iparm)
- do i=1,20
- do j=1,20
- do k=1,nterm_sccor
- v1sccor(k,i,j)=v1sccor_all(k,i,j,iparm)
- v2sccor(k,i,j)=v2sccor_all(k,i,j,iparm)
+ do i=-nsccortyp,nsccortyp
+ do j=-nsccortyp,nsccortyp
+
+ nterm_sccor(j,i)=nterm_sccor_all(j,i,iparm)
+ do l=1,3
+ do k=1,nterm_sccor(j,i)
+ v1sccor(k,l,j,i)=v1sccor_all(k,l,j,i,iparm)
+ v2sccor(k,l,j,i)=v2sccor_all(k,l,j,i,iparm)
+ enddo
enddo
enddo
enddo
& vbldsc0_all(maxbondterm,ntyp,max_parm),
& aksc_all(maxbondterm,ntyp,max_parm),
& abond0_all(maxbondterm,ntyp,max_parm),
- & a0thet_all(ntyp,max_parm),athet_all(2,ntyp,max_parm),
- & bthet_all(2,ntyp,max_parm),polthet_all(0:3,ntyp,max_parm),
- & gthet_all(3,ntyp,max_parm),theta0_all(ntyp,max_parm),
- & sig0_all(ntyp,max_parm),sigc0_all(ntyp,max_parm),
+ & a0thet_all(-ntyp:ntyp,max_parm),
+ & athet_all(2,-ntyp:ntyp,-1:1,-1:1,max_parm),
+ & bthet_all(2,-ntyp:ntyp,-1:1,-1:1,max_parm),
+ & polthet_all(0:3,-ntyp:ntyp,max_parm),
+ & gthet_all(3,-ntyp:ntyp,max_parm),theta0_all(-ntyp:ntyp,max_parm),
+ & sig0_all(-ntyp:ntyp,max_parm),sigc0_all(-ntyp:ntyp,max_parm),
& aa0thet_all(maxthetyp1,maxthetyp1,maxthetyp1,max_parm),
& aathet_all(maxtheterm,maxthetyp1,maxthetyp1,maxthetyp1,max_parm),
& bbthet_all(maxsingle,maxtheterm2,maxthetyp1,maxthetyp1,
& ggthet_all(maxdouble,maxdouble,maxtheterm3,maxthetyp1,maxthetyp1,
& maxthetyp1,max_parm),
& dsc_all(ntyp1,max_parm),bsc_all(maxlob,ntyp,max_parm),
- & censc_all(3,maxlob,ntyp,max_parm),
- & gaussc_all(3,3,maxlob,ntyp,max_parm),dsc0_all(ntyp1,max_parm),
+ & censc_all(3,maxlob,-ntyp:ntyp,max_parm),
+ & gaussc_all(3,3,maxlob,-ntyp:ntyp,max_parm),
+ & dsc0_all(ntyp1,max_parm),
& sc_parmin_all(65,ntyp,max_parm),
- & v0_all(maxtor,maxtor,max_parm),
- & v1_all(maxterm,maxtor,maxtor,max_parm),
- & v2_all(maxterm,maxtor,maxtor,max_parm),
+ & v0_all(-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & v1_all(maxterm,-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & v2_all(maxterm,-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
& vlor1_all(maxlor,maxtor,maxtor,max_parm),
& vlor2_all(maxlor,maxtor,maxtor,max_parm),
& vlor3_all(maxlor,maxtor,maxtor,max_parm),
- & v1c_all(2,maxtermd_1,maxtor,maxtor,maxtor,max_parm),
- & v1s_all(2,maxtermd_1,maxtor,maxtor,maxtor,max_parm),
- & v2c_all(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor,max_parm),
- & v2s_all(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor,max_parm),
- & b1_all(2,maxtor,max_parm),b2_all(2,maxtor,max_parm),
- & cc_all(2,2,maxtor,max_parm),dd_all(2,2,maxtor,max_parm),
- & ee_all(2,2,maxtor,max_parm),ctilde_all(2,2,maxtor,max_parm),
- & dtilde_all(2,2,maxtor,max_parm),b1tilde_all(2,maxtor,max_parm),
+ & v1c_all(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & v1s_all(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & v2c_all(maxtermd_2,maxtermd_2,-maxtor:maxtor,
+ & -maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & v2s_all(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & b1_all(2,-maxtor:maxtor,max_parm),
+ & b2_all(2,-maxtor:maxtor,max_parm),
+ & cc_all(2,2,-maxtor:maxtor,max_parm),
+ & dd_all(2,2,-maxtor:maxtor,max_parm),
+ & ee_all(2,2,-maxtor:maxtor,max_parm),
+ & ctilde_all(2,2,-maxtor:maxtor,max_parm),
+ & dtilde_all(2,2,-maxtor:maxtor,max_parm),
+ & b1tilde_all(2,-maxtor:maxtor,max_parm),
& app_all(2,2,max_parm),bpp_all(2,2,max_parm),
& ael6_all(2,2,max_parm),ael3_all(2,2,max_parm),
& aad_all(ntyp,2,max_parm),bad_all(ntyp,2,max_parm),
& v1ss_all(max_parm),v2ss_all(max_parm),v3ss_all(max_parm),
& v1sccor_all(maxterm_sccor,3,ntyp,ntyp,max_parm),
& v2sccor_all(maxterm_sccor,3,ntyp,ntyp,max_parm)
- integer nlob_all(ntyp1,max_parm),nlor_all(maxtor,maxtor,max_parm),
- & nterm_all(maxtor,maxtor,max_parm),
- & ntermd1_all(maxtor,maxtor,maxtor,max_parm),
- & ntermd2_all(maxtor,maxtor,maxtor,max_parm),
+ integer nlob_all(ntyp1,max_parm),
+ & nlor_all(-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & nterm_all(-maxtor:maxtor,-maxtor:maxtor,2,max_parm),
+ & ntermd1_all(-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
+ & ntermd2_all(-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2,max_parm),
& nbondterm_all(ntyp,max_parm),nthetyp_all(max_parm),
& ithetyp_all(ntyp1,max_parm),ntheterm_all(max_parm),
& ntheterm2_all(max_parm),ntheterm3_all(max_parm),
+++ /dev/null
-Makefile_MPICH_ifort
\ No newline at end of file
--- /dev/null
+INSTALL_DIR = /users/software/mpich-1.2.7p1_intel-10.1_em64_ssh
+BIN = ../../../bin/wham/
+FC= ifort
+#OPT = -mcmodel=medium -O3 -ip -w
+OPT = -mcmodel=medium -g -CB
+FFLAGS = ${OPT} -c -I. -I./include_unres -I$(INSTALL_DIR)/include
+LIBS = -L$(INSTALL_DIR)/lib -lmpich -lpmpich ../../lib/xdrf/libxdrf.a
+CPPFLAGS = -DMPI -DLINUX -DUNRES -DSPLITELE -DPROCOR -DPGI -DISNAN -DAMD64 \
+ -DCRYST_BOND -DCRYST_THETA -DCRYST_SC
+
+.f.o:
+ ${FC} ${FFLAGS} $*.f
+
+.F.o:
+ ${FC} ${FFLAGS} ${CPPFLAGS} $*.F
+
+all: make_dbase
+
+objects = \
+ wham_multparm.o \
+ bxread.o \
+ xread.o \
+ cxread.o \
+ enecalc1.o \
+ energy_p_new.o \
+ initialize_p.o \
+ molread_zs.o \
+ openunits.o \
+ gnmr1.o \
+ readrtns.o \
+ arcos.o \
+ cartder.o \
+ cartprint.o \
+ chainbuild.o \
+ geomout.o \
+ icant.o \
+ intcor.o \
+ int_from_cart.o \
+ make_ensemble1.o \
+ matmult.o \
+ misc.o \
+ mygetenv.o \
+ parmread.o \
+ pinorm.o \
+ printmat.o \
+ proc_proc.o \
+ rescode.o \
+ setup_var.o \
+ slices.o \
+ store_parm.o \
+ timing.o \
+ wham_calc1.o
+
+objects_compar = \
+ readrtns_compar.o \
+ readpdb.o fitsq.o contact.o \
+ elecont.o contfunc.o cont_frag.o conf_compar.o match_contact.o \
+ angnorm.o odlodc.o promienie.o qwolynes.o read_ref_str.o \
+ rmscalc.o secondary.o proc_cont.o define_pairs.o mysort.o
+
+make_dbase: ${objects} ${objects_compar}
+ cc -o compinfo compinfo.c
+ ./compinfo
+ ${FC} -c ${FFLAGS} cinfo.f
+ $(FC) ${OPT} ${objects} ${objects_compar} cinfo.o \
+ ${LIBS} -static-intel -o ${BIN}/wham_multparm-ham_rep-oldparm
+
+clean:
+ /bin/rm *.o
* Derivatives in alpha and omega:
*
do i=2,nres-1
- dsci=dsc(itype(i))
+ dsci=dsc(iabs(itype(i)))
alphi=alph(i)
omegi=omeg(i)
cd print *,'i=',i,' dsci=',dsci,' alphi=',alphi,' omegi=',omegi
--- /dev/null
+C DO NOT EDIT THIS FILE - IT HAS BEEN GENERATED BY COMPINFO.C
+C 0 0 578
+ subroutine cinfo
+ include 'COMMON.IOUNITS'
+ write(iout,*)'++++ Compile info ++++'
+ write(iout,*)'Version 0.0 build 578'
+ write(iout,*)'compiled Tue Oct 30 08:00:06 2012'
+ write(iout,*)'compiled by aks255@matrix.chem.cornell.edu'
+ write(iout,*)'OS name: Linux '
+ write(iout,*)'OS release: 2.6.34.9-69.fc13.x86_64 '
+ write(iout,*)'OS version:',
+ & ' #1 SMP Tue May 3 09:23:03 UTC 2011 '
+ write(iout,*)'flags:'
+ write(iout,*)'INSTALL_DIR = /users/software/mpich-1.2.7p1_int...'
+ write(iout,*)'BIN = ../../../bin/wham/'
+ write(iout,*)'FC= ifort'
+ write(iout,*)'OPT = -mcmodel=medium -g -CB'
+ write(iout,*)'FFLAGS = ${OPT} -c -I. -I./include_unres -I$(IN...'
+ write(iout,*)'LIBS = -L$(INSTALL_DIR)/lib -lmpich -lpmpich .....'
+ write(iout,*)'CPPFLAGS = -DMPI -DLINUX -DUNRES -DSPLITELE -DP...'
+ write(iout,*)'objects = \\'
+ write(iout,*)' wham_multparm.o \\'
+ write(iout,*)' bxread.o \\'
+ write(iout,*)' xread.o \\'
+ write(iout,*)' cxread.o \\'
+ write(iout,*)' enecalc1.o \\'
+ write(iout,*)' energy_p_new.o \\'
+ write(iout,*)' initialize_p.o \\'
+ write(iout,*)' molread_zs.o \\'
+ write(iout,*)' openunits.o \\'
+ write(iout,*)' gnmr1.o \\'
+ write(iout,*)' readrtns.o \\'
+ write(iout,*)' arcos.o \\'
+ write(iout,*)' cartder.o \\'
+ write(iout,*)' cartprint.o \\'
+ write(iout,*)' chainbuild.o \\'
+ write(iout,*)' geomout.o \\'
+ write(iout,*)' icant.o \\'
+ write(iout,*)' intcor.o \\'
+ write(iout,*)' int_from_cart.o \\'
+ write(iout,*)' make_ensemble1.o \\'
+ write(iout,*)' matmult.o \\'
+ write(iout,*)' misc.o \\'
+ write(iout,*)' mygetenv.o \\'
+ write(iout,*)' parmread.o \\'
+ write(iout,*)' pinorm.o \\'
+ write(iout,*)' printmat.o \\'
+ write(iout,*)' proc_proc.o \\'
+ write(iout,*)' rescode.o \\'
+ write(iout,*)' setup_var.o \\'
+ write(iout,*)' slices.o \\'
+ write(iout,*)' store_parm.o \\'
+ write(iout,*)' timing.o \\'
+ write(iout,*)' wham_calc1.o'
+ write(iout,*)'objects_compar = \\'
+ write(iout,*)' readrtns_compar.o \\'
+ write(iout,*)' readpdb.o fitsq.o contact.o \\'
+ write(iout,*)' elecont.o contfunc.o cont_frag.o conf_c...'
+ write(iout,*)'++++ End of compile info ++++'
+ return
+ end
endif
110 format (a,'(',i3,')',9f8.3)
do i=ist,ien-kkk
- iti=itype(i)
+ iti=iabs(itype(i))
do j=i+kkk,ien
- itj=itype(j)
+ itj=iabs(itype(j))
itypi=iti
itypj=itj
xj = c(1,nres+j)-c(1,nres+i)
it2=itype(i2)
write (iout,'(i3,2x,a,i4,2x,a,i4,5f8.3,3f10.5)')
& i,restyp(it1),i1,restyp(it2),i2,cscore(i),
- & sc_cutoff(it1,it2),ddsc(i),ddla(i),ddlb(i),
+ & sc_cutoff(iabs(it1),iabs(it2)),ddsc(i),ddla(i),ddlb(i),
& omt1(i),omt2(i),omt12(i)
enddo
endif
write (iout,*)
errmsg_count=errmsg_count+1
+ call pdbout(indstart(me1)+iii,
+ & 1.0d0/(1.987D-3*beta_h(ib,ipar)),
+ &energia(0),eini,0.0d0,0.0d0)
+ call enerprint(energia(0),fT)
if (errmsg_count.gt.maxerrmsg_count)
& write (iout,*) "Too many warning messages"
if (einicheck.gt.1) then
enddo
do j=nnt,nct
itj=itype(j)
- if (itype(j).ne.10 .and. (vbld(nres+j)-dsc(itj)).gt.2.0d0) then
+ if (itype(j).ne.10 .and.(vbld(nres+j)-dsc(iabs(itj))).gt.2.0d0)
+ & then
if (iprint.gt.0)
& write (iout,*) "Bad CA-SC bond length",j," ",vbld(nres+j),
& " for conformation",ii
& +wturn3*fact(2)*gel_loc_turn3(i)
& +wturn6*fact(5)*gel_loc_turn6(i)
& +wel_loc*fact(2)*gel_loc_loc(i)
- & +wsccor*fact(1)*gsccor_loc(i)
+c & +wsccor*fact(1)*gsccor_loc(i)
enddo
endif
return
evdw=0.0D0
evdw_t=0.0d0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
cd write (iout,*) 'i=',i,' iint=',iint,' istart=',istart(i,iint),
cd & 'iend=',iend(i,iint)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
evdw=0.0D0
evdw_t=0.0d0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ if (itypi.eq.ntyp1) cycle
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
C
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
- itypj=itype(j)
+ itypj=iabs(itype(j))
+ if (itypj.eq.ntyp1) cycle
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
zj=c(3,nres+j)-zi
c endif
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=vbld_inv(j+nres)
chi1=chi(itypi,itypj)
chi2=chi(itypj,itypi)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
c & 'evdw',i,j,evdwij,' ss'
ELSE
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
chi1=chi(itypi,itypj)
c if (icall.gt.0) lprn=.true.
ind=0
do i=iatsc_s,iatsc_e
- itypi=itype(i)
- itypi1=itype(i+1)
+ itypi=iabs(itype(i))
+ itypi1=iabs(itype(i+1))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
do iint=1,nint_gr(i)
do j=istart(i,iint),iend(i,iint)
ind=ind+1
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=vbld_inv(j+nres)
sig0ij=sigma(itypi,itypj)
r0ij=r0(itypi,itypj)
do iint=1,nscp_gr(i)
do j=iscpstart(i,iint),iscpend(i,iint)
- itypj=itype(j)
+ itypj=iabs(itype(j))
C Uncomment following three lines for SC-p interactions
c xj=c(1,nres+j)-xi
c yj=c(2,nres+j)-yi
C distance and angle dependent SS bond potential.
if (.not.dyn_ss .and. i.le.nss) then
C 15/02/13 CC dynamic SSbond - additional check
- if (ii.gt.nres .and. itype(iii).eq.1 .and. itype(jjj).eq.1) then
+ if (ii.gt.nres .and. iabs(itype(iii)).eq.1 .and.
+ & iabs(itype(jjj)).eq.1) then
call ssbond_ene(iii,jjj,eij)
ehpb=ehpb+2*eij
endif
include 'COMMON.VAR'
include 'COMMON.IOUNITS'
double precision erij(3),dcosom1(3),dcosom2(3),gg(3)
- itypi=itype(i)
+ itypi=iabs(itype(i))
xi=c(1,nres+i)
yi=c(2,nres+i)
zi=c(3,nres+i)
dyi=dc_norm(2,nres+i)
dzi=dc_norm(3,nres+i)
dsci_inv=dsc_inv(itypi)
- itypj=itype(j)
+ itypj=iabs(itype(j))
dscj_inv=dsc_inv(itypj)
xj=c(1,nres+j)-xi
yj=c(2,nres+j)-yi
c 09/18/07 AL: multimodal bond potential based on AM1 CA-SC PMF's included
c
do i=nnt,nct
- iti=itype(i)
+ iti=iabs(itype(i))
if (iti.ne.10) then
nbi=nbondterm(iti)
if (nbi.eq.1) then
C Zero the energy function and its derivative at 0 or pi.
call splinthet(theta(i),0.5d0*delta,ss,ssd)
it=itype(i-1)
+ ichir1=isign(1,itype(i-2))
+ ichir2=isign(1,itype(i))
+ if (itype(i-2).eq.10) ichir1=isign(1,itype(i-1))
+ if (itype(i).eq.10) ichir2=isign(1,itype(i-1))
+ if (itype(i-1).eq.10) then
+ itype1=isign(10,itype(i-2))
+ ichir11=isign(1,itype(i-2))
+ ichir12=isign(1,itype(i-2))
+ itype2=isign(10,itype(i))
+ ichir21=isign(1,itype(i))
+ ichir22=isign(1,itype(i))
+ endif
c if (i.gt.ithet_start .and.
c & (itel(i-1).eq.0 .or. itel(i-2).eq.0)) goto 1215
c if (i.gt.3 .and. (i.le.4 .or. itel(i-3).ne.0)) then
C In following comments this theta will be referred to as t_c.
thet_pred_mean=0.0d0
do k=1,2
- athetk=athet(k,it)
- bthetk=bthet(k,it)
+ athetk=athet(k,it,ichir1,ichir2)
+ bthetk=bthet(k,it,ichir1,ichir2)
+ if (it.eq.10) then
+ athetk=athet(k,itype1,ichir11,ichir12)
+ bthetk=bthet(k,itype2,ichir21,ichir22)
+ endif
thet_pred_mean=thet_pred_mean+athetk*y(k)+bthetk*z(k)
enddo
c write (iout,*) "thet_pred_mean",thet_pred_mean
thet_pred_mean=thet_pred_mean*ss+a0thet(it)
c write (iout,*) "thet_pred_mean",thet_pred_mean
C Derivatives of the "mean" values in gamma1 and gamma2.
- dthetg1=(-athet(1,it)*y(2)+athet(2,it)*y(1))*ss
- dthetg2=(-bthet(1,it)*z(2)+bthet(2,it)*z(1))*ss
+ dthetg1=(-athet(1,it,ichir1,ichir2)*y(2)
+ &+athet(2,it,ichir1,ichir2)*y(1))*ss
+ dthetg2=(-bthet(1,it,ichir1,ichir2)*z(2)
+ & +bthet(2,it,ichir1,ichir2)*z(1))*ss
+ if (it.eq.10) then
+ dthetg1=(-athet(1,itype1,ichir11,ichir12)*y(2)
+ &+athet(2,itype1,ichir11,ichir12)*y(1))*ss
+ dthetg2=(-bthet(1,itype2,ichir21,ichir22)*z(2)
+ & +bthet(2,itype2,ichir21,ichir22)*z(1))*ss
+ endif
if (theta(i).gt.pi-delta) then
call theteng(pi-delta,thet_pred_mean,theta0(it),f0,fprim0,
& E_tc0)
etheta=0.0D0
c write (iout,*) "ithetyp",(ithetyp(i),i=1,ntyp1)
do i=ithet_start,ithet_end
+ if (iabs(itype(i+1)).eq.20) iblock=2
+ if (iabs(itype(i+1)).ne.20) iblock=1
dethetai=0.0d0
dephii=0.0d0
dephii1=0.0d0
theti2=0.5d0*theta(i)
- ityp2=ithetyp(itype(i-1))
+ ityp2=ithetyp((itype(i-1)))
do k=1,nntheterm
coskt(k)=dcos(k*theti2)
sinkt(k)=dsin(k*theti2)
#else
phii=phi(i)
#endif
- ityp1=ithetyp(itype(i-2))
+ ityp1=ithetyp(iabs(itype(i-2)))
do k=1,nsingle
cosph1(k)=dcos(k*phii)
sinph1(k)=dsin(k*phii)
#else
phii1=phi(i+1)
#endif
- ityp3=ithetyp(itype(i))
+ ityp3=ithetyp((itype(i)))
do k=1,nsingle
cosph2(k)=dcos(k*phii1)
sinph2(k)=dsin(k*phii1)
c write (iout,*) "i",i," ityp1",itype(i-2),ityp1,
c & " ityp2",itype(i-1),ityp2," ityp3",itype(i),ityp3
c call flush(iout)
- ethetai=aa0thet(ityp1,ityp2,ityp3)
+ ethetai=aa0thet(ityp1,ityp2,ityp3,iblock)
do k=1,ndouble
do l=1,k-1
ccl=cosph1(l)*cosph2(k-l)
enddo
endif
do k=1,ntheterm
- ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3)*sinkt(k)
- dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3)
+ ethetai=ethetai+aathet(k,ityp1,ityp2,ityp3,iblock)*sinkt(k)
+ dethetai=dethetai+0.5d0*k*aathet(k,ityp1,ityp2,ityp3,iblock)
& *coskt(k)
if (lprn)
- & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3),
+ & write (iout,*) "k",k," aathet",aathet(k,ityp1,ityp2,ityp3,
+ & iblock),
& " ethetai",ethetai
enddo
if (lprn) then
endif
do m=1,ntheterm2
do k=1,nsingle
- aux=bbthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)
- & +ccthet(k,m,ityp1,ityp2,ityp3)*sinph1(k)
- & +ddthet(k,m,ityp1,ityp2,ityp3)*cosph2(k)
- & +eethet(k,m,ityp1,ityp2,ityp3)*sinph2(k)
+ aux=bbthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)
+ & +ccthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k)
+ & +ddthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)
+ & +eethet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*aux*coskt(m)
dephii=dephii+k*sinkt(m)*(
- & ccthet(k,m,ityp1,ityp2,ityp3)*cosph1(k)-
- & bbthet(k,m,ityp1,ityp2,ityp3)*sinph1(k))
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)*cosph1(k)-
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph1(k))
dephii1=dephii1+k*sinkt(m)*(
- & eethet(k,m,ityp1,ityp2,ityp3)*cosph2(k)-
- & ddthet(k,m,ityp1,ityp2,ityp3)*sinph2(k))
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)*cosph2(k)-
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)*sinph2(k))
if (lprn)
& write (iout,*) "m",m," k",k," bbthet",
- & bbthet(k,m,ityp1,ityp2,ityp3)," ccthet",
- & ccthet(k,m,ityp1,ityp2,ityp3)," ddthet",
- & ddthet(k,m,ityp1,ityp2,ityp3)," eethet",
- & eethet(k,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & bbthet(k,m,ityp1,ityp2,ityp3,iblock)," ccthet",
+ & ccthet(k,m,ityp1,ityp2,ityp3,iblock)," ddthet",
+ & ddthet(k,m,ityp1,ityp2,ityp3,iblock)," eethet",
+ & eethet(k,m,ityp1,ityp2,ityp3,iblock)," ethetai",ethetai
enddo
enddo
if (lprn)
do m=1,ntheterm3
do k=2,ndouble
do l=1,k-1
- aux=ffthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)
+ aux=ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)
ethetai=ethetai+sinkt(m)*aux
dethetai=dethetai+0.5d0*m*coskt(m)*aux
dephii=dephii+l*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)-
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)+
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)-
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)+
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
dephii1=dephii1+(k-l)*sinkt(m)*(
- & -ffthet(l,k,m,ityp1,ityp2,ityp3)*sinph1ph2(l,k)+
- & ffthet(k,l,m,ityp1,ityp2,ityp3)*sinph1ph2(k,l)+
- & ggthet(l,k,m,ityp1,ityp2,ityp3)*cosph1ph2(l,k)-
- & ggthet(k,l,m,ityp1,ityp2,ityp3)*cosph1ph2(k,l))
+ & -ffthet(l,k,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(l,k)+
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)*sinph1ph2(k,l)+
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(l,k)-
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)*cosph1ph2(k,l))
if (lprn) then
write (iout,*) "m",m," k",k," l",l," ffthet",
- & ffthet(l,k,m,ityp1,ityp2,ityp3),
- & ffthet(k,l,m,ityp1,ityp2,ityp3)," ggthet",
- & ggthet(l,k,m,ityp1,ityp2,ityp3),
- & ggthet(k,l,m,ityp1,ityp2,ityp3)," ethetai",ethetai
+ & ffthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ffthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ggthet",
+ & ggthet(l,k,m,ityp1,ityp2,ityp3,iblock),
+ & ggthet(k,l,m,ityp1,ityp2,ityp3,iblock)," ethetai",
+ & ethetai
write (iout,*) cosph1ph2(l,k)*sinkt(m),
& cosph1ph2(k,l)*sinkt(m),
& sinph1ph2(l,k)*sinkt(m),sinph1ph2(k,l)*sinkt(m)
do i=loc_start,loc_end
it=itype(i)
if (it.eq.10) goto 1
- nlobit=nlob(it)
+ nlobit=nlob(iabs(it))
c print *,'i=',i,' it=',it,' nlobit=',nlobit
c write (iout,*) 'i=',i,' ssa=',ssa,' ssad=',ssad
theti=theta(i+1)-pipol
do iii=-1,1
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j,iii)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j,iii)+emin)
cd print *,'j=',j,' expfac=',expfac
escloc_i=escloc_i+expfac
do k=1,3
dersc12=0.0d0
do j=1,nlobit
- expfac=dexp(bsc(j,it)-0.5D0*contr(j)+emin)
+ expfac=dexp(bsc(j,iabs(it))-0.5D0*contr(j)+emin)
escloc_i=escloc_i+expfac
do k=1,2
dersc(k)=dersc(k)+Ax(k,j)*expfac
cosfac=dsqrt(cosfac2)
sinfac2=0.5d0/(1.0d0-costtab(i+1))
sinfac=dsqrt(sinfac2)
- it=itype(i)
+ it=iabs(itype(i))
if (it.eq.10) goto 1
c
C Compute the axes of tghe local cartesian coordinates system; store in
y_prime(j) = (dc_norm(j,i) + dc_norm(j,i-1))*sinfac
enddo
do j = 1,3
- z_prime(j) = -uz(j,i-1)
+ z_prime(j) = -uz(j,i-1)*dsign(1.0d0,dfloat(itype(i)))
enddo
c write (2,*) "i",i
c write (2,*) "x_prime",(x_prime(j),j=1,3)
C Compute the energy of the ith side cbain
C
c write (2,*) "xx",xx," yy",yy," zz",zz
- it=itype(i)
+ it=iabs(itype(i))
do j = 1,65
x(j) = sc_parmin(j,it)
enddo
Cc diagnostics - remove later
xx1 = dcos(alph(2))
yy1 = dsin(alph(2))*dcos(omeg(2))
- zz1 = -dsin(alph(2))*dsin(omeg(2))
+ zz1 = -dsign(1.0d0,itype(i))*dsin(alph(2))*dsin(omeg(2))
write(2,'(3f8.1,3f9.3,1x,3f9.3)')
& alph(2)*rad2deg,omeg(2)*rad2deg,theta(3)*rad2deg,xx,yy,zz,
& xx1,yy1,zz1
dZZ_Ci1(k)=0.0d0
dZZ_Ci(k)=0.0d0
do j=1,3
- dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)*dC_norm(j,i+nres)
- dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)*dC_norm(j,i+nres)
+ dZZ_Ci(k)=dZZ_Ci(k)-uzgrad(j,k,2,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+ dZZ_Ci1(k)=dZZ_Ci1(k)-uzgrad(j,k,1,i-1)
+ & *dsign(1.0d0,dfloat(itype(i)))*dC_norm(j,i+nres)
+
enddo
dXX_XYZ(k)=vbld_inv(i+nres)*(x_prime(k)-xx*dC_norm(k,i+nres))
etors=0.0D0
do i=iphi_start,iphi_end
if (itel(i-2).eq.0 .or. itel(i-1).eq.0) goto 1215
+ if (iabs(itype(i)).eq.20) then
+ iblock=2
+ else
+ iblock=1
+ endif
itori=itortyp(itype(i-2))
itori1=itortyp(itype(i-1))
phii=phi(i)
gloci=0.0D0
C Regular cosine and sine terms
- do j=1,nterm(itori,itori1)
- v1ij=v1(j,itori,itori1)
- v2ij=v2(j,itori,itori1)
+ do j=1,nterm(itori,itori1,iblock)
+ v1ij=v1(j,itori,itori1,iblock)
+ v2ij=v2(j,itori,itori1,iblock)
cosphi=dcos(j*phii)
sinphi=dsin(j*phii)
etors=etors+v1ij*cosphi+v2ij*sinphi
C
cosphi=dcos(0.5d0*phii)
sinphi=dsin(0.5d0*phii)
- do j=1,nlor(itori,itori1)
+ do j=1,nlor(itori,itori1,iblock)
vl1ij=vlor1(j,itori,itori1)
vl2ij=vlor2(j,itori,itori1)
vl3ij=vlor3(j,itori,itori1)
gloci=gloci+vl1ij*(vl3ij*cosphi-vl2ij*sinphi)*pom
enddo
C Subtract the constant term
- etors=etors-v0(itori,itori1)
+ etors=etors-v0(itori,itori1,iblock)
if (lprn)
& write (iout,'(2(a3,2x,i3,2x),2i3,6f8.3/26x,6f8.3/)')
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
- & (v1(j,itori,itori1),j=1,6),(v2(j,itori,itori1),j=1,6)
+ & (v1(j,itori,itori1,1),j=1,6),(v2(j,itori,itori1,1),j=1,6)
gloc(i-3,icg)=gloc(i-3,icg)+wtor*fact*gloci
c write (iout,*) 'i=',i,' gloc=',gloc(i-3,icg)
1215 continue
phii1=phi(i+1)
gloci1=0.0D0
gloci2=0.0D0
+ iblock=1
+ if (iabs(itype(i+1)).eq.20) iblock=2
C Regular cosine and sine terms
- do j=1,ntermd_1(itori,itori1,itori2)
- v1cij=v1c(1,j,itori,itori1,itori2)
- v1sij=v1s(1,j,itori,itori1,itori2)
- v2cij=v1c(2,j,itori,itori1,itori2)
- v2sij=v1s(2,j,itori,itori1,itori2)
+c c do j=1,ntermd_1(itori,itori1,itori2,iblock)
+c v1cij=v1c(1,j,itori,itori1,itori2,iblock)
+c v1sij=v1s(1,j,itori,itori1,itori2,iblock)
+c v2cij=v1c(2,j,itori,itori1,itori2,iblock)
+c v2sij=v1s(2,j,itori,itori1,itori2,iblock)
+ do j=1,ntermd_1(itori,itori1,itori2,iblock)
+ v1cij=v1c(1,j,itori,itori1,itori2,iblock)
+ v1sij=v1s(1,j,itori,itori1,itori2,iblock)
+ v2cij=v1c(2,j,itori,itori1,itori2,iblock)
+ v2sij=v1s(2,j,itori,itori1,itori2,iblock)
+
cosphi1=dcos(j*phii)
sinphi1=dsin(j*phii)
cosphi2=dcos(j*phii1)
gloci1=gloci1+j*(v1sij*cosphi1-v1cij*sinphi1)
gloci2=gloci2+j*(v2sij*cosphi2-v2cij*sinphi2)
enddo
- do k=2,ntermd_2(itori,itori1,itori2)
+ do k=2,ntermd_2(itori,itori1,itori2,iblock)
do l=1,k-1
- v1cdij = v2c(k,l,itori,itori1,itori2)
- v2cdij = v2c(l,k,itori,itori1,itori2)
- v1sdij = v2s(k,l,itori,itori1,itori2)
- v2sdij = v2s(l,k,itori,itori1,itori2)
+ v1cdij = v2c(k,l,itori,itori1,itori2,iblock)
+ v2cdij = v2c(l,k,itori,itori1,itori2,iblock)
+ v1sdij = v2s(k,l,itori,itori1,itori2,iblock)
+ v2sdij = v2s(l,k,itori,itori1,itori2,iblock)
cosphi1p2=dcos(l*phii+(k-l)*phii1)
cosphi1m2=dcos(l*phii-(k-l)*phii1)
sinphi1p2=dsin(l*phii+(k-l)*phii1)
esccor=0.0D0
do i=itau_start,itau_end
esccor_ii=0.0D0
- isccori=isccortyp(itype(i-2))
- isccori1=isccortyp(itype(i-1))
+ isccori=isccortyp((itype(i-2)))
+ isccori1=isccortyp((itype(i-1)))
phii=phi(i)
cccc Added 9 May 2012
cc Tauangle is torsional engle depending on the value of first digit
c 3 = SC...Ca...Ca...SCi
gloci=0.0D0
if (((intertyp.eq.3).and.((itype(i-2).eq.10).or.
- & (itype(i-1).eq.10).or.(itype(i-2).eq.21).or.
- & (itype(i-1).eq.21)))
+ & (itype(i-1).eq.10).or.(itype(i-2).eq.ntyp1).or.
+ & (itype(i-1).eq.ntyp1)))
& .or. ((intertyp.eq.1).and.((itype(i-2).eq.10)
- & .or.(itype(i-2).eq.21)))
+ & .or.(itype(i-2).eq.ntyp1)))
& .or.((intertyp.eq.2).and.((itype(i-1).eq.10).or.
- & (itype(i-1).eq.21)))) cycle
- if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.21)) cycle
- if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.21))
+ & (itype(i-1).eq.ntyp1)))) cycle
+ if ((intertyp.eq.2).and.(i.eq.4).and.(itype(1).eq.ntyp1)) cycle
+ if ((intertyp.eq.1).and.(i.eq.nres).and.(itype(nres).eq.ntyp1))
& cycle
do j=1,nterm_sccor(isccori,isccori1)
v1ij=v1sccor(j,intertyp,isccori,isccori1)
& restyp(itype(i-2)),i-2,restyp(itype(i-1)),i-1,itori,itori1,
& (v1sccor(j,intertyp,itori,itori1),j=1,6)
& ,(v2sccor(j,intertyp,itori,itori1),j=1,6)
- gsccor_loc(i-3)=gsccor_loc(i-3)+gloci
+c gsccor_loc(i-3)=gsccor_loc(i-3)+gloci
enddo !intertyp
enddo
c do i=1,nres
integer dimen1,dimen2,atom,indx
double precision buffer(dimen1,dimen2)
double precision zapas
- common /contacts_hb/ zapas(3,20,maxres,7),
- & facont_hb(20,maxres),ees0p(20,maxres),ees0m(20,maxres),
- & num_cont_hb(maxres),jcont_hb(20,maxres)
+ common /contacts_hb/ zapas(3,ntyp,maxres,7),
+ & facont_hb(ntyp,maxres),ees0p(ntyp,maxres),ees0m(ntyp,maxres),
+ & num_cont_hb(maxres),jcont_hb(ntyp,maxres)
num_kont=num_cont_hb(atom)
do i=1,num_kont
do k=1,7
integer dimen1,dimen2,atom,indx
double precision buffer(dimen1,dimen2)
double precision zapas
- common /contacts_hb/ zapas(3,20,maxres,7),
- & facont_hb(20,maxres),ees0p(20,maxres),ees0m(20,maxres),
- & num_cont_hb(maxres),jcont_hb(20,maxres)
+ common /contacts_hb/ zapas(3,ntyp,maxres,7),
+ & facont_hb(ntyp,maxres),ees0p(ntyp,maxres),
+ & ees0m(ntyp,maxres),
+ & num_cont_hb(maxres),jcont_hb(ntyp,maxres)
num_kont=buffer(1,indx+26)
num_kont_old=num_cont_hb(atom)
num_cont_hb(atom)=num_kont+num_kont_old
integer nlob,loc_start,loc_end,ithet_start,ithet_end,
& iphi_start,iphi_end,itau_start,itau_end
C Parameters of the virtual-bond-angle probability distribution
- common /thetas/ a0thet(ntyp),athet(2,ntyp),bthet(2,ntyp),
- & polthet(0:3,ntyp),gthet(3,ntyp),theta0(ntyp),sig0(ntyp),
- & sigc0(ntyp)
+ common /thetas/ a0thet(-ntyp:ntyp),athet(2,-ntyp:ntyp,-1:1,-1:1)
+ & ,bthet(2,-ntyp:ntyp,-1:1,-1:1),
+ & polthet(0:3,-ntyp:ntyp),gthet(3,-ntyp:ntyp),theta0(-ntyp:ntyp),
+ &sig0(-ntyp:ntyp), sigc0(-ntyp:ntyp)
C Parameters of ab initio-derived potential of virtual-bond-angle bending
integer nthetyp,ntheterm,ntheterm2,ntheterm3,nsingle,ndouble,
& ithetyp(ntyp1),nntheterm
& ndouble,nntheterm
C Parameters of the side-chain probability distribution
common /sclocal/ dsc(ntyp1),dsc_inv(ntyp1),bsc(maxlob,ntyp),
- & censc(3,maxlob,ntyp),gaussc(3,3,maxlob,ntyp),dsc0(ntyp1),
+ & censc(3,maxlob,-ntyp:ntyp),gaussc(3,3,maxlob,-ntyp:ntyp),
+ & dsc0(ntyp1),
& nlob(ntyp1)
C Virtual-bond lenghts
common /peptbond/ vbl,vblinv,vblinv2,vbl_cis,vbl0
character*3 restyp
character*1 onelet
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),onelet(-ntyp1:ntyp1)
character*10 ename,wname
integer nprint_ene,print_order
common /namterm/ ename(max_ene),wname(max_ene),nprint_ene,
& dcostau,dsintau,dtauangle,dcosomicron,
& domicron,v0sccor
integer nterm_sccor,isccortyp,nsccortyp,nlor_sccor
- common /sccor/ v1sccor(maxterm_sccor,3,20,20),
- & v2sccor(maxterm_sccor,3,20,20),
- & v0sccor(ntyp,ntyp),
- & vlor1sccor(maxterm_sccor,20,20),
- & vlor2sccor(maxterm_sccor,20,20),
- & vlor3sccor(maxterm_sccor,20,20),gloc_sc(3,0:maxres2,10),
+ common /sccor/ v1sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v2sccor(maxterm_sccor,3,-ntyp:ntyp,-ntyp:ntyp),
+ & v0sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor1sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor2sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & vlor3sccor(maxterm_sccor,-ntyp:ntyp,-ntyp:ntyp),
+ & gloc_sc(3,0:maxres2,10),
& dcostau(3,3,3,maxres2),dsintau(3,3,3,maxres2),
& dtauangle(3,3,3,maxres2),dcosomicron(3,3,3,maxres2),
& domicron(3,3,3,maxres2),
- & nterm_sccor(ntyp,ntyp),isccortyp(ntyp),nsccortyp,
- & nlor_sccor(ntyp,ntyp)
+ & nterm_sccor(-ntyp:ntyp,-ntyp:ntyp),isccortyp(-ntyp:ntyp),
+ & nsccortyp,
+ & nlor_sccor(-ntyp:ntyp,-ntyp:ntyp)
C Torsional constants of the rotation about virtual-bond dihedral angles
double precision v1,v2,vlor1,vlor2,vlor3,v0
integer itortyp,ntortyp,nterm,nlor,nterm_old
- common/torsion/v0(maxtor,maxtor),v1(maxterm,maxtor,maxtor),
- & v2(maxterm,maxtor,maxtor),vlor1(maxlor,maxtor,maxtor),
+ common/torsion/v0(-maxtor:maxtor,-maxtor:maxtor,2),
+ & v1(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & v2(maxterm,-maxtor:maxtor,-maxtor:maxtor,2),
+ & vlor1(maxlor,maxtor,maxtor),
& vlor2(maxlor,maxtor,maxtor),vlor3(maxlor,maxtor,maxtor),
- & itortyp(ntyp),ntortyp,nterm(maxtor,maxtor),nlor(maxtor,maxtor)
+ & itortyp(-ntyp:ntyp),ntortyp,
+ & nterm(-maxtor:maxtor,-maxtor:maxtor,2),
+ & nlor(-maxtor:maxtor,-maxtor:maxtor,2)
& ,nterm_old
C 6/23/01 - constants for double torsionals
double precision v1c,v1s,v2c,v2s
integer ntermd_1,ntermd_2
- common /torsiond/ v1c(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v1s(2,maxtermd_1,maxtor,maxtor,maxtor),
- & v2c(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & v2s(maxtermd_2,maxtermd_2,maxtor,maxtor,maxtor),
- & ntermd_1(maxtor,maxtor,maxtor),ntermd_2(maxtor,maxtor,maxtor)
+ common /torsiond/
+ &v1c(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v1s(2,maxtermd_1,-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ &v2c(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ &v2s(maxtermd_2,maxtermd_2,-maxtor:maxtor,-maxtor:maxtor,
+ & -maxtor:maxtor,2),
+ & ntermd_1(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2),
+ & ntermd_2(-maxtor:maxtor,-maxtor:maxtor,-maxtor:maxtor,2)
C 9/18/99 - added Fourier coeffficients of the expansion of local energy
C surface
double precision b1,b2,cc,dd,ee,ctilde,dtilde,b1tilde
integer nloctyp
- common/fourier/ b1(2,maxtor),b2(2,maxtor),cc(2,2,maxtor),
- & dd(2,2,maxtor),ee(2,2,maxtor),ctilde(2,2,maxtor),
- & dtilde(2,2,maxtor),b1tilde(2,maxtor),nloctyp
+ common/fourier/ b1(2,-maxtor:maxtor),b2(2,-maxtor:maxtor),
+ & cc(2,2,-maxtor:maxtor),
+ & dd(2,2,-maxtor:maxtor),ee(2,2,-maxtor:maxtor),
+ & ctilde(2,2,-maxtor:maxtor),
+ & dtilde(2,2,-maxtor:maxtor),b1tilde(2,-maxtor:maxtor),nloctyp
double precision b
- common /fourier1/ b(13,maxtor)
+ common /fourier1/ b(13)
igeom= 8
intin= 9
ithep= 11
+ ithep_pdb=51
irotam=12
+ irotam_pdb=52
itorp= 13
itordp= 23
ielep= 14
sigii(i)=0.0D0
rr0(i)=0.0D0
a0thet(i)=0.0D0
- do j=1,2
- athet(j,i)=0.0D0
- bthet(j,i)=0.0D0
+ do j=1,2
+ do ichir1=-1,1
+ do ichir2=-1,1
+ athet(j,i,ichir1,ichir2)=0.0D0
+ bthet(j,i,ichir1,ichir2)=0.0D0
+ enddo
+ enddo
enddo
do j=0,3
polthet(j,i)=0.0D0
enddo
nlob(ntyp1)=0
dsc(ntyp1)=0.0D0
- do i=1,maxtor
- itortyp(i)=0
- do j=1,maxtor
- do k=1,maxterm
- v1(k,j,i)=0.0D0
- v2(k,j,i)=0.0D0
+ do i=-maxtor,maxtor
+ itortyp(i)=0
+ do iblock=1,2
+ do j=-maxtor,maxtor
+ do k=1,maxterm
+ v1(k,j,i,iblock)=0.0D0
+ v2(k,j,i,iblock)=0.0D0
enddo
enddo
+ enddo
enddo
+ do iblock=1,2
+ do i=-maxtor,maxtor
+ do j=-maxtor,maxtor
+ do k=-maxtor,maxtor
+ do l=1,maxtermd_1
+ v1c(1,l,i,j,k,iblock)=0.0D0
+ v1s(1,l,i,j,k,iblock)=0.0D0
+ v1c(2,l,i,j,k,iblock)=0.0D0
+ v1s(2,l,i,j,k,iblock)=0.0D0
+ enddo !l
+ do l=1,maxtermd_2
+ do m=1,maxtermd_2
+ v2c(m,l,i,j,k,iblock)=0.0D0
+ v2s(m,l,i,j,k,iblock)=0.0D0
+ enddo !m
+ enddo !l
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
do i=1,maxres
itype(i)=0
itel(i)=0
include 'COMMON.WEIGHTS'
include 'COMMON.FFIELD'
data restyp /
+ &'DD' ,'DPR','DLY','DAR','DHI','DAS','DGL','DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
&'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
data onelet /
+ &'z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
&'S','Q','N','E','D','H','R','K','P','X'/
data potname /'LJ','LJK','BP','GB','GBV'/
nint_gr(i)=1
istart(i,1)=i+1
iend(i,1)=nct
- ind_scint=int_scint+nct-i
+ ind_scint=ind_scint+nct-i
#endif
endif
#ifdef MPL
if (i.gt.2) tauangle(3,i+1)=beta(i+nres-1,i-1,i,i+nres)
if (i.gt.2) tauangle(1,i+1)=beta(i-1+nres,i-1,i,i+1)
if (i.gt.2) tauangle(2,i+1)=beta(i-2,i-1,i,i+nres)
-
omeg(i)=beta(nres+i,i,maxres2,i+1)
theta(i+1)=alpha(i-1,i,i+1)
alph(i)=alpha(nres+i,i,maxres2)
write (iout,'(20i4)') (itype(i),i=1,nres)
do i=1,nres-1
#ifdef PROCOR
- if (itype(i).eq.21 .or. itype(i+1).eq.21) then
+ if (itype(i).eq.ntyp1 .or. itype(i+1).eq.ntyp1) then
#else
- if (itype(i).eq.21) then
+ if (itype(i).eq.ntyp1) then
#endif
itel(i)=0
#ifdef PROCOR
- else if (itype(i+1).ne.20) then
+ else if (iabs(itype(i+1)).ne.20) then
#else
- else if (itype(i).ne.20) then
+ else if (iabs(itype(i)).ne.20) then
#endif
itel(i)=1
else
nnt=1
nct=nres
- if (itype(1).eq.21) nnt=2
- if (itype(nres).eq.21) nct=nct-1
+ if (itype(1).eq.ntyp1) nnt=2
+ if (itype(nres).eq.ntyp1) nct=nct-1
write(iout,*) 'NNT=',NNT,' NCT=',NCT
c Read distance restraints
if (constr_dist.gt.0) then
call reads(controlcard,"TORDPAR",tordname_t,tordname)
open (itordp,file=tordname_t,status='old')
rewind(itordp)
- call reads(controlcard,"SCCORAR",sccorname_t,sccorname)
+ call reads(controlcard,"SCCORPAR",sccorname_t,sccorname)
open (isccor,file=sccorname_t,status='old')
rewind(isccor)
call reads(controlcard,"FOURIER",fouriername_t,fouriername)
C of the virtual-bond valence angles theta
C
do i=1,ntyp
- read (ithep,*) a0thet(i),(athet(j,i),j=1,2),(bthet(j,i),j=1,2)
+ read (ithep,*) a0thet(i),(athet(j,i,1,1),j=1,2),
+ & (bthet(j,i,1,1),j=1,2)
read (ithep,*) (polthet(j,i),j=0,3)
read (ithep,*) (gthet(j,i),j=1,3)
read (ithep,*) theta0(i),sig0(i),sigc0(i)
sigc0(i)=sigc0(i)**2
enddo
+ do i=1,ntyp
+ athet(1,i,1,-1)=athet(1,i,1,1)
+ athet(2,i,1,-1)=athet(2,i,1,1)
+ bthet(1,i,1,-1)=-bthet(1,i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,i,1,1)
+ athet(1,i,-1,1)=-athet(1,i,1,1)
+ athet(2,i,-1,1)=-athet(2,i,1,1)
+ bthet(1,i,-1,1)=bthet(1,i,1,1)
+ bthet(2,i,-1,1)=bthet(2,i,1,1)
+ enddo
+ do i=-ntyp,-1
+ a0thet(i)=a0thet(-i)
+ athet(1,i,-1,-1)=athet(1,-i,1,1)
+ athet(2,i,-1,-1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,-1,-1)=-bthet(2,-i,1,1)
+ athet(1,i,-1,1)=athet(1,-i,1,1)
+ athet(2,i,-1,1)=-athet(2,-i,1,1)
+ bthet(1,i,-1,1)=-bthet(1,-i,1,1)
+ bthet(2,i,-1,1)=bthet(2,-i,1,1)
+ athet(1,i,1,-1)=-athet(1,-i,1,1)
+ athet(2,i,1,-1)=athet(2,-i,1,1)
+ bthet(1,i,1,-1)=bthet(1,-i,1,1)
+ bthet(2,i,1,-1)=-bthet(2,-i,1,1)
+ theta0(i)=theta0(-i)
+ sig0(i)=sig0(-i)
+ sigc0(i)=sigc0(-i)
+ do j=0,3
+ polthet(j,i)=polthet(j,-i)
+ enddo
+ do j=1,3
+ gthet(j,i)=gthet(j,-i)
+ enddo
+ enddo
close (ithep)
if (lprint) then
c write (iout,'(a)')
& ' b1*10^1 ',' b2*10^1 '
do i=1,ntyp
write(iout,'(a3,1h&,2x,5(f8.3,1h&))') restyp(i),
- & a0thet(i),(100*athet(j,i),j=1,2),(10*bthet(j,i),j=1,2)
+ & a0thet(i),(100*athet(j,i,1,1),j=1,2),
+ & (10*bthet(j,i,1,1),j=1,2)
enddo
write (iout,'(/a/9x,5a/79(1h-))')
& 'Parameters of the expression for sigma(theta_c):',
& ntheterm3,nsingle,ndouble
nntheterm=max0(ntheterm,ntheterm2,ntheterm3)
read (ithep,*) (ithetyp(i),i=1,ntyp1)
- do i=1,maxthetyp
- do j=1,maxthetyp
- do k=1,maxthetyp
- aa0thet(i,j,k)=0.0d0
+ do i=-ntyp1,-1
+ ithetyp(i)=-ithetyp(-i)
+ enddo
+c write (iout,*) "tu dochodze"
+ do iblock=1,2
+ do i=-maxthetyp,maxthetyp
+ do j=-maxthetyp,maxthetyp
+ do k=-maxthetyp,maxthetyp
+ aa0thet(i,j,k,iblock)=0.0d0
do l=1,ntheterm
- aathet(l,i,j,k)=0.0d0
+ aathet(l,i,j,k,iblock)=0.0d0
enddo
do l=1,ntheterm2
do m=1,nsingle
- bbthet(m,l,i,j,k)=0.0d0
- ccthet(m,l,i,j,k)=0.0d0
- ddthet(m,l,i,j,k)=0.0d0
- eethet(m,l,i,j,k)=0.0d0
+ bbthet(m,l,i,j,k,iblock)=0.0d0
+ ccthet(m,l,i,j,k,iblock)=0.0d0
+ ddthet(m,l,i,j,k,iblock)=0.0d0
+ eethet(m,l,i,j,k,iblock)=0.0d0
enddo
enddo
do l=1,ntheterm3
do m=1,ndouble
do mm=1,ndouble
- ffthet(mm,m,l,i,j,k)=0.0d0
- ggthet(mm,m,l,i,j,k)=0.0d0
+ ffthet(mm,m,l,i,j,k,iblock)=0.0d0
+ ggthet(mm,m,l,i,j,k,iblock)=0.0d0
enddo
enddo
enddo
enddo
enddo
+ enddo
enddo
- do i=1,nthetyp
- do j=1,nthetyp
- do k=1,nthetyp
- read (ithep,'(3a)') res1,res2,res3
- read (ithep,*) aa0thet(i,j,k)
- read (ithep,*)(aathet(l,i,j,k),l=1,ntheterm)
+
+ do iblock=1,2
+ do i=0,nthetyp
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ read (ithep,'(6a)') res1
+ read (ithep,*) aa0thet(i,j,k,iblock)
+ read (ithep,*)(aathet(l,i,j,k,iblock),l=1,ntheterm)
read (ithep,*)
- & ((bbthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ccthet(lll,ll,i,j,k),lll=1,nsingle),
- & (ddthet(lll,ll,i,j,k),lll=1,nsingle),
- & (eethet(lll,ll,i,j,k),lll=1,nsingle),ll=1,ntheterm2)
+ & ((bbthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ccthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (ddthet(lll,ll,i,j,k,iblock),lll=1,nsingle),
+ & (eethet(lll,ll,i,j,k,iblock),lll=1,nsingle)
+ & ,ll=1,ntheterm2)
read (ithep,*)
- & (((ffthet(llll,lll,ll,i,j,k),ffthet(lll,llll,ll,i,j,k),
- & ggthet(llll,lll,ll,i,j,k),ggthet(lll,llll,ll,i,j,k),
+ & (((ffthet(llll,lll,ll,i,j,k,iblock),
+ & ffthet(lll,llll,ll,i,j,k,iblock),
+ & ggthet(llll,lll,ll,i,j,k,iblock)
+ & ,ggthet(lll,llll,ll,i,j,k,iblock),
& llll=1,lll-1),lll=2,ndouble),ll=1,ntheterm3)
enddo
enddo
do i=1,nthetyp
do j=1,nthetyp
do l=1,ntheterm
- aathet(l,i,j,nthetyp+1)=aathet(l,i,j,1)
- aathet(l,nthetyp+1,i,j)=aathet(l,1,i,j)
+ aathet(l,i,j,nthetyp+1,iblock)=0.0d0
+ aathet(l,nthetyp+1,i,j,iblock)=0.0d0
enddo
- aa0thet(i,j,nthetyp+1)=aa0thet(i,j,1)
- aa0thet(nthetyp+1,i,j)=aa0thet(1,i,j)
+ aa0thet(i,j,nthetyp+1,iblock)=0.0d0
+ aa0thet(nthetyp+1,i,j,iblock)=0.0d0
enddo
do l=1,ntheterm
- aathet(l,nthetyp+1,i,nthetyp+1)=aathet(l,1,i,1)
+ aathet(l,nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
- aa0thet(nthetyp+1,i,nthetyp+1)=aa0thet(1,i,1)
+ aa0thet(nthetyp+1,i,nthetyp+1,iblock)=0.0d0
enddo
+ enddo
+C Substitution for D aminoacids from symmetry.
+ do iblock=1,2
+ do i=-nthetyp,0
+ do j=-nthetyp,nthetyp
+ do k=-nthetyp,nthetyp
+ aa0thet(i,j,k,iblock)=aa0thet(-i,-j,-k,iblock)
+ do l=1,ntheterm
+ aathet(l,i,j,k,iblock)=aathet(l,-i,-j,-k,iblock)
+ enddo
+ do ll=1,ntheterm2
+ do lll=1,nsingle
+ bbthet(lll,ll,i,j,k,iblock)=bbthet(lll,ll,-i,-j,-k,iblock)
+ ccthet(lll,ll,i,j,k,iblock)=-ccthet(lll,ll,-i,-j,-k,iblock)
+ ddthet(lll,ll,i,j,k,iblock)=ddthet(lll,ll,-i,-j,-k,iblock)
+ eethet(lll,ll,i,j,k,iblock)=-eethet(lll,ll,-i,-j,-k,iblock)
+ enddo
+ enddo
+ do ll=1,ntheterm3
+ do lll=2,ndouble
+ do llll=1,lll-1
+ ffthet(llll,lll,ll,i,j,k,iblock)=
+ & ffthet(llll,lll,ll,-i,-j,-k,iblock)
+ ffthet(lll,llll,ll,i,j,k,iblock)=
+ & ffthet(lll,llll,ll,-i,-j,-k,iblock)
+ ggthet(llll,lll,ll,i,j,k,iblock)=
+ & -ggthet(llll,lll,ll,-i,-j,-k,iblock)
+ ggthet(lll,llll,ll,i,j,k,iblock)=
+ & -ggthet(lll,llll,ll,-i,-j,-k,iblock)
+ enddo !ll
+ enddo !lll
+ enddo !llll
+ enddo !k
+ enddo !j
+ enddo !i
+ enddo !iblock
C
C Control printout of the coefficients of virtual-bond-angle potentials
C
write (iout,'(//4a)')
& 'Type ',onelett(i),onelett(j),onelett(k)
write (iout,'(//a,10x,a)') " l","a[l]"
- write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k)
+ write (iout,'(i2,1pe15.5)') 0,aa0thet(i,j,k,iblock)
write (iout,'(i2,1pe15.5)')
- & (l,aathet(l,i,j,k),l=1,ntheterm)
+ & (l,aathet(l,i,j,k,iblock),l=1,ntheterm)
do l=1,ntheterm2
write (iout,'(//2h m,4(9x,a,3h[m,i1,1h]))')
& "b",l,"c",l,"d",l,"e",l
do m=1,nsingle
write (iout,'(i2,4(1pe15.5))') m,
- & bbthet(m,l,i,j,k),ccthet(m,l,i,j,k),
- & ddthet(m,l,i,j,k),eethet(m,l,i,j,k)
+ & bbthet(m,l,i,j,k,iblock),ccthet(m,l,i,j,k,iblock),
+ & ddthet(m,l,i,j,k,iblock),eethet(m,l,i,j,k,iblock)
enddo
enddo
do l=1,ntheterm3
do m=2,ndouble
do n=1,m-1
write (iout,'(i1,1x,i1,4(1pe15.5))') n,m,
- & ffthet(n,m,l,i,j,k),ffthet(m,n,l,i,j,k),
- & ggthet(n,m,l,i,j,k),ggthet(m,n,l,i,j,k)
+ & ffthet(n,m,l,i,j,k,iblock),
+ & ffthet(m,n,l,i,j,k,iblock),
+ & ggthet(n,m,l,i,j,k,iblock),
+ & ggthet(m,n,l,i,j,k,iblock)
enddo
enddo
enddo
enddo
bsc(1,i)=0.0D0
read(irotam,*)(censc(k,1,i),k=1,3),((blower(k,l,1),l=1,k),k=1,3)
+ censc(1,1,-i)=censc(1,1,i)
+ censc(2,1,-i)=censc(2,1,i)
+ censc(3,1,-i)=-censc(3,1,i)
do j=2,nlob(i)
read (irotam,*) bsc(j,i)
read (irotam,*) (censc(k,j,i),k=1,3),
& ((blower(k,l,j),l=1,k),k=1,3)
+ censc(1,j,-i)=censc(1,j,i)
+ censc(2,j,-i)=censc(2,j,i)
+ censc(3,j,-i)=-censc(3,j,i)
enddo
do j=1,nlob(i)
do k=1,3
enddo
gaussc(k,l,j,i)=akl
gaussc(l,k,j,i)=akl
+ if (((k.eq.3).and.(l.ne.3))
+ & .or.((l.eq.3).and.(k.ne.3))) then
+ gaussc(k,l,j,-i)=-akl
+ gaussc(l,k,j,-i)=-akl
+ else
+ gaussc(k,l,j,-i)=akl
+ gaussc(l,k,j,-i)=akl
+ endif
enddo
enddo
enddo
C
read (itorp,*) ntortyp
read (itorp,*) (itortyp(i),i=1,ntyp)
- write (iout,*) 'ntortyp',ntortyp
- do i=1,ntortyp
- do j=1,ntortyp
- read (itorp,*) nterm(i,j),nlor(i,j)
+ do iblock=1,2
+ do i=-ntyp,-1
+ itortyp(i)=-itortyp(-i)
+ enddo
+c write (iout,*) 'ntortyp',ntortyp
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ read (itorp,*) nterm(i,j,iblock),
+ & nlor(i,j,iblock)
+ nterm(-i,-j,iblock)=nterm(i,j,iblock)
+ nlor(-i,-j,iblock)=nlor(i,j,iblock)
v0ij=0.0d0
si=-1.0d0
- do k=1,nterm(i,j)
- read (itorp,*) kk,v1(k,i,j),v2(k,i,j)
- v0ij=v0ij+si*v1(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ read (itorp,*) kk,v1(k,i,j,iblock),v2(k,i,j,iblock)
+ v1(k,-i,-j,iblock)=v1(k,i,j,iblock)
+ v2(k,-i,-j,iblock)=-v2(k,i,j,iblock)
+ v0ij=v0ij+si*v1(k,i,j,iblock)
si=-si
enddo
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
read (itorp,*) kk,vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
v0ij=v0ij+vlor1(k,i,j)/(1+vlor3(k,i,j)**2)
enddo
- v0(i,j)=v0ij
+ v0(i,j,iblock)=v0ij
+ v0(-i,-j,iblock)=v0ij
enddo
enddo
+ enddo
close (itorp)
if (lprint) then
write (iout,'(/a/)') 'Torsional constants:'
do j=1,ntortyp
write (iout,*) 'ityp',i,' jtyp',j
write (iout,*) 'Fourier constants'
- do k=1,nterm(i,j)
- write (iout,'(2(1pe15.5))') v1(k,i,j),v2(k,i,j)
+ do k=1,nterm(i,j,iblock)
+ write (iout,'(2(1pe15.5))') v1(k,i,j,iblock),
+ & v2(k,i,j,iblock)
enddo
write (iout,*) 'Lorenz constants'
- do k=1,nlor(i,j)
+ do k=1,nlor(i,j,iblock)
write (iout,'(3(1pe15.5))')
& vlor1(k,i,j),vlor2(k,i,j),vlor3(k,i,j)
enddo
C
C 6/23/01 Read parameters for double torsionals
C
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
read (itordp,'(3a1)') t1,t2,t3
if (t1.ne.onelett(i) .or. t2.ne.onelett(j)
& .or. t3.ne.onelett(k)) then
& i,j,k,t1,t2,t3
stop "Error in double torsional parameter file"
endif
- read (itordp,*) ntermd_1(i,j,k),ntermd_2(i,j,k)
- read (itordp,*) (v1c(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(1,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1c(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) (v1s(2,l,i,j,k),l=1,ntermd_1(i,j,k))
- read (itordp,*) ((v2c(l,m,i,j,k),v2c(m,l,i,j,k),
- & v2s(l,m,i,j,k),v2s(m,l,i,j,k),m=1,l-1),l=1,ntermd_2(i,j,k))
- enddo
- enddo
- enddo
+ read (itordp,*) ntermd_1(i,j,k,iblock),
+ & ntermd_2(i,j,k,iblock)
+ ntermd_1(-i,-j,-k,iblock)=ntermd_1(i,j,k,iblock)
+ ntermd_2(-i,-j,-k,iblock)=ntermd_2(i,j,k,iblock)
+ read (itordp,*) (v1c(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(1,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1c(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+ read (itordp,*) (v1s(2,l,i,j,k,iblock),l=1,
+ & ntermd_1(i,j,k,iblock))
+C Martix of D parameters for one dimesional foureir series
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,-i,-j,-k,iblock)=v1c(1,l,i,j,k,iblock)
+ v1s(1,l,-i,-j,-k,iblock)=-v1s(1,l,i,j,k,iblock)
+ v1c(2,l,-i,-j,-k,iblock)=v1c(2,l,i,j,k,iblock)
+ v1s(2,l,-i,-j,-k,iblock)=-v1s(2,l,i,j,k,iblock)
+c write(iout,*) "whcodze" ,
+c & v1s(2,l,-i,-j,-k,iblock),v1s(2,l,i,j,k,iblock)
+ enddo
+ read (itordp,*) ((v2c(l,m,i,j,k,iblock),
+ & v2c(m,l,i,j,k,iblock),v2s(l,m,i,j,k,iblock),
+ & v2s(m,l,i,j,k,iblock),
+ & m=1,l-1),l=1,ntermd_2(i,j,k,iblock))
+C Martix of D parameters for two dimesional fourier series
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,l-1
+ v2c(l,m,-i,-j,-k,iblock)=v2c(l,m,i,j,k,iblock)
+ v2c(m,l,-i,-j,-k,iblock)=v2c(m,l,i,j,k,iblock)
+ v2s(l,m,-i,-j,-k,iblock)=-v2s(l,m,i,j,k,iblock)
+ v2s(m,l,-i,-j,-k,iblock)=-v2s(m,l,i,j,k,iblock)
+ enddo!m
+ enddo!l
+ enddo!k
+ enddo!j
+ enddo!i
+ enddo!iblock
if (lprint) then
write (iout,*)
write (iout,*) 'Constants for double torsionals'
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
+ do iblock=1,2
+ do i=0,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
write (iout,*) 'ityp',i,' jtyp',j,' ktyp',k,
- & ' nsingle',ntermd_1(i,j,k),' ndouble',ntermd_2(i,j,k)
+ & ' nsingle',ntermd_1(i,j,k,iblock),
+ & ' ndouble',ntermd_2(i,j,k,iblock)
write (iout,*)
write (iout,*) 'Single angles:'
- do l=1,ntermd_1(i,j,k)
+ do l=1,ntermd_1(i,j,k,iblock)
write (iout,'(i5,2f10.5,5x,2f10.5)') l,
- & v1c(1,l,i,j,k),v1s(1,l,i,j,k),
- & v1c(2,l,i,j,k),v1s(2,l,i,j,k)
+ & v1c(1,l,i,j,k,iblock),v1s(1,l,i,j,k,iblock),
+ & v1c(2,l,i,j,k,iblock),v1s(2,l,i,j,k,iblock)
enddo
write (iout,*)
write (iout,*) 'Pairs of angles:'
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
write (iout,'(i5,20f10.5)')
- & l,(v2c(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ & l,(v2c(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
- write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k))
- do l=1,ntermd_2(i,j,k)
+ write (iout,'(3x,20i10)') (l,l=1,ntermd_2(i,j,k,iblock))
+ do l=1,ntermd_2(i,j,k,iblock)
write (iout,'(i5,20f10.5)')
- & l,(v2s(l,m,i,j,k),m=1,ntermd_2(i,j,k))
+ & l,(v2s(l,m,i,j,k,iblock),m=1,ntermd_2(i,j,k,iblock))
enddo
write (iout,*)
enddo
enddo
enddo
+ enddo
endif
#endif
C Read of Side-chain backbone correlation parameters
C
read (isccor,*) nsccortyp
read (isccor,*) (isccortyp(i),i=1,ntyp)
+ do i=-ntyp,-1
+ isccortyp(i)=-isccortyp(-i)
+ enddo
+ iscprol=isccortyp(20)
c write (iout,*) 'ntortyp',ntortyp
maxinter=3
cc maxinter is maximum interaction sites
do j=1,nsccortyp
read (isccor,*) nterm_sccor(i,j),nlor_sccor(i,j)
v0ijsccor=0.0d0
+ v0ijsccor1=0.0d0
+ v0ijsccor2=0.0d0
+ v0ijsccor3=0.0d0
si=-1.0d0
-
+ nterm_sccor(-i,j)=nterm_sccor(i,j)
+ nterm_sccor(-i,-j)=nterm_sccor(i,j)
+ nterm_sccor(i,-j)=nterm_sccor(i,j)
do k=1,nterm_sccor(i,j)
read (isccor,*) kk,v1sccor(k,l,i,j)
& ,v2sccor(k,l,i,j)
+ if (j.eq.iscprol) then
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)*0.5d0
+ & +v2sccor(k,l,i,j)*dsqrt(0.75d0)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)*0.5d0
+ & +v1sccor(k,l,i,j)*dsqrt(0.75d0)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ else
+ if (i.eq.isccortyp(10)) then
+ v1sccor(k,l,i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ else
+ if (j.eq.isccortyp(10)) then
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,j)
+ else
+ v1sccor(k,l,i,-j)=-v1sccor(k,l,i,j)
+ v2sccor(k,l,i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,-j)=v1sccor(k,l,i,j)
+ v2sccor(k,l,-i,-j)=-v2sccor(k,l,i,j)
+ v1sccor(k,l,-i,j)=v1sccor(k,l,i,-j)
+ v2sccor(k,l,-i,j)=-v2sccor(k,l,i,-j)
+ endif
+ endif
+ endif
v0ijsccor=v0ijsccor+si*v1sccor(k,l,i,j)
+ v0ijsccor1=v0ijsccor+si*v1sccor(k,l,-i,j)
+ v0ijsccor2=v0ijsccor+si*v1sccor(k,l,i,-j)
+ v0ijsccor3=v0ijsccor+si*v1sccor(k,l,-i,-j)
si=-si
enddo
do k=1,nlor_sccor(i,j)
v0ijsccor=v0ijsccor+vlor1sccor(k,i,j)/
&(1+vlor3sccor(k,i,j)**2)
enddo
- v0sccor(i,j)=v0ijsccor
+ v0sccor(l,i,j)=v0ijsccor
+ v0sccor(l,-i,j)=v0ijsccor1
+ v0sccor(l,i,-j)=v0ijsccor2
+ v0sccor(l,-i,-j)=v0ijsccor3
enddo
enddo
enddo
C interaction energy of the Gly, Ala, and Pro prototypes.
C
read (ifourier,*) nloctyp
- do i=1,nloctyp
+ do i=0,nloctyp-1
read (ifourier,*)
- read (ifourier,*) (b(ii,i),ii=1,13)
+ read (ifourier,*) (b(ii),ii=1,13)
if (lprint) then
write (iout,*) 'Type',i
- write (iout,'(a,i2,a,f10.5)') ('b(',ii,')=',b(ii,i),ii=1,13)
+ write (iout,'(a,i2,a,f10.5)') ('b(',ii,')=',b(ii),ii=1,13)
endif
- B1(1,i) = b(3,i)
- B1(2,i) = b(5,i)
- B1tilde(1,i) = b(3,i)
- B1tilde(2,i) =-b(5,i)
- B2(1,i) = b(2,i)
- B2(2,i) = b(4,i)
- CC(1,1,i)= b(7,i)
- CC(2,2,i)=-b(7,i)
- CC(2,1,i)= b(9,i)
- CC(1,2,i)= b(9,i)
- Ctilde(1,1,i)=b(7,i)
- Ctilde(1,2,i)=b(9,i)
- Ctilde(2,1,i)=-b(9,i)
- Ctilde(2,2,i)=b(7,i)
- DD(1,1,i)= b(6,i)
- DD(2,2,i)=-b(6,i)
- DD(2,1,i)= b(8,i)
- DD(1,2,i)= b(8,i)
- Dtilde(1,1,i)=b(6,i)
- Dtilde(1,2,i)=b(8,i)
- Dtilde(2,1,i)=-b(8,i)
- Dtilde(2,2,i)=b(6,i)
- EE(1,1,i)= b(10,i)+b(11,i)
- EE(2,2,i)=-b(10,i)+b(11,i)
- EE(2,1,i)= b(12,i)-b(13,i)
- EE(1,2,i)= b(12,i)+b(13,i)
+ B1(1,i) = b(3)
+ B1(2,i) = b(5)
+ B1(1,-i) = b(3)
+ B1(2,-i) = -b(5)
+c b1(1,i)=0.0d0
+c b1(2,i)=0.0d0
+ B1tilde(1,i) = b(3)
+ B1tilde(2,i) =-b(5)
+ B1tilde(1,-i) =-b(3)
+ B1tilde(2,-i) =b(5)
+c b1tilde(1,i)=0.0d0
+c b1tilde(2,i)=0.0d0
+ B2(1,i) = b(2)
+ B2(2,i) = b(4)
+ B2(1,-i) =b(2)
+ B2(2,-i) =-b(4)
+
+c b2(1,i)=0.0d0
+c b2(2,i)=0.0d0
+ CC(1,1,i)= b(7)
+ CC(2,2,i)=-b(7)
+ CC(2,1,i)= b(9)
+ CC(1,2,i)= b(9)
+ CC(1,1,-i)= b(7)
+ CC(2,2,-i)=-b(7)
+ CC(2,1,-i)=-b(9)
+ CC(1,2,-i)=-b(9)
+c CC(1,1,i)=0.0d0
+c CC(2,2,i)=0.0d0
+c CC(2,1,i)=0.0d0
+c CC(1,2,i)=0.0d0
+ Ctilde(1,1,i)=b(7)
+ Ctilde(1,2,i)=b(9)
+ Ctilde(2,1,i)=-b(9)
+ Ctilde(2,2,i)=b(7)
+ Ctilde(1,1,-i)=b(7)
+ Ctilde(1,2,-i)=-b(9)
+ Ctilde(2,1,-i)=b(9)
+ Ctilde(2,2,-i)=b(7)
+
+c Ctilde(1,1,i)=0.0d0
+c Ctilde(1,2,i)=0.0d0
+c Ctilde(2,1,i)=0.0d0
+c Ctilde(2,2,i)=0.0d0
+ DD(1,1,i)= b(6)
+ DD(2,2,i)=-b(6)
+ DD(2,1,i)= b(8)
+ DD(1,2,i)= b(8)
+ DD(1,1,-i)= b(6)
+ DD(2,2,-i)=-b(6)
+ DD(2,1,-i)=-b(8)
+ DD(1,2,-i)=-b(8)
+c DD(1,1,i)=0.0d0
+c DD(2,2,i)=0.0d0
+c DD(2,1,i)=0.0d0
+c DD(1,2,i)=0.0d0
+ Dtilde(1,1,i)=b(6)
+ Dtilde(1,2,i)=b(8)
+ Dtilde(2,1,i)=-b(8)
+ Dtilde(2,2,i)=b(6)
+ Dtilde(1,1,-i)=b(6)
+ Dtilde(1,2,-i)=-b(8)
+ Dtilde(2,1,-i)=b(8)
+ Dtilde(2,2,-i)=b(6)
+
+c Dtilde(1,1,i)=0.0d0
+c Dtilde(1,2,i)=0.0d0
+c Dtilde(2,1,i)=0.0d0
+c Dtilde(2,2,i)=0.0d0
+ EE(1,1,i)= b(10)+b(11)
+ EE(2,2,i)=-b(10)+b(11)
+ EE(2,1,i)= b(12)-b(13)
+ EE(1,2,i)= b(12)+b(13)
+ EE(1,1,-i)= b(10)+b(11)
+ EE(2,2,-i)=-b(10)+b(11)
+ EE(2,1,-i)=-b(12)+b(13)
+ EE(1,2,-i)=-b(12)-b(13)
+
+c ee(1,1,i)=1.0d0
+c ee(2,2,i)=1.0d0
+c ee(2,1,i)=0.0d0
+c ee(1,2,i)=0.0d0
+c ee(2,1,i)=ee(1,2,i)
enddo
if (lprint) then
do i=1,nloctyp
enddo
close (isidep1)
do i=1,ntyp1
- if (i.eq.10 .or. i.eq.21) then
+ if (i.eq.10 .or. i.eq.ntyp1) then
dsc_inv(i)=0.0d0
else
dsc_inv(i)=1.0d0/dsc(i)
ishift=ires-1
if (res.ne.'GLY' .and. res.ne. 'ACE') then
ishift=ishift-1
- itype(1)=21
+ itype(1)=ntyp1
endif
ibeg=0
else
nstart_sup=1
if (itype(nres).ne.10) then
nres=nres+1
- itype(nres)=21
+ itype(nres)=ntyp1
do j=1,3
dcj=c(j,nres-2)-c(j,nres-3)
c(j,nres)=c(j,nres-1)+dcj
c(j,nres+1)=c(j,1)
c(j,2*nres)=c(j,nres)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
nsup=nsup-1
nstart_sup=2
do j=1,3
do i=2,nres
iti=itype(i)
write (iout,*) i,i-1,(c(j,i),j=1,3),(c(j,i-1),j=1,3),dist(i,i-1)
- if (itype(i-1).ne.21 .and. itype(i).ne.21 .and.
+ if (itype(i-1).ne.ntyp1 .and. itype(i).ne.ntyp1 .and.
& (dist(i,i-1).lt.2.0D0 .or. dist(i,i-1).gt.5.0D0)) then
write (iout,'(a,i4)') 'Bad Cartesians for residue',i
stop
theta(i+1)=alpha(i-1,i,i+1)
if (i.gt.2) phi(i+1)=beta(i-2,i-1,i,i+1)
enddo
- if (itype(1).eq.21) then
+ if (itype(1).eq.ntyp1) then
do j=1,3
c(j,1)=c(j,2)+(c(j,3)-c(j,4))
enddo
endif
- if (itype(nres).eq.21) then
+ if (itype(nres).eq.ntyp1) then
do j=1,3
c(j,nres)=c(j,nres-1)+(c(j,nres-2)-c(j,nres-3))
enddo
endif
if (lprn)
& write (iout,'(a3,i4,7f10.3)') restyp(iti),i,dist(i,i-1),
- & rad2deg*theta(i),rad2deg*phi(i),dsc(iti),di,
+ & rad2deg*theta(i),rad2deg*phi(i),dsc(iabs(iti)),di,
& rad2deg*alph(i),rad2deg*omeg(i)
enddo
else if (lprn) then
if (itype.eq.0) then
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (ucase(nam).eq.restyp(i)) then
rescode=i
return
else
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (nam(1:1).eq.onelet(i)) then
rescode=i
return
include 'COMMON.SCROT'
include 'COMMON.SCCOR'
include 'COMMON.ALLPARM'
- integer i,j,k,l,m,mm,iparm
+ integer i,j,k,l,m,mm,iparm,ichir1,ichir2,iblock,iii
c Store weights
ww_all(1,iparm)=wsc
enddo
c Store bond angle parameters
#ifdef CRYST_THETA
- do i=1,ntyp
+ do i=-ntyp,ntyp
a0thet_all(i,iparm)=a0thet(i)
+ do ichir1=-1,1
+ do ichir2=-1,1
do j=1,2
- athet_all(j,i,iparm)=athet(j,i)
- bthet_all(j,i,iparm)=bthet(j,i)
+ athet_all(j,i,ichir1,ichir2,iparm)=athet(j,i,ichir1,ichir2)
+ bthet_all(j,i,ichir1,ichir2,iparm)=bthet(j,i,ichir1,ichir2)
+ enddo
+ enddo
enddo
do j=0,3
polthet_all(j,i,iparm)=polthet(j,i)
#endif
#ifdef CRYST_SC
c Store the sidechain rotamer parameters
- do i=1,ntyp
- nlob_all(i,iparm)=nlob(i)
- do j=1,nlob(i)
- bsc_all(j,i,iparm)=bsc(j,i)
+ do i=-ntyp,ntyp
+ iii=iabs(i)
+ if (i.eq.0) cycle
+ nlob_all(iii,iparm)=nlob(iii)
+ do j=1,nlob(iii)
+ bsc_all(j,iii,iparm)=bsc(j,iii)
do k=1,3
censc_all(k,j,i,iparm)=censc(k,j,i)
enddo
enddo
#endif
c Store the torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- v0_all(i,j,iparm)=v0(i,j)
- nterm_all(i,j,iparm)=nterm(i,j)
- nlor_all(i,j,iparm)=nlor(i,j)
- do k=1,nterm(i,j)
- v1_all(k,i,j,iparm)=v1(k,i,j)
- v2_all(k,i,j,iparm)=v2(i,i,j)
- enddo
- do k=1,nlor(i,j)
- vlor1_all(k,i,j,iparm)=vlor1(k,i,j)
- vlor2_all(k,i,j,iparm)=vlor2(k,i,j)
- vlor3_all(k,i,j,iparm)=vlor3(k,i,j)
- enddo
- enddo
- enddo
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ v0_all(i,j,iblock,iparm)=v0(i,j,iblock)
+ nterm_all(i,j,iblock,iparm)=nterm(i,j,iblock)
+ nlor_all(i,j,iblock,iparm)=nlor(i,j,iblock)
+ do k=1,nterm(i,j,iblock)
+ v1_all(k,i,j,iblock,iparm)=v1(k,i,j,iblock)
+ v2_all(k,i,j,iblock,iparm)=v2(k,i,j,iblock)
+ enddo
+ do k=1,nlor(i,j,iblock)
+ vlor1_all(k,i,j,iparm)=vlor1(k,i,j)
+ vlor2_all(k,i,j,iparm)=vlor2(k,i,j)
+ vlor3_all(k,i,j,iparm)=vlor3(k,i,j)
+ enddo
+ enddo
+ enddo
+ enddo
c Store the double torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
- ntermd1_all(i,j,k,iparm)=ntermd_1(i,j,k)
- ntermd2_all(i,j,k,iparm)=ntermd_2(i,j,k)
- do l=1,ntermd_1(i,j,k)
- v1c_all(1,l,i,j,k,iparm)=v1c(1,l,i,j,k)
- v1c_all(2,l,i,j,k,iparm)=v1c(2,l,i,j,k)
- v2c_all(1,l,i,j,k,iparm)=v2c(1,l,i,j,k)
- v2c_all(2,l,i,j,k,iparm)=v2c(2,l,i,j,k)
- enddo
- do l=1,ntermd_2(i,j,k)
- do m=1,ntermd_2(i,j,k)
- v2s_all(l,m,i,j,k,iparm)=v2s(l,m,i,j,k)
- enddo
- enddo
- enddo
- enddo
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
+ ntermd1_all(i,j,k,iblock,iparm)=ntermd_1(i,j,k,iblock)
+ ntermd2_all(i,j,k,iblock,iparm)=ntermd_2(i,j,k,iblock)
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c_all(1,l,i,j,k,iblock,iparm)=v1c(1,l,i,j,k,iblock)
+ v1c_all(2,l,i,j,k,iblock,iparm)=v1c(2,l,i,j,k,iblock)
+ v2c_all(1,l,i,j,k,iblock,iparm)=v2c(1,l,i,j,k,iblock)
+ v2c_all(2,l,i,j,k,iblock,iparm)=v2c(2,l,i,j,k,iblock)
+ enddo
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,ntermd_2(i,j,k,iblock)
+ v2s_all(l,m,i,j,k,iblock,iparm)=v2s(l,m,i,j,k,iblock)
+ enddo
+ enddo
+ enddo
+ enddo
+ enddo
enddo
c Store parameters of the cumulants
- do i=1,nloctyp
+ do i=-nloctyp,nloctyp
do j=1,2
b1_all(j,i,iparm)=b1(j,i)
b1tilde_all(j,i,iparm)=b1tilde(j,i)
include 'COMMON.SCROT'
include 'COMMON.SCCOR'
include 'COMMON.ALLPARM'
- integer i,j,k,l,m,mm,iparm
+ integer i,j,k,l,m,mm,iparm,ichir1,ichir2,iblock,iii
c Restore weights
wsc=ww_all(1,iparm)
enddo
c Restore bond angle parameters
#ifdef CRYST_THETA
- do i=1,ntyp
+ do i=-ntyp,ntyp
a0thet(i)=a0thet_all(i,iparm)
+
+ do ichir1=-1,1
+ do ichir2=-1,1
do j=1,2
- athet(j,i)=athet_all(j,i,iparm)
- bthet(j,i)=bthet_all(j,i,iparm)
- enddo
+ athet(j,i,ichir1,ichir2)=athet_all(j,i,ichir1,ichir2,iparm)
+ bthet(j,i,ichir1,ichir2)=bthet_all(j,i,ichir1,ichir2,iparm)
+ enddo
+ enddo
+ enddo
do j=0,3
polthet(j,i)=polthet_all(j,i,iparm)
enddo
#endif
c Restore the sidechain rotamer parameters
#ifdef CRYST_SC
- do i=1,ntyp
- nlob(i)=nlob_all(i,iparm)
- do j=1,nlob(i)
- bsc(j,i)=bsc_all(j,i,iparm)
+ do i=-ntyp,ntyp
+ if (i.eq.0) cycle
+ iii=iabs(i)
+ nlob(iii)=nlob_all(iii,iparm)
+ do j=1,nlob(iii)
+ bsc(j,iii)=bsc_all(j,iii,iparm)
do k=1,3
censc(k,j,i)=censc_all(k,j,i,iparm)
enddo
enddo
#endif
c Restore the torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- v0(i,j)=v0_all(i,j,iparm)
- nterm(i,j)=nterm_all(i,j,iparm)
- nlor(i,j)=nlor_all(i,j,iparm)
- do k=1,nterm(i,j)
- v1(k,i,j)=v1_all(k,i,j,iparm)
- v2(i,i,j)=v2_all(k,i,j,iparm)
- enddo
- do k=1,nlor(i,j)
- vlor1(k,i,j)=vlor1_all(k,i,j,iparm)
- vlor2(k,i,j)=vlor2_all(k,i,j,iparm)
- vlor3(k,i,j)=vlor3_all(k,i,j,iparm)
- enddo
- enddo
- enddo
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ v0(i,j,iblock)=v0_all(i,j,iblock,iparm)
+ nterm(i,j,iblock)=nterm_all(i,j,iblock,iparm)
+ nlor(i,j,iblock)=nlor_all(i,j,iblock,iparm)
+ do k=1,nterm(i,j,iblock)
+ v1(k,i,j,iblock)=v1_all(k,i,j,iblock,iparm)
+ v2(k,i,j,iblock)=v2_all(k,i,j,iblock,iparm)
+ enddo
+ do k=1,nlor(i,j,iblock)
+ vlor1(k,i,j)=vlor1_all(k,i,j,iparm)
+ vlor2(k,i,j)=vlor2_all(k,i,j,iparm)
+ vlor3(k,i,j)=vlor3_all(k,i,j,iparm)
+ enddo
+ enddo
+ enddo
+ enddo
c Restore the double torsional parameters
- do i=1,ntortyp
- do j=1,ntortyp
- do k=1,ntortyp
- ntermd_1(i,j,k)=ntermd1_all(i,j,k,iparm)
- ntermd_2(i,j,k)=ntermd2_all(i,j,k,iparm)
- do l=1,ntermd_1(i,j,k)
- v1c(1,l,i,j,k)=v1c_all(1,l,i,j,k,iparm)
- v1c(2,l,i,j,k)=v1c_all(2,l,i,j,k,iparm)
- v2c(1,l,i,j,k)=v2c_all(1,l,i,j,k,iparm)
- v2c(2,l,i,j,k)=v2c_all(2,l,i,j,k,iparm)
- enddo
- do l=1,ntermd_2(i,j,k)
- do m=1,ntermd_2(i,j,k)
- v2s(l,m,i,j,k)=v2s_all(l,m,i,j,k,iparm)
- enddo
- enddo
- enddo
- enddo
+ do iblock=1,2
+ do i=-ntortyp+1,ntortyp-1
+ do j=-ntortyp+1,ntortyp-1
+ do k=-ntortyp+1,ntortyp-1
+ ntermd_1(i,j,k,iblock)=ntermd1_all(i,j,k,iblock,iparm)
+ ntermd_2(i,j,k,iblock)=ntermd2_all(i,j,k,iblock,iparm)
+ do l=1,ntermd_1(i,j,k,iblock)
+ v1c(1,l,i,j,k,iblock)=v1c_all(1,l,i,j,k,iblock,iparm)
+ v1c(2,l,i,j,k,iblock)=v1c_all(2,l,i,j,k,iblock,iparm)
+ v2c(1,l,i,j,k,iblock)=v2c_all(1,l,i,j,k,iblock,iparm)
+ v2c(2,l,i,j,k,iblock)=v2c_all(2,l,i,j,k,iblock,iparm)
+ enddo
+ do l=1,ntermd_2(i,j,k,iblock)
+ do m=1,ntermd_2(i,j,k,iblock)
+ v2s(l,m,i,j,k,iblock)=v2s_all(l,m,i,j,k,iblock,iparm)
+ enddo
+ enddo
+ enddo
+ enddo
+ enddo
enddo
c Restore parameters of the cumulants
- do i=1,nloctyp
+ do i=-nloctyp,nloctyp
do j=1,2
b1(j,i)=b1_all(j,i,iparm)
b1tilde(j,i)=b1tilde_all(j,i,iparm)
character*3 restyp
character*1 onelet
- common /names/ restyp(ntyp+1),onelet(ntyp+1)
+ common /names/ restyp(-ntyp1:ntyp1),onelet(-ntyp1:ntyp1)
character*10 ename,wname
integer nprint_ene,print_order
common /namterm/ ename(n_ene),wname(n_ene),nprint_ene,
parameter (maxconts=maxres)
C Number of AA types (at present only natural AA's will be handled
integer ntyp,ntyp1
- parameter (ntyp=20,ntyp1=ntyp+1)
+ parameter (ntyp=24,ntyp1=ntyp+1)
C Max. number of types of dihedral angles & multiplicity of torsional barriers
C and the number of terms in double torsionals
integer maxtor,maxterm,maxlor,maxtermd_1,maxtermd_2
include 'COMMON.NAMES'
include 'COMMON.FFIELD'
data restyp /
+ &'DD','DAU','DAI','DDB','DSM','DPR','DLY','DAR','DHI','DAS','DGL',
+ & 'DSG','DGN','DSN','DTH',
+ &'DYY','DAL','DTY','DTR','DVA','DLE','DIL','DPN','MED','DCY','ZER',
&'CYS','MET','PHE','ILE','LEU','VAL','TRP','TYR','ALA','GLY','THR',
- &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','D'/
+ &'SER','GLN','ASN','GLU','ASP','HIS','ARG','LYS','PRO','SME','DBZ',
+ &'AIB','ABU','D'/
data onelet /
+ &'z','z','z','z','z','p','k','r','h','d','e','n','q','s','t','g',
+ &'a','y','w','v','l','i','f','m','c','x',
&'C','M','F','I','L','V','W','Y','A','G','T',
- &'S','Q','N','E','D','H','R','K','P','X'/
+ &'S','Q','N','E','D','H','R','K','P','z','z','z','z','X'/
+ data potname /'LJ','LJK','BP','GB','GBV'/
end
if (ione.eq.0) then
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (ucase(nam).eq.restyp(i)) then
rescode=i
return
enddo
else
- do i=1,ntyp1
+ do i=-ntyp1,ntyp1
if (nam(1:1).eq.onelet(i)) then
rescode=i
return